DE2738714A1 - Verfahren zur steuerung von diamin- katalysierter polyphenylenaether-polymerisation - Google Patents
Verfahren zur steuerung von diamin- katalysierter polyphenylenaether-polymerisationInfo
- Publication number
- DE2738714A1 DE2738714A1 DE19772738714 DE2738714A DE2738714A1 DE 2738714 A1 DE2738714 A1 DE 2738714A1 DE 19772738714 DE19772738714 DE 19772738714 DE 2738714 A DE2738714 A DE 2738714A DE 2738714 A1 DE2738714 A1 DE 2738714A1
- Authority
- DE
- Germany
- Prior art keywords
- carbon atoms
- polymerization
- water
- copper
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims description 35
- 238000006116 polymerization reaction Methods 0.000 title claims description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 87
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 41
- 239000000203 mixture Substances 0.000 claims description 27
- 125000004432 carbon atom Chemical group C* 0.000 claims description 26
- 239000003054 catalyst Substances 0.000 claims description 21
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 16
- -1 polyphenylene Polymers 0.000 claims description 12
- 229920001955 polyphenylene ether Polymers 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 10
- 229910052760 oxygen Inorganic materials 0.000 claims description 10
- 239000001301 oxygen Substances 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 8
- 229910052794 bromium Inorganic materials 0.000 claims description 8
- 150000004985 diamines Chemical class 0.000 claims description 8
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 8
- 239000005749 Copper compound Substances 0.000 claims description 7
- 150000001880 copper compounds Chemical class 0.000 claims description 7
- 239000011347 resin Substances 0.000 claims description 7
- 229920005989 resin Polymers 0.000 claims description 7
- 239000002904 solvent Substances 0.000 claims description 7
- 150000003512 tertiary amines Chemical class 0.000 claims description 7
- DJEQZVQFEPKLOY-UHFFFAOYSA-N N,N-dimethylbutylamine Chemical group CCCCN(C)C DJEQZVQFEPKLOY-UHFFFAOYSA-N 0.000 claims description 6
- 229910052799 carbon Inorganic materials 0.000 claims description 6
- 150000001875 compounds Chemical class 0.000 claims description 6
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical group CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 claims description 6
- 150000002989 phenols Chemical class 0.000 claims description 6
- 239000004215 Carbon black (E152) Substances 0.000 claims description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 5
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- 239000007789 gas Substances 0.000 claims description 4
- GZFGOTFRPZRKDS-UHFFFAOYSA-N 4-bromophenol Chemical class OC1=CC=C(Br)C=C1 GZFGOTFRPZRKDS-UHFFFAOYSA-N 0.000 claims description 3
- 229910001513 alkali metal bromide Inorganic materials 0.000 claims description 3
- 229910001616 alkaline earth metal bromide Inorganic materials 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 3
- 238000005691 oxidative coupling reaction Methods 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229920000265 Polyparaphenylene Polymers 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims description 2
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 2
- 125000002993 cycloalkylene group Chemical group 0.000 claims description 2
- 150000002430 hydrocarbons Chemical class 0.000 claims description 2
- 150000003739 xylenols Chemical class 0.000 claims description 2
- 150000001721 carbon Chemical group 0.000 claims 3
- 125000005843 halogen group Chemical group 0.000 claims 1
- 125000005270 trialkylamine group Chemical group 0.000 claims 1
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 28
- 229920000642 polymer Polymers 0.000 description 17
- 238000006243 chemical reaction Methods 0.000 description 16
- 239000000243 solution Substances 0.000 description 15
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 6
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- 230000015572 biosynthetic process Effects 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- QTMDXZNDVAMKGV-UHFFFAOYSA-L copper(ii) bromide Chemical compound [Cu+2].[Br-].[Br-] QTMDXZNDVAMKGV-UHFFFAOYSA-L 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 3
- 125000004429 atom Chemical group 0.000 description 3
- 229960004643 cupric oxide Drugs 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 239000012071 phase Substances 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 229910021590 Copper(II) bromide Inorganic materials 0.000 description 2
- JPVYNHNXODAKFH-UHFFFAOYSA-N Cu2+ Chemical compound [Cu+2] JPVYNHNXODAKFH-UHFFFAOYSA-N 0.000 description 2
- 150000003863 ammonium salts Chemical class 0.000 description 2
- 150000001450 anions Chemical group 0.000 description 2
- 150000001649 bromium compounds Chemical class 0.000 description 2
- 239000007810 chemical reaction solvent Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 229910000009 copper(II) carbonate Inorganic materials 0.000 description 2
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 2
- NKNDPYCGAZPOFS-UHFFFAOYSA-M copper(i) bromide Chemical compound Br[Cu] NKNDPYCGAZPOFS-UHFFFAOYSA-M 0.000 description 2
- OPQARKPSCNTWTJ-UHFFFAOYSA-L copper(ii) acetate Chemical compound [Cu+2].CC([O-])=O.CC([O-])=O OPQARKPSCNTWTJ-UHFFFAOYSA-L 0.000 description 2
- GEZOTWYUIKXWOA-UHFFFAOYSA-L copper;carbonate Chemical compound [Cu+2].[O-]C([O-])=O GEZOTWYUIKXWOA-UHFFFAOYSA-L 0.000 description 2
- 235000019854 cupric carbonate Nutrition 0.000 description 2
- 239000011646 cupric carbonate Substances 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- XKBGEWXEAPTVCK-UHFFFAOYSA-M methyltrioctylammonium chloride Chemical compound [Cl-].CCCCCCCC[N+](C)(CCCCCCCC)CCCCCCCC XKBGEWXEAPTVCK-UHFFFAOYSA-M 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000006053 organic reaction Methods 0.000 description 2
- LPNBBFKOUUSUDB-UHFFFAOYSA-N p-toluic acid Chemical compound CC1=CC=C(C(O)=O)C=C1 LPNBBFKOUUSUDB-UHFFFAOYSA-N 0.000 description 2
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- IOLCXVTUBQKXJR-UHFFFAOYSA-M potassium bromide Chemical compound [K+].[Br-] IOLCXVTUBQKXJR-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- WRDBAMRVJWQPMU-UHFFFAOYSA-N BrC1=CC(C(C=C1)(C)O)C Chemical compound BrC1=CC(C(C=C1)(C)O)C WRDBAMRVJWQPMU-UHFFFAOYSA-N 0.000 description 1
- JHPYSMMFWIRBGX-UHFFFAOYSA-L BrC1=CC(C(C=C1)(C)O)C.[Cu](Br)Br Chemical compound BrC1=CC(C(C=C1)(C)O)C.[Cu](Br)Br JHPYSMMFWIRBGX-UHFFFAOYSA-L 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- 229910021589 Copper(I) bromide Inorganic materials 0.000 description 1
- 229910021592 Copper(II) chloride Inorganic materials 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000003973 alkyl amines Chemical class 0.000 description 1
- 239000012296 anti-solvent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- ODWXUNBKCRECNW-UHFFFAOYSA-M bromocopper(1+) Chemical compound Br[Cu+] ODWXUNBKCRECNW-UHFFFAOYSA-M 0.000 description 1
- HMRDQEMTHMWRIK-UHFFFAOYSA-M butanoate;copper(1+) Chemical compound [Cu+].CCCC([O-])=O HMRDQEMTHMWRIK-UHFFFAOYSA-M 0.000 description 1
- 210000001217 buttock Anatomy 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000013522 chelant Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- RFKZUAOAYVHBOY-UHFFFAOYSA-M copper(1+);acetate Chemical compound [Cu+].CC([O-])=O RFKZUAOAYVHBOY-UHFFFAOYSA-M 0.000 description 1
- BERDEBHAJNAUOM-UHFFFAOYSA-N copper(I) oxide Inorganic materials [Cu]O[Cu] BERDEBHAJNAUOM-UHFFFAOYSA-N 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 1
- KRFJLUBVMFXRPN-UHFFFAOYSA-N cuprous oxide Chemical compound [O-2].[Cu+].[Cu+] KRFJLUBVMFXRPN-UHFFFAOYSA-N 0.000 description 1
- 229940112669 cuprous oxide Drugs 0.000 description 1
