DE2601051A1 - Neue substituierte thiomethylarylharnstoffverbindungen - Google Patents
Neue substituierte thiomethylarylharnstoffverbindungenInfo
- Publication number
- DE2601051A1 DE2601051A1 DE19762601051 DE2601051A DE2601051A1 DE 2601051 A1 DE2601051 A1 DE 2601051A1 DE 19762601051 DE19762601051 DE 19762601051 DE 2601051 A DE2601051 A DE 2601051A DE 2601051 A1 DE2601051 A1 DE 2601051A1
- Authority
- DE
- Germany
- Prior art keywords
- compound according
- group
- carbon atoms
- alkyl
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims description 57
- 210000002700 urine Anatomy 0.000 title 1
- 238000000034 method Methods 0.000 claims description 35
- 125000004432 carbon atom Chemical group C* 0.000 claims description 23
- 125000000217 alkyl group Chemical group 0.000 claims description 18
- 241000196324 Embryophyta Species 0.000 claims description 9
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 5
- 101150065749 Churc1 gene Proteins 0.000 claims description 5
- 102100038239 Protein Churchill Human genes 0.000 claims description 5
- 125000003342 alkenyl group Chemical group 0.000 claims description 5
- 229910052799 carbon Inorganic materials 0.000 claims 1
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 24
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- -1 tert-butylthiomethyl Chemical group 0.000 description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- 239000004009 herbicide Substances 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000007921 spray Substances 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 230000006378 damage Effects 0.000 description 5
- DPMZXMBOYHBELT-UHFFFAOYSA-N 1,3,5-trimethyl-1,3,5-triazinane Chemical compound CN1CN(C)CN(C)C1 DPMZXMBOYHBELT-UHFFFAOYSA-N 0.000 description 4
- SXJYSIBLFGQAND-UHFFFAOYSA-N 1-isocyanato-3-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC(N=C=O)=C1 SXJYSIBLFGQAND-UHFFFAOYSA-N 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 244000046052 Phaseolus vulgaris Species 0.000 description 4
- 238000001914 filtration Methods 0.000 description 4
- 239000007789 gas Substances 0.000 description 4
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 4
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 4
- 239000002689 soil Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 241000894007 species Species 0.000 description 4
- 239000000126 substance Substances 0.000 description 4
- 235000005474 African couch grass Nutrition 0.000 description 3
- 244000178993 Brassica juncea Species 0.000 description 3
- 235000014698 Brassica juncea var multisecta Nutrition 0.000 description 3
- 241001520106 Eustachys Species 0.000 description 3
- 238000005481 NMR spectroscopy Methods 0.000 description 3
- 241001330453 Paspalum Species 0.000 description 3
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 3
- 244000207667 Rumex vesicarius Species 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 239000000835 fiber Substances 0.000 description 3
- 230000002363 herbicidal effect Effects 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 238000002360 preparation method Methods 0.000 description 3
- 238000012216 screening Methods 0.000 description 3
- 239000004094 surface-active agent Substances 0.000 description 3
- 240000001592 Amaranthus caudatus Species 0.000 description 2
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 2
- 244000237956 Amaranthus retroflexus Species 0.000 description 2
- 235000013479 Amaranthus retroflexus Nutrition 0.000 description 2
- 241000219198 Brassica Species 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- 229920001213 Polysorbate 20 Polymers 0.000 description 2
- 235000015422 Rumex crispus ssp. crispus Nutrition 0.000 description 2
- 235000015426 Rumex crispus ssp. fauriei Nutrition 0.000 description 2
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 2
- 239000004202 carbamide Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 2
- KJRCEJOSASVSRA-UHFFFAOYSA-N propane-2-thiol Chemical compound CC(C)S KJRCEJOSASVSRA-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- KDOIUFIZFQJSCT-UHFFFAOYSA-N 1-ethylsulfanyl-n-methylmethanamine;hydrochloride Chemical compound Cl.CCSCNC KDOIUFIZFQJSCT-UHFFFAOYSA-N 0.000 description 1
- IFDZNBVEINMRLU-UHFFFAOYSA-N 1-phenyl-1-(trifluoromethyl)urea Chemical compound NC(=O)N(C(F)(F)F)C1=CC=CC=C1 IFDZNBVEINMRLU-UHFFFAOYSA-N 0.000 description 1
- HKNIBUUBFMMKFB-UHFFFAOYSA-N 2,4,4-trimethylpentan-2-ylsulfanylmethanamine Chemical compound CC(C)(C)CC(C)(C)SCN HKNIBUUBFMMKFB-UHFFFAOYSA-N 0.000 description 1
- 235000007558 Avena sp Nutrition 0.000 description 1
- 235000011331 Brassica Nutrition 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 244000152970 Digitaria sanguinalis Species 0.000 description 1
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 1
- 244000088461 Panicum crus-galli Species 0.000 description 1
- 235000011999 Panicum crusgalli Nutrition 0.000 description 1
- 235000021501 Rumex crispus Nutrition 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- 239000011149 active material Substances 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 235000011089 carbon dioxide Nutrition 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000001804 emulsifying effect Effects 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 230000012010 growth Effects 0.000 description 1
- 239000003324 growth hormone secretagogue Substances 0.000 description 1
- 239000003906 humectant Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000003750 molluscacide Substances 0.000 description 1
- 230000002013 molluscicidal effect Effects 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- BBXBGAJKQZHBSE-UHFFFAOYSA-N n-methyl-1-propan-2-ylsulfanylmethanamine;hydrochloride Chemical compound Cl.CNCSC(C)C BBXBGAJKQZHBSE-UHFFFAOYSA-N 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 230000008635 plant growth Effects 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- WMXCDAVJEZZYLT-UHFFFAOYSA-N tert-butylthiol Chemical compound CC(C)(C)S WMXCDAVJEZZYLT-UHFFFAOYSA-N 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 150000003672 ureas Chemical class 0.000 description 1
- 238000005303 weighing Methods 0.000 description 1
- 238000009736 wetting Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/39—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton at least one of the nitrogen atoms being part of any of the groups, X being a hetero atom, Y being any atom
- C07C323/43—Y being a hetero atom
- C07C323/44—X or Y being nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US54037475A | 1975-01-13 | 1975-01-13 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2601051A1 true DE2601051A1 (de) | 1976-07-15 |
Family
ID=24155183
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19762601051 Withdrawn DE2601051A1 (de) | 1975-01-13 | 1976-01-13 | Neue substituierte thiomethylarylharnstoffverbindungen |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4111682A (OSRAM) |
| JP (1) | JPS5195040A (OSRAM) |
| BE (1) | BE837534A (OSRAM) |
| BR (1) | BR7600167A (OSRAM) |
| CA (1) | CA1073466A (OSRAM) |
| CH (1) | CH617571A5 (OSRAM) |
| DD (1) | DD123856A5 (OSRAM) |
| DE (1) | DE2601051A1 (OSRAM) |
| DK (1) | DK11976A (OSRAM) |
| EG (1) | EG12114A (OSRAM) |
| FR (1) | FR2297212A1 (OSRAM) |
| GB (1) | GB1479126A (OSRAM) |
| HU (1) | HU173776B (OSRAM) |
| IL (1) | IL48829A (OSRAM) |
| IN (1) | IN142854B (OSRAM) |
| MY (1) | MY7800487A (OSRAM) |
| NL (1) | NL7600306A (OSRAM) |
| PH (1) | PH13853A (OSRAM) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4090864A (en) * | 1977-05-31 | 1978-05-23 | Stauffer Chemical Company | Herbicidal acetamidothiomethyl ureas |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AU1395983A (en) * | 1982-05-03 | 1983-11-10 | Uniroyal Inc. | Substituted urea herbicides |
| AU7353300A (en) | 1999-09-08 | 2001-04-10 | Guilford Pharmaceuticals Inc. | Non-peptidic cyclophilin binding compounds and their use |
| WO2002059080A2 (en) | 2001-01-25 | 2002-08-01 | Guilford Pharmaceuticals Inc. | Trisubstituted carbocyclic cyclophilin binding compounds and their use |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA699773A (en) * | 1964-12-15 | T. Goebel Max | Herbicidally active aryl alkyl methoxymethyl ureas | |
| US2708677A (en) * | 1950-08-23 | 1955-05-17 | Cilag Ltd | Thioethers and a process for their production |
| US3072719A (en) * | 1959-04-23 | 1963-01-08 | Monsanto Chemicals | 3, 4-dichlorophenyl substituted alkyl ureas |
| DE1192454B (de) * | 1963-12-03 | 1965-05-06 | Basf Ag | Selektive herbizide Mittel |
| DE1542687A1 (de) | 1965-06-04 | 1970-07-23 | Basf Ag | Herbizide Mittel |
| DE1542688A1 (de) * | 1965-06-12 | 1970-07-02 | Basf Ag | Herbizide Mittel |
| DE2101698A1 (de) * | 1971-01-15 | 1972-09-07 | Badische Anilin- & Soda-Fabrik Ag, 6700 Ludwigshafen | Substituierte m-Trifluormethylphenylharnstoffderivate |
| BE791449A (fr) * | 1971-11-17 | 1973-05-16 | Roussel Uclaf | Nouvelles urees substituees et procede de |
| BG23537A3 (bg) * | 1973-05-22 | 1977-09-15 | Philargo S.A. | Средство за регулиране растежа на растенията |
| US3978123A (en) * | 1973-07-12 | 1976-08-31 | Chevron Research Company | Herbicidal n-alkylsulfoxymethyl-and-n-alkylsulfonyl-methyl-n-aryl |
| CH608691A5 (OSRAM) * | 1975-02-18 | 1979-01-31 | Roussel Uclaf |
-
1976
- 1976-01-12 PH PH17960A patent/PH13853A/en unknown
- 1976-01-12 FR FR7600554A patent/FR2297212A1/fr active Granted
- 1976-01-13 HU HU76SA2877A patent/HU173776B/hu unknown
- 1976-01-13 JP JP51003145A patent/JPS5195040A/ja active Pending
- 1976-01-13 EG EG13/76A patent/EG12114A/xx active
- 1976-01-13 DE DE19762601051 patent/DE2601051A1/de not_active Withdrawn
- 1976-01-13 BR BR167/76A patent/BR7600167A/pt unknown
- 1976-01-13 GB GB1179/76A patent/GB1479126A/en not_active Expired
- 1976-01-13 CA CA243,462A patent/CA1073466A/en not_active Expired
- 1976-01-13 NL NL7600306A patent/NL7600306A/xx not_active Application Discontinuation
- 1976-01-13 CH CH33776A patent/CH617571A5/de not_active IP Right Cessation
- 1976-01-13 BE BE7000761A patent/BE837534A/xx unknown
- 1976-01-13 DD DD190792A patent/DD123856A5/xx unknown
- 1976-01-13 DK DK11976*#A patent/DK11976A/da unknown
- 1976-01-13 IL IL48829A patent/IL48829A/xx unknown
- 1976-03-24 IN IN515/CAL/1976A patent/IN142854B/en unknown
-
1977
- 1977-05-31 US US05/801,889 patent/US4111682A/en not_active Expired - Lifetime
-
1978
- 1978-12-30 MY MY487/78A patent/MY7800487A/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4090864A (en) * | 1977-05-31 | 1978-05-23 | Stauffer Chemical Company | Herbicidal acetamidothiomethyl ureas |
Also Published As
| Publication number | Publication date |
|---|---|
| IN142854B (OSRAM) | 1977-09-03 |
| PH13853A (en) | 1980-10-22 |
| JPS5195040A (OSRAM) | 1976-08-20 |
| IL48829A (en) | 1979-01-31 |
| GB1479126A (en) | 1977-07-06 |
| IL48829A0 (en) | 1976-03-31 |
| BR7600167A (pt) | 1976-11-09 |
| AU1024476A (en) | 1977-07-21 |
| CA1073466A (en) | 1980-03-11 |
| FR2297212B1 (OSRAM) | 1979-07-27 |
| CH617571A5 (OSRAM) | 1980-06-13 |
| FR2297212A1 (fr) | 1976-08-06 |
| DK11976A (da) | 1976-07-14 |
| BE837534A (nl) | 1976-07-13 |
| EG12114A (en) | 1978-09-30 |
| DD123856A5 (OSRAM) | 1977-01-19 |
| HU173776B (hu) | 1979-08-28 |
| US4111682A (en) | 1978-09-05 |
| MY7800487A (en) | 1978-12-31 |
| NL7600306A (nl) | 1976-07-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2406475C2 (de) | 5-Acetamido-2,4-dimethyltrifluormethansulfonanilid und dessen landwirtschaftlich geeignete Salze, Verfahren zur Herstellung dieser Verbindungen und diese Verbindungen enthaltende Mittel | |
| DE1542879A1 (de) | Verfahren zur Herstellung neuer Nematozide | |
| CH632732A5 (de) | Herbizide mittel, enthaltend derivate der phenoxy-phenoxypropionsaeure. | |
| DE2744137A1 (de) | Neue benzolsulfonamid-derivate | |
| CH638223A5 (de) | N-((phosphinyl)amino)thio-methylcarbamate bzw. n-((phosphinothioyl)amino)thio-methylcarbamate, verfahren zu ihrer herstellung sowie ihre verwendung in pestiziden. | |
| EP0037971B1 (de) | Trisubstituierte Cyanguanidine, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Fungizide | |
| EP0036390A2 (de) | Diphenyläther-Harnstoffe mit herbizider Wirkung | |
| CH628017A5 (de) | Verfahren zur herstellung der neuen verbindung n-(4-benzyloxyphenyl)-n'-methyl-n'-methoxyharnstoff. | |
| DE2601051A1 (de) | Neue substituierte thiomethylarylharnstoffverbindungen | |
| EP0030922B1 (de) | Äthinyl-Phenylharnstoffe, Verfahren zu deren Herstellung und deren Verwendung als Herbizide | |
| DE2436957A1 (de) | Carbaminsaeure-derivate | |
| DE3047629A1 (de) | "tetrahydrofuranderivate" | |
| CH633546A5 (en) | Tetrahydro-1,3,5-thiadiazin-4-one compounds | |
| EP0008565A1 (de) | Bis-(phenoxy-alkyl-2-imidazolin)-1,1'-sulfide, Verfahren zu ihrer Herstellung, Mittel welche diese Sulfide als aktive Komponente enthalten und deren Verwendung zur Bekämpfung von Schädlingen | |
| DE3237998C2 (de) | Phenoxyalkylamidderivate, Verfahren zu deren Herstellung und herbizide Zusammensetzungen, welche diese enthalten | |
| DE2131928A1 (de) | Neue N,N-Dialkylthiocarbamate und ihre Verwendung in Herbiziden | |
| DE2156919A1 (de) | m-substituierte Phenylharnstoffe und -thioharnstoffe sowie diese als Wirkstoffe enthaltende Herbizide | |
| DE2743513C2 (de) | Verfahren zur Herstellung eines Thiocarbamidsäureesters | |
| DE1810581C3 (de) | N-Acyl-p-dialkylamino-phenylhydrazone, Verfahren zu ihrer Herstellung und deren Verwendung zur Bekämpfung von phytopathogene Pilzen | |
| DE2154634A1 (OSRAM) | ||
| EP0016731B1 (de) | Meta-Cyanoalkoxy-Phenylharnstoffe mit herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| DE2046597C3 (de) | S-Benzyl-N-äthyl-N-isobutylthiocarbamat und Herbizides Mittel | |
| DE1542879C3 (de) | Verwendung von Derivaten des 23-Dihydro-2^-dimethyl-7-benzofuranyl-carbamats als Nematozide | |
| DE2229211A1 (de) | N-Acetonitrilo-alpha-phenoxyalkylamide und ihre Verwendung als Herbizide | |
| AT209347B (de) | Verfahren zur Herstellung von neuen N-Thiotrichlormethylderivaten heterocyclischer Stickstoffverbindungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |