DE2834537C2 - - Google Patents
Info
- Publication number
- DE2834537C2 DE2834537C2 DE2834537A DE2834537A DE2834537C2 DE 2834537 C2 DE2834537 C2 DE 2834537C2 DE 2834537 A DE2834537 A DE 2834537A DE 2834537 A DE2834537 A DE 2834537A DE 2834537 C2 DE2834537 C2 DE 2834537C2
- Authority
- DE
- Germany
- Prior art keywords
- copolyesters
- polymers
- acid
- melting points
- terephthalic acid
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 claims description 62
- 229920001634 Copolyester Polymers 0.000 claims description 59
- 238000002844 melting Methods 0.000 description 61
- 230000008018 melting Effects 0.000 description 61
- 229920000728 polyester Polymers 0.000 description 39
- 229920000642 polymer Polymers 0.000 description 36
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 24
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 24
- 239000004973 liquid crystal related substance Substances 0.000 description 16
- 238000000034 method Methods 0.000 description 13
- 125000003118 aryl group Chemical group 0.000 description 12
- 239000002253 acid Substances 0.000 description 10
- 239000000155 melt Substances 0.000 description 9
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 6
- GDBUZIKSJGRBJP-UHFFFAOYSA-N 4-acetoxy benzoic acid Chemical compound CC(=O)OC1=CC=C(C(O)=O)C=C1 GDBUZIKSJGRBJP-UHFFFAOYSA-N 0.000 description 5
- 238000010586 diagram Methods 0.000 description 5
- 238000004519 manufacturing process Methods 0.000 description 5
- 238000006116 polymerization reaction Methods 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 229920000106 Liquid crystal polymer Polymers 0.000 description 4
- 239000004977 Liquid-crystal polymers (LCPs) Substances 0.000 description 4
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 4
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 150000005690 diesters Chemical class 0.000 description 3
- 150000002148 esters Chemical group 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- KYTZHLUVELPASH-UHFFFAOYSA-N naphthalene-1,2-dicarboxylic acid Chemical group C1=CC=CC2=C(C(O)=O)C(C(=O)O)=CC=C21 KYTZHLUVELPASH-UHFFFAOYSA-N 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 239000004033 plastic Substances 0.000 description 3
- 239000007790 solid phase Substances 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 230000009286 beneficial effect Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 150000001991 dicarboxylic acids Chemical class 0.000 description 2
- WOZVHXUHUFLZGK-UHFFFAOYSA-N dimethyl terephthalate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C=C1 WOZVHXUHUFLZGK-UHFFFAOYSA-N 0.000 description 2
- 150000002009 diols Chemical class 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 125000000687 hydroquinonyl group Chemical group C1(O)=C(C=C(O)C=C1)* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000004014 plasticizer Substances 0.000 description 2
- -1 polytetramethylene terephthalate Polymers 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- REFDOIWRJDGBHY-UHFFFAOYSA-N 2-bromobenzene-1,4-diol Chemical compound OC1=CC=C(O)C(Br)=C1 REFDOIWRJDGBHY-UHFFFAOYSA-N 0.000 description 1
- AFWLZUDFOYMCBF-UHFFFAOYSA-N 4-butanoyloxybenzoic acid Chemical compound CCCC(=O)OC1=CC=C(C(O)=O)C=C1 AFWLZUDFOYMCBF-UHFFFAOYSA-N 0.000 description 1
- RYAQFHLUEMJOMF-UHFFFAOYSA-N 4-phenoxybenzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1OC1=CC=CC=C1 RYAQFHLUEMJOMF-UHFFFAOYSA-N 0.000 description 1
- MNPYETDBTVUTDQ-UHFFFAOYSA-N 4-propanoyloxybenzoic acid Chemical compound CCC(=O)OC1=CC=C(C(O)=O)C=C1 MNPYETDBTVUTDQ-UHFFFAOYSA-N 0.000 description 1
- PCXMISPZSFODLD-UHFFFAOYSA-N 6,9-dioxatricyclo[9.3.1.14,14]hexadeca-1(14),2,4(16),11(15),12-pentaene-5,10-dione Chemical compound C1=C(C=C2)C(=O)OCCOC(=O)C3=CC=C1C2=C3 PCXMISPZSFODLD-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002302 Nylon 6,6 Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004974 Thermotropic liquid crystal Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 238000005452 bending Methods 0.000 description 1
- YXZUGYXICVZUOK-UHFFFAOYSA-N benzene-1,4-diol;propanoic acid Chemical compound CCC(O)=O.CCC(O)=O.OC1=CC=C(O)C=C1 YXZUGYXICVZUOK-UHFFFAOYSA-N 0.000 description 1
- 230000027455 binding Effects 0.000 description 1
- 238000009739 binding Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- BTVWZWFKMIUSGS-UHFFFAOYSA-N dimethylethyleneglycol Natural products CC(C)(O)CO BTVWZWFKMIUSGS-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 230000002535 lyotropic effect Effects 0.000 description 1
- 238000010128 melt processing Methods 0.000 description 1
- 238000002074 melt spinning Methods 0.000 description 1
- OJURWUUOVGOHJZ-UHFFFAOYSA-N methyl 2-[(2-acetyloxyphenyl)methyl-[2-[(2-acetyloxyphenyl)methyl-(2-methoxy-2-oxoethyl)amino]ethyl]amino]acetate Chemical compound C=1C=CC=C(OC(C)=O)C=1CN(CC(=O)OC)CCN(CC(=O)OC)CC1=CC=CC=C1OC(C)=O OJURWUUOVGOHJZ-UHFFFAOYSA-N 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 229920003366 poly(p-phenylene terephthalamide) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920000515 polycarbonate Polymers 0.000 description 1
- 239000004417 polycarbonate Substances 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920006380 polyphenylene oxide Polymers 0.000 description 1
- 229920000874 polytetramethylene terephthalate Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 238000007639 printing Methods 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 230000000630 rising effect Effects 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000009987 spinning Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- KKEYFWRCBNTPAC-UHFFFAOYSA-L terephthalate(2-) Chemical compound [O-]C(=O)C1=CC=C(C([O-])=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-L 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G63/00—Macromolecular compounds obtained by reactions forming a carboxylic ester link in the main chain of the macromolecule
- C08G63/02—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds
- C08G63/60—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from the reaction of a mixture of hydroxy carboxylic acids, polycarboxylic acids and polyhydroxy compounds
- C08G63/605—Polyesters derived from hydroxycarboxylic acids or from polycarboxylic acids and polyhydroxy compounds derived from the reaction of a mixture of hydroxy carboxylic acids, polycarboxylic acids and polyhydroxy compounds the hydroxy and carboxylic groups being bound to aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Artificial Filaments (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/822,989 US4169933A (en) | 1977-08-08 | 1977-08-08 | Liquid crystal copolyesters containing terephthalic acid and 2,6-naphthalenedicarboxylic acid |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2834537A1 DE2834537A1 (de) | 1979-02-22 |
| DE2834537C2 true DE2834537C2 (Direct) | 1989-09-07 |
Family
ID=25237494
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782834537 Granted DE2834537A1 (de) | 1977-08-08 | 1978-08-07 | Copolyester auf terephthalsaeurebasis |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4169933A (Direct) |
| JP (1) | JPS5430290A (Direct) |
| DE (1) | DE2834537A1 (Direct) |
| FR (1) | FR2400043A1 (Direct) |
| GB (1) | GB2002404B (Direct) |
| IT (1) | IT1097939B (Direct) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6403504B1 (en) | 1984-03-15 | 2002-06-11 | Cytec Technology Corp. | Composite fiber blends |
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SE416814B (sv) * | 1974-05-10 | 1981-02-09 | Du Pont | Nya syntetiska polyestrar och sett for deras framstellning |
| US4238598A (en) * | 1979-02-08 | 1980-12-09 | Fiber Industries, Inc. | Polyester of para-hydroxy benzoic acid, 1,2-bis(para-carboxy phenoxy)ethane, terephthalic acid and hydroquinone capable of forming an anisotropic melt which readily undergoes melt processing |
| EP0024499B1 (en) * | 1979-06-25 | 1984-03-07 | Teijin Limited | Biaxially oriented wholly aromatic polyester film and process for producing same |
| US4256624A (en) * | 1979-07-02 | 1981-03-17 | Celanese Corporation | Polyester of 6-hydroxy-2-naphthoic acid, aromatic diol, and aromatic diacid capable of undergoing melt processing |
| US4337191A (en) * | 1979-11-05 | 1982-06-29 | Fiber Industries, Inc. | Polyester of para-hydroxy benzoic acid, 2,6-naphthalene dicarboxylic acid, terephthalic acid and methylhydroquinone exhibiting improved hydrolytic stability and which is capable of forming an anisotropic melt |
| US4267289A (en) * | 1980-07-03 | 1981-05-12 | Celanese Corporation | Blend of wholly aromatic polyesters |
| US4375530A (en) * | 1982-07-06 | 1983-03-01 | Celanese Corporation | Polyester of 2,6-naphthalene dicarboxylic acid, 2,6-dihydroxy naphthalene, terephthalic acid, and hydroquinone capable of forming an anisotropic melt |
| JPS5943115A (ja) * | 1982-08-27 | 1984-03-10 | Toray Ind Inc | ミツクス糸の製造方法 |
| JPS6054112U (ja) * | 1983-09-20 | 1985-04-16 | 株式会社三協精機製作所 | 大口径超広角レンズ |
| US4764583A (en) * | 1986-03-14 | 1988-08-16 | Mitsui Petrochemical Industries, Ltd. | Melt-moldable wholly aromatic polyester |
| US4664972A (en) * | 1986-04-23 | 1987-05-12 | E. I. Du Pont De Nemours And Company | Optically anisotropic melt forming aromatic copolyesters based on t-butylhydroquinone |
| JPH07696B2 (ja) * | 1986-04-30 | 1995-01-11 | 三井石油化学工業株式会社 | 芳香族ポリエステル |
| FR2607818B1 (fr) * | 1986-12-05 | 1989-03-24 | Rhone Poulenc Chimie | Copolyesters amides aromatiques thermotropes |
| JPH0717748B2 (ja) * | 1986-12-19 | 1995-03-01 | 川崎製鉄株式会社 | 芳香族ポリエステルアミド |
| FR2617851B1 (fr) * | 1987-07-10 | 1989-11-24 | Rhone Poulenc Chimie | Copolyesters et copolyesteramides aromatiques thermotropes |
| FR2617852B1 (fr) * | 1987-07-10 | 1989-11-24 | Rhone Poulenc Chimie | Copolyesters amides aromatiques thermotropes |
| US4849499A (en) * | 1988-08-01 | 1989-07-18 | Eastman Kodak Company | Melt processable, liquid crystalline polyesters |
| US5025082A (en) * | 1988-08-24 | 1991-06-18 | Mitsubishi Kasei Corporation | Aromatic polyester, aromatic polyester-amide and processes for producing the same |
| JPH0453001U (Direct) * | 1990-09-06 | 1992-05-06 | ||
| US5237038A (en) * | 1990-11-16 | 1993-08-17 | Eastman Kodak Company | Polyesters from terephthalic acid, 2,6-naphthalenedicarboxylic acid, hydroquinone and 4,4'-biphenol |
| US5221730A (en) * | 1990-11-16 | 1993-06-22 | Eastman Kodak Company | Polyesters from terephthalic acid, 2,6-naphthalenedicarboxylic acid and hydroquinone |
| US5110896A (en) * | 1990-12-10 | 1992-05-05 | E. I. Du Pont De Nemours And Company | Thermotropic liquid crystalline polyester compositions |
| DE4041520A1 (de) * | 1990-12-22 | 1992-06-25 | Bayer Ag | Modifizierte polyesterharze, ein verfahren zu deren herstellung und toner, die solche polyesterharze enthalten |
| US5260409A (en) * | 1991-06-21 | 1993-11-09 | Eastman Kodak Company | Liquid crystalline polyester |
| US5250654A (en) * | 1992-05-04 | 1993-10-05 | E. I. Du Pont De Nemours And Company | Thermotropic liquid crystalline polyester compositions |
| US5346969A (en) * | 1992-12-23 | 1994-09-13 | E. I. Du Pont De Nemours And Company | Polyimide polymeric blends |
| US5710237A (en) * | 1994-09-06 | 1998-01-20 | E. I. Du Pont De Nemours And Company | Liquid crystalline polyester resin |
| CN1085684C (zh) * | 1996-01-05 | 2002-05-29 | 纳幕尔杜邦公司 | 液晶聚合物组合物 |
| US5798432A (en) * | 1996-03-22 | 1998-08-25 | Hoechst Celanese Corp. | Method of making thermotropic liquid crystalline polymers containing hydroquinone |
| WO1997045469A1 (en) * | 1996-05-28 | 1997-12-04 | E.I. Du Pont De Nemours And Company | Liquid crystalline polyester resin |
| US5700863A (en) * | 1996-08-19 | 1997-12-23 | E. I. Du Pont De Nemours And Company | Polyimide polymeric blends |
| WO1998010927A1 (en) | 1996-09-11 | 1998-03-19 | Dupont Canada Inc. | Polymeric multilayer heat exchangers containing a barrier layer |
| EP0925181B1 (en) | 1996-09-11 | 2003-04-16 | Dupont Canada Inc. | Heat exchangers containing liquid crystalline polymer layers |
| US5988649A (en) | 1997-05-01 | 1999-11-23 | E. I. Du Pont De Nemours And Company | Fractured seal ring |
| US6093787A (en) * | 1997-06-06 | 2000-07-25 | Eastman Chemical Company | Liquid crystalline polyesters and molding compositions prepared therefrom |
| US6121369A (en) * | 1997-06-06 | 2000-09-19 | Eastman Chemical Company | Liquid crystalline polyester compositions containing carbon black |
| US6048922A (en) * | 1997-08-20 | 2000-04-11 | Eastman Chemical Company | Process for preparing high strength fiber reinforced composites |
| US6051644A (en) | 1997-10-10 | 2000-04-18 | Eastman Chemical Company | Fiber reinforced resins with improved physical properties and process for producing same |
| EP1312631A3 (en) * | 1998-09-18 | 2003-06-25 | Eastman Chemical Company | Liquid crystalline polyesters having a surprisingly good combination of a low melting point, a high heat distortion temperature, a low melt viscosity, and a high tensile elongation |
| US5969083A (en) * | 1998-09-18 | 1999-10-19 | Eastman Chemical Company | Liquid crystalline polyesters having a surprisingly good combination of a low melting point, a high heat distortion temperature, a low melt viscosity, and a high tensile elongation |
| US6348163B1 (en) * | 1998-09-18 | 2002-02-19 | Eastman Chemical Company | Liquid crystalline polyesters compositions containing aromatic phosphonites and a process for the preparation thereof |
| US6379795B1 (en) | 1999-01-19 | 2002-04-30 | E. I. Du Pont De Nemours And Company | Injection moldable conductive aromatic thermoplastic liquid crystalline polymeric compositions |
| US6364008B1 (en) | 1999-01-22 | 2002-04-02 | E. I. Du Pont De Nemours And Company | Heat exchanger with tube plates |
| WO2000079206A1 (en) | 1999-06-22 | 2000-12-28 | Dupont Canada Inc. | Heat exchanger formed from tubes joined by simultaneous extrusion thermal bonding |
| DE60104895T2 (de) | 2000-10-06 | 2006-06-08 | E.I. Du Pont De Nemours And Co., Wilmington | Wärmetauscher, hergestellt aus biegbaren kunststoffrohren |
| CA2476187A1 (en) * | 2002-02-13 | 2003-08-21 | Dupont Canada Inc. | Method for manufacturing fuel cell separator plates under low shear strain |
| JP2004051867A (ja) * | 2002-07-23 | 2004-02-19 | Sumitomo Chem Co Ltd | 芳香族液晶ポリエステルフィルムおよびその金属積層体 |
| US20040113129A1 (en) * | 2002-07-25 | 2004-06-17 | Waggoner Marion G. | Static dissipative thermoplastic polymer composition |
| US20050082720A1 (en) * | 2003-01-23 | 2005-04-21 | Bloom Joy S. | Moldings of liquid crystalline polymer powders |
| US20050189725A1 (en) | 2003-12-22 | 2005-09-01 | Edwards Mark S. | Multi-layered seal structure |
| KR100611205B1 (ko) * | 2004-08-26 | 2006-08-10 | 삼성전자주식회사 | Vsb 방식 수신기를 위한 심볼 타이밍 복원장치 및 그복원방법 |
| CA2538761A1 (en) * | 2005-03-08 | 2006-09-08 | Anthony Joseph Cesaroni | Method for sealing heat exchanger tubes |
| EP1871818B1 (en) * | 2005-04-19 | 2009-01-14 | E.I. Du Pont De Nemours And Company | Liquid crystalline polymer composition |
| US7547849B2 (en) * | 2005-06-15 | 2009-06-16 | E.I. Du Pont De Nemours And Company | Compositions useful in electronic circuitry type applications, patternable using amplified light, and methods and compositions relating thereto |
| US8475924B2 (en) | 2007-07-09 | 2013-07-02 | E.I. Du Pont De Nemours And Company | Compositions and methods for creating electronic circuitry |
| US20090017309A1 (en) * | 2007-07-09 | 2009-01-15 | E. I. Du Pont De Nemours And Company | Compositions and methods for creating electronic circuitry |
| US20100193950A1 (en) * | 2009-01-30 | 2010-08-05 | E.I.Du Pont De Nemours And Company | Wafer level, chip scale semiconductor device packaging compositions, and methods relating thereto |
| US20170232776A1 (en) | 2014-10-01 | 2017-08-17 | E.I. Du Pont De Nemours And Company | Non-thermoplastic polyimide spindle cover |
| US10302127B2 (en) | 2015-04-28 | 2019-05-28 | E. I. Du Pont De Nemours And Company | Needle bearing |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1769930A1 (de) * | 1967-09-05 | 1971-09-16 | Sun Oil Co | Lineare Polyester,die Naphthalin-2,6-dicarboxylat und Terephthalat enthalten |
| US3637595A (en) * | 1969-05-28 | 1972-01-25 | Steve G Cottis | P-oxybenzoyl copolyesters |
| US3778410A (en) * | 1972-09-28 | 1973-12-11 | Eastman Kodak Co | Process for preparing a final copolyester by reacting a starting polyester with an acyloxy aromatic carboxylic acid |
| US3804805A (en) * | 1972-12-01 | 1974-04-16 | Eastman Kodak Co | Copolyester prepared from polyethylene terephthalate and an acyloxy benzoic acid |
| US3884876A (en) * | 1973-08-31 | 1975-05-20 | Carborundum Co | Partially crosslinked linear aromatic polyesters |
| SE416814B (sv) * | 1974-05-10 | 1981-02-09 | Du Pont | Nya syntetiska polyestrar och sett for deras framstellning |
| US4035356A (en) * | 1976-05-07 | 1977-07-12 | Eastman Kodak Company | Copolyester prepared from an acyloxybenzoic acid and polyethylene terephthalate modified with p-hydroxyethoxybenzoic acid |
-
1977
- 1977-08-08 US US05/822,989 patent/US4169933A/en not_active Expired - Lifetime
-
1978
- 1978-08-04 IT IT26526/78A patent/IT1097939B/it active
- 1978-08-07 DE DE19782834537 patent/DE2834537A1/de active Granted
- 1978-08-08 JP JP9657578A patent/JPS5430290A/ja active Granted
- 1978-08-08 GB GB7832552A patent/GB2002404B/en not_active Expired
- 1978-08-08 FR FR7823309A patent/FR2400043A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US6403504B1 (en) | 1984-03-15 | 2002-06-11 | Cytec Technology Corp. | Composite fiber blends |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2834537A1 (de) | 1979-02-22 |
| US4169933A (en) | 1979-10-02 |
| FR2400043B1 (Direct) | 1982-06-04 |
| IT7826526A0 (it) | 1978-08-04 |
| IT1097939B (it) | 1985-08-31 |
| JPS6319530B2 (Direct) | 1988-04-22 |
| GB2002404B (en) | 1982-02-17 |
| JPS5430290A (en) | 1979-03-06 |
| GB2002404A (en) | 1979-02-21 |
| FR2400043A1 (fr) | 1979-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2834537C2 (Direct) | ||
| DE2834536A1 (de) | Copolyester | |
| EP0225537B1 (de) | Vollaromatische mesomorphe Polyesterimide, deren Herstellung sowie Verwendung | |
| DE2166076A1 (de) | Dihydroxyspirochromanverbindungen, sowie diese dihydroxyspirochromanverbindungen enthaltende polyesterzusammensetzungen | |
| DE3878815T2 (de) | Harz mit ausgezeichneter waermebestaendigkeit und anisotropischen eigenschaften in der schmelze. | |
| EP0226078B1 (de) | Vollaromatische mesomorphe Polyester, deren Herstellung sowie Verwendung | |
| DE2525092A1 (de) | Neue copolyester sowie verfahren zu ihrer herstellung | |
| EP0226847B1 (de) | Vollaromatische mesmorphe Polyetherester, deren Herstellung und Verwendung | |
| DE2542938A1 (de) | Transparente polyamide | |
| DE69125501T2 (de) | Polyester aus Terephtalsäure, 2,6-Naphthalendicarbonsäure und Hydrochinon | |
| DE3542855A1 (de) | Vollaromatische mesomorphe polyesteramide, deren herstellung und verwendung | |
| DE2720004A1 (de) | Copolyester sowie verfahren zu ihrer herstellung | |
| EP0032163B1 (de) | Verfahren zum Regenerieren und Aufarbeiten von inaktivem linearen Poly(alkylenterephthalat) | |
| EP0398052A2 (de) | Leichtfliessende Polyarylensulfid-Formmassen | |
| DE1929070A1 (de) | Copolyesterharze | |
| DE60214734T2 (de) | Amorphe copolyester | |
| DE1108432B (de) | Verfahren zur Herstellung von Polyaethylenterephthalat | |
| DE3789994T2 (de) | Polyester-Polymere. | |
| EP0050742B1 (de) | Transparente kochwasser- und sterilisationsbeständige Polyamide | |
| DE2840960C2 (Direct) | ||
| DE4411361C1 (de) | Neue steifkettige Polyester und Verfahren zur Herstellung derselben | |
| EP0284726B1 (de) | Aromatische Polyester auf Basis von Phenoxyterephthalsäure, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2348698A1 (de) | Copolyester mit einer logarithmischen viskositaetszahl von mindestens 0,4 | |
| DE2722120A1 (de) | Copolyester sowie verfahren zu ihrer herstellung | |
| DE2145260A1 (de) | Transparente polyamide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: BRANDES, J., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 8 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8327 | Change in the person/name/address of the patent owner |
Owner name: EASTMAN CHEMICAL CO., KINGSPORT, TENN., US |