DE2809102C2 - Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden - Google Patents
Verfahren zur Herstellung von α,β-ungesättigen CarbonsäureamidenInfo
- Publication number
- DE2809102C2 DE2809102C2 DE2809102A DE2809102A DE2809102C2 DE 2809102 C2 DE2809102 C2 DE 2809102C2 DE 2809102 A DE2809102 A DE 2809102A DE 2809102 A DE2809102 A DE 2809102A DE 2809102 C2 DE2809102 C2 DE 2809102C2
- Authority
- DE
- Germany
- Prior art keywords
- general formula
- mol
- reaction
- methyl methacrylate
- methyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 17
- 150000003857 carboxamides Chemical class 0.000 title 1
- 150000001408 amides Chemical class 0.000 claims description 11
- -1 alkyl radical Chemical class 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 18
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 description 16
- 125000004432 carbon atom Chemical group C* 0.000 description 14
- 150000001412 amines Chemical class 0.000 description 12
- 229910052739 hydrogen Inorganic materials 0.000 description 11
- 239000001257 hydrogen Substances 0.000 description 11
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 8
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 6
- 239000003381 stabilizer Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 229910052742 iron Inorganic materials 0.000 description 5
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 4
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 4
- 229910000831 Steel Inorganic materials 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 239000010959 steel Substances 0.000 description 4
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 150000001735 carboxylic acids Chemical class 0.000 description 3
- 230000006735 deficit Effects 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 125000003107 substituted aryl group Chemical group 0.000 description 3
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 2
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- UUIQMZJEGPQKFD-UHFFFAOYSA-N Methyl butyrate Chemical compound CCCC(=O)OC UUIQMZJEGPQKFD-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000005263 alkylenediamine group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- SVOAENZIOKPANY-CVBJKYQLSA-L copper;(z)-octadec-9-enoate Chemical compound [Cu+2].CCCCCCCC\C=C/CCCCCCCC([O-])=O.CCCCCCCC\C=C/CCCCCCCC([O-])=O SVOAENZIOKPANY-CVBJKYQLSA-L 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 2
- AQBLLJNPHDIAPN-LNTINUHCSA-K iron(3+);(z)-4-oxopent-2-en-2-olate Chemical compound [Fe+3].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O AQBLLJNPHDIAPN-LNTINUHCSA-K 0.000 description 2
- WFKDPJRCBCBQNT-UHFFFAOYSA-N n,2-dimethylprop-2-enamide Chemical compound CNC(=O)C(C)=C WFKDPJRCBCBQNT-UHFFFAOYSA-N 0.000 description 2
- 238000005580 one pot reaction Methods 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- FSYKKLYZXJSNPZ-UHFFFAOYSA-N sarcosine Chemical compound C[NH2+]CC([O-])=O FSYKKLYZXJSNPZ-UHFFFAOYSA-N 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- GEYOCULIXLDCMW-UHFFFAOYSA-N 1,2-phenylenediamine Chemical compound NC1=CC=CC=C1N GEYOCULIXLDCMW-UHFFFAOYSA-N 0.000 description 1
- MCSVQCDNSCMOAS-UHFFFAOYSA-N 1-n',1-n',2,2-tetramethylpropane-1,1-diamine Chemical compound CN(C)C(N)C(C)(C)C MCSVQCDNSCMOAS-UHFFFAOYSA-N 0.000 description 1
- GZZZSOOGQLOEOB-UHFFFAOYSA-N 2,2-dichloro-n-(4-hydroxyphenyl)-n-methylacetamide Chemical compound ClC(Cl)C(=O)N(C)C1=CC=C(O)C=C1 GZZZSOOGQLOEOB-UHFFFAOYSA-N 0.000 description 1
- DDHUNHGZUHZNKB-UHFFFAOYSA-N 2,2-dimethylpropane-1,3-diamine Chemical compound NCC(C)(C)CN DDHUNHGZUHZNKB-UHFFFAOYSA-N 0.000 description 1
- YQIGLEFUZMIVHU-UHFFFAOYSA-N 2-methyl-n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C(C)=C YQIGLEFUZMIVHU-UHFFFAOYSA-N 0.000 description 1
- 244000309494 Bipolaris glycines Species 0.000 description 1
- 239000005749 Copper compound Substances 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- JGFBQFKZKSSODQ-UHFFFAOYSA-N Isothiocyanatocyclopropane Chemical compound S=C=NC1CC1 JGFBQFKZKSSODQ-UHFFFAOYSA-N 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- 229910006069 SO3H Inorganic materials 0.000 description 1
- 108010077895 Sarcosine Proteins 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- 238000007259 addition reaction Methods 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 125000005078 alkoxycarbonylalkyl group Chemical group 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- PWLNAUNEAKQYLH-UHFFFAOYSA-N butyric acid octyl ester Natural products CCCCCCCCOC(=O)CCC PWLNAUNEAKQYLH-UHFFFAOYSA-N 0.000 description 1
- 150000001880 copper compounds Chemical class 0.000 description 1
- 125000004663 dialkyl amino group Chemical group 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- XHFGWHUWQXTGAT-UHFFFAOYSA-N dimethylamine hydrochloride Natural products CNC(C)C XHFGWHUWQXTGAT-UHFFFAOYSA-N 0.000 description 1
- IQDGSYLLQPDQDV-UHFFFAOYSA-N dimethylazanium;chloride Chemical compound Cl.CNC IQDGSYLLQPDQDV-UHFFFAOYSA-N 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- SUPCQIBBMFXVTL-UHFFFAOYSA-N ethyl 2-methylprop-2-enoate Chemical compound CCOC(=O)C(C)=C SUPCQIBBMFXVTL-UHFFFAOYSA-N 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- WFKAJVHLWXSISD-UHFFFAOYSA-N isobutyramide Chemical class CC(C)C(N)=O WFKAJVHLWXSISD-UHFFFAOYSA-N 0.000 description 1
- FQPSGWSUVKBHSU-UHFFFAOYSA-N methacrylamide Chemical compound CC(=C)C(N)=O FQPSGWSUVKBHSU-UHFFFAOYSA-N 0.000 description 1
- YYJWBYNQJLBIGS-UHFFFAOYSA-N methyl 2-methylbut-2-enoate Chemical compound COC(=O)C(C)=CC YYJWBYNQJLBIGS-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- QNILTEGFHQSKFF-UHFFFAOYSA-N n-propan-2-ylprop-2-enamide Chemical compound CC(C)NC(=O)C=C QNILTEGFHQSKFF-UHFFFAOYSA-N 0.000 description 1
- 238000012856 packing Methods 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 150000003141 primary amines Chemical class 0.000 description 1
- ISYORFGKSZLPNW-UHFFFAOYSA-N propan-2-ylazanium;chloride Chemical compound [Cl-].CC(C)[NH3+] ISYORFGKSZLPNW-UHFFFAOYSA-N 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical class CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 1
- AOHJOMMDDJHIJH-UHFFFAOYSA-N propylenediamine Chemical compound CC(N)CN AOHJOMMDDJHIJH-UHFFFAOYSA-N 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229940043230 sarcosine Drugs 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C231/00—Preparation of carboxylic acid amides
- C07C231/02—Preparation of carboxylic acid amides from carboxylic acids or from esters, anhydrides, or halides thereof by reaction with ammonia or amines
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2809102A DE2809102C2 (de) | 1978-03-03 | 1978-03-03 | Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden |
| IT67146/79A IT1119254B (it) | 1978-03-03 | 1979-01-23 | Procedimento per la preparazione delle ammidi di acidi carbossilici insaturi |
| FR7903882A FR2418788A1 (fr) | 1978-03-03 | 1979-02-15 | Procede de preparation d'amides alpha, beta-insatures |
| US06/014,361 US4228102A (en) | 1978-03-03 | 1979-02-23 | Preparation of carboxylic acid amides |
| GB7907189A GB2017683B (en) | 1978-03-03 | 1979-03-01 | Preparation of a,b-unsaturated carboxylic acid amides |
| JP2261079A JPS554360A (en) | 1978-03-03 | 1979-03-01 | Manufacture of alpha*betaaunsaturated carboxylic acid amide |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2809102A DE2809102C2 (de) | 1978-03-03 | 1978-03-03 | Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2809102A1 DE2809102A1 (de) | 1979-09-13 |
| DE2809102C2 true DE2809102C2 (de) | 1986-12-04 |
Family
ID=6033411
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2809102A Expired DE2809102C2 (de) | 1978-03-03 | 1978-03-03 | Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4228102A (esLanguage) |
| JP (1) | JPS554360A (esLanguage) |
| DE (1) | DE2809102C2 (esLanguage) |
| FR (1) | FR2418788A1 (esLanguage) |
| GB (1) | GB2017683B (esLanguage) |
| IT (1) | IT1119254B (esLanguage) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4287363A (en) * | 1980-09-02 | 1981-09-01 | Texaco Inc. | Preparation of N-(alkylaminoalkyl)acrylamides |
| DE3123970A1 (de) * | 1981-06-19 | 1983-01-05 | Röhm GmbH, 6100 Darmstadt | "verfahren zur herstellung von methacrylamiden" |
| US4393237A (en) * | 1981-07-02 | 1983-07-12 | Texaco Inc. | Polyoxyalkylenepolyacrylamides |
| US4536600A (en) * | 1981-07-02 | 1985-08-20 | Texaco Inc. | Polyoxyalkylenepolyacrylamides and the preparation thereof |
| DE3130508A1 (de) * | 1981-08-01 | 1983-02-17 | Röhm GmbH, 6100 Darmstadt | "verfahren zur herstellung von methacryl- und acrylamiden" |
| DE3209800C2 (de) * | 1982-03-18 | 1990-03-08 | Chemische Fabrik Stockhausen GmbH, 4150 Krefeld | Verfahren zur Herstellung von N-(tert. Aminoalkyl)acrylamiden |
| US4492801A (en) * | 1983-02-28 | 1985-01-08 | Texaco Inc. | Production of N-substituted (meth)acrylamides from (meth)acrylates and amines over a metal alkoxide catalyst |
| JPS6023357A (ja) * | 1983-07-19 | 1985-02-05 | Mitsui Toatsu Chem Inc | 2−メチル−4′−イソプロピル−2−ペンテノイルアニリドおよび選択性殺草剤 |
| US4675441A (en) * | 1983-09-23 | 1987-06-23 | Texaco Inc. | Preparation of N-substituted acrylamides |
| US4613673A (en) * | 1983-09-23 | 1986-09-23 | Texaco Inc. | Catalysts preparation thereof and preparation of N-substituted acrylamides therewith |
| DE3402599C2 (de) * | 1984-01-26 | 1986-02-27 | Chemische Fabrik Stockhausen GmbH, 4150 Krefeld | Verfahren zur Herstellung von N-substituierten α,ß-ungesättigten Carbonsäureamiden |
| KR0151106B1 (ko) * | 1988-02-25 | 1999-05-15 | 리챠드 지. 워터만 | N-(하이드록시알킬)-2-불포화 아미드 및 2-알케닐 옥사졸린의 제조방법 |
| US4791230A (en) * | 1988-03-30 | 1988-12-13 | Texaco Chemical Company | Hydroxy-terminated amides |
| DE4027843A1 (de) * | 1990-09-03 | 1992-03-05 | Roehm Gmbh | Kontinuierliches verfahren zur herstellung von n-substituierten acryl- und methacrylamiden |
| US20050121480A1 (en) * | 2003-09-15 | 2005-06-09 | Erik Cooley | Systems and methods for providing a self-arresting device |
| US8445723B2 (en) * | 2008-08-19 | 2013-05-21 | Nalco Company | Processes for producing N-alkyl (alkyl)acrylamides |
| WO2022249994A1 (ja) * | 2021-05-28 | 2022-12-01 | 富士フイルム株式会社 | N-(ヘテロ)アリール(メタ)アクリルアミド化合物の製造方法 |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE752481C (de) | 1939-09-01 | 1952-11-10 | Ig Farbenindustrie Ag | Verfahren zur Herstellung von Acrylsaeureamiden |
| US2451436A (en) * | 1947-01-03 | 1948-10-12 | American Cyanamid Co | Method of preparing n-alkyl acrylamides |
| US2683741A (en) * | 1947-06-17 | 1954-07-13 | Allied Chem & Dye Corp | Production of nu-alkylacrylamides |
| US2529838A (en) * | 1948-09-23 | 1950-11-14 | American Cyanamid Co | Preparation of n, n-dialkylacrylamides |
| US2719175A (en) * | 1952-11-01 | 1955-09-27 | Eastman Kodak Co | Vapor phase preparation of n-substituted acrylamides |
| DE1146489B (de) * | 1955-08-25 | 1963-04-04 | American Cyanamid Co | Verfahren zur Gewinnung von eisenfreiem Acrylsaeureamid aus einer waessrigen eisenhaltigen Acrylsaeureamid-loesung |
| US3878247A (en) * | 1974-01-25 | 1975-04-15 | Jefferson Chem Co Inc | Preparation of n-(tertiaryaminoalkyl) acrylamides |
| US3945970A (en) * | 1974-06-28 | 1976-03-23 | The Goodyear Tire & Rubber Company | Preparation of methacrylamides |
| US4031138A (en) * | 1976-03-18 | 1977-06-21 | Texaco Development Corporation | Stable substituted acrylamides or methacrylamides |
-
1978
- 1978-03-03 DE DE2809102A patent/DE2809102C2/de not_active Expired
-
1979
- 1979-01-23 IT IT67146/79A patent/IT1119254B/it active
- 1979-02-15 FR FR7903882A patent/FR2418788A1/fr active Granted
- 1979-02-23 US US06/014,361 patent/US4228102A/en not_active Expired - Lifetime
- 1979-03-01 JP JP2261079A patent/JPS554360A/ja active Granted
- 1979-03-01 GB GB7907189A patent/GB2017683B/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2418788B1 (esLanguage) | 1983-01-28 |
| GB2017683B (en) | 1982-10-27 |
| JPS554360A (en) | 1980-01-12 |
| IT1119254B (it) | 1986-03-10 |
| FR2418788A1 (fr) | 1979-09-28 |
| JPS6236028B2 (esLanguage) | 1987-08-05 |
| IT7967146A0 (it) | 1979-01-23 |
| GB2017683A (en) | 1979-10-10 |
| US4228102A (en) | 1980-10-14 |
| DE2809102A1 (de) | 1979-09-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2809102C2 (de) | Verfahren zur Herstellung von α,β-ungesättigen Carbonsäureamiden | |
| DE19823925C2 (de) | Verfahren zur Herstellung von beta-Hydroxyalkylamiden | |
| JP2009529025A (ja) | 分枝カルボン酸ジエステル | |
| EP0512211A2 (de) | Verfahren zur Herstellung von substituierten Malonesteraniliden und Malonsäure-monoaniliden | |
| EP0143303A2 (de) | Verfahren zur Herstellung von substituierten Bernsteinsäureamiden | |
| EP3655413A1 (de) | Herstellung von glufosinat durch umsetzung von 3-[n-butoxy(methyl)phosphoryl]-1 -cyanopropylacetat zu einer mischung aus n-butyl(3-amino-3-cyanopropyl)-methylphosphinat und (3-amino-3-cyanopropyl)-methylphosphinsäure ammoniumsalz | |
| DE3130508C2 (esLanguage) | ||
| DE69604642T2 (de) | Verfahren zur herstellung von iodierten kontrastmitteln | |
| DE3412650A1 (de) | Verfahren zur herstellung von hydroxyalkyl-acrylamiden und -methacrylamiden | |
| EP0598338A1 (de) | Verfahren zur Herstellung von 1,3-Difluorbenzol | |
| DE69910867T2 (de) | Verbessertes Verfahren zur Herstellung von Chloroalkylen und Alkynylaminen | |
| DE69710405T2 (de) | Verfahren zur Herstellung von primären Amid-Derivaten | |
| DE69104043T2 (de) | Zwischenprodukt für die herstellung von deferoxamine. | |
| WO2005049570A1 (de) | Verfahren zur synthese optisch aktiver piperidine durch hydrierung optisch aktiver pyridine | |
| EP0484650B1 (de) | Verfahren zur Herstellung substituierter Monoamide von Dicarbonsäuremonoalkylestern | |
| DE69025190T2 (de) | Aminoacetalderivate | |
| DE60100523T2 (de) | Verfahren zur Herstellung von N-carboxy-t-leucin Anhydrid | |
| DE2524389C2 (de) | Verfahren zur Herstellung von Malonsäuredialkylestern | |
| DE2836520C2 (de) | Verfahren zur Herstellung von alpha , beta -ungesättigten, N-substituierten Carbonsäureamiden | |
| EP0606058A2 (de) | Halogenierte Zimtsäuren und deren Ester, sowie Verfahren zu ihrer Herstellung und halogenierte Aryldiazoniumsalze | |
| DE69100775T2 (de) | Verfahren zur Herstellung von Benzylmethacrylat und seine am aromatischen Ring substituierten Halogen- und Alkylderivate. | |
| EP2310365A1 (de) | Verfahren zur herstellung von n-phenyl-n-(4-piperidinyl) amidsalzen | |
| AT360499B (de) | Verfahren zur herstellung von estern von mono- - oder dicarbonsaeuren und ammonsulfat | |
| DE1140583B (de) | Verfahren zur Herstellung von o-[Bis-(2-chloraethyl)-amino]-phenyl-alanin | |
| AT231423B (de) | Verfahren zur Herstellung von Methacrylsäure und deren Estern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8366 | Restricted maintained after opposition proceedings | ||
| 8305 | Restricted maintenance of patent after opposition | ||
| D4 | Patent maintained restricted | ||
| 8339 | Ceased/non-payment of the annual fee |