DE2608195C3 - Kinderschaukelsitz - Google Patents
KinderschaukelsitzInfo
- Publication number
- DE2608195C3 DE2608195C3 DE2608195A DE2608195A DE2608195C3 DE 2608195 C3 DE2608195 C3 DE 2608195C3 DE 2608195 A DE2608195 A DE 2608195A DE 2608195 A DE2608195 A DE 2608195A DE 2608195 C3 DE2608195 C3 DE 2608195C3
- Authority
- DE
- Germany
- Prior art keywords
- blind holes
- children
- swing seat
- seat
- row
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000002861 polymer material Substances 0.000 claims description 7
- 238000010521 absorption reaction Methods 0.000 claims description 2
- 230000003014 reinforcing effect Effects 0.000 claims description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 24
- 230000002787 reinforcement Effects 0.000 description 7
- 230000006378 damage Effects 0.000 description 5
- 239000000463 material Substances 0.000 description 3
- 229920001084 poly(chloroprene) Polymers 0.000 description 3
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 208000027418 Wounds and injury Diseases 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 229920001971 elastomer Polymers 0.000 description 2
- HQQADJVZYDDRJT-UHFFFAOYSA-N ethene;prop-1-ene Chemical group C=C.CC=C HQQADJVZYDDRJT-UHFFFAOYSA-N 0.000 description 2
- 208000014674 injury Diseases 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- 229920001897 terpolymer Polymers 0.000 description 2
- 241001634884 Cochlicopa lubricella Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 238000001746 injection moulding Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 230000000475 sunscreen effect Effects 0.000 description 1
- 239000000516 sunscreening agent Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63G—MERRY-GO-ROUNDS; SWINGS; ROCKING-HORSES; CHUTES; SWITCHBACKS; SIMILAR DEVICES FOR PUBLIC AMUSEMENT
- A63G9/00—Swings
Landscapes
- Seats For Vehicles (AREA)
- Special Chairs (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9361/75A GB1535728A (en) | 1975-03-06 | 1975-03-06 | Seat for a swing |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2608195A1 DE2608195A1 (de) | 1976-09-16 |
| DE2608195B2 DE2608195B2 (de) | 1980-10-16 |
| DE2608195C3 true DE2608195C3 (de) | 1981-06-04 |
Family
ID=9870460
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2608195A Expired DE2608195C3 (de) | 1975-03-06 | 1976-02-27 | Kinderschaukelsitz |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US4066258A (OSRAM) |
| JP (1) | JPS51145648A (OSRAM) |
| AU (1) | AU501268B2 (OSRAM) |
| BE (1) | BE839282A (OSRAM) |
| CA (1) | CA1060773A (OSRAM) |
| DE (1) | DE2608195C3 (OSRAM) |
| FR (1) | FR2313101A1 (OSRAM) |
| GB (1) | GB1535728A (OSRAM) |
| IT (1) | IT1057276B (OSRAM) |
| NL (1) | NL182287C (OSRAM) |
| NZ (1) | NZ180106A (OSRAM) |
| SE (1) | SE408133B (OSRAM) |
| ZA (1) | ZA761120B (OSRAM) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5299877U (OSRAM) * | 1976-01-23 | 1977-07-28 | ||
| EP0012565A1 (en) * | 1978-12-12 | 1980-06-25 | Sutcliffe Engineering Holdings Limited | Seats for swings |
| AU6285680A (en) * | 1979-10-08 | 1981-04-16 | Sutcliffe Engineering Holdings Ltd. | Flexible swing seat |
| JPS63308Y2 (OSRAM) * | 1980-12-10 | 1988-01-06 | ||
| US4524966A (en) * | 1983-08-24 | 1985-06-25 | Game Time, Inc. | Seat for recreational swing set |
| US4793607A (en) * | 1986-05-14 | 1988-12-27 | Lemay Machine Company | Reinforced plastic swing seat and method of molding |
| GB2194739A (en) * | 1986-09-03 | 1988-03-16 | Sutcliffe Group Ltd | Seats for swings |
| GB2215351A (en) * | 1988-03-01 | 1989-09-20 | Sutcliffe Group Ltd | Swing seats |
| US5238456A (en) * | 1992-05-21 | 1993-08-24 | Tony Chang | Reinforced swing seat |
| GB2267223B (en) * | 1992-05-29 | 1995-04-26 | Sutcliffe Leisure Ltd | Seats for swings |
| US5338260A (en) * | 1992-12-21 | 1994-08-16 | Hedstrom Corporation | Children's swing |
| GB2318068B (en) * | 1996-10-08 | 2000-12-13 | Sutcliffe Play Ltd | Seats for swings |
| GB2416495A (en) * | 2004-07-23 | 2006-02-01 | Sutcliffe Play Ltd | Cardle-type swing seats for children |
| US8083600B2 (en) * | 2009-10-09 | 2011-12-27 | Backyard Leisure Holdings, Inc. | Swing seat |
| US9283488B2 (en) * | 2013-10-14 | 2016-03-15 | M&M Sales Enterprises Inc. | Belt tire swing |
Family Cites Families (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE7316752U (de) * | 1973-08-30 | Rathgeber Gmbh | Gepolstertes Sitzbrett fur Schaukeln | |
| US1975262A (en) * | 1933-02-08 | 1934-10-02 | Everwear Mfg Company | Swing seat |
| US2100002A (en) * | 1936-07-09 | 1937-11-23 | Everwear Mfg Company | Swing seat |
| US2225737A (en) * | 1938-09-26 | 1940-12-24 | American Playground Device Co | Swing seat |
| GB847131A (en) | 1957-08-02 | 1960-09-07 | Hallam Sleigh & Cheston Ltd | Improvements in seats |
| GB1032766A (en) | 1961-09-12 | 1966-06-15 | Dunlop Rubber Co | Improvements relating to seating structures |
| GB936896A (en) | 1961-10-06 | 1963-09-18 | Evertaut Seating Ltd | Improvements relating to seats |
| US3261607A (en) * | 1964-03-23 | 1966-07-19 | Gym Dandy Inc | Plastic swing or like seat |
| GB1216453A (en) | 1968-08-28 | 1970-12-23 | Plexowood Inc | Improvements in and relating to composite articles |
| GB1304373A (OSRAM) | 1969-07-15 | 1973-01-24 | ||
| DE6940274U (de) * | 1969-10-13 | 1970-02-19 | Herta Stilp | Sitz fuer eine kinder-gitterschaukel |
| GB1303852A (OSRAM) | 1970-05-05 | 1973-01-24 | Universal Oil Prod Co | |
| GB1299617A (en) | 1970-06-04 | 1972-12-13 | Vauxhall Motors Ltd | Vehicle seat construction |
| US3712614A (en) * | 1970-07-17 | 1973-01-23 | Cambridge Res & Dev Group | Swing seat |
| GB1370301A (en) | 1971-01-14 | 1974-10-16 | Electric Power Storage Ltd | Battery charging apparatus |
| SE375437B (OSRAM) * | 1972-08-08 | 1975-04-21 | G Ohlsson |
-
1975
- 1975-03-06 GB GB9361/75A patent/GB1535728A/en not_active Expired
-
1976
- 1976-02-23 US US05/660,433 patent/US4066258A/en not_active Expired - Lifetime
- 1976-02-23 CA CA246,355A patent/CA1060773A/en not_active Expired
- 1976-02-24 NZ NZ180106A patent/NZ180106A/xx unknown
- 1976-02-25 ZA ZA761120A patent/ZA761120B/xx unknown
- 1976-02-26 SE SE7602552A patent/SE408133B/xx not_active IP Right Cessation
- 1976-02-27 DE DE2608195A patent/DE2608195C3/de not_active Expired
- 1976-03-01 IT IT48353/76A patent/IT1057276B/it active
- 1976-03-05 JP JP51024035A patent/JPS51145648A/ja active Granted
- 1976-03-05 FR FR7606289A patent/FR2313101A1/fr active Granted
- 1976-03-05 NL NLAANVRAGE7602365,A patent/NL182287C/xx not_active IP Right Cessation
- 1976-03-05 AU AU11721/76A patent/AU501268B2/en not_active Expired
- 1976-03-05 BE BE164934A patent/BE839282A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1057276B (it) | 1982-03-10 |
| FR2313101B1 (OSRAM) | 1980-11-14 |
| NZ180106A (en) | 1980-02-21 |
| ZA761120B (en) | 1977-02-23 |
| NL182287C (nl) | 1988-02-16 |
| NL182287B (nl) | 1987-09-16 |
| JPS51145648A (en) | 1976-12-14 |
| DE2608195B2 (de) | 1980-10-16 |
| JPS5632953B2 (OSRAM) | 1981-07-31 |
| AU501268B2 (en) | 1979-06-14 |
| SE408133B (sv) | 1979-05-21 |
| AU1172176A (en) | 1977-09-08 |
| SE7602552L (sv) | 1976-09-07 |
| GB1535728A (en) | 1978-12-13 |
| BE839282A (fr) | 1976-09-06 |
| DE2608195A1 (de) | 1976-09-16 |
| FR2313101A1 (fr) | 1976-12-31 |
| NL7602365A (nl) | 1976-09-08 |
| US4066258A (en) | 1978-01-03 |
| CA1060773A (en) | 1979-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2608195C3 (de) | Kinderschaukelsitz | |
| DE2437809C3 (de) | Siebboden sowie Siebkörper und Rahmen hierfür | |
| DE2504849C3 (de) | Schutzhelm | |
| DE19947245B4 (de) | Vorrichtung für die Absorption von Stossenergie | |
| DE2554210A1 (de) | Kunststoffpalette | |
| DE2413772A1 (de) | Stossdaempfende stosstange | |
| DE2429625A1 (de) | Vorder- und/oder rueckwaertiger stossfaenger fuer kraftfahrzeuge | |
| DE2431302C3 (de) | Energieabsorbierende Stoßstange | |
| DE1903966A1 (de) | Hufbeschlag aus Kunststoff | |
| DE2231637A1 (de) | Energie absorbierende stosstangenvorrichtung | |
| DE1634060C3 (de) | Dockpuffer | |
| DE4302639A1 (en) | C frame for tool closure units of injection moulding machine - has single cast main frame comprising two side frames, upper forward projecting front frames, front frame between side frames and tensioning pillars | |
| DE2200512B2 (de) | Abstandshalter fuer bewehrungsstaebe | |
| DE69324167T2 (de) | Sitze für schaukeln | |
| DE2850723A1 (de) | Stossfaenger fuer fahrzeuge | |
| DE2903307A1 (de) | Transportpalette | |
| DE69303623T2 (de) | Laufgang zum uberbrücken von hindernissen | |
| EP1561898A2 (de) | Leiter mit einer Trittplatte | |
| DE2327032A1 (de) | Fender | |
| DE2258181A1 (de) | Energie absorbierende stosstangenvorrichtung | |
| DE19621236A1 (de) | Gerüstbohle | |
| DE9114637U1 (de) | Spoiler | |
| DE8204777U1 (de) | Kinderschaukelsitz | |
| DE4328840A1 (de) | Schalenski | |
| DE2827194A1 (de) | Falldaempfende platte |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) |