DE2603076C2 - Verfahren zur Herstellung von 2-Aminobutan-1-ol - Google Patents
Verfahren zur Herstellung von 2-Aminobutan-1-olInfo
- Publication number
- DE2603076C2 DE2603076C2 DE2603076A DE2603076A DE2603076C2 DE 2603076 C2 DE2603076 C2 DE 2603076C2 DE 2603076 A DE2603076 A DE 2603076A DE 2603076 A DE2603076 A DE 2603076A DE 2603076 C2 DE2603076 C2 DE 2603076C2
- Authority
- DE
- Germany
- Prior art keywords
- nitropropane
- hydrogenation
- tertiary amine
- nitrobutan
- formaldehyde
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- JCBPETKZIGVZRE-UHFFFAOYSA-N 2-aminobutan-1-ol Chemical compound CCC(N)CO JCBPETKZIGVZRE-UHFFFAOYSA-N 0.000 title claims description 10
- 238000000034 method Methods 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 35
- JSZOAYXJRCEYSX-UHFFFAOYSA-N 1-nitropropane Chemical compound CCC[N+]([O-])=O JSZOAYXJRCEYSX-UHFFFAOYSA-N 0.000 claims description 21
- MHIHRIPETCJEMQ-UHFFFAOYSA-N 2-nitrobutan-1-ol Chemical compound CCC(CO)[N+]([O-])=O MHIHRIPETCJEMQ-UHFFFAOYSA-N 0.000 claims description 21
- 238000005984 hydrogenation reaction Methods 0.000 claims description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 12
- 239000003054 catalyst Substances 0.000 claims description 11
- 239000000908 ammonium hydroxide Substances 0.000 claims description 9
- 125000001453 quaternary ammonium group Chemical group 0.000 claims description 9
- 150000003512 tertiary amines Chemical class 0.000 claims description 9
- 230000022244 formylation Effects 0.000 claims description 8
- 238000006170 formylation reaction Methods 0.000 claims description 8
- 239000002904 solvent Substances 0.000 claims description 4
- 238000003756 stirring Methods 0.000 claims description 4
- 239000012736 aqueous medium Substances 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 18
- 238000006243 chemical reaction Methods 0.000 description 17
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 12
- 239000012071 phase Substances 0.000 description 9
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- 235000011114 ammonium hydroxide Nutrition 0.000 description 8
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 8
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 7
- -1 aromatic radical Chemical class 0.000 description 7
- 239000001257 hydrogen Substances 0.000 description 7
- 229910052739 hydrogen Inorganic materials 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- YADISKICBOYXFS-UHFFFAOYSA-N 2-ethyl-2-nitropropane-1,3-diol Chemical compound CCC(CO)(CO)[N+]([O-])=O YADISKICBOYXFS-UHFFFAOYSA-N 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 229910052763 palladium Inorganic materials 0.000 description 4
- 229910052697 platinum Inorganic materials 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 230000005494 condensation Effects 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 150000001414 amino alcohols Chemical class 0.000 description 2
- NDKBVBUGCNGSJJ-UHFFFAOYSA-M benzyltrimethylammonium hydroxide Chemical compound [OH-].C[N+](C)(C)CC1=CC=CC=C1 NDKBVBUGCNGSJJ-UHFFFAOYSA-M 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 235000011089 carbon dioxide Nutrition 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000007717 exclusion Effects 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- SLRMQYXOBQWXCR-UHFFFAOYSA-N 2154-56-5 Chemical compound [CH2]C1=CC=CC=C1 SLRMQYXOBQWXCR-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical group [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000007423 decrease Effects 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- QUPDWYMUPZLYJZ-UHFFFAOYSA-N ethyl Chemical compound C[CH2] QUPDWYMUPZLYJZ-UHFFFAOYSA-N 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000008098 formaldehyde solution Substances 0.000 description 1
- 238000005194 fractionation Methods 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical compound OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003408 phase transfer catalysis Methods 0.000 description 1
- 238000003822 preparative gas chromatography Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- 239000012808 vapor phase Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/02—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton
- C07C215/04—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated
- C07C215/06—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic
- C07C215/08—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups and amino groups bound to acyclic carbon atoms of the same carbon skeleton the carbon skeleton being saturated and acyclic with only one hydroxy group and one amino group bound to the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7503431A FR2300070A1 (fr) | 1975-02-04 | 1975-02-04 | Preparation de l'amino-2 butanol-1 |
| FR7534567A FR2331548A2 (fr) | 1975-11-13 | 1975-11-13 | Preparation de l'amino-2 butanol-1 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2603076A1 DE2603076A1 (de) | 1976-08-05 |
| DE2603076C2 true DE2603076C2 (de) | 1986-06-19 |
Family
ID=26218713
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2603076A Expired DE2603076C2 (de) | 1975-02-04 | 1976-01-28 | Verfahren zur Herstellung von 2-Aminobutan-1-ol |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4067905A (OSRAM) |
| JP (1) | JPS6048502B2 (OSRAM) |
| BR (1) | BR7600615A (OSRAM) |
| CA (1) | CA1072581A (OSRAM) |
| CH (1) | CH609674A5 (OSRAM) |
| DE (1) | DE2603076C2 (OSRAM) |
| ES (1) | ES444681A1 (OSRAM) |
| GB (1) | GB1505621A (OSRAM) |
| IT (1) | IT1054800B (OSRAM) |
| LU (1) | LU74301A1 (OSRAM) |
| NL (1) | NL185919C (OSRAM) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4924029A (en) * | 1988-06-24 | 1990-05-08 | W. R. Grace & Co.-Conn. | Reduction of nitroaliphatics via homogeneous catalysis |
| US5099067A (en) * | 1988-08-05 | 1992-03-24 | Northwestern University | Use of ammonium formate as a hydrogen transfer reagent for reduction of chiral nitro compounds with retention of configuration |
| DE10105277A1 (de) * | 2001-02-02 | 2002-08-14 | Basf Ag | Verfahren zur Hydrierung von flüssigen organischen Verbindungen |
| JP2013522296A (ja) * | 2010-03-15 | 2013-06-13 | アンガス ケミカル カンパニー | アミノアルコール化合物の製造方法 |
| CN103080229B (zh) * | 2010-06-30 | 2015-07-22 | 陶氏环球技术有限责任公司 | 用于织物加工的支链的仲醇烷氧基化物表面活性剂 |
| US8674139B2 (en) * | 2010-09-27 | 2014-03-18 | Angus Chemical Company | Process for making tertiary aminoalcohol compounds |
| EP2720995B1 (en) * | 2011-07-20 | 2017-08-23 | ANGUS Chemical Company | Process for making tertiary aminoalcohol compounds |
| CN107235847B (zh) * | 2017-06-12 | 2019-09-10 | 嘉兴润博化工科技有限公司 | 一种2-氨基-1-丁醇的制备方法 |
| WO2021024271A1 (en) * | 2019-08-02 | 2021-02-11 | INDIAN INSTITUTE OF TECHNOLOGY MADRAS (IIT Madras) | Continuous flow process and apparatus for manufacture of dl-2-nitro-1-butanol |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2132330A (en) * | 1937-06-30 | 1938-10-04 | Purdue Research Foundation | Preparation of nitrohydroxy compounds |
| US2673880A (en) * | 1951-08-07 | 1954-03-30 | Commercial Solvents Corp | Production of amino hydroxy compounds |
| US3534112A (en) * | 1967-11-13 | 1970-10-13 | Commercial Solvents Corp | Nitroalkanols from nitroalkanes and formaldehyde |
| US3564062A (en) * | 1968-03-15 | 1971-02-16 | Commercial Solvents Corp | Production of nitroalkanols |
| US3546298A (en) * | 1968-03-15 | 1970-12-08 | Commercial Solvents Corp | Production of alkanolamines |
| US3736265A (en) * | 1970-11-06 | 1973-05-29 | Texaco Inc | Stabilized palladium-carbon catalysts |
| US3739027A (en) * | 1971-05-21 | 1973-06-12 | Texaco Inc | Hydrogenation of nitroparaffins |
| US3801640A (en) * | 1972-06-08 | 1974-04-02 | Texaco Inc | Process for reducing nitrosubstrates to corresponding amines by use of homogeneous nickel catalysts in the presence of hydrogen and carbon monoxide |
-
1976
- 1976-01-15 CH CH46476A patent/CH609674A5/xx not_active IP Right Cessation
- 1976-01-16 IT IT19340/76A patent/IT1054800B/it active
- 1976-01-19 NL NLAANVRAGE7600512,A patent/NL185919C/xx not_active IP Right Cessation
- 1976-01-20 US US05/650,695 patent/US4067905A/en not_active Expired - Lifetime
- 1976-01-23 CA CA244,330A patent/CA1072581A/en not_active Expired
- 1976-01-28 DE DE2603076A patent/DE2603076C2/de not_active Expired
- 1976-01-28 ES ES444681A patent/ES444681A1/es not_active Expired
- 1976-01-30 BR BR7600615A patent/BR7600615A/pt unknown
- 1976-02-03 GB GB4265/76A patent/GB1505621A/en not_active Expired
- 1976-02-03 LU LU74301A patent/LU74301A1/xx unknown
- 1976-02-04 JP JP51010454A patent/JPS6048502B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NL185919B (nl) | 1990-03-16 |
| BR7600615A (pt) | 1976-08-31 |
| ES444681A1 (es) | 1977-05-16 |
| GB1505621A (en) | 1978-03-30 |
| IT1054800B (it) | 1981-11-30 |
| DE2603076A1 (de) | 1976-08-05 |
| US4067905A (en) | 1978-01-10 |
| CH609674A5 (OSRAM) | 1979-03-15 |
| JPS51146407A (en) | 1976-12-16 |
| LU74301A1 (OSRAM) | 1976-06-18 |
| JPS6048502B2 (ja) | 1985-10-28 |
| NL185919C (nl) | 1990-08-16 |
| NL7600512A (nl) | 1976-08-06 |
| CA1072581A (en) | 1980-02-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0161544A2 (de) | Verfahren zur Herstellung von Ameisensäure | |
| DE2603076C2 (de) | Verfahren zur Herstellung von 2-Aminobutan-1-ol | |
| EP0400426A2 (de) | Verfahren zur Herstellung von alpha-, omega-Diaminen | |
| DE1941536A1 (de) | 1-Alkyl-2-aminomethylpyrrolidine sowie Verfahren zur Herstellung dieser Verbindungen und deren Zwischenprodukte | |
| EP0352504B1 (de) | Verfahren zur gemeinschaftlichen Herstellung von 3-Dialkylaminopropionitrilen, Bis-(2-cyanoethyl)-ether und gewünschtenfalls Ethylencyanhydrin | |
| DE2551055A1 (de) | Verfahren zur herstellung von 1,3- oder 1,4-bis-(aminomethyl)-cyclohexan | |
| EP3601211B1 (de) | Katalytisches verfahren zur herstellung von n,n-dimethylglucamin ausgehend aus n-methylglucamin | |
| DE69110295T2 (de) | Verfahren zur herstellung von iminen und/oder aminen von alkoholen. | |
| DE1668571B2 (de) | Verfahren zur Herstellung von 2-Methyl-polycycloalkylmethylaminen | |
| DE60317626T2 (de) | Verfahren zur herstellung von 2,5-bis(trifluormethyl)nitrobenzol | |
| EP0021374B1 (de) | Verfahren zur Herstellung von 4-Amino-diphenylaminen | |
| EP0070424B1 (de) | Verfahren zur Herstellung von N,N'-disubstituierten 3-Aminopropanamiden | |
| EP0083764B1 (de) | Verfahren zur Herstellung von Carbamaten | |
| DE2453365A1 (de) | Verfahren zur herstellung von n-trimethylsilylacetamid | |
| DE2737299C2 (de) | Verfahren zur Gewinnung von reinem 3-Phenoxybenzaldehyd | |
| DE4432610C1 (de) | Verfahren zur Herstellung von Selegilin-Hydrochlorid | |
| DE2005515C3 (de) | Verfahren zur Herstellung von γ -Cyanbutyraldinünen | |
| DE4210311C2 (OSRAM) | ||
| EP0104531A1 (de) | Gegebenenfalls Isomerengemische darstellende cycloaliphatische Diisocyanate, ein Verfahren zu ihrer Herstellung, sowie ihre Verwendung als Ausgangsmaterialien bei der Herstellung von Polyurethankunststoffen | |
| DE68906563T2 (de) | 2(1-alkylaminoalkyl)-3-hydroxy-1,4-naphthoquinon.Verfahren zur Herstellung und Verfahren zur Herstellung daraus von 2-(1-alkenyl)-3-hydroxy-1,4-naphthochinon und 2-alkyl-3-acyloxy-1,4 naphthochinon. | |
| DE3152459C2 (OSRAM) | ||
| DE2557501C2 (OSRAM) | ||
| DE102006041941A1 (de) | Verfahren zur Herstellung von 1,2-Diolen aus Carbonyl-Verbindungen | |
| DE3877648T2 (de) | Verfahren zur herstellung von naproxen. | |
| DE3318534C2 (OSRAM) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |