DE2655167C2 - Hochdruckentladungslampe mit Metallhalogeniden - Google Patents
Hochdruckentladungslampe mit MetallhalogenidenInfo
- Publication number
- DE2655167C2 DE2655167C2 DE2655167A DE2655167A DE2655167C2 DE 2655167 C2 DE2655167 C2 DE 2655167C2 DE 2655167 A DE2655167 A DE 2655167A DE 2655167 A DE2655167 A DE 2655167A DE 2655167 C2 DE2655167 C2 DE 2655167C2
- Authority
- DE
- Germany
- Prior art keywords
- μμοι
- lamp
- iodine
- filling
- bromine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229910001507 metal halide Inorganic materials 0.000 title claims description 5
- 150000005309 metal halides Chemical class 0.000 title claims description 5
- -1 sodium halide Chemical class 0.000 claims description 11
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 10
- 229910052740 iodine Inorganic materials 0.000 claims description 10
- 239000011630 iodine Substances 0.000 claims description 10
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 10
- 229910052708 sodium Inorganic materials 0.000 claims description 10
- 239000011734 sodium Substances 0.000 claims description 10
- 229910052718 tin Inorganic materials 0.000 claims description 10
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 8
- 150000004820 halides Chemical class 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 238000009877 rendering Methods 0.000 claims description 7
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 6
- 229910052736 halogen Inorganic materials 0.000 claims description 6
- 150000002367 halogens Chemical class 0.000 claims description 6
- 229910052744 lithium Inorganic materials 0.000 claims description 6
- 229910052756 noble gas Inorganic materials 0.000 claims description 5
- 229910052716 thallium Inorganic materials 0.000 claims description 5
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 claims description 5
- 229910052738 indium Inorganic materials 0.000 claims description 4
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 3
- 150000004694 iodide salts Chemical class 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 claims description 2
- 150000001649 bromium compounds Chemical class 0.000 claims description 2
- 229910052793 cadmium Inorganic materials 0.000 claims description 2
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 2
- 229910052733 gallium Inorganic materials 0.000 claims description 2
- 239000000463 material Substances 0.000 claims description 2
- 125000001246 bromo group Chemical group Br* 0.000 claims 2
- 239000007789 gas Substances 0.000 claims 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims 1
- 238000007792 addition Methods 0.000 claims 1
- 229910052802 copper Inorganic materials 0.000 claims 1
- 239000010949 copper Substances 0.000 claims 1
- 229910052732 germanium Inorganic materials 0.000 claims 1
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims 1
- 150000002835 noble gases Chemical class 0.000 claims 1
- 230000001105 regulatory effect Effects 0.000 abstract 1
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 6
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- 229910052801 chlorine Inorganic materials 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 230000005855 radiation Effects 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- 239000002245 particle Substances 0.000 description 3
- QPBYLOWPSRZOFX-UHFFFAOYSA-J tin(iv) iodide Chemical compound I[Sn](I)(I)I QPBYLOWPSRZOFX-UHFFFAOYSA-J 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229910001508 alkali metal halide Inorganic materials 0.000 description 2
- 150000001340 alkali metals Chemical class 0.000 description 2
- 229910001615 alkaline earth metal halide Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 230000002349 favourable effect Effects 0.000 description 2
- 235000009518 sodium iodide Nutrition 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000010678 Paulownia tomentosa Nutrition 0.000 description 1
- 240000002834 Paulownia tomentosa Species 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 1
- KURZCZMGELAPSV-UHFFFAOYSA-N [Br].[I] Chemical group [Br].[I] KURZCZMGELAPSV-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 229910003440 dysprosium oxide Inorganic materials 0.000 description 1
- NLQFUUYNQFMIJW-UHFFFAOYSA-N dysprosium(iii) oxide Chemical compound O=[Dy]O[Dy]=O NLQFUUYNQFMIJW-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000007772 electrode material Substances 0.000 description 1
- 238000005265 energy consumption Methods 0.000 description 1
- 230000005284 excitation Effects 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 229910052761 rare earth metal Inorganic materials 0.000 description 1
- 150000002910 rare earth metals Chemical class 0.000 description 1
- 230000001172 regenerating effect Effects 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 238000004904 shortening Methods 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2655167A DE2655167C2 (de) | 1976-12-06 | 1976-12-06 | Hochdruckentladungslampe mit Metallhalogeniden |
| US05/854,765 US4171498A (en) | 1976-12-06 | 1977-11-25 | High pressure electric discharge lamp containing metal halides |
| GB49568/77A GB1584417A (en) | 1976-12-06 | 1977-11-29 | High pressure electrical discharge lamp containing metal halides |
| FR7736530A FR2373157A1 (fr) | 1976-12-06 | 1977-12-05 | Lampe a decharge a haute pression contenant des halogenures metalliques |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2655167A DE2655167C2 (de) | 1976-12-06 | 1976-12-06 | Hochdruckentladungslampe mit Metallhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2655167A1 DE2655167A1 (de) | 1978-06-08 |
| DE2655167C2 true DE2655167C2 (de) | 1986-12-18 |
Family
ID=5994768
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2655167A Expired DE2655167C2 (de) | 1976-12-06 | 1976-12-06 | Hochdruckentladungslampe mit Metallhalogeniden |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4171498A (OSRAM) |
| DE (1) | DE2655167C2 (OSRAM) |
| FR (1) | FR2373157A1 (OSRAM) |
| GB (1) | GB1584417A (OSRAM) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2840771A1 (de) * | 1978-09-19 | 1980-03-27 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| DE4035561A1 (de) * | 1989-11-08 | 1991-05-16 | Matsushita Electric Works Ltd | Lampe mit hochintensitaets-entladungsroehre |
| DE10234758A1 (de) * | 2002-07-30 | 2004-02-12 | Sli Lichtsysteme Gmbh | Metall-Halogendampflampe niedriger Leistung |
| DE102006034833A1 (de) * | 2006-07-27 | 2008-01-31 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe |
Families Citing this family (35)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4360756A (en) * | 1979-11-13 | 1982-11-23 | General Electric Company | Metal halide lamp containing ThI4 with added elemental cadmium or zinc |
| US4387319A (en) * | 1981-03-30 | 1983-06-07 | General Electric Company | Metal halide lamp containing ScI3 with added cadmium or zinc |
| US4469980A (en) * | 1981-12-21 | 1984-09-04 | General Electric Company | Fluorescent lamp with non-scattering phosphor |
| JPS58112239A (ja) * | 1981-12-25 | 1983-07-04 | Toshiba Corp | 小形メタルハライドランプ |
| DD203430A1 (de) * | 1982-01-19 | 1983-10-19 | Kloss | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4557700A (en) * | 1983-06-09 | 1985-12-10 | Gte Products Corporation | Metal halide discharge lamp gas fill process to provide minimal color separation |
| US4612000A (en) * | 1983-06-09 | 1986-09-16 | Gte Products Corporation | Single-ended metal halide discharge lamps and process of manufacture |
| US4605881A (en) * | 1984-11-29 | 1986-08-12 | General Electric Company | High pressure sodium iodide arc lamp with excess iodine |
| US4801846A (en) * | 1986-12-19 | 1989-01-31 | Gte Laboratories Incorporated | Rare earth halide light source with enhanced red emission |
| HU196861B (en) * | 1987-01-23 | 1989-01-30 | Tungsram Reszvenytarsasag | Low colour-temperature high-pressure metal-halide lamp with good colour reproduction |
| NL191812C (nl) * | 1987-09-04 | 1996-08-02 | Philips Electronics Nv | Hogedrukgasontladingslamp en armatuur voorzien van die lamp. |
| US4866328A (en) * | 1988-04-15 | 1989-09-12 | North American Philips Corp. | Electric lamp with reduced internal photoelectron production |
| KR0167339B1 (ko) * | 1989-02-07 | 1999-01-15 | 스루오 스토무 | 금속 할라이드 램프 |
| US4992700A (en) * | 1989-03-10 | 1991-02-12 | General Electric Company | Reprographic metal halide lamps having high blue emission |
| US5013968A (en) * | 1989-03-10 | 1991-05-07 | General Electric Company | Reprographic metal halide lamps having long life and maintenance |
| JP2650463B2 (ja) * | 1989-05-31 | 1997-09-03 | 岩崎電気株式会社 | メタルハライドランプ |
| US5021703A (en) * | 1989-06-06 | 1991-06-04 | Gte Products Corporation | Metal halide lamp |
| US5159229A (en) * | 1989-06-06 | 1992-10-27 | Gte Products Corporation | Metal halide lamp having CO in gas fill |
| US5256940A (en) * | 1989-11-08 | 1993-10-26 | Matsushita Electric Works, Ltd. | High intensity discharge lamp device |
| DE4013039A1 (de) * | 1990-04-24 | 1991-10-31 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
| DE4132530A1 (de) * | 1991-09-30 | 1993-04-01 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe kleiner leistung |
| US5272407A (en) * | 1991-12-18 | 1993-12-21 | North American Philips Corporation | Electric lamp having screens for reducing photo electron emission |
| US5708328A (en) * | 1992-06-03 | 1998-01-13 | General Electric Company | Universal burn metal halide lamp |
| GB2284704B (en) * | 1993-12-10 | 1998-07-08 | Gen Electric | Patterned optical interference coatings for electric lamps |
| US5972442A (en) * | 1996-08-23 | 1999-10-26 | Advanced Lighting Technologies, Inc. | Strengthening agent, strengthened metal halide particles, and improved lamp fill material |
| US6284165B1 (en) * | 1996-08-23 | 2001-09-04 | Scott Anderson | Methods of strengthening metal halide particles, and improved lamp fill material |
| JPH1092385A (ja) * | 1996-09-12 | 1998-04-10 | Matsushita Electron Corp | 管 球 |
| CA2398677A1 (en) * | 2000-01-20 | 2001-07-26 | Osram Sylvania Inc. | High pressure sodium lamp having reduced arc tube size |
| DE10254969A1 (de) * | 2002-11-26 | 2004-06-03 | Philips Intellectual Property & Standards Gmbh | Hochdruckentladungslampe mit Quecksilberchlorid bei begrenztem Chlorgehalt |
| US20090015162A1 (en) * | 2003-06-30 | 2009-01-15 | Koninklijke Philips Electronics N.V. | Electric Lamp Having Strapless Support Mount for Mh Arc Tubes |
| DE102004019185A1 (de) * | 2004-04-16 | 2005-11-10 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe |
| US20060132043A1 (en) * | 2004-12-20 | 2006-06-22 | Srivastava Alok M | Mercury-free discharge compositions and lamps incorporating gallium |
| US7633226B2 (en) * | 2005-11-30 | 2009-12-15 | General Electric Company | Electrode materials for electric lamps and methods of manufacture thereof |
| DE102008049476A1 (de) * | 2008-09-29 | 2010-04-01 | Osram Gesellschaft mit beschränkter Haftung | Hochdruckentladungslampe |
| US9171712B2 (en) | 2014-07-05 | 2015-10-27 | National Institute Of Standards And Technology | Lamp having a secondary halide that improves luminous efficiency |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3398312A (en) * | 1965-11-24 | 1968-08-20 | Westinghouse Electric Corp | High pressure vapor discharge lamp having a fill including sodium iodide and a free metal |
| US3521110A (en) * | 1967-09-25 | 1970-07-21 | Gen Electric | Mercury-metallic halide vapor lamp with regenerative cycle |
| NL7011321A (OSRAM) * | 1970-07-31 | 1972-02-02 | ||
| US3781586A (en) * | 1972-12-04 | 1973-12-25 | Gen Electric | Long lifetime mercury-metal halide discharge lamps |
| NL7303079A (OSRAM) * | 1973-03-06 | 1974-09-10 | ||
| DE2422411A1 (de) * | 1974-05-09 | 1975-12-11 | Philips Patentverwaltung | Hochdruckquecksilberdampfentladungslampe |
| GB1541437A (en) * | 1975-02-13 | 1979-02-28 | Thorn Electrical Ind Ltd | Electrical discharge lamp |
-
1976
- 1976-12-06 DE DE2655167A patent/DE2655167C2/de not_active Expired
-
1977
- 1977-11-25 US US05/854,765 patent/US4171498A/en not_active Expired - Lifetime
- 1977-11-29 GB GB49568/77A patent/GB1584417A/en not_active Expired
- 1977-12-05 FR FR7736530A patent/FR2373157A1/fr active Granted
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2840771A1 (de) * | 1978-09-19 | 1980-03-27 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| DE4035561A1 (de) * | 1989-11-08 | 1991-05-16 | Matsushita Electric Works Ltd | Lampe mit hochintensitaets-entladungsroehre |
| DE10234758A1 (de) * | 2002-07-30 | 2004-02-12 | Sli Lichtsysteme Gmbh | Metall-Halogendampflampe niedriger Leistung |
| DE10234758B4 (de) * | 2002-07-30 | 2006-02-16 | Sli Lichtsysteme Gmbh | Metall-Halogendampflampe niedriger Leistung |
| DE102006034833A1 (de) * | 2006-07-27 | 2008-01-31 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2655167A1 (de) | 1978-06-08 |
| FR2373157B1 (OSRAM) | 1983-01-07 |
| US4171498A (en) | 1979-10-16 |
| FR2373157A1 (fr) | 1978-06-30 |
| GB1584417A (en) | 1981-02-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2655167C2 (de) | Hochdruckentladungslampe mit Metallhalogeniden | |
| DE2519377A1 (de) | Quecksilberdampf-hochdruckentladungslampe | |
| DE1940539A1 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Metallhalogenidzusatz | |
| DE69228357T2 (de) | Lichtbogenkammer für eine Lampe die eine quecksilberfreie Füllung enthält | |
| EP0453893B1 (de) | Hochdruckentladungslampe | |
| DE3813421A1 (de) | Hochdruck-quecksilberdampfentladungslampe | |
| EP0535311A1 (de) | Hochdruckentladungslampe kleiner Leistung | |
| DE3917792C2 (de) | Elektrodenlose Metallhalogenid-Entladungslampe hoher Intensität | |
| DE3506295A1 (de) | Kompakte hochdruckentladungslampe | |
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2225308C3 (de) | Hochdruckgasentladungslampe | |
| DE2031449C3 (de) | Hochdruck-Metalldampf lampe mit einer in ausgewählten Spektralbereichen konzentrierten Strahlung | |
| DE2619674C2 (de) | Halogen-Metalldampfentladungslampe | |
| DE2422411A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2840771C2 (OSRAM) | ||
| DE2725297C3 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE2422576C3 (de) | Quecksilberdampflampe | |
| DE2408572A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE1489527B2 (de) | Quecksilberdampfhochdrucklampe | |
| DE2106447C2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit einem Zusatz von Metallhalogeniden | |
| DE2201831A1 (de) | Bogenentladungsvorrichtung | |
| DE1489406C3 (de) | Hochdruck-Quecksilberdampf entladungslampe | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE2114804B2 (de) | Quecksilberdampf-Hochdruckentladungslampe mit Zusatz von Halogeniden der Seltenen Erden | |
| DE2456757A1 (de) | Metallhalogenid-hochdruckgasentladungslampe |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2840771 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2840771 Format of ref document f/p: P |