DE2712165C2 - Verfahren zur Herstellung aromatischer Bisimide - Google Patents
Verfahren zur Herstellung aromatischer BisimideInfo
- Publication number
- DE2712165C2 DE2712165C2 DE2712165A DE2712165A DE2712165C2 DE 2712165 C2 DE2712165 C2 DE 2712165C2 DE 2712165 A DE2712165 A DE 2712165A DE 2712165 A DE2712165 A DE 2712165A DE 2712165 C2 DE2712165 C2 DE 2712165C2
- Authority
- DE
- Germany
- Prior art keywords
- reaction
- alkali metal
- general formula
- metal hydroxide
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 22
- 125000003118 aryl group Chemical group 0.000 title claims description 20
- 230000008569 process Effects 0.000 title description 9
- 238000002360 preparation method Methods 0.000 title description 4
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 53
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 51
- 238000006243 chemical reaction Methods 0.000 claims description 40
- 239000000203 mixture Substances 0.000 claims description 30
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 23
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 19
- 239000002904 solvent Substances 0.000 claims description 16
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 claims description 15
- 150000001875 compounds Chemical class 0.000 claims description 11
- 239000007787 solid Substances 0.000 claims description 10
- 239000006184 cosolvent Substances 0.000 claims description 9
- -1 des Alkali metal hydroxide Chemical class 0.000 claims description 9
- 229940106691 bisphenol a Drugs 0.000 claims description 3
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 239000008096 xylene Substances 0.000 claims description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 15
- 239000000010 aprotic solvent Substances 0.000 description 11
- 239000008188 pellet Substances 0.000 description 11
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 10
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 229940078552 o-xylene Drugs 0.000 description 8
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 238000010992 reflux Methods 0.000 description 7
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- 238000004458 analytical method Methods 0.000 description 6
- 241001233037 catfish Species 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 5
- 239000012299 nitrogen atmosphere Substances 0.000 description 5
- 238000006462 rearrangement reaction Methods 0.000 description 5
- 230000008901 benefit Effects 0.000 description 4
- 125000006159 dianhydride group Chemical group 0.000 description 4
- 239000002808 molecular sieve Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 4
- JBCHWGTZAAZJKG-UHFFFAOYSA-N 2-methyl-5-nitroisoindole-1,3-dione Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(C)C(=O)C2=C1 JBCHWGTZAAZJKG-UHFFFAOYSA-N 0.000 description 3
- BONIIQYTWOPUQI-UHFFFAOYSA-N 4-nitroisoindole-1,3-dione Chemical compound [O-][N+](=O)C1=CC=CC2=C1C(=O)NC2=O BONIIQYTWOPUQI-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- GTDPSWPPOUPBNX-UHFFFAOYSA-N ac1mqpva Chemical compound CC12C(=O)OC(=O)C1(C)C1(C)C2(C)C(=O)OC1=O GTDPSWPPOUPBNX-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N acetic acid anhydride Natural products CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 150000001491 aromatic compounds Chemical class 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 239000000470 constituent Substances 0.000 description 3
- 150000004985 diamines Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical class C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- GMOAOEGBMSRFFQ-UHFFFAOYSA-N 3-nitrobenzene-1,2-dicarboxamide Chemical compound NC(=O)C1=CC=CC([N+]([O-])=O)=C1C(N)=O GMOAOEGBMSRFFQ-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- URLKBWYHVLBVBO-UHFFFAOYSA-N Para-Xylene Chemical group CC1=CC=C(C)C=C1 URLKBWYHVLBVBO-UHFFFAOYSA-N 0.000 description 2
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- DMEGYFMYUHOHGS-UHFFFAOYSA-N cycloheptane Chemical compound C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000012456 homogeneous solution Substances 0.000 description 2
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical compound CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 2
- 150000002989 phenols Chemical class 0.000 description 2
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- MQXNNWDXHFBFEB-UHFFFAOYSA-N 2,2-bis(2-hydroxyphenyl)propane Chemical compound C=1C=CC=C(O)C=1C(C)(C)C1=CC=CC=C1O MQXNNWDXHFBFEB-UHFFFAOYSA-N 0.000 description 1
- ZXDDPOHVAMWLBH-UHFFFAOYSA-N 2,4-Dihydroxybenzophenone Chemical compound OC1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 ZXDDPOHVAMWLBH-UHFFFAOYSA-N 0.000 description 1
- MFGOFGRYDNHJTA-UHFFFAOYSA-N 2-amino-1-(2-fluorophenyl)ethanol Chemical compound NCC(O)C1=CC=CC=C1F MFGOFGRYDNHJTA-UHFFFAOYSA-N 0.000 description 1
- FFBUYJAHSNPQDH-UHFFFAOYSA-N 2-ethyl-5-nitroisoindole-1,3-dione Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)N(CC)C(=O)C2=C1 FFBUYJAHSNPQDH-UHFFFAOYSA-N 0.000 description 1
- FWIZOFDVGZCRTB-UHFFFAOYSA-N 2-methyl-4-nitroisoindole-1,3-dione Chemical compound C1=CC([N+]([O-])=O)=C2C(=O)N(C)C(=O)C2=C1 FWIZOFDVGZCRTB-UHFFFAOYSA-N 0.000 description 1
- WCUDAIJOADOKAW-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)pentan-2-yl]phenol Chemical compound C=1C=C(O)C=CC=1C(C)(CCC)C1=CC=C(O)C=C1 WCUDAIJOADOKAW-UHFFFAOYSA-N 0.000 description 1
- HNNCFMUZZXJQLR-UHFFFAOYSA-N 5-nitro-2-phenylisoindole-1,3-dione Chemical compound O=C1C2=CC([N+](=O)[O-])=CC=C2C(=O)N1C1=CC=CC=C1 HNNCFMUZZXJQLR-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MQJKPEGWNLWLTK-UHFFFAOYSA-N Dapsone Chemical compound C1=CC(N)=CC=C1S(=O)(=O)C1=CC=C(N)C=C1 MQJKPEGWNLWLTK-UHFFFAOYSA-N 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Natural products CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 102100032950 GPI mannosyltransferase 1 Human genes 0.000 description 1
- 101710100495 GPI mannosyltransferase 1 Proteins 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 244000018633 Prunus armeniaca Species 0.000 description 1
- 235000009827 Prunus armeniaca Nutrition 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 229960000583 acetic acid Drugs 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- 235000015895 biscuits Nutrition 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- HUCVOHYBFXVBRW-UHFFFAOYSA-M caesium hydroxide Inorganic materials [OH-].[Cs+] HUCVOHYBFXVBRW-UHFFFAOYSA-M 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000004020 conductor Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- AUHZEENZYGFFBQ-UHFFFAOYSA-N mesitylene Substances CC1=CC(C)=CC(C)=C1 AUHZEENZYGFFBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001827 mesitylenyl group Chemical group [H]C1=C(C(*)=C(C([H])=C1C([H])([H])[H])C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 1
- OLAPPGSPBNVTRF-UHFFFAOYSA-N naphthalene-1,4,5,8-tetracarboxylic acid Chemical compound C1=CC(C(O)=O)=C2C(C(=O)O)=CC=C(C(O)=O)C2=C1C(O)=O OLAPPGSPBNVTRF-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000003880 polar aprotic solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000012260 resinous material Substances 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 150000000000 tetracarboxylic acids Chemical class 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D209/00—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D209/02—Heterocyclic compounds containing five-membered rings, condensed with other rings, with one nitrogen atom as the only ring hetero atom condensed with one carbocyclic ring
- C07D209/44—Iso-indoles; Hydrogenated iso-indoles
- C07D209/48—Iso-indoles; Hydrogenated iso-indoles with oxygen atoms in positions 1 and 3, e.g. phthalimide
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Indole Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/670,047 US4017511A (en) | 1976-03-24 | 1976-03-24 | Preparation of aromatic bisimides |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2712165A1 DE2712165A1 (de) | 1977-09-29 |
| DE2712165C2 true DE2712165C2 (de) | 1985-01-03 |
Family
ID=24688765
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2712165A Expired DE2712165C2 (de) | 1976-03-24 | 1977-03-19 | Verfahren zur Herstellung aromatischer Bisimide |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US4017511A (OSRAM) |
| BE (1) | BE852462A (OSRAM) |
| CA (1) | CA1086745A (OSRAM) |
| DE (1) | DE2712165C2 (OSRAM) |
| FR (1) | FR2345432A1 (OSRAM) |
| GB (1) | GB1550985A (OSRAM) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0010994B1 (en) * | 1978-11-07 | 1983-04-20 | Brent Chemicals International Plc | Process for producing substituted naphthalic acid compounds |
| US4302575A (en) * | 1979-12-26 | 1981-11-24 | General Electric Company | Heat curable polyimides |
| US4293670A (en) * | 1979-12-26 | 1981-10-06 | Union Carbide Corporation | Blends of poly(aryl ether) resins and polyetherimide resins |
| US4467097A (en) * | 1982-09-29 | 1984-08-21 | General Electric Company | Method for making aromatic bis(etherimide)s |
| US4523006A (en) * | 1983-02-01 | 1985-06-11 | General Electric Company | Polyetherimides of di(phthalic anhydride) derivatives of di(substituted phenol) sulfones |
| US4578470A (en) * | 1983-06-20 | 1986-03-25 | General Electric Company | Bis-imides containing heterocyclic aromatic rings |
| US4623732A (en) | 1983-11-18 | 1986-11-18 | General Electric Company | Process for the preparation of N-alkylphthalimide and copolymer derived therefrom |
| US4757149A (en) * | 1986-12-31 | 1988-07-12 | General Electric Company | Synthesis of bis(N-substituted phthalimide)ethers |
| US5149761A (en) * | 1988-10-12 | 1992-09-22 | Bayer Aktiengesellschaft | Aromatic ether imides |
| US5208346A (en) * | 1992-03-16 | 1993-05-04 | General Electric Company | Simplified process for the preparation of aromatic bismides |
| US5359084A (en) * | 1993-02-18 | 1994-10-25 | General Electric Company | Method of preparing aromatic ether bisimides |
| US5648433A (en) * | 1994-05-31 | 1997-07-15 | Eastman Chemical Company | Ternary polyetherimide/polyester/polyester blends |
| US6252011B1 (en) | 1994-05-31 | 2001-06-26 | Eastman Chemical Company | Blends of polyetherimides with polyesters of 2,6-naphthalenedicarboxylic acid |
| EP1183311B1 (en) | 1999-04-07 | 2006-09-27 | Solvay Advanced Polymers, L.L.C. | Poly(biphenyl ether sulfone) resins having improved uv yellowing resistance |
| US20050272853A1 (en) * | 2003-08-26 | 2005-12-08 | Solvay Advanced Polymers | Aromatic polycondensation polymer compositions exhibiting enhanced strength properties |
| EP1776094A2 (en) * | 2004-08-06 | 2007-04-25 | Grain Processing Corporation | Tablet coating composition |
| EP2001955B1 (en) * | 2006-03-07 | 2010-10-06 | Solvay Advanced Polymers, L.L.C. | New polyarylene composition and articles made therefrom |
| US8362114B2 (en) * | 2007-02-28 | 2013-01-29 | Solvay Advanced Polymers, L.L.C. | Thermoplastic compositions containing microspheres |
| WO2008116939A2 (en) * | 2007-04-23 | 2008-10-02 | Solvay Advanced Polymers, L.L.C. | Thermoplastic polymer mixtures, and applications thereof |
| US8080671B2 (en) | 2008-05-23 | 2011-12-20 | Sabic Innovative Plastics Ip B.V. | Production of low color polyetherimides |
| CN102199118B (zh) * | 2011-03-16 | 2013-09-25 | 黑龙江省科学院石油化学研究院 | 一种合成氧代-双(n-甲基邻苯二甲酰亚胺)的方法 |
| EP3397635B1 (en) * | 2015-12-29 | 2021-11-03 | SHPP Global Technologies B.V. | Methods for the manufacture of an aromatic bisimide and a polyetherimide |
| CN106279085B (zh) * | 2016-08-17 | 2018-07-10 | 万华化学集团股份有限公司 | 一种混合异构双醚四甲酸二酐的制备方法 |
| WO2020099685A1 (en) | 2018-11-16 | 2020-05-22 | Rhodia Operations | Polymer composites comprising an aliphatic polyamide matrix and sized glass or basalt fibres |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3847867A (en) * | 1971-01-20 | 1974-11-12 | Gen Electric | Polyetherimides |
| US3879428A (en) * | 1973-03-30 | 1975-04-22 | Gen Electric | Method for making aromatic bis(ether anhydride)s |
| US3922284A (en) * | 1973-03-30 | 1975-11-25 | Gen Electric | N-Substituted aromatic thioetherophthalimides |
| US3933852A (en) * | 1974-05-08 | 1976-01-20 | General Electric Company | Process for making N-methyl nitrophthalimides |
| US3956322A (en) * | 1975-03-14 | 1976-05-11 | General Electric Company | Dianhydrides of bis-(orthodicarboxyphenyloxyphenyl)acetylene and bis-(ortho-dicarboxyphenyloxyphenyl)2,2-dichloroethylene |
-
1976
- 1976-03-24 US US05/670,047 patent/US4017511A/en not_active Expired - Lifetime
-
1977
- 1977-02-24 CA CA272,587A patent/CA1086745A/en not_active Expired
- 1977-03-15 BE BE175791A patent/BE852462A/xx not_active IP Right Cessation
- 1977-03-19 DE DE2712165A patent/DE2712165C2/de not_active Expired
- 1977-03-21 GB GB11790/77A patent/GB1550985A/en not_active Expired
- 1977-03-22 FR FR7708486A patent/FR2345432A1/fr active Granted
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| BE852462A (fr) | 1977-07-01 |
| FR2345432A1 (fr) | 1977-10-21 |
| US4017511A (en) | 1977-04-12 |
| CA1086745A (en) | 1980-09-30 |
| DE2712165A1 (de) | 1977-09-29 |
| GB1550985A (en) | 1979-08-22 |
| FR2345432B1 (OSRAM) | 1981-07-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2712165C2 (de) | Verfahren zur Herstellung aromatischer Bisimide | |
| DE2412466C2 (de) | Verfahren zur Herstellung von aromatischen Bis-ätheranhydriden | |
| DE2438327C2 (de) | Polyätherchinoxaline und Verfahren zu deren Herstellung | |
| DE2721255A1 (de) | Verfahren zur herstellung von terephthalsaeure, ausgehend von dikaliumterephthalat in einer einstufigen durchfuehrung | |
| DE2155431A1 (de) | Verfahren zur Herstellung von cyclischen, dianhydridabgeschlossenen Monomeren | |
| DE1518517C (OSRAM) | ||
| DE2451936A1 (de) | Verfahren zur umwandlung einer aromatischen verbindung mit wenigstens zwei hydroxylgruppen an einem benzolring in den entsprechenden monoaether | |
| DE2948635A1 (de) | Meta-, para-substituierte isopropyliden-bisphenole und verfahren zu ihrer herstellung | |
| DE2429694C2 (de) | Verfahren zur Herstellung von Bis (nitrophthalimiden) | |
| WO1991007377A1 (de) | Verfahren zur kontinuierlichen herstellung von 3,3'-dichlor-benzidin-dihidrochlorid | |
| DE1215728B (de) | Verfahren zur Herstellung von Glycidestern bzw. Glycidaethern aromatischer Hydroxy- oder Mercaptocarbonsaeuren | |
| DE3026937A1 (de) | Verfahren zur herstellung eines aromatischen oligoesters mit zwei endstaendigen hydroxylgruppen | |
| DE3141455A1 (de) | Verfahren zum isolieren von 4,4'-dihydroxydiphenylsulfon | |
| DE2032170B2 (de) | Verfahren zur Herstellung von Isobornylphenolen | |
| DE2416594C2 (de) | Verfahren zur Herstellung vn 2, 2',3,3'-Tetracarbonsäurediphenylätherdianhydrid | |
| DE2605525A1 (de) | Verfahren zum umwandeln von 1,1- diarylalkanen in die entsprechenden diarylketone | |
| DE1670490B2 (de) | N,N'-Diglycidyl-bis-hydantoinylverbindungen, Verfahren zu ihrer Herstellung ihre Verwendung | |
| DE2259239A1 (de) | Verfahren zur herstellung von 2alkoxy-5-alkylsulfonyl-benzoesaeure | |
| DE1495793B2 (de) | Verfahren zum herstellen von epoxidpolyaddukten | |
| DE965490C (de) | Verfahren zur Herstellung von aromatischen Sulfoniumverbindungen | |
| DE533129C (de) | Verfahren zur Herstellung von Chloranil und Bromanil | |
| EP0172931B1 (de) | Verfahren zur Gewinnung von 5-Ring-Dicarbonsäureanhydriden | |
| DE2210916C3 (de) | Verfahren zur Herstellung von Dibrompropyläthern hochhalogenierter Phenole | |
| DE1190672B (de) | Verfahren zur Herstellung von thermoplastischen Produkten | |
| DE875201C (de) | Verfahren zur Herstellung von substituierten Arylvinylsulfonen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |