DE2710490A1 - 7-acylamino-3-(5-sulfoalkyl-1,3,4- oxadiazol-2-ylthiomethyl)-3-cephem-4- carbonsaeuren, ihre salze, verfahren zu ihrer herstellung, zwischenprodukte und arzneimittel - Google Patents
7-acylamino-3-(5-sulfoalkyl-1,3,4- oxadiazol-2-ylthiomethyl)-3-cephem-4- carbonsaeuren, ihre salze, verfahren zu ihrer herstellung, zwischenprodukte und arzneimittelInfo
- Publication number
- DE2710490A1 DE2710490A1 DE19772710490 DE2710490A DE2710490A1 DE 2710490 A1 DE2710490 A1 DE 2710490A1 DE 19772710490 DE19772710490 DE 19772710490 DE 2710490 A DE2710490 A DE 2710490A DE 2710490 A1 DE2710490 A1 DE 2710490A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- cephem
- ylthiomethyl
- oxadiazol
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Ceased
Links
- 150000003839 salts Chemical class 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 8
- 229940126601 medicinal product Drugs 0.000 title claims description 3
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000013067 intermediate product Substances 0.000 title 1
- -1 formamido, ureido Chemical group 0.000 claims description 40
- 150000001875 compounds Chemical class 0.000 claims description 32
- 239000002253 acid Substances 0.000 claims description 31
- 150000002148 esters Chemical group 0.000 claims description 8
- 125000006239 protecting group Chemical group 0.000 claims description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 3
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- CCCVMLVDWJUMEN-JLOHTSLTSA-N (6R)-7-(3-cyanopropanethioylamino)-8-oxo-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(#N)CCC(=S)NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)CS(=O)(=O)O)C(=O)O)C1=O CCCVMLVDWJUMEN-JLOHTSLTSA-N 0.000 claims description 2
- 150000007513 acids Chemical class 0.000 claims description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 2
- ZZVUWRFHKOJYTH-UHFFFAOYSA-N diphenhydramine Chemical group C=1C=CC=CC=1C(OCCN(C)C)C1=CC=CC=C1 ZZVUWRFHKOJYTH-UHFFFAOYSA-N 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 239000000543 intermediate Substances 0.000 claims description 2
- 125000006503 p-nitrobenzyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1[N+]([O-])=O)C([H])([H])* 0.000 claims description 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 2
- 125000006000 trichloroethyl group Chemical group 0.000 claims description 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 2
- 125000001544 thienyl group Chemical group 0.000 claims 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims 2
- BOLRZETXDUTGKN-QWQCLYJRSA-N (6R)-7-[(2-amino-2-phenylacetyl)amino]-8-oxo-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound NC(C(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)CS(=O)(=O)O)C(=O)O)C1=O)C1=CC=CC=C1 BOLRZETXDUTGKN-QWQCLYJRSA-N 0.000 claims 1
- UDXMZGTZTVULCO-MKTAYPAQSA-N (6R)-7-[(2-hydroxy-2-phenylacetyl)amino]-8-oxo-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C(C(O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)CS(=O)(=O)O)C(=O)O)C1=O UDXMZGTZTVULCO-MKTAYPAQSA-N 0.000 claims 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 claims 1
- DJHXFOUIYQUICX-QHDYGNBISA-N C1C(=C(N2[C@H](S1)C(C2=O)NC(=S)CC(F)(F)F)C(=O)O)CSC3=NN=C(O3)CS(=O)(=O)O Chemical compound C1C(=C(N2[C@H](S1)C(C2=O)NC(=S)CC(F)(F)F)C(=O)O)CSC3=NN=C(O3)CS(=O)(=O)O DJHXFOUIYQUICX-QHDYGNBISA-N 0.000 claims 1
- 230000003115 biocidal effect Effects 0.000 claims 1
- NVRSPIKUPKOSIY-UHFFFAOYSA-N chembl1743348 Chemical compound CC=1N=NOC=1O NVRSPIKUPKOSIY-UHFFFAOYSA-N 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims 1
- LVWZTYCIRDMTEY-UHFFFAOYSA-N metamizole Chemical compound O=C1C(N(CS(O)(=O)=O)C)=C(C)N(C)N1C1=CC=CC=C1 LVWZTYCIRDMTEY-UHFFFAOYSA-N 0.000 claims 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims 1
- 125000004076 pyridyl group Chemical group 0.000 claims 1
- 125000000542 sulfonic acid group Chemical group 0.000 claims 1
- 125000003831 tetrazolyl group Chemical group 0.000 claims 1
- 125000004205 trifluoroethyl group Chemical group [H]C([H])(*)C(F)(F)F 0.000 claims 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 24
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- 239000000203 mixture Substances 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 15
- 239000000243 solution Substances 0.000 description 13
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 8
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 239000011541 reaction mixture Substances 0.000 description 6
- 159000000000 sodium salts Chemical class 0.000 description 6
- NAALWYMQQGELET-UHFFFAOYSA-N (2-sulfanylidene-3h-1,3,4-oxadiazol-5-yl)methanesulfonic acid Chemical compound OS(=O)(=O)CC1=NN=C(S)O1 NAALWYMQQGELET-UHFFFAOYSA-N 0.000 description 5
- 239000007864 aqueous solution Substances 0.000 description 5
- 239000002585 base Substances 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 239000011347 resin Substances 0.000 description 5
- 229920005989 resin Polymers 0.000 description 5
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 4
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000001768 cations Chemical class 0.000 description 4
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241000588724 Escherichia coli Species 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 230000010933 acylation Effects 0.000 description 3
- 238000005917 acylation reaction Methods 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- KCIDZIIHRGYJAE-YGFYJFDDSA-L dipotassium;[(2r,3r,4s,5r,6r)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] phosphate Chemical class [K+].[K+].OC[C@H]1O[C@H](OP([O-])([O-])=O)[C@H](O)[C@@H](O)[C@H]1O KCIDZIIHRGYJAE-YGFYJFDDSA-L 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- UDXMZGTZTVULCO-MRXJRLSOSA-N (6R)-7-[[(2R)-2-hydroxy-2-phenylacetyl]amino]-8-oxo-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C([C@H](O)C1=CC=CC=C1)(=O)NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)CS(=O)(=O)O)C(=O)O)C1=O UDXMZGTZTVULCO-MRXJRLSOSA-N 0.000 description 2
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 2
- DPZNOMCNRMUKPS-UHFFFAOYSA-N 1,3-Dimethoxybenzene Chemical compound COC1=CC=CC(OC)=C1 DPZNOMCNRMUKPS-UHFFFAOYSA-N 0.000 description 2
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 2
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 2
- MZCBLVULGZHOLK-IOJJLOCKSA-N S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NN=C(CS(O)(=O)=O)O1 Chemical compound S([C@@H]1C(C(N1C=1C(O)=O)=O)N)CC=1CSC1=NN=C(CS(O)(=O)=O)O1 MZCBLVULGZHOLK-IOJJLOCKSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 2
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- WMBXLXQWCPHXCY-UHFFFAOYSA-N carbonodithioic s,s-acid;hydrazine Chemical class NN.OC(S)=S WMBXLXQWCPHXCY-UHFFFAOYSA-N 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- VEUUMBGHMNQHGO-UHFFFAOYSA-N ethyl chloroacetate Chemical compound CCOC(=O)CCl VEUUMBGHMNQHGO-UHFFFAOYSA-N 0.000 description 2
- 235000019253 formic acid Nutrition 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 239000003456 ion exchange resin Substances 0.000 description 2
- 229920003303 ion-exchange polymer Polymers 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 239000011591 potassium Substances 0.000 description 2
- 238000006467 substitution reaction Methods 0.000 description 2
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- PMCCZSDVXTUGTD-FQNRMIAFSA-N (6R)-8-oxo-7-[(2-pyridin-3-ylethanethioyl)amino]-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound N1=CC(=CC=C1)CC(=S)NC1[C@@H]2N(C(=C(CS2)CSC=2OC(=NN=2)CS(=O)(=O)O)C(=O)O)C1=O PMCCZSDVXTUGTD-FQNRMIAFSA-N 0.000 description 1
- AIXDHXNOPXTZLV-MLCNVEJWSA-N (6r)-8-oxo-3-[[5-(sulfomethyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-7-[[2-(2,2,2-trifluoroethylsulfinyl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound FC(F)(F)CS(=O)CC(=O)NC([C@H]1SC2)C(=O)N1C(C(=O)O)=C2CSC1=NN=C(CS(O)(=O)=O)O1 AIXDHXNOPXTZLV-MLCNVEJWSA-N 0.000 description 1
- FIAZTSFGZORROG-UHFFFAOYSA-N 2-(2,2,2-trifluoroethylsulfinyl)acetic acid Chemical class OC(=O)CS(=O)CC(F)(F)F FIAZTSFGZORROG-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YVPPWLBQPPBIGX-UHFFFAOYSA-N 2-ethoxy-2-oxoethanesulfonic acid Chemical compound CCOC(=O)CS(O)(=O)=O YVPPWLBQPPBIGX-UHFFFAOYSA-N 0.000 description 1
- DTUHGWFWMWDFOC-UHFFFAOYSA-N 2-iodo-3,4-dimethoxybenzaldehyde Chemical compound COC1=CC=C(C=O)C(I)=C1OC DTUHGWFWMWDFOC-UHFFFAOYSA-N 0.000 description 1
- QBVOIMMNBLNYHJ-UHFFFAOYSA-N 2-pyridin-3-ylethanethioic s-acid Chemical class OC(=S)CC1=CC=CN=C1 QBVOIMMNBLNYHJ-UHFFFAOYSA-N 0.000 description 1
- BOLRZETXDUTGKN-HTCLMOQTSA-N C1C(=C(N2[C@H](S1)C(C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)CSC4=NN=C(O4)CS(=O)(=O)O Chemical compound C1C(=C(N2[C@H](S1)C(C2=O)NC(=O)[C@@H](C3=CC=CC=C3)N)C(=O)O)CSC4=NN=C(O4)CS(=O)(=O)O BOLRZETXDUTGKN-HTCLMOQTSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229930186147 Cephalosporin Natural products 0.000 description 1
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 1
- 241000588772 Morganella morganii Species 0.000 description 1
- 241000607142 Salmonella Species 0.000 description 1
- 241000607720 Serratia Species 0.000 description 1
- 241000607768 Shigella Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 125000003668 acetyloxy group Chemical group [H]C([H])([H])C(=O)O[*] 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 244000052616 bacterial pathogen Species 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical group 0.000 description 1
- 229940124587 cephalosporin Drugs 0.000 description 1
- 150000001780 cephalosporins Chemical class 0.000 description 1
- 150000001782 cephems Chemical group 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229910000365 copper sulfate Inorganic materials 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- MLIREBYILWEBDM-UHFFFAOYSA-N cyanoacetic acid Chemical class OC(=O)CC#N MLIREBYILWEBDM-UHFFFAOYSA-N 0.000 description 1
- 239000002552 dosage form Substances 0.000 description 1
- 239000002024 ethyl acetate extract Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- 229940093915 gynecological organic acid Drugs 0.000 description 1
- JBFYUZGYRGXSFL-UHFFFAOYSA-N imidazolide Chemical compound C1=C[N-]C=N1 JBFYUZGYRGXSFL-UHFFFAOYSA-N 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 125000003392 indanyl group Chemical group C1(CCC2=CC=CC=C12)* 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 238000010647 peptide synthesis reaction Methods 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- DPLVEEXVKBWGHE-UHFFFAOYSA-N potassium sulfide Chemical compound [S-2].[K+].[K+] DPLVEEXVKBWGHE-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 238000010254 subcutaneous injection Methods 0.000 description 1
- 239000007929 subcutaneous injection Substances 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 150000003952 β-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/10—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles
- C07D271/113—1,3,4-Oxadiazoles; Hydrogenated 1,3,4-oxadiazoles with oxygen, sulfur or nitrogen atoms, directly attached to ring carbon atoms, the nitrogen atoms not forming part of a nitro radical
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Communicable Diseases (AREA)
- Pharmacology & Pharmacy (AREA)
- Oncology (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Cephalosporin Compounds (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/666,095 US4041162A (en) | 1976-03-11 | 1976-03-11 | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2710490A1 true DE2710490A1 (de) | 1977-09-22 |
Family
ID=24672798
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19772710490 Ceased DE2710490A1 (de) | 1976-03-11 | 1977-03-10 | 7-acylamino-3-(5-sulfoalkyl-1,3,4- oxadiazol-2-ylthiomethyl)-3-cephem-4- carbonsaeuren, ihre salze, verfahren zu ihrer herstellung, zwischenprodukte und arzneimittel |
Country Status (6)
| Country | Link |
|---|---|
| US (5) | US4041162A (enExample) |
| JP (1) | JPS52111590A (enExample) |
| BE (1) | BE852187A (enExample) |
| DE (1) | DE2710490A1 (enExample) |
| FR (3) | FR2343746A1 (enExample) |
| GB (3) | GB1580482A (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4083975A (en) * | 1976-09-24 | 1978-04-11 | Smithkline Corporation | 7-Acylamino-3-(3-sulfomethyl-1,2,4-triazol-5-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4079134A (en) * | 1976-09-24 | 1978-03-14 | Smithkline Corporation | 7-Acylamino-3-(5-sulfomethyl-1,3,4-thiadiazol-2-ylthiomethyl)-3-cephem-4-carboxylic acids |
| US4223134A (en) * | 1978-11-28 | 1980-09-16 | Eli Lilly And Company | Process for preparing cephalosporin antibiotics |
| WO2003050125A1 (en) * | 2001-12-11 | 2003-06-19 | Orchid Chemicals & Pharmaceuticals Limited | A new method for the preparation of ceftiofur sodium |
| TW201838974A (zh) * | 2017-04-19 | 2018-11-01 | 印度商Pi工業公司 | 具殺菌性質之雜環化合物 |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE633640A (enExample) * | 1962-06-19 | |||
| US3819623A (en) * | 1968-04-12 | 1974-06-25 | Fujisawa Pharmaceutical Co | 3,7-disubstituted cephalosporin compounds |
| BE759570A (fr) * | 1969-11-28 | 1971-05-27 | Ciba Geigy | Derives de l'acide 7-cyanacetylamino-cephalosporanique et procede pour leur preparation |
| US3867380A (en) * | 1971-02-18 | 1975-02-18 | Smithkline Corp | 3-Heterocyclic thiomethylcephalosporins |
| CH570407A5 (enExample) * | 1972-03-29 | 1975-12-15 | Ciba Geigy Ag | |
| US3865819A (en) * | 1972-05-03 | 1975-02-11 | Smithkline Corp | Substituted sulfonylacetamido cephalosporins |
| US3828037A (en) * | 1972-07-20 | 1974-08-06 | Smithkline Corp | Trifluoromethylmercaptoacetamidocephalosporins |
| US3946005A (en) * | 1972-11-14 | 1976-03-23 | Smithkline Corporation | 7-Amino-3-(1,2,4-triazolinylthiomethyl)cephalosporins |
| US3957768A (en) * | 1972-11-14 | 1976-05-18 | Smithkline Corporation | 3-heterocyclicthiomethylcephalosporins |
| US3943129A (en) * | 1972-11-14 | 1976-03-09 | Smithkline Corporation | 7-Amino-3-(1,3,4-thiadiazolinylthio-methyl) cephalosporins |
| CA1022544A (en) * | 1972-12-21 | 1977-12-13 | Yukiyasu Murakami | Process of preparing a heterocyclic acyl group-substituted cephalosporin derivative |
| GB1478055A (en) | 1973-07-27 | 1977-06-29 | Erba Carlo Spa | Cephalosporin compounds |
| US3883520A (en) * | 1973-08-17 | 1975-05-13 | Smithkline Corp | Substituted mercaptoacetamidocephalosporins |
| US3962232A (en) * | 1973-11-05 | 1976-06-08 | Eli Lilly And Company | 7-methoxycephalosporins |
| NZ176206A (en) * | 1973-12-25 | 1978-03-06 | Takeda Chemical Industries Ltd | Cephalosporins |
| JPS57873B2 (enExample) | 1973-12-25 | 1982-01-08 | ||
| GB1509074A (en) | 1974-04-05 | 1978-04-26 | Yamanouchi Pharma Co Ltd | Cephalosporin derivatives |
| IE44607B1 (en) * | 1975-03-18 | 1982-01-27 | Smithkline Corp | Cephalosporin compounds |
| US4041162A (en) * | 1976-03-11 | 1977-08-09 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
-
1976
- 1976-03-11 US US05/666,095 patent/US4041162A/en not_active Expired - Lifetime
-
1977
- 1977-03-07 BE BE175559A patent/BE852187A/xx not_active IP Right Cessation
- 1977-03-08 GB GB26610/79A patent/GB1580482A/en not_active Expired
- 1977-03-08 GB GB9724/77A patent/GB1580481A/en not_active Expired
- 1977-03-08 GB GB26757/79A patent/GB1580483A/en not_active Expired
- 1977-03-09 JP JP2658377A patent/JPS52111590A/ja active Granted
- 1977-03-10 FR FR7707181A patent/FR2343746A1/fr active Granted
- 1977-03-10 DE DE19772710490 patent/DE2710490A1/de not_active Ceased
- 1977-04-25 US US05/790,717 patent/US4138556A/en not_active Expired - Lifetime
- 1977-04-25 US US05/790,715 patent/US4130644A/en not_active Expired - Lifetime
- 1977-04-25 US US05/790,716 patent/US4067880A/en not_active Expired - Lifetime
- 1977-04-25 US US05/790,738 patent/US4112088A/en not_active Expired - Lifetime
- 1977-08-31 FR FR7726413A patent/FR2355840A1/fr active Granted
- 1977-08-31 FR FR7726412A patent/FR2355847A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2355840A1 (fr) | 1978-01-20 |
| US4138556A (en) | 1979-02-06 |
| US4041162A (en) | 1977-08-09 |
| US4112088A (en) | 1978-09-05 |
| GB1580483A (en) | 1980-12-03 |
| JPS6133825B2 (enExample) | 1986-08-04 |
| US4130644A (en) | 1978-12-19 |
| GB1580481A (en) | 1980-12-03 |
| BE852187A (fr) | 1977-09-07 |
| FR2355840B1 (enExample) | 1980-04-11 |
| FR2343746B1 (enExample) | 1980-10-10 |
| JPS52111590A (en) | 1977-09-19 |
| US4067880A (en) | 1978-01-10 |
| GB1580482A (en) | 1980-12-03 |
| FR2355847A1 (fr) | 1978-01-20 |
| FR2343746A1 (fr) | 1977-10-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH622262A5 (enExample) | ||
| DE3013966A1 (de) | 7- eckige klammer auf 2-(2-amino- 4-thiazolyl)-2- eckige klammer auf (1- carboxy-1,1-dialkyl)-alkoxyimino eckige klammer zu -acetamido eckige klammer zu -cephem-sulfoxide, verfahren zu ihrer herstellung, arzneimittel und verwendung | |
| CH651049A5 (de) | Verfahren zur herstellung von 3-alkoxymethylcephalosporansaeuren oder deren salzen. | |
| CH628902A5 (de) | Verfahren zur herstellung von 7-beta-(2-oxyimino-2-arylacetamido)-cephalosporinen. | |
| DE2655692A1 (de) | 3-(1-ureidoalkyl)-tetrazol-5-ylthiomethyl-3-cephem-4-carbonsaeure-verbindungen, verfahren zu ihrer herstellung, diese verbindungen enthaltende arzneimittel und zwischenprodukte | |
| DE2709293A1 (de) | Cephalosporine, verfahren zu ihrer herstellung und arzneimittel | |
| DE2714214A1 (de) | 7-alpha-ureidoacylamido-7alpha- methoxy- und -desmethoxycephalosporansaeure-derivate | |
| DE2312997A1 (de) | Verfahren zur herstellung von 7-(alphahydroxy-alpha-phenyl)-acetamido-3-(1-methyl1h-tetrazol-5-ylthiomethyl)-3-cephem-4carbonsaeure und derivaten davon | |
| DE2740280A1 (de) | 7-acylamino-8-oxo-3-oxa-1-azabicyclo eckige klammer auf 4.2.0 eckige klammer zu octan-2-carbonsaeure-derivate | |
| DE2558022A1 (de) | Tetrazol-5-yl-thiomethylcephalosporine | |
| DE2710490A1 (de) | 7-acylamino-3-(5-sulfoalkyl-1,3,4- oxadiazol-2-ylthiomethyl)-3-cephem-4- carbonsaeuren, ihre salze, verfahren zu ihrer herstellung, zwischenprodukte und arzneimittel | |
| DE2619458A1 (de) | 7 beta -acylamino-6 alpha h-8-oxo-4thia-1-azabicyclo eckige klammer auf 4.2.0 eckige klammer zu oct-2-en-2- carbonsaeure-derivate, verfahren zu ihrer herstellung, arzneimittel und zwischenprodukte | |
| DE2538801A1 (de) | Cephalosporinderivate und verfahren zu ihrer herstellung | |
| DE2611270C2 (de) | Cephalosporin-Derivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2521063A1 (de) | Phenylacetamidocephalosporin- derivate | |
| DE2700271A1 (de) | Thienopyridinderivate | |
| DE2639380A1 (de) | 3- eckige klammer auf 1-(2-hydroxyalkyl)-tetrazol-5-ylthiomethyl eckige klammer zu -3-cephem-4-carbonsaeuren, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneimittel | |
| DE2731261A1 (de) | 3-(alkylsulfonamidoalkyltetrazolylthiomethyl)-cephalosporin-derivate und ihre salze, verfahren zu ihrer herstellung und arzneimittel | |
| DE3433147A1 (de) | Neues verfahren zur herstellung von cephalosporinantibiotika | |
| DE2925302C2 (de) | Acylureidocephalosporinderivate und ihre Verwendung | |
| DE2552861A1 (de) | Verfahren zur herstellung von 7-methoxycephalosporinverbindungen | |
| DE3347928C2 (enExample) | ||
| DE2702552A1 (de) | 7alpha-methoxy-cephalosporine und verfahren zur herstellung derselben | |
| DE2627126A1 (de) | 7beta-acyloxycephalosporin- derivate | |
| DE2437143A1 (de) | Substituierte phenylglycylcephalosporine, ihre salze, verfahren zu ihrer herstellung und arzneimittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8131 | Rejection |