DE2830555A1 - Chinazolinonyl-verbindungen - Google Patents
Chinazolinonyl-verbindungenInfo
- Publication number
- DE2830555A1 DE2830555A1 DE19782830555 DE2830555A DE2830555A1 DE 2830555 A1 DE2830555 A1 DE 2830555A1 DE 19782830555 DE19782830555 DE 19782830555 DE 2830555 A DE2830555 A DE 2830555A DE 2830555 A1 DE2830555 A1 DE 2830555A1
- Authority
- DE
- Germany
- Prior art keywords
- chlorine
- nitro
- alkyl
- bromine
- alkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims description 11
- 239000000460 chlorine Substances 0.000 claims description 61
- -1 heteroaromatic amines Chemical class 0.000 claims description 55
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 40
- 229910052801 chlorine Inorganic materials 0.000 claims description 40
- 239000000049 pigment Substances 0.000 claims description 34
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 30
- 229910052794 bromium Inorganic materials 0.000 claims description 30
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 29
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 29
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 25
- 239000011737 fluorine Substances 0.000 claims description 25
- 229910052731 fluorine Inorganic materials 0.000 claims description 25
- 229910052739 hydrogen Inorganic materials 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 18
- 229910052736 halogen Inorganic materials 0.000 claims description 12
- 150000002367 halogens Chemical class 0.000 claims description 12
- 238000000034 method Methods 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 11
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 11
- 239000000987 azo dye Substances 0.000 claims description 10
- 230000008569 process Effects 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 9
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 9
- 125000001424 substituent group Chemical group 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims description 6
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- 125000004656 alkyl sulfonylamino group Chemical group 0.000 claims description 4
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 claims description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000004769 (C1-C4) alkylsulfonyl group Chemical group 0.000 claims description 3
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000000542 sulfonic acid group Chemical group 0.000 claims description 3
- 125000003806 alkyl carbonyl amino group Chemical group 0.000 claims description 2
- 125000005521 carbonamide group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- YNPRSKWRXCTESV-UHFFFAOYSA-N 2-(2-oxo-3h-quinazolin-4-yl)acetic acid Chemical class C1=CC=C2C(CC(=O)O)=NC(=O)NC2=C1 YNPRSKWRXCTESV-UHFFFAOYSA-N 0.000 claims 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 125000001246 bromo group Chemical group Br* 0.000 claims 1
- 238000005859 coupling reaction Methods 0.000 description 20
- 230000008878 coupling Effects 0.000 description 19
- 238000010168 coupling process Methods 0.000 description 19
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 18
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 15
- 239000003973 paint Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 12
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 10
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 10
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 10
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 9
- 239000004922 lacquer Substances 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Natural products CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 8
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 8
- 238000007639 printing Methods 0.000 description 8
- 239000002253 acid Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 238000000227 grinding Methods 0.000 description 7
- 239000000976 ink Substances 0.000 description 7
- 239000004408 titanium dioxide Substances 0.000 description 7
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 6
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 6
- 238000001035 drying Methods 0.000 description 6
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 5
- 229920000180 alkyd Polymers 0.000 description 5
- 239000000839 emulsion Substances 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 235000019439 ethyl acetate Nutrition 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 230000005012 migration Effects 0.000 description 5
- 238000013508 migration Methods 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 4
- 125000001769 aryl amino group Chemical group 0.000 description 4
- 239000004359 castor oil Substances 0.000 description 4
- 235000019438 castor oil Nutrition 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000975 dye Substances 0.000 description 4
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 229920003023 plastic Polymers 0.000 description 4
- 239000004033 plastic Substances 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- 239000002966 varnish Substances 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 229920000877 Melamine resin Polymers 0.000 description 3
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 239000004952 Polyamide Substances 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000011230 binding agent Substances 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 239000003292 glue Substances 0.000 description 3
- 239000008187 granular material Substances 0.000 description 3
- 150000002391 heterocyclic compounds Chemical class 0.000 description 3
- 238000001746 injection moulding Methods 0.000 description 3
- 238000004898 kneading Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 125000005545 phthalimidyl group Chemical group 0.000 description 3
- 239000004014 plasticizer Substances 0.000 description 3
- 229920002647 polyamide Polymers 0.000 description 3
- 229920002689 polyvinyl acetate Polymers 0.000 description 3
- 239000011118 polyvinyl acetate Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- DVKJHBMWWAPEIU-UHFFFAOYSA-N toluene 2,4-diisocyanate Chemical compound CC1=CC=C(N=C=O)C=C1N=C=O DVKJHBMWWAPEIU-UHFFFAOYSA-N 0.000 description 3
- LZDKZFUFMNSQCJ-UHFFFAOYSA-N 1,2-diethoxyethane Chemical compound CCOCCOCC LZDKZFUFMNSQCJ-UHFFFAOYSA-N 0.000 description 2
- YXIWHUQXZSMYRE-UHFFFAOYSA-N 1,3-benzothiazole-2-thiol Chemical compound C1=CC=C2SC(S)=NC2=C1 YXIWHUQXZSMYRE-UHFFFAOYSA-N 0.000 description 2
- KHUFHLFHOQVFGB-UHFFFAOYSA-N 1-aminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC=C2N KHUFHLFHOQVFGB-UHFFFAOYSA-N 0.000 description 2
- ATCRIUVQKHMXSH-UHFFFAOYSA-N 2,4-dichlorobenzoic acid Chemical compound OC(=O)C1=CC=C(Cl)C=C1Cl ATCRIUVQKHMXSH-UHFFFAOYSA-N 0.000 description 2
- CZZZABOKJQXEBO-UHFFFAOYSA-N 2,4-dimethylaniline Chemical compound CC1=CC=C(N)C(C)=C1 CZZZABOKJQXEBO-UHFFFAOYSA-N 0.000 description 2
- AVYGCQXNNJPXSS-UHFFFAOYSA-N 2,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC=C1Cl AVYGCQXNNJPXSS-UHFFFAOYSA-N 0.000 description 2
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 2
- UZHALXIAWJOLLR-UHFFFAOYSA-N 2-amino-4-chlorobenzonitrile Chemical compound NC1=CC(Cl)=CC=C1C#N UZHALXIAWJOLLR-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- CXNVOWPRHWWCQR-UHFFFAOYSA-N 4-Chloro-ortho-toluidine Chemical compound CC1=CC(Cl)=CC=C1N CXNVOWPRHWWCQR-UHFFFAOYSA-N 0.000 description 2
- GWSQAGVGSHXRJK-UHFFFAOYSA-N 4-amino-5-methoxy-n,2-dimethylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC(OC)=C(N)C=C1C GWSQAGVGSHXRJK-UHFFFAOYSA-N 0.000 description 2
- PBGKNXWGYQPUJK-UHFFFAOYSA-N 4-chloro-2-nitroaniline Chemical compound NC1=CC=C(Cl)C=C1[N+]([O-])=O PBGKNXWGYQPUJK-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000004640 Melamine resin Substances 0.000 description 2
- XUMBMVFBXHLACL-UHFFFAOYSA-N Melanin Chemical compound O=C1C(=O)C(C2=CNC3=C(C(C(=O)C4=C32)=O)C)=C2C4=CNC2=C1C XUMBMVFBXHLACL-UHFFFAOYSA-N 0.000 description 2
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 2
- 239000000020 Nitrocellulose Substances 0.000 description 2
- GLUUGHFHXGJENI-UHFFFAOYSA-N Piperazine Chemical compound C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- 229920005830 Polyurethane Foam Polymers 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- 229920000297 Rayon Polymers 0.000 description 2
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 229940081735 acetylcellulose Drugs 0.000 description 2
- 125000004442 acylamino group Chemical group 0.000 description 2
- 239000001361 adipic acid Substances 0.000 description 2
- 235000011037 adipic acid Nutrition 0.000 description 2
- 238000007605 air drying Methods 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 150000004982 aromatic amines Chemical class 0.000 description 2
- 229920002678 cellulose Polymers 0.000 description 2
- 239000001913 cellulose Substances 0.000 description 2
- 229920002301 cellulose acetate Polymers 0.000 description 2
- 229920001727 cellulose butyrate Polymers 0.000 description 2
- 239000004568 cement Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 239000003240 coconut oil Substances 0.000 description 2
- 235000019864 coconut oil Nutrition 0.000 description 2
- 238000004040 coloring Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 229920001577 copolymer Polymers 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- JXTHNDFMNIQAHM-UHFFFAOYSA-N dichloroacetic acid Chemical compound OC(=O)C(Cl)Cl JXTHNDFMNIQAHM-UHFFFAOYSA-N 0.000 description 2
- 229940117389 dichlorobenzene Drugs 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 239000003822 epoxy resin Substances 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 239000000835 fiber Substances 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- VKYKSIONXSXAKP-UHFFFAOYSA-N hexamethylenetetramine Chemical compound C1N(C2)CN3CN1CN2C3 VKYKSIONXSXAKP-UHFFFAOYSA-N 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 229920002521 macromolecule Polymers 0.000 description 2
- 238000001819 mass spectrum Methods 0.000 description 2
- QPJVMBTYPHYUOC-UHFFFAOYSA-N methyl benzoate Chemical compound COC(=O)C1=CC=CC=C1 QPJVMBTYPHYUOC-UHFFFAOYSA-N 0.000 description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 2
- 238000000465 moulding Methods 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002826 nitrites Chemical class 0.000 description 2
- 229920001220 nitrocellulos Polymers 0.000 description 2
- RNVCVTLRINQCPJ-UHFFFAOYSA-N o-toluidine Chemical compound CC1=CC=CC=C1N RNVCVTLRINQCPJ-UHFFFAOYSA-N 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 235000019198 oils Nutrition 0.000 description 2
- 230000000485 pigmenting effect Effects 0.000 description 2
- 229920002239 polyacrylonitrile Polymers 0.000 description 2
- 229920000515 polycarbonate Polymers 0.000 description 2
- 239000004417 polycarbonate Substances 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 229920000570 polyether Polymers 0.000 description 2
- 229920000573 polyethylene Polymers 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 229920001451 polypropylene glycol Polymers 0.000 description 2
- 239000011496 polyurethane foam Substances 0.000 description 2
- 239000004800 polyvinyl chloride Substances 0.000 description 2
- 229920000915 polyvinyl chloride Polymers 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 2
- 238000009987 spinning Methods 0.000 description 2
- 229920003002 synthetic resin Polymers 0.000 description 2
- 239000000057 synthetic resin Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 229920006337 unsaturated polyester resin Polymers 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000001052 yellow pigment Substances 0.000 description 2
- ZVWHURINXJWEER-UHFFFAOYSA-N 1,1,3,3-tetraphenylurea Chemical compound C=1C=CC=CC=1N(C=1C=CC=CC=1)C(=O)N(C=1C=CC=CC=1)C1=CC=CC=C1 ZVWHURINXJWEER-UHFFFAOYSA-N 0.000 description 1
- AIHIKIZCFCEKEX-UHFFFAOYSA-N 1,2,3,4-tetrahydroquinazolin-6-amine Chemical compound N1CNCC2=CC(N)=CC=C21 AIHIKIZCFCEKEX-UHFFFAOYSA-N 0.000 description 1
- RAIPHJJURHTUIC-UHFFFAOYSA-N 1,3-thiazol-2-amine Chemical compound NC1=NC=CS1 RAIPHJJURHTUIC-UHFFFAOYSA-N 0.000 description 1
- SDICTISQCKLMEB-UHFFFAOYSA-N 1,4-diamino-5-nitroanthracene-9,10-dione Chemical compound O=C1C=2C(N)=CC=C(N)C=2C(=O)C2=C1C=CC=C2[N+]([O-])=O SDICTISQCKLMEB-UHFFFAOYSA-N 0.000 description 1
- FBMQNRKSAWNXBT-UHFFFAOYSA-N 1,4-diaminoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2N FBMQNRKSAWNXBT-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- KNOYUKKOVLJJRM-UHFFFAOYSA-N 1,5-diamino-2,4,6,8-tetrabromoanthracene-9,10-dione Chemical compound O=C1C2=C(N)C(Br)=CC(Br)=C2C(=O)C2=C1C(Br)=CC(Br)=C2N KNOYUKKOVLJJRM-UHFFFAOYSA-N 0.000 description 1
- LTKWSXKAESUVPP-UHFFFAOYSA-N 1,5-diamino-4-chloroanthracene-9,10-dione Chemical compound O=C1C2=C(N)C=CC(Cl)=C2C(=O)C2=C1C=CC=C2N LTKWSXKAESUVPP-UHFFFAOYSA-N 0.000 description 1
- VWBVCOPVKXNMMZ-UHFFFAOYSA-N 1,5-diaminoanthracene-9,10-dione Chemical compound O=C1C2=C(N)C=CC=C2C(=O)C2=C1C=CC=C2N VWBVCOPVKXNMMZ-UHFFFAOYSA-N 0.000 description 1
- YNGOIPAYCAIZAS-UHFFFAOYSA-N 1,7-diaminoanthracene-9,10-dione Chemical compound C1=CC(N)=C2C(=O)C3=CC(N)=CC=C3C(=O)C2=C1 YNGOIPAYCAIZAS-UHFFFAOYSA-N 0.000 description 1
- CXNVLAFSMZBOKZ-UHFFFAOYSA-N 1-(4-amino-9,10-dihydroxyanthracen-1-yl)imino-4-iminoanthracene-9,10-dione Chemical compound C1=CC=C2C(=C1)C(=C3C(=CC=C(C3=C2O)N=C4C=CC(=N)C5=C4C(=O)C6=CC=CC=C6C5=O)N)O CXNVLAFSMZBOKZ-UHFFFAOYSA-N 0.000 description 1
- ZINRVIQBCHAZMM-UHFFFAOYSA-N 1-Amino-2,4-dibromoanthraquinone Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(Br)=CC(Br)=C2N ZINRVIQBCHAZMM-UHFFFAOYSA-N 0.000 description 1
- MVRDXWVWKOUPDO-UHFFFAOYSA-N 1-amino-2-bromoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(Br)=C2N MVRDXWVWKOUPDO-UHFFFAOYSA-N 0.000 description 1
- QQOBTPNGSQEDAS-UHFFFAOYSA-N 1-amino-2-chloroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(Cl)=C2N QQOBTPNGSQEDAS-UHFFFAOYSA-N 0.000 description 1
- KXKQOXULEPSPIU-UHFFFAOYSA-N 1-amino-4-(cyclohexylamino)anthracene-9,10-dione Chemical compound C1=2C(=O)C3=CC=CC=C3C(=O)C=2C(N)=CC=C1NC1CCCCC1 KXKQOXULEPSPIU-UHFFFAOYSA-N 0.000 description 1
- ICVRBKCRXNVOJC-UHFFFAOYSA-N 1-amino-4-(methylamino)anthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2NC ICVRBKCRXNVOJC-UHFFFAOYSA-N 0.000 description 1
- VIQMJMDPUIBXQO-UHFFFAOYSA-N 1-amino-4-bromo-2-methylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=C(N)C(C)=CC(Br)=C3C(=O)C2=C1 VIQMJMDPUIBXQO-UHFFFAOYSA-N 0.000 description 1
- XHWWVXZEALFXQA-UHFFFAOYSA-N 1-amino-4-chloro-2-methylanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=C(N)C(C)=CC(Cl)=C3C(=O)C2=C1 XHWWVXZEALFXQA-UHFFFAOYSA-N 0.000 description 1
- AQXYVFBSOOBBQV-UHFFFAOYSA-N 1-amino-4-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(O)=CC=C2N AQXYVFBSOOBBQV-UHFFFAOYSA-N 0.000 description 1
- KXOGXZAXERYOTC-UHFFFAOYSA-N 1-amino-4-methoxyanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2OC KXOGXZAXERYOTC-UHFFFAOYSA-N 0.000 description 1
- SSLUBNFUCQBYTP-UHFFFAOYSA-N 1-amino-4-nitro-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C([N+]([O-])=O)=CC(C(O)=O)=C2N SSLUBNFUCQBYTP-UHFFFAOYSA-N 0.000 description 1
- KXMLYSJUXIUOHI-UHFFFAOYSA-N 1-amino-4-nitroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C([N+]([O-])=O)=CC=C2N KXMLYSJUXIUOHI-UHFFFAOYSA-N 0.000 description 1
- QIHMGEKACAOTPE-UHFFFAOYSA-N 1-amino-5-chloroanthracene-9,10-dione Chemical compound O=C1C2=C(Cl)C=CC=C2C(=O)C2=C1C=CC=C2N QIHMGEKACAOTPE-UHFFFAOYSA-N 0.000 description 1
- ZKHNBCNZDYATQG-UHFFFAOYSA-N 1-amino-5-hydroxyanthracene-9,10-dione Chemical compound O=C1C2=C(O)C=CC=C2C(=O)C2=C1C=CC=C2N ZKHNBCNZDYATQG-UHFFFAOYSA-N 0.000 description 1
- LQALCRBYILBSKK-UHFFFAOYSA-N 1-amino-6,7-difluoroanthracene-9,10-dione Chemical compound O=C1C2=CC(F)=C(F)C=C2C(=O)C2=C1C=CC=C2N LQALCRBYILBSKK-UHFFFAOYSA-N 0.000 description 1
- BGQNFUMJSRPCPC-UHFFFAOYSA-N 1-amino-6-fluoroanthracene-9,10-dione Chemical compound O=C1C2=CC(F)=CC=C2C(=O)C2=C1C=CC=C2N BGQNFUMJSRPCPC-UHFFFAOYSA-N 0.000 description 1
- IIVILFZVZSEDBQ-UHFFFAOYSA-N 1-amino-6-methyl-2-sulfanylanthracene-9,10-dione Chemical compound SC1=CC=C2C(=O)C3=CC(C)=CC=C3C(=O)C2=C1N IIVILFZVZSEDBQ-UHFFFAOYSA-N 0.000 description 1
- DOGJKOVYZNHUFI-UHFFFAOYSA-N 1-amino-7-fluoroanthracene-9,10-dione Chemical compound O=C1C2=CC=C(F)C=C2C(=O)C2=C1C=CC=C2N DOGJKOVYZNHUFI-UHFFFAOYSA-N 0.000 description 1
- RGDLNDUMSKYKDC-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-carboxamide Chemical compound C1=CC=C2C(=O)C3=C(N)C(C(=O)N)=CC=C3C(=O)C2=C1 RGDLNDUMSKYKDC-UHFFFAOYSA-N 0.000 description 1
- MMKNBFSDCOALQO-UHFFFAOYSA-N 1-amino-9,10-dioxoanthracene-2-carboxylic acid Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=CC(C(O)=O)=C2N MMKNBFSDCOALQO-UHFFFAOYSA-N 0.000 description 1
- QAGQMOJLLKQGEO-UHFFFAOYSA-N 1-aminocyclohexa-2,4-diene-1-carboxylic acid Chemical compound OC(=O)C1(N)CC=CC=C1 QAGQMOJLLKQGEO-UHFFFAOYSA-N 0.000 description 1
- GUMCAKKKNKYFEB-UHFFFAOYSA-N 2,4,5-trichloroaniline Chemical compound NC1=CC(Cl)=C(Cl)C=C1Cl GUMCAKKKNKYFEB-UHFFFAOYSA-N 0.000 description 1
- NATVSFWWYVJTAZ-UHFFFAOYSA-N 2,4,6-trichloroaniline Chemical compound NC1=C(Cl)C=C(Cl)C=C1Cl NATVSFWWYVJTAZ-UHFFFAOYSA-N 0.000 description 1
- KMWDXUMOFMAQRI-UHFFFAOYSA-N 2,4-dichloro-5-ethylaniline Chemical compound CCC1=CC(N)=C(Cl)C=C1Cl KMWDXUMOFMAQRI-UHFFFAOYSA-N 0.000 description 1
- AJROJTARXSATEB-UHFFFAOYSA-N 2,4-dichloro-5-methoxyaniline Chemical compound COC1=CC(N)=C(Cl)C=C1Cl AJROJTARXSATEB-UHFFFAOYSA-N 0.000 description 1
- KQCMTOWTPBNWDB-UHFFFAOYSA-N 2,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C=C1Cl KQCMTOWTPBNWDB-UHFFFAOYSA-N 0.000 description 1
- GEQNZVKIDIPGCO-UHFFFAOYSA-N 2,4-dimethoxyaniline Chemical compound COC1=CC=C(N)C(OC)=C1 GEQNZVKIDIPGCO-UHFFFAOYSA-N 0.000 description 1
- LXQOQPGNCGEELI-UHFFFAOYSA-N 2,4-dinitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O LXQOQPGNCGEELI-UHFFFAOYSA-N 0.000 description 1
- XPKFTIYOZUJAGA-UHFFFAOYSA-N 2,5-diethoxyaniline Chemical compound CCOC1=CC=C(OCC)C(N)=C1 XPKFTIYOZUJAGA-UHFFFAOYSA-N 0.000 description 1
- ZTQGTYFYOODGOQ-UHFFFAOYSA-N 2,5-dimethoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=C(OC)C=C1N ZTQGTYFYOODGOQ-UHFFFAOYSA-N 0.000 description 1
- NAZDVUBIEPVUKE-UHFFFAOYSA-N 2,5-dimethoxyaniline Chemical compound COC1=CC=C(OC)C(N)=C1 NAZDVUBIEPVUKE-UHFFFAOYSA-N 0.000 description 1
- WQOWBWVMZPPPGX-UHFFFAOYSA-N 2,6-diaminoanthracene-9,10-dione Chemical compound NC1=CC=C2C(=O)C3=CC(N)=CC=C3C(=O)C2=C1 WQOWBWVMZPPPGX-UHFFFAOYSA-N 0.000 description 1
- JDMFXJULNGEPOI-UHFFFAOYSA-N 2,6-dichloroaniline Chemical compound NC1=C(Cl)C=CC=C1Cl JDMFXJULNGEPOI-UHFFFAOYSA-N 0.000 description 1
- MIHADVKEHAFNPG-UHFFFAOYSA-N 2-Amino-5-nitrothiazole Chemical compound NC1=NC=C([N+]([O-])=O)S1 MIHADVKEHAFNPG-UHFFFAOYSA-N 0.000 description 1
- XOGPDSATLSAZEK-UHFFFAOYSA-N 2-Aminoanthraquinone Chemical compound C1=CC=C2C(=O)C3=CC(N)=CC=C3C(=O)C2=C1 XOGPDSATLSAZEK-UHFFFAOYSA-N 0.000 description 1
- PXBFMLJZNCDSMP-UHFFFAOYSA-N 2-Aminobenzamide Chemical compound NC(=O)C1=CC=CC=C1N PXBFMLJZNCDSMP-UHFFFAOYSA-N 0.000 description 1
- XNWFRZJHXBZDAG-UHFFFAOYSA-N 2-METHOXYETHANOL Chemical compound COCCO XNWFRZJHXBZDAG-UHFFFAOYSA-N 0.000 description 1
- ILCLJQFCMRCPNM-UHFFFAOYSA-N 2-Methylpropyl 2-aminobenzoate Chemical compound CC(C)COC(=O)C1=CC=CC=C1N ILCLJQFCMRCPNM-UHFFFAOYSA-N 0.000 description 1
- APLNAFMUEHKRLM-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)N=CN2 APLNAFMUEHKRLM-UHFFFAOYSA-N 0.000 description 1
- PLGPRGMWHYWEFT-UHFFFAOYSA-N 2-amino-1-chloroanthracene-9,10-dione Chemical compound C1=CC=C2C(=O)C3=C(Cl)C(N)=CC=C3C(=O)C2=C1 PLGPRGMWHYWEFT-UHFFFAOYSA-N 0.000 description 1
- CLWMYQQCXBSIBF-UHFFFAOYSA-N 2-amino-3-bromoanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=C(N)C(Br)=C2 CLWMYQQCXBSIBF-UHFFFAOYSA-N 0.000 description 1
- VMOJFUJVEWWUAV-UHFFFAOYSA-N 2-amino-3-chloroanthracene-9,10-dione Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C=C(N)C(Cl)=C2 VMOJFUJVEWWUAV-UHFFFAOYSA-N 0.000 description 1
- GOJUJUVQIVIZAV-UHFFFAOYSA-N 2-amino-4,6-dichloropyrimidine-5-carbaldehyde Chemical group NC1=NC(Cl)=C(C=O)C(Cl)=N1 GOJUJUVQIVIZAV-UHFFFAOYSA-N 0.000 description 1
- OLNLRPSGYYHOAY-UHFFFAOYSA-N 2-amino-4-carbamoylbenzoic acid Chemical compound NC(=O)C1=CC=C(C(O)=O)C(N)=C1 OLNLRPSGYYHOAY-UHFFFAOYSA-N 0.000 description 1
- HHNWXQCVWVVVQZ-UHFFFAOYSA-N 2-amino-4-methoxybenzoic acid Chemical compound COC1=CC=C(C(O)=O)C(N)=C1 HHNWXQCVWVVVQZ-UHFFFAOYSA-N 0.000 description 1
- MGCGMYPNXAFGFA-UHFFFAOYSA-N 2-amino-5-nitrobenzonitrile Chemical compound NC1=CC=C([N+]([O-])=O)C=C1C#N MGCGMYPNXAFGFA-UHFFFAOYSA-N 0.000 description 1
- 229940018167 2-amino-5-nitrothiazole Drugs 0.000 description 1
- DVJPMCANMMJVQH-UHFFFAOYSA-N 2-amino-n,n,4-trimethyl-1,3-thiazole-5-carboxamide Chemical compound CN(C)C(=O)C=1SC(N)=NC=1C DVJPMCANMMJVQH-UHFFFAOYSA-N 0.000 description 1
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical compound C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 description 1
- CGPPWNTVTNCHDO-UHFFFAOYSA-N 2-bromo-4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1Br CGPPWNTVTNCHDO-UHFFFAOYSA-N 0.000 description 1
- VLMRGLCBIFWPGL-UHFFFAOYSA-N 2-chloro-4-methylsulfonylaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C(Cl)=C1 VLMRGLCBIFWPGL-UHFFFAOYSA-N 0.000 description 1
- VKTTYIXIDXWHKW-UHFFFAOYSA-N 2-chloro-5-(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC=C1Cl VKTTYIXIDXWHKW-UHFFFAOYSA-N 0.000 description 1
- AKCRQHGQIJBRMN-UHFFFAOYSA-N 2-chloroaniline Chemical compound NC1=CC=CC=C1Cl AKCRQHGQIJBRMN-UHFFFAOYSA-N 0.000 description 1
- UWIWGZCNYRBVJL-UHFFFAOYSA-N 2-chloronaphthalen-1-amine Chemical compound C1=CC=C2C(N)=C(Cl)C=CC2=C1 UWIWGZCNYRBVJL-UHFFFAOYSA-N 0.000 description 1
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- UAQPVXNVJIGRGE-UHFFFAOYSA-N 2-ethoxyethyl nitrite Chemical compound CCOCCON=O UAQPVXNVJIGRGE-UHFFFAOYSA-N 0.000 description 1
- PRIUALOJYOZZOJ-UHFFFAOYSA-L 2-ethylhexyl 2-[dibutyl-[2-(2-ethylhexoxy)-2-oxoethyl]sulfanylstannyl]sulfanylacetate Chemical compound CCCCC(CC)COC(=O)CS[Sn](CCCC)(CCCC)SCC(=O)OCC(CC)CCCC PRIUALOJYOZZOJ-UHFFFAOYSA-L 0.000 description 1
- GVBHRNIWBGTNQA-UHFFFAOYSA-N 2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=CC=C1N GVBHRNIWBGTNQA-UHFFFAOYSA-N 0.000 description 1
- VXUMJWGCPAUKTB-UHFFFAOYSA-N 2-methoxy-5-methyl-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=C(C)C=C1N VXUMJWGCPAUKTB-UHFFFAOYSA-N 0.000 description 1
- NIPDVSLAMPAWTP-UHFFFAOYSA-N 2-methoxy-5-nitroaniline Chemical compound COC1=CC=C([N+]([O-])=O)C=C1N NIPDVSLAMPAWTP-UHFFFAOYSA-N 0.000 description 1
- XTTIQGSLJBWVIV-UHFFFAOYSA-N 2-methyl-4-nitroaniline Chemical compound CC1=CC([N+]([O-])=O)=CC=C1N XTTIQGSLJBWVIV-UHFFFAOYSA-N 0.000 description 1
- DPJCXCZTLWNFOH-UHFFFAOYSA-N 2-nitroaniline Chemical compound NC1=CC=CC=C1[N+]([O-])=O DPJCXCZTLWNFOH-UHFFFAOYSA-N 0.000 description 1
- SDYWXFYBZPNOFX-UHFFFAOYSA-N 3,4-dichloroaniline Chemical compound NC1=CC=C(Cl)C(Cl)=C1 SDYWXFYBZPNOFX-UHFFFAOYSA-N 0.000 description 1
- CDIDGWDGQGVCIB-UHFFFAOYSA-N 3,5-bis(trifluoromethyl)aniline Chemical compound NC1=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 CDIDGWDGQGVCIB-UHFFFAOYSA-N 0.000 description 1
- UQRLKWGPEVNVHT-UHFFFAOYSA-N 3,5-dichloroaniline Chemical compound NC1=CC(Cl)=CC(Cl)=C1 UQRLKWGPEVNVHT-UHFFFAOYSA-N 0.000 description 1
- QHMDKGRWJVOUFU-UHFFFAOYSA-N 3-amino-4-chlorobenzamide Chemical compound NC(=O)C1=CC=C(Cl)C(N)=C1 QHMDKGRWJVOUFU-UHFFFAOYSA-N 0.000 description 1
- CHFUQQXEHLJIQS-UHFFFAOYSA-N 3-amino-4-methoxy-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC=C(OC)C(N)=C1 CHFUQQXEHLJIQS-UHFFFAOYSA-N 0.000 description 1
- INCJNDAQNPWMPZ-UHFFFAOYSA-N 3-amino-4-methoxybenzamide Chemical compound COC1=CC=C(C(N)=O)C=C1N INCJNDAQNPWMPZ-UHFFFAOYSA-N 0.000 description 1
- DTNODBHGOLWROS-UHFFFAOYSA-N 3-amino-4-methylbenzenesulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1N DTNODBHGOLWROS-UHFFFAOYSA-N 0.000 description 1
- NXFCCUBWWTWZGE-UHFFFAOYSA-N 3-amino-n,4-dimethylbenzamide Chemical compound CNC(=O)C1=CC=C(C)C(N)=C1 NXFCCUBWWTWZGE-UHFFFAOYSA-N 0.000 description 1
- WBGVVXSCGNGJFL-UHFFFAOYSA-N 3-amino-n,n-diethyl-4-methoxybenzenesulfonamide Chemical compound CCN(CC)S(=O)(=O)C1=CC=C(OC)C(N)=C1 WBGVVXSCGNGJFL-UHFFFAOYSA-N 0.000 description 1
- RUEOLHBWSOMCKM-UHFFFAOYSA-N 3-amino-n-(2,4-dimethylphenyl)-4-methylbenzamide Chemical compound CC1=CC(C)=CC=C1NC(=O)C1=CC=C(C)C(N)=C1 RUEOLHBWSOMCKM-UHFFFAOYSA-N 0.000 description 1
- IDBCVYWZEFXJJD-UHFFFAOYSA-N 3-amino-n-(2,5-dichlorophenyl)-4-methylbenzamide Chemical compound C1=C(N)C(C)=CC=C1C(=O)NC1=CC(Cl)=CC=C1Cl IDBCVYWZEFXJJD-UHFFFAOYSA-N 0.000 description 1
- ZXPXRBDYCANCCU-UHFFFAOYSA-N 3-aminobenzo[b]phenalen-7-one Chemical compound C12=CC=CC=C2C(=O)C2=CC=CC3=C2C1=CC=C3N ZXPXRBDYCANCCU-UHFFFAOYSA-N 0.000 description 1
- XJCVRTZCHMZPBD-UHFFFAOYSA-N 3-nitroaniline Chemical compound NC1=CC=CC([N+]([O-])=O)=C1 XJCVRTZCHMZPBD-UHFFFAOYSA-N 0.000 description 1
- OYAHSBDYBOBAAQ-UHFFFAOYSA-N 3-phenyl-1,2,4-thiadiazol-5-amine Chemical compound S1C(N)=NC(C=2C=CC=CC=2)=N1 OYAHSBDYBOBAAQ-UHFFFAOYSA-N 0.000 description 1
- YWLRDENSBUHPSN-UHFFFAOYSA-N 3h-naphtho[2,3-f]quinazolin-4-amine Chemical compound C1=CC2=CC3=CC=CC=C3C=C2C2=C1N(N)CN=C2 YWLRDENSBUHPSN-UHFFFAOYSA-N 0.000 description 1
- OMUPQCXITFAUCB-UHFFFAOYSA-N 4,5-dichloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=C(Cl)C=C1N OMUPQCXITFAUCB-UHFFFAOYSA-N 0.000 description 1
- SIXWIUJQBBANGK-UHFFFAOYSA-N 4-(4-fluorophenyl)-1h-pyrazol-5-amine Chemical compound N1N=CC(C=2C=CC(F)=CC=2)=C1N SIXWIUJQBBANGK-UHFFFAOYSA-N 0.000 description 1
- XRTJYEIMLZALBD-UHFFFAOYSA-N 4-(6-methyl-1,3-benzothiazol-2-yl)aniline Chemical compound S1C2=CC(C)=CC=C2N=C1C1=CC=C(N)C=C1 XRTJYEIMLZALBD-UHFFFAOYSA-N 0.000 description 1
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 description 1
- IFQWBWVICSDDSO-UHFFFAOYSA-N 4-acetamido-2-aminobenzoic acid Chemical compound CC(=O)NC1=CC=C(C(O)=O)C(N)=C1 IFQWBWVICSDDSO-UHFFFAOYSA-N 0.000 description 1
- CISVVDNATRQDNU-UHFFFAOYSA-N 4-amino-2,5-dimethoxy-n-methylbenzenesulfonamide Chemical compound CNS(=O)(=O)C1=CC(OC)=C(N)C=C1OC CISVVDNATRQDNU-UHFFFAOYSA-N 0.000 description 1
- CVINWVPRKDIGLL-UHFFFAOYSA-N 4-chloro-2-(trifluoromethyl)aniline Chemical compound NC1=CC=C(Cl)C=C1C(F)(F)F CVINWVPRKDIGLL-UHFFFAOYSA-N 0.000 description 1
- MOJMJIHMADVVCQ-UHFFFAOYSA-N 4-chloro-2-ethoxyaniline Chemical compound CCOC1=CC(Cl)=CC=C1N MOJMJIHMADVVCQ-UHFFFAOYSA-N 0.000 description 1
- XBAPOWUMJRIKAV-UHFFFAOYSA-N 4-chloro-2-methoxy-5-methylaniline Chemical compound COC1=CC(Cl)=C(C)C=C1N XBAPOWUMJRIKAV-UHFFFAOYSA-N 0.000 description 1
- WOXLPNAOCCIZGP-UHFFFAOYSA-N 4-chloro-2-methoxyaniline Chemical compound COC1=CC(Cl)=CC=C1N WOXLPNAOCCIZGP-UHFFFAOYSA-N 0.000 description 1
- QSNSCYSYFYORTR-UHFFFAOYSA-N 4-chloroaniline Chemical compound NC1=CC=C(Cl)C=C1 QSNSCYSYFYORTR-UHFFFAOYSA-N 0.000 description 1
- NAELBNIEPRXPCO-UHFFFAOYSA-N 4-ethylsulfonyl-2-nitroaniline Chemical compound CCS(=O)(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 NAELBNIEPRXPCO-UHFFFAOYSA-N 0.000 description 1
- QFMJFXFXQAFGBO-UHFFFAOYSA-N 4-methoxy-2-nitroaniline Chemical compound COC1=CC=C(N)C([N+]([O-])=O)=C1 QFMJFXFXQAFGBO-UHFFFAOYSA-N 0.000 description 1
- IETLXQKNZFHVRQ-UHFFFAOYSA-N 4-methoxy-2h-1,3-benzoxazol-3-amine Chemical compound COC1=CC=CC2=C1N(N)CO2 IETLXQKNZFHVRQ-UHFFFAOYSA-N 0.000 description 1
- NDZFWKZHVAUUTN-UHFFFAOYSA-N 4-methylsulfonyl-2-nitroaniline Chemical compound CS(=O)(=O)C1=CC=C(N)C([N+]([O-])=O)=C1 NDZFWKZHVAUUTN-UHFFFAOYSA-N 0.000 description 1
- TYMLOMAKGOJONV-UHFFFAOYSA-N 4-nitroaniline Chemical compound NC1=CC=C([N+]([O-])=O)C=C1 TYMLOMAKGOJONV-UHFFFAOYSA-N 0.000 description 1
- BVPJPRYNQHAOPQ-UHFFFAOYSA-N 4-nitronaphthalen-1-amine Chemical compound C1=CC=C2C(N)=CC=C([N+]([O-])=O)C2=C1 BVPJPRYNQHAOPQ-UHFFFAOYSA-N 0.000 description 1
- HTPYOPCOLFDNIM-UHFFFAOYSA-N 5-(benzenesulfonyl)-2-methoxyaniline Chemical compound C1=C(N)C(OC)=CC=C1S(=O)(=O)C1=CC=CC=C1 HTPYOPCOLFDNIM-UHFFFAOYSA-N 0.000 description 1
- WRZOMWDJOLIVQP-UHFFFAOYSA-N 5-Chloro-ortho-toluidine Chemical compound CC1=CC=C(Cl)C=C1N WRZOMWDJOLIVQP-UHFFFAOYSA-N 0.000 description 1
- CNSNLRXGBRBCAU-UHFFFAOYSA-N 5-amino-1,4-dichloroanthracene-9,10-dione Chemical compound O=C1C2=C(Cl)C=CC(Cl)=C2C(=O)C2=C1C=CC=C2N CNSNLRXGBRBCAU-UHFFFAOYSA-N 0.000 description 1
- UXPIWHPHEGRYLB-UHFFFAOYSA-N 5-aminobenzene-1,3-dicarboxamide Chemical compound NC(=O)C1=CC(N)=CC(C(N)=O)=C1 UXPIWHPHEGRYLB-UHFFFAOYSA-N 0.000 description 1
- XTTHAADPPZNOBT-UHFFFAOYSA-N 5-benzylsulfonyl-2-methoxyaniline Chemical compound C1=C(N)C(OC)=CC=C1S(=O)(=O)CC1=CC=CC=C1 XTTHAADPPZNOBT-UHFFFAOYSA-N 0.000 description 1
- SWQWTDAWUSBMGA-UHFFFAOYSA-N 5-chloro-1,3-thiazol-2-amine Chemical compound NC1=NC=C(Cl)S1 SWQWTDAWUSBMGA-UHFFFAOYSA-N 0.000 description 1
- WLJSUJOESWTGEX-UHFFFAOYSA-N 5-chloro-2-(4-chlorophenoxy)aniline Chemical compound NC1=CC(Cl)=CC=C1OC1=CC=C(Cl)C=C1 WLJSUJOESWTGEX-UHFFFAOYSA-N 0.000 description 1
- UZEGGYTUIIXOIX-UHFFFAOYSA-N 5-chloro-2-ethoxyaniline Chemical compound CCOC1=CC=C(Cl)C=C1N UZEGGYTUIIXOIX-UHFFFAOYSA-N 0.000 description 1
- POKAEVPBUOLQIY-UHFFFAOYSA-N 5-chloro-2-methoxy-4-nitroaniline Chemical compound COC1=CC([N+]([O-])=O)=C(Cl)C=C1N POKAEVPBUOLQIY-UHFFFAOYSA-N 0.000 description 1
- WBSMIPLNPSCJFS-UHFFFAOYSA-N 5-chloro-2-methoxyaniline Chemical compound COC1=CC=C(Cl)C=C1N WBSMIPLNPSCJFS-UHFFFAOYSA-N 0.000 description 1
- XDLWNEUYUGKDTC-UHFFFAOYSA-N 5-ethylsulfonyl-2-methoxyaniline Chemical compound CCS(=O)(=O)C1=CC=C(OC)C(N)=C1 XDLWNEUYUGKDTC-UHFFFAOYSA-N 0.000 description 1
- DSBIJCMXAIKKKI-UHFFFAOYSA-N 5-nitro-o-toluidine Chemical compound CC1=CC=C([N+]([O-])=O)C=C1N DSBIJCMXAIKKKI-UHFFFAOYSA-N 0.000 description 1
- PPYFMWXMDIAZSV-UHFFFAOYSA-N 5-nitronaphthalen-2-amine Chemical compound [O-][N+](=O)C1=CC=CC2=CC(N)=CC=C21 PPYFMWXMDIAZSV-UHFFFAOYSA-N 0.000 description 1
- JBEQGKQAHVYHEC-UHFFFAOYSA-N 6-amino-3-methyl-2h-naphtho[2,3-f]quinolin-1-one Chemical compound C1=CC=CC2=CC3=C(C(=O)CC(C)=N4)C4=CC(N)=C3C=C21 JBEQGKQAHVYHEC-UHFFFAOYSA-N 0.000 description 1
- VMNXKIDUTPOHPO-UHFFFAOYSA-N 6-chloro-1,3-benzothiazol-2-amine Chemical compound C1=C(Cl)C=C2SC(N)=NC2=C1 VMNXKIDUTPOHPO-UHFFFAOYSA-N 0.000 description 1
- KZHGPDSVHSDCMX-UHFFFAOYSA-N 6-methoxy-1,3-benzothiazol-2-amine Chemical compound COC1=CC=C2N=C(N)SC2=C1 KZHGPDSVHSDCMX-UHFFFAOYSA-N 0.000 description 1
- DZWTXWPRWRLHIL-UHFFFAOYSA-N 6-methyl-1,3-benzothiazol-2-amine Chemical compound CC1=CC=C2N=C(N)SC2=C1 DZWTXWPRWRLHIL-UHFFFAOYSA-N 0.000 description 1
- ZYHNHJAMVNINSY-UHFFFAOYSA-N 6-methylsulfonyl-1,3-benzothiazol-2-amine Chemical compound CS(=O)(=O)C1=CC=C2N=C(N)SC2=C1 ZYHNHJAMVNINSY-UHFFFAOYSA-N 0.000 description 1
- GZVHEAJQGPRDLQ-UHFFFAOYSA-N 6-phenyl-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(N)=NC(C=2C=CC=CC=2)=N1 GZVHEAJQGPRDLQ-UHFFFAOYSA-N 0.000 description 1
- MVTBZYCNAYYTAC-UHFFFAOYSA-N 7-amino-3-methyl-2h-naphtho[2,3-f]quinolin-1-one Chemical compound C1=CC=CC2=CC3=C(C(=O)CC(C)=N4)C4=CC=C3C(N)=C21 MVTBZYCNAYYTAC-UHFFFAOYSA-N 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- 241000272525 Anas platyrhynchos Species 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- TWLLPUMZVVGILS-UHFFFAOYSA-N Ethyl 2-aminobenzoate Chemical compound CCOC(=O)C1=CC=CC=C1N TWLLPUMZVVGILS-UHFFFAOYSA-N 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- MKYBYDHXWVHEJW-UHFFFAOYSA-N N-[1-oxo-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propan-2-yl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(C(C)NC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 MKYBYDHXWVHEJW-UHFFFAOYSA-N 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229920002396 Polyurea Polymers 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical compound C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- 235000011941 Tilia x europaea Nutrition 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- SMEGJBVQLJJKKX-HOTMZDKISA-N [(2R,3S,4S,5R,6R)-5-acetyloxy-3,4,6-trihydroxyoxan-2-yl]methyl acetate Chemical compound CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)OC(=O)C)O)O SMEGJBVQLJJKKX-HOTMZDKISA-N 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 1
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229920003232 aliphatic polyester Polymers 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000005907 alkyl ester group Chemical group 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- 229960004050 aminobenzoic acid Drugs 0.000 description 1
- 229960003116 amyl nitrite Drugs 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000002490 anilino group Chemical group [H]N(*)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 125000004657 aryl sulfonyl amino group Chemical group 0.000 description 1
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 1
- 229910052601 baryte Inorganic materials 0.000 description 1
- 239000010428 baryte Substances 0.000 description 1
- 239000011324 bead Substances 0.000 description 1
- 150000001555 benzenes Chemical class 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-N benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-N 0.000 description 1
- 229940092714 benzenesulfonic acid Drugs 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 239000004202 carbamide Substances 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 238000006477 desulfuration reaction Methods 0.000 description 1
- 230000023556 desulfurization Effects 0.000 description 1
- JQZRVMZHTADUSY-UHFFFAOYSA-L di(octanoyloxy)tin Chemical compound [Sn+2].CCCCCCCC([O-])=O.CCCCCCCC([O-])=O JQZRVMZHTADUSY-UHFFFAOYSA-L 0.000 description 1
- 239000012954 diazonium Substances 0.000 description 1
- 150000001989 diazonium salts Chemical class 0.000 description 1
- 238000006193 diazotization reaction Methods 0.000 description 1
- 229960005215 dichloroacetic acid Drugs 0.000 description 1
- DSSKDXUDARIMTR-UHFFFAOYSA-N dimethyl 2-aminobenzene-1,4-dicarboxylate Chemical compound COC(=O)C1=CC=C(C(=O)OC)C(N)=C1 DSSKDXUDARIMTR-UHFFFAOYSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 238000007599 discharging Methods 0.000 description 1
- KPUWHANPEXNPJT-UHFFFAOYSA-N disiloxane Chemical class [SiH3]O[SiH3] KPUWHANPEXNPJT-UHFFFAOYSA-N 0.000 description 1
- 239000002270 dispersing agent Substances 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 238000006253 efflorescence Methods 0.000 description 1
- 229920001971 elastomer Polymers 0.000 description 1
- 238000000921 elemental analysis Methods 0.000 description 1
- ACKLIRAPAVQACS-UHFFFAOYSA-N ethane-1,2-diol;sulfuric acid Chemical compound OCCO.OS(O)(=O)=O ACKLIRAPAVQACS-UHFFFAOYSA-N 0.000 description 1
- CCIVGXIOQKPBKL-UHFFFAOYSA-M ethanesulfonate Chemical compound CCS([O-])(=O)=O CCIVGXIOQKPBKL-UHFFFAOYSA-M 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 229940013688 formic acid Drugs 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 238000007646 gravure printing Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000004312 hexamethylene tetramine Substances 0.000 description 1
- 235000010299 hexamethylene tetramine Nutrition 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 238000010030 laminating Methods 0.000 description 1
- 239000004571 lime Substances 0.000 description 1
- 239000000944 linseed oil Substances 0.000 description 1
- 235000021388 linseed oil Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002689 maleic acids Chemical class 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- CDGNLUSBENXDGG-UHFFFAOYSA-N meta-Cresidine Chemical compound COC1=CC=C(N)C(C)=C1 CDGNLUSBENXDGG-UHFFFAOYSA-N 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000005395 methacrylic acid group Chemical group 0.000 description 1
- QIAAPANEUUVUSA-UHFFFAOYSA-N methyl 1-amino-9,10-dioxoanthracene-2-carboxylate Chemical compound C1=CC=C2C(=O)C3=C(N)C(C(=O)OC)=CC=C3C(=O)C2=C1 QIAAPANEUUVUSA-UHFFFAOYSA-N 0.000 description 1
- FODZNORQIATQIP-UHFFFAOYSA-N methyl 2-amino-3,5-dichlorobenzoate Chemical compound COC(=O)C1=CC(Cl)=CC(Cl)=C1N FODZNORQIATQIP-UHFFFAOYSA-N 0.000 description 1
- SVFOICCGZVRLER-UHFFFAOYSA-N methyl 2-amino-4-(phenylcarbamoyl)benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1C(=O)NC1=CC=CC=C1 SVFOICCGZVRLER-UHFFFAOYSA-N 0.000 description 1
- PDWBHZYCNIOXCB-UHFFFAOYSA-N methyl 2-amino-4-[(2,5-dichlorobenzoyl)amino]benzoate Chemical compound C1=C(N)C(C(=O)OC)=CC=C1NC(=O)C1=CC(Cl)=CC=C1Cl PDWBHZYCNIOXCB-UHFFFAOYSA-N 0.000 description 1
- FUPUSAFEUIFSEY-UHFFFAOYSA-N methyl 2-amino-4-carbamoylbenzoate Chemical compound COC(=O)C1=CC=C(C(N)=O)C=C1N FUPUSAFEUIFSEY-UHFFFAOYSA-N 0.000 description 1
- TYUGYIMCRDPMPJ-UHFFFAOYSA-N methyl 2-amino-4-methyl-1,3-thiazole-5-carboxylate Chemical compound COC(=O)C=1SC(N)=NC=1C TYUGYIMCRDPMPJ-UHFFFAOYSA-N 0.000 description 1
- VAQBJVZNPBNHGC-UHFFFAOYSA-N methyl 2-amino-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C=C1N VAQBJVZNPBNHGC-UHFFFAOYSA-N 0.000 description 1
- VGURYVWLCVIMTF-UHFFFAOYSA-N methyl 2-amino-4-nitrobenzoate Chemical compound COC(=O)C1=CC=C([N+]([O-])=O)C=C1N VGURYVWLCVIMTF-UHFFFAOYSA-N 0.000 description 1
- WFAWRPHNQAVIPL-UHFFFAOYSA-N methyl 2-amino-4-sulfamoylbenzoate Chemical compound COC(=O)C1=CC=C(S(N)(=O)=O)C=C1N WFAWRPHNQAVIPL-UHFFFAOYSA-N 0.000 description 1
- MDHYFUPTSWXVIA-UHFFFAOYSA-N methyl 2-amino-5-methylbenzoate Chemical compound COC(=O)C1=CC(C)=CC=C1N MDHYFUPTSWXVIA-UHFFFAOYSA-N 0.000 description 1
- VOQBLPBLKSXCDB-UHFFFAOYSA-N methyl 2-amino-5-nitrobenzoate Chemical compound COC(=O)C1=CC([N+]([O-])=O)=CC=C1N VOQBLPBLKSXCDB-UHFFFAOYSA-N 0.000 description 1
- BXRYSXCIRIKKJV-UHFFFAOYSA-N methyl 2-amino-6-chlorobenzoate Chemical compound COC(=O)C1=C(N)C=CC=C1Cl BXRYSXCIRIKKJV-UHFFFAOYSA-N 0.000 description 1
- HCLLOQLXKCCWLJ-UHFFFAOYSA-N methyl 2-amino-6-methylbenzoate Chemical compound COC(=O)C1=C(C)C=CC=C1N HCLLOQLXKCCWLJ-UHFFFAOYSA-N 0.000 description 1
- YEPWCJHMSVABPQ-UHFFFAOYSA-N methyl 3-amino-4-methylbenzoate Chemical compound COC(=O)C1=CC=C(C)C(N)=C1 YEPWCJHMSVABPQ-UHFFFAOYSA-N 0.000 description 1
- WHMQTPBEFHEYJI-UHFFFAOYSA-N methyl 3-aminonaphthalene-2-carboxylate Chemical compound C1=CC=C2C=C(N)C(C(=O)OC)=CC2=C1 WHMQTPBEFHEYJI-UHFFFAOYSA-N 0.000 description 1
- 229940095102 methyl benzoate Drugs 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- YEMZEMNLHVJVJK-UHFFFAOYSA-N n'-(2-nitrophenyl)acetohydrazide Chemical compound CC(=O)NNC1=CC=CC=C1[N+]([O-])=O YEMZEMNLHVJVJK-UHFFFAOYSA-N 0.000 description 1
- GEMHFKXPOCTAIP-UHFFFAOYSA-N n,n-dimethyl-n'-phenylcarbamimidoyl chloride Chemical compound CN(C)C(Cl)=NC1=CC=CC=C1 GEMHFKXPOCTAIP-UHFFFAOYSA-N 0.000 description 1
- DSEYJTPEKOUONE-UHFFFAOYSA-N n-(3-amino-4-chloro-1-methylcyclohexa-2,4-dien-1-yl)acetamide Chemical compound CC(=O)NC1(C)CC=C(Cl)C(N)=C1 DSEYJTPEKOUONE-UHFFFAOYSA-N 0.000 description 1
- CPWKRSWUPXTENQ-UHFFFAOYSA-N n-(3-amino-4-chlorophenyl)benzamide Chemical compound C1=C(Cl)C(N)=CC(NC(=O)C=2C=CC=CC=2)=C1 CPWKRSWUPXTENQ-UHFFFAOYSA-N 0.000 description 1
- ROKKABNPZRSHHY-UHFFFAOYSA-N n-(4-amino-2,5-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=CC(Cl)=C(N)C=C1Cl ROKKABNPZRSHHY-UHFFFAOYSA-N 0.000 description 1
- GLVCAEGUHYVWHO-UHFFFAOYSA-N n-(4-amino-2-methoxy-5-methylphenyl)benzamide Chemical compound COC1=CC(N)=C(C)C=C1NC(=O)C1=CC=CC=C1 GLVCAEGUHYVWHO-UHFFFAOYSA-N 0.000 description 1
- BDJMCMGZOMQUMJ-UHFFFAOYSA-N n-(4-amino-3-bromo-9,10-dioxoanthracen-1-yl)-4-methylbenzenesulfonamide Chemical compound C1=CC(C)=CC=C1S(=O)(=O)NC1=CC(Br)=C(N)C2=C1C(=O)C1=CC=CC=C1C2=O BDJMCMGZOMQUMJ-UHFFFAOYSA-N 0.000 description 1
- VIUTVHGOAOMQHY-UHFFFAOYSA-N n-(4-amino-5-chloro-2-methoxyphenyl)benzamide Chemical compound COC1=CC(N)=C(Cl)C=C1NC(=O)C1=CC=CC=C1 VIUTVHGOAOMQHY-UHFFFAOYSA-N 0.000 description 1
- WUTYQBPQNVVTGI-UHFFFAOYSA-N n-(4-amino-9,10-dioxoanthracen-1-yl)acetamide Chemical compound O=C1C2=CC=CC=C2C(=O)C2=C1C(N)=CC=C2NC(=O)C WUTYQBPQNVVTGI-UHFFFAOYSA-N 0.000 description 1
- VNAPWHKXDFTHKX-UHFFFAOYSA-N n-(5-amino-2,4-dichlorophenyl)acetamide Chemical compound CC(=O)NC1=CC(N)=C(Cl)C=C1Cl VNAPWHKXDFTHKX-UHFFFAOYSA-N 0.000 description 1
- OTKLJHUTFZDDFF-UHFFFAOYSA-N n-(8-amino-9,10-dioxoanthracen-1-yl)benzamide Chemical compound C=12C(=O)C=3C(N)=CC=CC=3C(=O)C2=CC=CC=1NC(=O)C1=CC=CC=C1 OTKLJHUTFZDDFF-UHFFFAOYSA-N 0.000 description 1
- FITZJYAVATZPMJ-UHFFFAOYSA-N naphthalene-2,6-disulfonic acid Chemical compound C1=C(S(O)(=O)=O)C=CC2=CC(S(=O)(=O)O)=CC=C21 FITZJYAVATZPMJ-UHFFFAOYSA-N 0.000 description 1
- BWLMSSYNXWIARE-UHFFFAOYSA-N naphtho[2,3-f]quinazolin-6-amine Chemical compound C1=CC=C2C=C3C(N)=CC4=NC=NC=C4C3=CC2=C1 BWLMSSYNXWIARE-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-N o-dicarboxybenzene Natural products OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 238000000643 oven drying Methods 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 230000019612 pigmentation Effects 0.000 description 1
- 229920000139 polyethylene terephthalate Polymers 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920001228 polyisocyanate Polymers 0.000 description 1
- 239000005056 polyisocyanate Substances 0.000 description 1
- 229920000193 polymethacrylate Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 239000011527 polyurethane coating Substances 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 206010037844 rash Diseases 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 235000010288 sodium nitrite Nutrition 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 230000007480 spreading Effects 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- LZOZLBFZGFLFBV-UHFFFAOYSA-N sulfene Chemical compound C=S(=O)=O LZOZLBFZGFLFBV-UHFFFAOYSA-N 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000004073 vulcanization Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000012463 white pigment Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/0018—Monoazo dyes prepared by diazotising and coupling from diazotized aminopolycyclic rings
- C09B29/0022—Monoazo dyes prepared by diazotising and coupling from diazotized aminopolycyclic rings from diazotized aminoanthracene
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/70—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings condensed with carbocyclic rings or ring systems
- C07D239/72—Quinazolines; Hydrogenated quinazolines
- C07D239/86—Quinazolines; Hydrogenated quinazolines with hetero atoms directly attached in position 4
- C07D239/88—Oxygen atoms
- C07D239/90—Oxygen atoms with acyclic radicals attached in position 2 or 3
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B29/00—Monoazo dyes prepared by diazotising and coupling
- C09B29/32—Monoazo dyes prepared by diazotising and coupling from coupling components containing a reactive methylene group
- C09B29/325—Monoazo dyes prepared by diazotising and coupling from coupling components containing a reactive methylene group free of acid groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Inks, Pencil-Leads, Or Crayons (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782830555 DE2830555A1 (de) | 1978-07-12 | 1978-07-12 | Chinazolinonyl-verbindungen |
| US06/043,494 US4288362A (en) | 1978-07-12 | 1979-05-29 | Monoazo pigments containing a quinazo linonylacetoacetanilide coupling component |
| DE7979102211T DE2967247D1 (en) | 1978-07-12 | 1979-07-02 | Quinazoline derivatives, azo dyes derived from the quinazolines and their use as pigments |
| EP79102211A EP0008627B1 (de) | 1978-07-12 | 1979-07-02 | Chinazolin-Derivate, sowie Azofarbstoffe, die sich von den Chinazolin-Derivaten ableiten und deren Verwendung als Pigmente |
| JP8655279A JPS5513290A (en) | 1978-07-12 | 1979-07-10 | Heterocyclic compound |
| BR7904409A BR7904409A (pt) | 1978-07-12 | 1979-07-11 | Compostos heterociclicos,processo para sua preparacao,azocorantes,processo para sua preparacao e seu emprego |
| JP63320753A JPH01198666A (ja) | 1978-07-12 | 1988-12-21 | アゾ着色剤 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782830555 DE2830555A1 (de) | 1978-07-12 | 1978-07-12 | Chinazolinonyl-verbindungen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2830555A1 true DE2830555A1 (de) | 1980-03-06 |
Family
ID=6044154
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782830555 Withdrawn DE2830555A1 (de) | 1978-07-12 | 1978-07-12 | Chinazolinonyl-verbindungen |
| DE7979102211T Expired DE2967247D1 (en) | 1978-07-12 | 1979-07-02 | Quinazoline derivatives, azo dyes derived from the quinazolines and their use as pigments |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE7979102211T Expired DE2967247D1 (en) | 1978-07-12 | 1979-07-02 | Quinazoline derivatives, azo dyes derived from the quinazolines and their use as pigments |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4288362A (enExample) |
| EP (1) | EP0008627B1 (enExample) |
| JP (2) | JPS5513290A (enExample) |
| BR (1) | BR7904409A (enExample) |
| DE (2) | DE2830555A1 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4412949A (en) * | 1980-07-02 | 1983-11-01 | Basf Aktiengesellschaft | Pigments comprising cyanomethylquinazolones coupled to diazo compounds prepared from 1-aminoanthroquinones |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4469515A (en) * | 1979-07-11 | 1984-09-04 | Ciba-Geigy Corporation | Production of pigments |
| JPS60176129U (ja) * | 1984-04-30 | 1985-11-21 | 日本精機株式会社 | 計器用段差文字板 |
| JPS60188323U (ja) * | 1984-05-23 | 1985-12-13 | 日本精機株式会社 | 段差文字板 |
| JPH0166021U (enExample) * | 1987-10-21 | 1989-04-27 | ||
| DE4007535A1 (de) * | 1990-03-09 | 1991-09-12 | Hoechst Ag | Wasserunloesliche azofarbmittel, ihre herstellung und verwendung |
| DE60021521T4 (de) | 1999-09-29 | 2006-09-21 | Ortho-Mcneil Pharmaceutical, Inc. | Isonipecotamide zur behandlung von integrin vermittelten störungen |
| US7081460B2 (en) * | 2001-04-09 | 2006-07-25 | Ortho-Mcneil Pharmaceutical, Inc. | Quinazoline and quinazoline-like compounds for the treatment of integrin-mediated disorders |
| US20100267752A1 (en) * | 2008-10-15 | 2010-10-21 | Gilead Palo Alto, Inc. | 3-HYDROQUINAZOLIN-4-ONE DERIVATIVES FOR USE AS STEAROYL CoA DESATURASE INHIBITORS |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES358994A1 (es) * | 1967-10-10 | 1970-11-01 | Ciba Geigy | Procedimiento para la preparacion de pigmentos colorantes azoicos. |
| DE1955808A1 (de) * | 1969-11-06 | 1971-06-09 | Hoechst Ag | Neue wasserunloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |
| US3963694A (en) * | 1971-03-03 | 1976-06-15 | Ciba-Geigy Corporation | Hydroxyquinolyl- and quinazolonylazoacetoacetylbenzimidazolone pigments |
| CH599299A5 (enExample) * | 1973-10-30 | 1978-05-31 | Ciba Geigy Ag | |
| DE2520896A1 (de) * | 1975-05-10 | 1976-11-25 | Basf Ag | Azopigmente der beta-hydroxynaphthoesaeurereihe |
-
1978
- 1978-07-12 DE DE19782830555 patent/DE2830555A1/de not_active Withdrawn
-
1979
- 1979-05-29 US US06/043,494 patent/US4288362A/en not_active Expired - Lifetime
- 1979-07-02 EP EP79102211A patent/EP0008627B1/de not_active Expired
- 1979-07-02 DE DE7979102211T patent/DE2967247D1/de not_active Expired
- 1979-07-10 JP JP8655279A patent/JPS5513290A/ja active Granted
- 1979-07-11 BR BR7904409A patent/BR7904409A/pt unknown
-
1988
- 1988-12-21 JP JP63320753A patent/JPH01198666A/ja active Pending
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4412949A (en) * | 1980-07-02 | 1983-11-01 | Basf Aktiengesellschaft | Pigments comprising cyanomethylquinazolones coupled to diazo compounds prepared from 1-aminoanthroquinones |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2967247D1 (en) | 1984-11-08 |
| US4288362A (en) | 1981-09-08 |
| EP0008627B1 (de) | 1984-10-03 |
| JPH0138108B2 (enExample) | 1989-08-11 |
| JPH01198666A (ja) | 1989-08-10 |
| EP0008627A2 (de) | 1980-03-19 |
| BR7904409A (pt) | 1980-04-08 |
| EP0008627A3 (en) | 1980-05-14 |
| JPS5513290A (en) | 1980-01-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4260540A (en) | Azo dye pigments containing 4-quinazolinone moieties | |
| US4225489A (en) | Heterocyclic azo dyes and pigments containing 4-quinazolinone moieties | |
| DE2830555A1 (de) | Chinazolinonyl-verbindungen | |
| EP0023617B1 (de) | Anthrachinonazo-Verbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Pigmente | |
| EP0008063B1 (de) | Azomethinderivate von Anthrachinonen, Verfahren zu deren Herstellung; deren Verwendung zum Pigmentieren organischer makromolekularer Stoffe und die so erhaltenen Materialien | |
| DE2935720A1 (de) | Azofarbstoffe, zwischenprodukte und verfahren zu ihrer herstellung sowie verfahren zum pigmentieren von organischem material. | |
| US4246401A (en) | Axomethine pigments | |
| EP0043937B1 (de) | Anthrachinonazo-Verbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung | |
| DE2351294A1 (de) | Azopigmente | |
| DE2660557C2 (de) | Azopigmente und ihre Verwendung | |
| DE2659676C2 (de) | Azoanthrachinonpigmente, deren Herstellung und Verwendung | |
| EP0023648B1 (de) | Anthrachinon-Azomethin-Verbindungen, Verfahren zu ihrer Herstellung; Verfahren zum Färben synthetischer Fasermaterialien sowie zum Pigmentieren organischer makro-molekularer Stoffe | |
| DE2145422A1 (de) | Neue disazopigmente und verfahren zu deren herstellung | |
| EP0018538B1 (de) | Anthrachinon-Derivate, Verfahren zu ihrer Herstellung, Verfahren zum Pigmentieren organischer makromolekularer Stoffe sowie pigmentiertes organisches makromolekulares Material | |
| CH649567A5 (de) | Azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung als pigmente. | |
| DE2822632C2 (enExample) | ||
| DE2544568C3 (de) | Sulfonsäuregruppenfreie Azofarbstoffe, Verfahren zu ihrer Herstellung und deren Verwendung als Pigmente in Lacken, Druckfarben oder Kunststoffen | |
| EP0023666B1 (de) | Anthrachinon-Azomethin-Verbindungen, Verfahren zu ihrer Herstellung sowie Verfahren zum Pigmentieren organischer makromolekularer Stoffe | |
| EP0058866B1 (de) | Anthrachinonazoverbindungen, Verfahren zu ihrer Herstellung sowie ihre Verwendung | |
| DE2144877A1 (de) | Monoazopigmente | |
| DE1768755A1 (de) | Pigmentfarbstoffe | |
| DE1768756A1 (de) | Pigmentfarbstoffe | |
| DE2416810A1 (de) | Wasserunloesliche azofarbstoffe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8130 | Withdrawal |