- MIHINWMALJZIBX-UHFFFAOYSA-N cyclohexa-2,4-dien-1-ol Chemical compound OC1CC=CC=C1 MIHINWMALJZIBX-UHFFFAOYSA-N 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- GBMDVOWEEQVZKZ-UHFFFAOYSA-N methanol;hydrate Chemical compound O.OC GBMDVOWEEQVZKZ-UHFFFAOYSA-N 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical class C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- AGGKEGLBGGJEBZ-UHFFFAOYSA-N tetramethylenedisulfotetramine Chemical compound C1N(S2(=O)=O)CN3S(=O)(=O)N1CN2C3 AGGKEGLBGGJEBZ-UHFFFAOYSA-N 0.000 description 1
- 229930195735 unsaturated hydrocarbon Natural products 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/718,836 US4059568A (en) | 1976-08-30 | 1976-08-30 | Method for the control of diamine catalyzed polyphenylene ether polymerization |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2738714A1 true DE2738714A1 (de) | 1978-03-02 |
Family
ID=24887752
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772738714 Withdrawn DE2738714A1 (de) | 1976-08-30 | 1977-08-27 | Verfahren zur steuerung von diamin- katalysierter polyphenylenaether-polymerisation |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4059568A (enExample) |
| JP (1) | JPS5329400A (enExample) |
| AU (1) | AU2820277A (enExample) |
| BR (1) | BR7705736A (enExample) |
| CA (1) | CA1106539A (enExample) |
| DE (1) | DE2738714A1 (enExample) |
| FR (1) | FR2362882A1 (enExample) |
| GB (1) | GB1538362A (enExample) |
| NL (1) | NL7709387A (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0061691A1 (de) * | 1981-04-01 | 1982-10-06 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Polyphenylenethern |
| EP0122394A3 (en) * | 1983-04-16 | 1985-01-16 | Chemische Werke Huls Ag | Process for the preparation of polyphenylene oxides |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4263426A (en) * | 1978-11-06 | 1981-04-21 | General Electric Company | Process for isolation of polyphenylene ether resin by crumbing in hot water |
| US4477650A (en) * | 1983-03-25 | 1984-10-16 | General Electric Company | Process for polyphenylene oxide preparation including catalyst pre-mixing |
| US4587327A (en) * | 1984-09-20 | 1986-05-06 | General Electric Company | Method for preparing polyphenylene oxide with copper (I) complex catalysts |
| US4598140A (en) * | 1984-09-20 | 1986-07-01 | General Electric Company | Copper (I)-phenoxides useful in polyphenylene oxide preparation |
| DE3529093A1 (de) * | 1985-08-14 | 1987-02-19 | Bayer Ag | Verfahren zur herstellung von mono- und bifunktionellen oligophenylenoxiden |
| US5621066A (en) * | 1994-08-10 | 1997-04-15 | General Electric Company | Environmentally friendly method for poly(phenylene ether) polymerization and catalyst recycle |
| JP3504587B2 (ja) * | 2000-06-19 | 2004-03-08 | 旭化成ケミカルズ株式会社 | ポリフェニレンエーテルの製造法 |
| US6472499B1 (en) | 2000-08-04 | 2002-10-29 | General Electric Company | Preparation of high intrinsic viscosity poly(arylene ether) resins |
| US7413791B2 (en) * | 2003-01-28 | 2008-08-19 | Matsushita Electric Works, Ltd. | Poly (phenylene ether) resin composition, prepreg, and laminated sheet |
| WO2020196718A1 (ja) | 2019-03-28 | 2020-10-01 | 四国化成工業株式会社 | 樹脂組成物及びその用途 |
| JP7397226B1 (ja) | 2023-02-07 | 2023-12-12 | 四国化成工業株式会社 | 難燃剤及びその用途 |
| JP7397227B1 (ja) | 2023-02-07 | 2023-12-12 | 四国化成工業株式会社 | リン化合物、その合成方法およびその利用 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH464537A (de) * | 1965-12-15 | 1968-10-31 | Alusuisse | Verfahren zur Herstellung von gegebenenfalls substituierten Polyphenylenäthern |
| DE2061116B2 (de) * | 1969-12-16 | 1973-02-01 | Sumitomo Chemical Co Ltd , Osaka (Japan) | Verfahren zur herstellung von polyphenylenoxiden |
| US3733299A (en) * | 1971-06-10 | 1973-05-15 | Gen Electric | Process for the preparation of polyphenylene ethers with activated copper-amine catalysts |
| US3900445A (en) * | 1973-12-26 | 1975-08-19 | Gen Electric | Process for the preparation of polyphenylene ethers with cuprous and cupric amine catalyst |
| US3914266A (en) * | 1974-02-11 | 1975-10-21 | Gen Electric | Copper complex |
| GB1497293A (en) * | 1974-02-11 | 1978-01-05 | Gen Electric | Preparation of polymer using copper catalysts |
| US3988297A (en) * | 1974-07-03 | 1976-10-26 | General Electric | Process for the preparation of polyphenylene ethers with activated copper-amine catalysts |
-
1976
- 1976-08-30 US US05/718,836 patent/US4059568A/en not_active Expired - Lifetime
-
1977
- 1977-08-19 CA CA285,133A patent/CA1106539A/en not_active Expired
- 1977-08-22 GB GB35088/77A patent/GB1538362A/en not_active Expired
- 1977-08-25 AU AU28202/77A patent/AU2820277A/en active Pending
- 1977-08-25 NL NL7709387A patent/NL7709387A/xx not_active Application Discontinuation
- 1977-08-26 BR BR7705736A patent/BR7705736A/pt unknown
- 1977-08-27 DE DE19772738714 patent/DE2738714A1/de not_active Withdrawn
- 1977-08-29 JP JP10412777A patent/JPS5329400A/ja active Pending
- 1977-08-30 FR FR7726326A patent/FR2362882A1/fr active Granted
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0061691A1 (de) * | 1981-04-01 | 1982-10-06 | BASF Aktiengesellschaft | Verfahren zur Herstellung von Polyphenylenethern |
| EP0122394A3 (en) * | 1983-04-16 | 1985-01-16 | Chemische Werke Huls Ag | Process for the preparation of polyphenylene oxides |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1538362A (en) | 1979-01-17 |
| JPS5329400A (en) | 1978-03-18 |
| AU2820277A (en) | 1979-03-08 |
| FR2362882A1 (fr) | 1978-03-24 |
| FR2362882B1 (enExample) | 1981-01-02 |
| NL7709387A (nl) | 1978-03-02 |
| BR7705736A (pt) | 1978-06-27 |
| US4059568A (en) | 1977-11-22 |
| CA1106539A (en) | 1981-08-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2228071C2 (de) | Verfahren zur Herstellung von Polyphenylenäthern mit aktivierten Kupfer-Amin-Katalysatoren | |
| DE2822857C2 (de) | Mit Acylresten endblockierte, chinongekuppelte Polyphenylenoxide | |
| DE2430130C3 (de) | Verfahren zur Herstellung von PoIyphenylenäthern | |
| DE69930669T2 (de) | Verfahren zur herstellung von niedermolekularem polyphenylenether harzen durch redistribution | |
| DE2738714A1 (de) | Verfahren zur steuerung von diamin- katalysierter polyphenylenaether-polymerisation | |
| DE2527759C2 (de) | Verfahren zum Herstellen der Selbstkondensationsprodukte eines Phenols unter Verwendung eines Mangan-(II)ω-Hydroxyoxim-Chelatkomplexes als Katalysator | |
| EP0099965B1 (de) | Verfahren zur Herstellung von hochmolekularen Polyphenylenoxiden | |
| DE2530827C2 (de) | Verfahren zur Herstellung von Polyphenylenäthern mit aktivierten Kupfer-Aminkatalysatoren | |
| DE2505328C2 (de) | Verfahren zum Herstellen von Polyphenylenoxyden | |
| DE2651074C2 (de) | Verfahren zur Herstellung hochmolekularer Polyphenylenäther | |
| DE2655161C2 (de) | Verfahren zur Herstellung von Polyphenylenoxiden | |
| EP0184149A2 (de) | Poly(phenylenether) und Verfahren zu ihrer Herstellung | |
| DE3044803C2 (enExample) | ||
| DE1645068C3 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| DE2702185A1 (de) | Verfahren zur extraktion des kupferkatalysators aus polyphenylenoxidloesungen | |
| EP0131915A1 (de) | Verfahren zur Entfernung des Katalysators aus Polyphenylenethern | |
| DE2505329C2 (de) | Verfahren zum Verkappen von Polyphenylenoxiden | |
| EP0071081A1 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| DE2011710C3 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| EP0510391B1 (de) | Verfahren zur Herstellung von Polyphenylenethern | |
| DE2725124A1 (de) | Vernetzte sulfonierte styrolhomo- oder -mischpolymerisate und verfahren zu ihrer herstellung | |
| DE1745432A1 (de) | Verfahren zur Herstellung von makromolekularen Polyphenylenoxiden | |
| EP0460419B1 (de) | Verfahren zur Herstellung von Polyphenylenethern | |
| DE3314711C2 (enExample) | ||
| DE3140026A1 (de) | Verfahren zur herstellung katalysatorfreier polyphenylenether |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |