DE2557333A1 - Verfahren zur herstellung von polyphenylenoxid - Google Patents
Verfahren zur herstellung von polyphenylenoxidInfo
- Publication number
- DE2557333A1 DE2557333A1 DE19752557333 DE2557333A DE2557333A1 DE 2557333 A1 DE2557333 A1 DE 2557333A1 DE 19752557333 DE19752557333 DE 19752557333 DE 2557333 A DE2557333 A DE 2557333A DE 2557333 A1 DE2557333 A1 DE 2557333A1
- Authority
- DE
- Germany
- Prior art keywords
- type
- manganese
- chelate
- reaction
- phenol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000004721 Polyphenylene oxide Substances 0.000 title description 51
- 229920006380 polyphenylene oxide Polymers 0.000 title description 51
- 238000004519 manufacturing process Methods 0.000 title description 12
- 239000011572 manganese Substances 0.000 claims description 119
- 229910052748 manganese Inorganic materials 0.000 claims description 80
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 claims description 79
- 239000013522 chelant Substances 0.000 claims description 79
- 238000006243 chemical reaction Methods 0.000 claims description 63
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 42
- 239000000203 mixture Substances 0.000 claims description 38
- 239000003446 ligand Substances 0.000 claims description 36
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 34
- 239000002904 solvent Substances 0.000 claims description 18
- 229910052739 hydrogen Inorganic materials 0.000 claims description 14
- 239000001257 hydrogen Substances 0.000 claims description 14
- 229910052760 oxygen Inorganic materials 0.000 claims description 12
- 230000008569 process Effects 0.000 claims description 12
- 125000004429 atom Chemical group 0.000 claims description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 11
- 239000001301 oxygen Substances 0.000 claims description 11
- 239000012429 reaction media Substances 0.000 claims description 9
- 125000004122 cyclic group Chemical group 0.000 claims description 8
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims description 8
- 229910052799 carbon Inorganic materials 0.000 claims description 7
- ORIHZIZPTZTNCU-YVMONPNESA-N salicylaldoxime Chemical compound O\N=C/C1=CC=CC=C1O ORIHZIZPTZTNCU-YVMONPNESA-N 0.000 claims description 7
- 229910052723 transition metal Inorganic materials 0.000 claims description 7
- 150000003624 transition metals Chemical class 0.000 claims description 7
- 229910052783 alkali metal Inorganic materials 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 125000002015 acyclic group Chemical group 0.000 claims description 5
- 150000001340 alkali metals Chemical class 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims description 5
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- 239000000126 substance Substances 0.000 claims description 2
- VJXIZXJHJXDYGJ-UHFFFAOYSA-N 2,6-dimethylphenol;phenol Chemical compound OC1=CC=CC=C1.CC1=CC=CC(C)=C1O VJXIZXJHJXDYGJ-UHFFFAOYSA-N 0.000 claims 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 36
- 229960003742 phenol Drugs 0.000 description 34
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 33
- 239000003054 catalyst Substances 0.000 description 29
- -1 2,6-xylenol sodium hydride Chemical compound 0.000 description 22
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 21
- 230000015572 biosynthetic process Effects 0.000 description 18
- 229910052757 nitrogen Inorganic materials 0.000 description 18
- 125000004432 carbon atom Chemical group C* 0.000 description 17
- 239000000243 solution Substances 0.000 description 17
- 238000006116 polymerization reaction Methods 0.000 description 13
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- 229910052717 sulfur Inorganic materials 0.000 description 10
- 201000006747 infectious mononucleosis Diseases 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 8
- 230000003197 catalytic effect Effects 0.000 description 8
- 150000002989 phenols Chemical class 0.000 description 8
- 229920000642 polymer Polymers 0.000 description 8
- 150000003141 primary amines Chemical class 0.000 description 8
- 230000035484 reaction time Effects 0.000 description 8
- SMQUZDBALVYZAC-UHFFFAOYSA-N salicylaldehyde Chemical compound OC1=CC=CC=C1C=O SMQUZDBALVYZAC-UHFFFAOYSA-N 0.000 description 8
- 125000001424 substituent group Chemical group 0.000 description 8
- 125000001931 aliphatic group Chemical group 0.000 description 7
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 238000009833 condensation Methods 0.000 description 6
- 238000006482 condensation reaction Methods 0.000 description 6
- 238000002474 experimental method Methods 0.000 description 6
- 230000007246 mechanism Effects 0.000 description 6
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 150000001875 compounds Chemical class 0.000 description 4
- 150000002697 manganese compounds Chemical class 0.000 description 4
- 238000005691 oxidative coupling reaction Methods 0.000 description 4
- 229920000768 polyamine Polymers 0.000 description 4
- 229920013637 polyphenylene oxide polymer Polymers 0.000 description 4
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- WMFOQBRAJBCJND-UHFFFAOYSA-M Lithium hydroxide Chemical compound [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229930195733 hydrocarbon Natural products 0.000 description 3
- 150000002430 hydrocarbons Chemical class 0.000 description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- 150000003739 xylenols Chemical class 0.000 description 3
- KLAQSPUVCDBEGF-UHFFFAOYSA-N 2,3,5,6-tetramethylphenol Chemical compound CC1=CC(C)=C(C)C(O)=C1C KLAQSPUVCDBEGF-UHFFFAOYSA-N 0.000 description 2
- QQOMQLYQAXGHSU-UHFFFAOYSA-N 2,3,6-Trimethylphenol Chemical compound CC1=CC=C(C)C(O)=C1C QQOMQLYQAXGHSU-UHFFFAOYSA-N 0.000 description 2
- KLIDCXVFHGNTTM-UHFFFAOYSA-N 2,6-dimethoxyphenol Chemical compound COC1=CC=CC(OC)=C1O KLIDCXVFHGNTTM-UHFFFAOYSA-N 0.000 description 2
- CDAWCLOXVUBKRW-UHFFFAOYSA-N 2-aminophenol Chemical compound NC1=CC=CC=C1O CDAWCLOXVUBKRW-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- FDLQZKYLHJJBHD-UHFFFAOYSA-N [3-(aminomethyl)phenyl]methanamine Chemical compound NCC1=CC=CC(CN)=C1 FDLQZKYLHJJBHD-UHFFFAOYSA-N 0.000 description 2
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 150000004945 aromatic hydrocarbons Chemical group 0.000 description 2
- 125000003118 aryl group Chemical group 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- VHRGRCVQAFMJIZ-UHFFFAOYSA-N cadaverine Chemical compound NCCCCCN VHRGRCVQAFMJIZ-UHFFFAOYSA-N 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- KZZKOVLJUKWSKX-UHFFFAOYSA-N cyclobutanamine Chemical compound NC1CCC1 KZZKOVLJUKWSKX-UHFFFAOYSA-N 0.000 description 2
- 230000009849 deactivation Effects 0.000 description 2
- 125000004663 dialkyl amino group Chemical group 0.000 description 2
- 125000000524 functional group Chemical group 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 125000005843 halogen group Chemical group 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 229910001437 manganese ion Inorganic materials 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 125000002950 monocyclic group Chemical class 0.000 description 2
- 239000000178 monomer Substances 0.000 description 2
- 238000006386 neutralization reaction Methods 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- KIDHWZJUCRJVML-UHFFFAOYSA-N putrescine Chemical compound NCCCCN KIDHWZJUCRJVML-UHFFFAOYSA-N 0.000 description 2
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- WAKHLWOJMHVUJC-FYWRMAATSA-N (2e)-2-hydroxyimino-1,2-diphenylethanol Chemical compound C=1C=CC=CC=1C(=N/O)\C(O)C1=CC=CC=C1 WAKHLWOJMHVUJC-FYWRMAATSA-N 0.000 description 1
- JJZONEUCDUQVGR-WXUKJITCSA-N (NE)-N-[(2E)-2-hydroxyimino-1,2-diphenylethylidene]hydroxylamine Chemical compound c1ccccc1\C(=N/O)\C(=N\O)\c1ccccc1 JJZONEUCDUQVGR-WXUKJITCSA-N 0.000 description 1
- YBKOPFQCLSPTPV-YVMONPNESA-N (nz)-n-(pyridin-3-ylmethylidene)hydroxylamine Chemical compound O\N=C/C1=CC=CN=C1 YBKOPFQCLSPTPV-YVMONPNESA-N 0.000 description 1
- JRNVQLOKVMWBFR-UHFFFAOYSA-N 1,2-benzenedithiol Chemical compound SC1=CC=CC=C1S JRNVQLOKVMWBFR-UHFFFAOYSA-N 0.000 description 1
- WZCQRUWWHSTZEM-UHFFFAOYSA-N 1,3-phenylenediamine Chemical compound NC1=CC=CC(N)=C1 WZCQRUWWHSTZEM-UHFFFAOYSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- CBCKQZAAMUWICA-UHFFFAOYSA-N 1,4-phenylenediamine Chemical compound NC1=CC=C(N)C=C1 CBCKQZAAMUWICA-UHFFFAOYSA-N 0.000 description 1
- AIKGZKSZCLOZQJ-UHFFFAOYSA-N 1-[4-(3-aminohexyl)phenyl]hexan-3-amine Chemical compound CCCC(N)CCC1=CC=C(CCC(N)CCC)C=C1 AIKGZKSZCLOZQJ-UHFFFAOYSA-N 0.000 description 1
- BMVXCPBXGZKUPN-UHFFFAOYSA-N 1-hexanamine Chemical compound CCCCCCN BMVXCPBXGZKUPN-UHFFFAOYSA-N 0.000 description 1
- ZHGIKBCGOGBDFG-UHFFFAOYSA-N 1-icosylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCCCCCCCCCCCC)=CC=CC2=C1 ZHGIKBCGOGBDFG-UHFFFAOYSA-N 0.000 description 1
- CRNKGYFOWLZFDQ-UHFFFAOYSA-N 1-pentadecylnaphthalene Chemical compound C1=CC=C2C(CCCCCCCCCCCCCCC)=CC=CC2=C1 CRNKGYFOWLZFDQ-UHFFFAOYSA-N 0.000 description 1
- FDHDUXOBMHHFFJ-UHFFFAOYSA-N 1-pentylnaphthalene Chemical compound C1=CC=C2C(CCCCC)=CC=CC2=C1 FDHDUXOBMHHFFJ-UHFFFAOYSA-N 0.000 description 1
- JPWUOWNCHOYFEN-UHFFFAOYSA-N 2,6-bis(2-chloroethyl)phenol Chemical compound OC1=C(CCCl)C=CC=C1CCCl JPWUOWNCHOYFEN-UHFFFAOYSA-N 0.000 description 1
- IKWYDWRGPXTPHV-UHFFFAOYSA-N 2,6-bis(2-chlorophenoxy)phenol Chemical class C1=CC=C(OC=2C(=CC=CC=2)Cl)C(O)=C1OC1=CC=CC=C1Cl IKWYDWRGPXTPHV-UHFFFAOYSA-N 0.000 description 1
- LBPCXYZANZSPPY-UHFFFAOYSA-N 2,6-bis(3-chloropropyl)phenol Chemical compound OC1=C(CCCCl)C=CC=C1CCCCl LBPCXYZANZSPPY-UHFFFAOYSA-N 0.000 description 1
- DUCSXVAAPCQAEP-UHFFFAOYSA-N 2,6-dibenzylphenol Chemical compound C1=CC=C(CC=2C=CC=CC=2)C(O)=C1CC1=CC=CC=C1 DUCSXVAAPCQAEP-UHFFFAOYSA-N 0.000 description 1
- PZPVXSMCRLNVRD-UHFFFAOYSA-N 2,6-dibutylphenol Chemical class CCCCC1=CC=CC(CCCC)=C1O PZPVXSMCRLNVRD-UHFFFAOYSA-N 0.000 description 1
- RGWXSQCOYFRTKU-UHFFFAOYSA-N 2,6-didodecylphenol Chemical compound CCCCCCCCCCCCC1=CC=CC(CCCCCCCCCCCC)=C1O RGWXSQCOYFRTKU-UHFFFAOYSA-N 0.000 description 1
- SMSZXONJAYKZCU-UHFFFAOYSA-N 2,6-diethoxyphenol Chemical compound CCOC1=CC=CC(OCC)=C1O SMSZXONJAYKZCU-UHFFFAOYSA-N 0.000 description 1
- METWAQRCMRWDAW-UHFFFAOYSA-N 2,6-diethylphenol Chemical compound CCC1=CC=CC(CC)=C1O METWAQRCMRWDAW-UHFFFAOYSA-N 0.000 description 1
- DZGKJLQPDIKXFT-UHFFFAOYSA-N 2,6-dimethylphenol;toluene Chemical compound CC1=CC=CC=C1.CC1=CC=CC(C)=C1O DZGKJLQPDIKXFT-UHFFFAOYSA-N 0.000 description 1
- ATGFTMUSEPZNJD-UHFFFAOYSA-N 2,6-diphenylphenol Chemical compound OC1=C(C=2C=CC=CC=2)C=CC=C1C1=CC=CC=C1 ATGFTMUSEPZNJD-UHFFFAOYSA-N 0.000 description 1
- NAILKKRDWBJCNH-UHFFFAOYSA-N 2,6-dipropylphenol Chemical compound CCCC1=CC=CC(CCC)=C1O NAILKKRDWBJCNH-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- VEUMANXWQDHAJV-UHFFFAOYSA-N 2-[2-[(2-hydroxyphenyl)methylideneamino]ethyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCN=CC1=CC=CC=C1O VEUMANXWQDHAJV-UHFFFAOYSA-N 0.000 description 1
- HBAWYVGIKDXZDG-UHFFFAOYSA-N 2-[2-[2-[2-[(2-hydroxyphenyl)methylideneamino]ethylsulfanyl]ethylsulfanyl]ethyliminomethyl]phenol Chemical compound OC1=CC=CC=C1C=NCCSCCSCCN=CC1=CC=CC=C1O HBAWYVGIKDXZDG-UHFFFAOYSA-N 0.000 description 1
- NHPYZDWJKMTYLZ-UHFFFAOYSA-N 2-ethoxy-6-methoxyphenol Chemical compound CCOC1=CC=CC(OC)=C1O NHPYZDWJKMTYLZ-UHFFFAOYSA-N 0.000 description 1
- IEURJKJFIZRKAG-UHFFFAOYSA-N 2-ethyl-4-octadecoxyphenol Chemical compound CCCCCCCCCCCCCCCCCCOC1=CC=C(O)C(CC)=C1 IEURJKJFIZRKAG-UHFFFAOYSA-N 0.000 description 1
- HOEFKWVMQYMLHU-UHFFFAOYSA-N 2-hydroxyimino-1,2-bis(4-methoxyphenyl)ethanol Chemical compound C1=CC(OC)=CC=C1C(O)C(=NO)C1=CC=C(OC)C=C1 HOEFKWVMQYMLHU-UHFFFAOYSA-N 0.000 description 1
- OLBYFEGTUWWPTR-UHFFFAOYSA-N 2-hydroxyimino-1,2-diphenylethanone Chemical compound C=1C=CC=CC=1C(=NO)C(=O)C1=CC=CC=C1 OLBYFEGTUWWPTR-UHFFFAOYSA-N 0.000 description 1
- WITWFSHCQMAXKW-UHFFFAOYSA-N 2-hydroxyimino-1-phenylbutan-1-ol Chemical compound CCC(=NO)C(O)C1=CC=CC=C1 WITWFSHCQMAXKW-UHFFFAOYSA-N 0.000 description 1
- BWVHLTNCVRBWKW-UHFFFAOYSA-N 2-methyl-6-(2-methylpropyl)phenol Chemical compound CC(C)CC1=CC=CC(C)=C1O BWVHLTNCVRBWKW-UHFFFAOYSA-N 0.000 description 1
- PGJXFACHLLIKFG-UHFFFAOYSA-N 2-methyl-6-phenylphenol Chemical compound CC1=CC=CC(C=2C=CC=CC=2)=C1O PGJXFACHLLIKFG-UHFFFAOYSA-N 0.000 description 1
- UVDVFLATQHIDPM-UHFFFAOYSA-N 2-methyliminoethanol Chemical compound CN=CCO UVDVFLATQHIDPM-UHFFFAOYSA-N 0.000 description 1
- YNFBMDWHEHETJW-UHFFFAOYSA-N 2-pyridin-2-yl-1h-benzimidazole Chemical compound N1=CC=CC=C1C1=NC2=CC=CC=C2N1 YNFBMDWHEHETJW-UHFFFAOYSA-N 0.000 description 1
- QPIOXOJERGNNMX-UHFFFAOYSA-N 3-(3-aminopropylsulfanyl)propan-1-amine Chemical compound NCCCSCCCN QPIOXOJERGNNMX-UHFFFAOYSA-N 0.000 description 1
- FVWLNKQRYYNYKJ-UHFFFAOYSA-N 3-chloro-2,6-dimethylphenol Chemical compound CC1=CC=C(Cl)C(C)=C1O FVWLNKQRYYNYKJ-UHFFFAOYSA-N 0.000 description 1
- LJOBNZKCJNRMFE-UHFFFAOYSA-N 3-hydroxyiminobutan-2-ol Chemical compound CC(O)C(C)=NO LJOBNZKCJNRMFE-UHFFFAOYSA-N 0.000 description 1
- OMMSGJSEZJLPGW-UHFFFAOYSA-N 3-hydroxyiminopentan-2-ol Chemical compound CCC(=NO)C(C)O OMMSGJSEZJLPGW-UHFFFAOYSA-N 0.000 description 1
- ICNFHJVPAJKPHW-UHFFFAOYSA-N 4,4'-Thiodianiline Chemical compound C1=CC(N)=CC=C1SC1=CC=C(N)C=C1 ICNFHJVPAJKPHW-UHFFFAOYSA-N 0.000 description 1
- YBRVSVVVWCFQMG-UHFFFAOYSA-N 4,4'-diaminodiphenylmethane Chemical compound C1=CC(N)=CC=C1CC1=CC=C(N)C=C1 YBRVSVVVWCFQMG-UHFFFAOYSA-N 0.000 description 1
- HLBLWEWZXPIGSM-UHFFFAOYSA-N 4-Aminophenyl ether Chemical compound C1=CC(N)=CC=C1OC1=CC=C(N)C=C1 HLBLWEWZXPIGSM-UHFFFAOYSA-N 0.000 description 1
- BLFRQYKZFKYQLO-UHFFFAOYSA-N 4-aminobutan-1-ol Chemical compound NCCCCO BLFRQYKZFKYQLO-UHFFFAOYSA-N 0.000 description 1
- CFCVHJRJEWDVOG-UHFFFAOYSA-N 4-chloro-2,3-dimethylphenol Chemical compound CC1=C(C)C(Cl)=CC=C1O CFCVHJRJEWDVOG-UHFFFAOYSA-N 0.000 description 1
- IPDXWXPSCKSIII-UHFFFAOYSA-N 4-propan-2-ylbenzene-1,3-diamine Chemical compound CC(C)C1=CC=C(N)C=C1N IPDXWXPSCKSIII-UHFFFAOYSA-N 0.000 description 1
- MFRKYEJMLQUSJX-UHFFFAOYSA-N 4-propan-2-ylcyclohexan-1-amine Chemical compound CC(C)C1CCC(N)CC1 MFRKYEJMLQUSJX-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- 101000933542 Homo sapiens Transcription factor BTF3 Proteins 0.000 description 1
- 102000006835 Lamins Human genes 0.000 description 1
- 108010047294 Lamins Proteins 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- WUGQZFFCHPXWKQ-UHFFFAOYSA-N Propanolamine Chemical compound NCCCO WUGQZFFCHPXWKQ-UHFFFAOYSA-N 0.000 description 1
- 229920000297 Rayon Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 102100026043 Transcription factor BTF3 Human genes 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 229940067621 aminobutyrate Drugs 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 150000004984 aromatic diamines Chemical class 0.000 description 1
- 239000003637 basic solution Substances 0.000 description 1
- HFACYLZERDEVSX-UHFFFAOYSA-N benzidine Chemical compound C1=CC(N)=CC=C1C1=CC=C(N)C=C1 HFACYLZERDEVSX-UHFFFAOYSA-N 0.000 description 1
- WAKHLWOJMHVUJC-UHFFFAOYSA-N benzoin alpha-oxime Natural products C=1C=CC=CC=1C(=NO)C(O)C1=CC=CC=C1 WAKHLWOJMHVUJC-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 150000001721 carbon Chemical group 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- MTFJSAGADRTKCI-VMPITWQZSA-N chembl77510 Chemical compound O\N=C\C1=CC=CC=N1 MTFJSAGADRTKCI-VMPITWQZSA-N 0.000 description 1
- 239000007809 chemical reaction catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 description 1
- 239000000460 chlorine Chemical group 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- VKIRRGRTJUUZHS-UHFFFAOYSA-N cyclohexane-1,4-diamine Chemical compound NC1CCC(N)CC1 VKIRRGRTJUUZHS-UHFFFAOYSA-N 0.000 description 1
- NISGSNTVMOOSJQ-UHFFFAOYSA-N cyclopentanamine Chemical compound NC1CCCC1 NISGSNTVMOOSJQ-UHFFFAOYSA-N 0.000 description 1
- UFULAYFCSOUIOV-UHFFFAOYSA-N cysteamine Chemical compound NCCS UFULAYFCSOUIOV-UHFFFAOYSA-N 0.000 description 1
- JGUQDUKBUKFFRO-CIIODKQPSA-N dimethylglyoxime Chemical compound O/N=C(/C)\C(\C)=N\O JGUQDUKBUKFFRO-CIIODKQPSA-N 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- NAQMVNRVTILPCV-UHFFFAOYSA-N hexane-1,6-diamine Chemical compound NCCCCCCN NAQMVNRVTILPCV-UHFFFAOYSA-N 0.000 description 1
- OANQELUUJGCUOQ-UHFFFAOYSA-N hexaphenylene Chemical group C1=CC=C2C3=CC=CC=C3C3=CC=CC=C3C3=CC=CC=C3C3=CC=CC=C3C3=CC=CC=C3C2=C1 OANQELUUJGCUOQ-UHFFFAOYSA-N 0.000 description 1
- BRWIZMBXBAOCCF-UHFFFAOYSA-N hydrazinecarbothioamide Chemical compound NNC(N)=S BRWIZMBXBAOCCF-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-N hydroperoxyl Chemical group O[O] OUUQCZGPVNCOIJ-UHFFFAOYSA-N 0.000 description 1
- 239000011630 iodine Chemical group 0.000 description 1
- 229910052740 iodine Chemical group 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 210000005053 lamin Anatomy 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- IVSZLXZYQVIEFR-UHFFFAOYSA-N m-xylene Chemical group CC1=CC=CC(C)=C1 IVSZLXZYQVIEFR-UHFFFAOYSA-N 0.000 description 1
- 229960003151 mercaptamine Drugs 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000012046 mixed solvent Substances 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- KFIGICHILYTCJF-UHFFFAOYSA-N n'-methylethane-1,2-diamine Chemical compound CNCCN KFIGICHILYTCJF-UHFFFAOYSA-N 0.000 description 1
- FWSXGNXGAJUIPS-UHFFFAOYSA-N n-pentan-2-ylidenehydroxylamine Chemical compound CCCC(C)=NO FWSXGNXGAJUIPS-UHFFFAOYSA-N 0.000 description 1
- KQSABULTKYLFEV-UHFFFAOYSA-N naphthalene-1,5-diamine Chemical compound C1=CC=C2C(N)=CC=CC2=C1N KQSABULTKYLFEV-UHFFFAOYSA-N 0.000 description 1
- 239000012038 nucleophile Substances 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- 150000002894 organic compounds Chemical group 0.000 description 1
- 230000001151 other effect Effects 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 125000003544 oxime group Chemical group 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- NFHFRUOZVGFOOS-UHFFFAOYSA-N palladium;triphenylphosphane Chemical compound [Pd].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 NFHFRUOZVGFOOS-UHFFFAOYSA-N 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 125000003367 polycyclic group Chemical class 0.000 description 1
- 229920001955 polyphenylene ether Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003335 secondary amines Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- YBRBMKDOPFTVDT-UHFFFAOYSA-N tert-butylamine Chemical compound CC(C)(C)N YBRBMKDOPFTVDT-UHFFFAOYSA-N 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G65/00—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule
- C08G65/34—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives
- C08G65/38—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols
- C08G65/44—Macromolecular compounds obtained by reactions forming an ether link in the main chain of the macromolecule from hydroxy compounds or their metallic derivatives derived from phenols by oxidation of phenols
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyethers (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/534,903 US3965069A (en) | 1974-12-20 | 1974-12-20 | Polyphenylene oxide is prepared using a mixture of manganese chelates as a catalyst |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2557333A1 true DE2557333A1 (de) | 1976-07-08 |
Family
ID=24131999
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752557333 Withdrawn DE2557333A1 (de) | 1974-12-20 | 1975-12-19 | Verfahren zur herstellung von polyphenylenoxid |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3965069A (enExample) |
| JP (1) | JPS5922737B2 (enExample) |
| CA (1) | CA1061046A (enExample) |
| DE (1) | DE2557333A1 (enExample) |
| FR (1) | FR2295057A1 (enExample) |
| GB (1) | GB1521050A (enExample) |
| NL (1) | NL7514889A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0491190A3 (en) * | 1990-12-18 | 1993-07-07 | General Electric Company | Polyphenylene ether process and resin composition |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4035357A (en) * | 1976-10-18 | 1977-07-12 | General Electric Company | Improved polyphenylene ether polymerization process using methylene chloride as solvent |
| US4187361A (en) * | 1976-12-21 | 1980-02-05 | General Electric Company | Method for preparing polyphenylene oxides with manganese-vinyl resin complexes |
| US4093598A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Oxidative coupling of phenolic monomers in the presence of manganese complexes of manganese phenyl benzoin oxime catalysts |
| US4075174A (en) * | 1976-12-21 | 1978-02-21 | General Electric Company | Promotion of manganese chelate catalyzed polyphenylene ether oxide polymerization reactions |
| US4093596A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Method for polymerization of polyphenylene oxides |
| US4093597A (en) * | 1976-12-21 | 1978-06-06 | General Electric Company | Polymerization of 2,6-di-substituted phenols |
| US4110312A (en) * | 1976-12-21 | 1978-08-29 | General Electric Company | Method for preparing polyphenylene oxides with manganese-vinyl resin complexes |
| US4427594A (en) | 1976-12-21 | 1984-01-24 | General Electric Company | Oxidative coupling of phenolic monomers with manganese complexes of phenyl benzoin oxime catalysts |
| US4226951A (en) * | 1978-06-19 | 1980-10-07 | General Electric Company | Block polymers of polyphenylene oxide and polystyrene |
| US4335234A (en) * | 1979-10-24 | 1982-06-15 | General Electric Company | Use of manganese chelate to oxidatively couple phenolic compound in a self-precipitating system |
| DE3340493A1 (de) * | 1983-11-09 | 1985-05-15 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von bifunktionellen polyphenylenoxiden |
| DE3445570A1 (de) * | 1984-12-14 | 1986-06-19 | Basf Ag, 6700 Ludwigshafen | Selbstverloeschende thermoplastische polyesterformmassen |
| JPH02258559A (ja) * | 1989-03-07 | 1990-10-19 | Sonoco Prod Co | 開口の容易なプラスチックフィルム製バッグ、その製造方法及びその開口方法 |
| US5250486A (en) * | 1990-12-18 | 1993-10-05 | General Electric Company | Polyphenylene ether process and resin composition |
| IT1251150B (it) * | 1991-08-05 | 1995-05-04 | Enichem Polimeri | Composizione termoplastica tenacizzata a base di polifenilenetere e poliammide |
| EP0666278A3 (en) * | 1994-02-03 | 1996-01-17 | Sumitomo Chemical Co | Polyphenylene ether resin composition. |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1570458A1 (de) * | 1965-07-14 | 1969-09-18 | Dynamit Nobel Ag | Verfahren zur Herstellung von Polyphenylenoxyden |
| JPS4826398B1 (enExample) * | 1970-12-18 | 1973-08-09 | ||
| US3825521A (en) * | 1971-07-31 | 1974-07-23 | Asahi Dow Ltd | Manganese amine chelate catalyzed aromatic polyether formation |
| US3784575A (en) * | 1972-05-05 | 1974-01-08 | Ici America Inc | Oxidation of phenols |
-
1974
- 1974-12-20 US US05/534,903 patent/US3965069A/en not_active Expired - Lifetime
-
1975
- 1975-12-16 GB GB51416/75A patent/GB1521050A/en not_active Expired
- 1975-12-18 CA CA242,339A patent/CA1061046A/en not_active Expired
- 1975-12-19 JP JP50150760A patent/JPS5922737B2/ja not_active Expired
- 1975-12-19 NL NL7514889A patent/NL7514889A/xx not_active Application Discontinuation
- 1975-12-19 DE DE19752557333 patent/DE2557333A1/de not_active Withdrawn
- 1975-12-19 FR FR7539110A patent/FR2295057A1/fr active Granted
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0491190A3 (en) * | 1990-12-18 | 1993-07-07 | General Electric Company | Polyphenylene ether process and resin composition |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2295057A1 (fr) | 1976-07-16 |
| GB1521050A (en) | 1978-08-09 |
| JPS5187600A (enExample) | 1976-07-31 |
| JPS5922737B2 (ja) | 1984-05-29 |
| NL7514889A (nl) | 1976-06-22 |
| FR2295057B1 (enExample) | 1979-09-14 |
| US3965069A (en) | 1976-06-22 |
| CA1061046A (en) | 1979-08-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2557333A1 (de) | Verfahren zur herstellung von polyphenylenoxid | |
| DE2527759C2 (de) | Verfahren zum Herstellen der Selbstkondensationsprodukte eines Phenols unter Verwendung eines Mangan-(II)ω-Hydroxyoxim-Chelatkomplexes als Katalysator | |
| DE2622700C2 (de) | Verfahren zur Herstellung von Polyphenylenoxiden | |
| DE2521985A1 (de) | Verfahren zur herstellung eines polyphenylenaethers | |
| DE2528045C2 (de) | Verfahren zur Herstellung von Selbstkondensationsprodukten von Phenolen | |
| DE1570683B2 (enExample) | ||
| DE2755937A1 (de) | Verfahren zur steuerung der grundmolaren viskositaetszahl von polyphenylenaether-reaktionsmischungen | |
| DE69005541T2 (de) | Verfahren zur Herstellung von aryloxytriazin-verkappten Polyphenylenethern. | |
| EP0184149B1 (de) | Poly(phenylenether) und Verfahren zu ihrer Herstellung | |
| DE3805697A1 (de) | Verfahren zur herstellung von p-hydroxy-benzaldehyden | |
| DE2155303C3 (de) | Verfahren zur Herstellung von Polyp henylenoxiden | |
| DE2451905A1 (de) | Verfahren zur herstellung von polyphenylenoxiden mit niedrigem molekulargewicht | |
| DE3325894A1 (de) | Verfahren zur entfernung des katalysators aus polyphenylenethern | |
| DE3417433A1 (de) | Katalysator und verfahren zur herstellung von polyphenylenoxid unter verwendung des katalysators | |
| DE2460323C2 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| DE2446425A1 (de) | Verfahren zur herstellung von polyphenylenaethern bei erhoehtem druck | |
| DE60012705T2 (de) | Katalysator für die oxidative polymerisation von fluorphenolen, verfahren zur oxidativen polymerisation von fluorphenolen und polyoxifluorphenylenderivate | |
| DE2756111A1 (de) | Verfahren zur herstellung eines polyphenylenoxid-harzes unter verwendung eines manganchelat-katalysators | |
| DE2160419A1 (de) | Verfahren zur Herstellung von Polyphenylenoxiden | |
| DE2217161C3 (de) | Verfahren zur Herstellung von Polyphenylenoxide!) | |
| DE3113096A1 (de) | Verfahren zur herstellung von polyphenylenethern | |
| EP0059374B1 (de) | Verfahren zur Herstellung von Polyphenylenäthern | |
| DE3029208A1 (de) | Verfahren zur herstellung von polyphenylenaethern | |
| DE60010545T2 (de) | Kristallisierbares Poly(2,5-disubstituiertes-1,4-phenylenoxid) und ein Verfahren zu seiner Herstellung | |
| DE3035599A1 (de) | Verfahren zur herstellung von polyphenylenaethern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8130 | Withdrawal |