DE2545391A1 - Elektrochrome anzeigeeinheit - Google Patents
Elektrochrome anzeigeeinheitInfo
- Publication number
- DE2545391A1 DE2545391A1 DE19752545391 DE2545391A DE2545391A1 DE 2545391 A1 DE2545391 A1 DE 2545391A1 DE 19752545391 DE19752545391 DE 19752545391 DE 2545391 A DE2545391 A DE 2545391A DE 2545391 A1 DE2545391 A1 DE 2545391A1
- Authority
- DE
- Germany
- Prior art keywords
- separator
- display unit
- electrochromic
- unit according
- layer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000000758 substrate Substances 0.000 claims description 33
- 239000000463 material Substances 0.000 claims description 21
- 239000000049 pigment Substances 0.000 claims description 19
- 239000003792 electrolyte Substances 0.000 claims description 11
- 239000011148 porous material Substances 0.000 claims description 10
- 239000011244 liquid electrolyte Substances 0.000 claims description 8
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 7
- 239000002245 particle Substances 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 4
- -1 polypropylene Polymers 0.000 claims description 4
- 239000000843 powder Substances 0.000 claims description 4
- 239000004743 Polypropylene Substances 0.000 claims description 3
- 229920001155 polypropylene Polymers 0.000 claims description 3
- 238000007789 sealing Methods 0.000 claims description 3
- 239000004408 titanium dioxide Substances 0.000 claims description 3
- 239000012528 membrane Substances 0.000 claims description 2
- 239000000203 mixture Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 30
- 230000003287 optical effect Effects 0.000 description 5
- 239000011521 glass Substances 0.000 description 3
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 229910001930 tungsten oxide Inorganic materials 0.000 description 3
- 239000000020 Nitrocellulose Substances 0.000 description 2
- 239000004809 Teflon Substances 0.000 description 2
- 229920006362 Teflon® Polymers 0.000 description 2
- FJWGYAHXMCUOOM-QHOUIDNNSA-N [(2s,3r,4s,5r,6r)-2-[(2r,3r,4s,5r,6s)-4,5-dinitrooxy-2-(nitrooxymethyl)-6-[(2r,3r,4s,5r,6s)-4,5,6-trinitrooxy-2-(nitrooxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-3,5-dinitrooxy-6-(nitrooxymethyl)oxan-4-yl] nitrate Chemical compound O([C@@H]1O[C@@H]([C@H]([C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O)O[C@H]1[C@@H]([C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@@H](CO[N+]([O-])=O)O1)O[N+]([O-])=O)CO[N+](=O)[O-])[C@@H]1[C@@H](CO[N+]([O-])=O)O[C@@H](O[N+]([O-])=O)[C@H](O[N+]([O-])=O)[C@H]1O[N+]([O-])=O FJWGYAHXMCUOOM-QHOUIDNNSA-N 0.000 description 2
- 239000012790 adhesive layer Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000003618 dip coating Methods 0.000 description 2
- 230000005684 electric field Effects 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 239000010445 mica Substances 0.000 description 2
- 229910052618 mica group Inorganic materials 0.000 description 2
- 229920001220 nitrocellulos Polymers 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- CMSGUKVDXXTJDQ-UHFFFAOYSA-N 4-(2-naphthalen-1-ylethylamino)-4-oxobutanoic acid Chemical compound C1=CC=C2C(CCNC(=O)CCC(=O)O)=CC=CC2=C1 CMSGUKVDXXTJDQ-UHFFFAOYSA-N 0.000 description 1
- 229920013683 Celanese Polymers 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000919 ceramic Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 230000037427 ion transport Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000002932 luster Substances 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 238000010422 painting Methods 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000647 polyepoxide Polymers 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000007650 screen-printing Methods 0.000 description 1
- 239000011343 solid material Substances 0.000 description 1
- 125000006850 spacer group Chemical group 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000004544 sputter deposition Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 description 1
- 229910001887 tin oxide Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- CMPGARWFYBADJI-UHFFFAOYSA-L tungstic acid Chemical compound O[W](O)(=O)=O CMPGARWFYBADJI-UHFFFAOYSA-L 0.000 description 1
- 238000007738 vacuum evaporation Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/15—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on an electrochromic effect
- G02F1/153—Constructional details
- G02F1/1533—Constructional details structural features not otherwise provided for
Landscapes
- Physics & Mathematics (AREA)
- Nonlinear Science (AREA)
- General Physics & Mathematics (AREA)
- Optics & Photonics (AREA)
- Electrochromic Elements, Electrophoresis, Or Variable Reflection Or Absorption Elements (AREA)
- Devices For Indicating Variable Information By Combining Individual Elements (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/540,481 US3944333A (en) | 1975-01-13 | 1975-01-13 | Electrochromic display with porous separator |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2545391A1 true DE2545391A1 (de) | 1976-07-15 |
Family
ID=24155636
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752545391 Withdrawn DE2545391A1 (de) | 1975-01-13 | 1975-10-10 | Elektrochrome anzeigeeinheit |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3944333A (https=) |
| JP (1) | JPS5199057A (https=) |
| CA (1) | CA1027221A (https=) |
| CH (1) | CH588713A5 (https=) |
| DE (1) | DE2545391A1 (https=) |
| FR (1) | FR2297471A1 (https=) |
| GB (1) | GB1494955A (https=) |
| HK (1) | HK27678A (https=) |
| MX (1) | MX3163E (https=) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2802728A1 (de) * | 1977-01-24 | 1978-07-27 | Sharp Kk | Elektrochrome anzeigezelle |
| DE2902106A1 (de) * | 1978-01-23 | 1979-07-26 | Sharp Kk | Elektrochrome anzeigevorrichtung mit einem elektrolytimpraegnierten trennelement und verfahren zur verbesserung der elektrolyt-aufnahmefaehigkeit des trennelements |
| DE3034525A1 (de) * | 1979-10-12 | 1981-04-23 | Sumitomo Electric Industries, Ltd., Osaka | Elektrochrome anzeige-einrichtung |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4021100A (en) * | 1974-09-03 | 1977-05-03 | American Cyanamid Company | Electrochromic device having an electrolyte contained in a solid porous insulating layer |
| CH582364A5 (https=) * | 1975-01-06 | 1976-11-30 | Bbc Brown Boveri & Cie | |
| CH612276A5 (https=) * | 1975-05-07 | 1979-07-13 | Bbc Brown Boveri & Cie | |
| JPS5289341A (en) * | 1976-01-20 | 1977-07-26 | Sharp Corp | Indication device |
| US4187004A (en) * | 1977-01-28 | 1980-02-05 | Sharp Kabushiki Kaisha | Negative type display in electrochromic display device |
| AU503856B2 (en) * | 1977-04-27 | 1979-09-20 | Timex Corporation | Electrochromic display |
| US4142783A (en) * | 1977-05-31 | 1979-03-06 | International Business Machines Corporation | Reversible electrochromic display device having memory |
| CA1110351A (en) * | 1977-06-01 | 1981-10-06 | Louis Destannes | Fabrication of a liquid-film display cell |
| US4128316A (en) * | 1977-06-15 | 1978-12-05 | Timex Corporation | Thin electrochromic display |
| US4128315A (en) * | 1977-06-15 | 1978-12-05 | Timex Corporation | Thin electrochromic display |
| DE2741051A1 (de) * | 1977-09-12 | 1979-03-15 | Siemens Ag | Elektrochrome anzeigevorrichtung |
| JPS5466159A (en) * | 1977-11-05 | 1979-05-28 | Tdk Corp | Electrochromic display device |
| SU851320A1 (ru) * | 1978-05-16 | 1981-07-30 | Предприятие П/Я Р-6429 | Электрохромный индикатор |
| JPS5542853U (https=) * | 1978-09-12 | 1980-03-19 | ||
| US4214820A (en) * | 1978-09-15 | 1980-07-29 | Timex Corporation | Electrochromic display having enhanced night viewability |
| US4240713A (en) * | 1978-11-08 | 1980-12-23 | Timex Corporation | Electrode barrier layer for hydrogen-colored electrochromic displays |
| US4306773A (en) * | 1978-11-20 | 1981-12-22 | General Motors Corporation | Electrochromic display device having reduced film dissolution |
| US4277147A (en) * | 1979-01-15 | 1981-07-07 | General Motors Corporation | Display device having reduced electrochromic film dissolution |
| JPS5660417A (en) * | 1979-10-23 | 1981-05-25 | Sumitomo Electric Ind Ltd | Electrochromic display device |
| JPS5694386A (en) * | 1979-12-27 | 1981-07-30 | Suwa Seikosha Kk | Liquiddcrystal display unit |
| US6515787B1 (en) | 2000-03-07 | 2003-02-04 | Eclipse Energy Systems, Inc. | Electrochromic layer |
| FR2825481B1 (fr) | 2001-05-31 | 2003-07-18 | Commissariat Energie Atomique | Structure electrochrome souple et procedes de fabrication de cette structure |
| US7009750B1 (en) | 2002-10-25 | 2006-03-07 | Eclipse Energy Systems, Inc. | Apparatus and methods for modulating refractive index |
| EP1519212A1 (en) * | 2003-09-27 | 2005-03-30 | 3M Innovative Properties Company | Display device for irreversibly switching from a first state to a second state |
| CN119684997B (zh) * | 2025-02-24 | 2025-05-13 | 德州学院 | 一种H4[SiW12O40]/PVP变色材料的制备方法及其在制备电致/光致双响应显示器件中的应用 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3692388A (en) * | 1969-11-28 | 1972-09-19 | Polaroid Corp | Electrically responsive light filter |
| US3807832A (en) * | 1972-11-09 | 1974-04-30 | American Cyanamid Co | Electrochromic (ec) mirror which rapidly changes reflectivity |
| US3844636A (en) * | 1972-12-13 | 1974-10-29 | American Cyanamid Co | Electrochromic mirror |
| JPS5087347A (https=) * | 1973-12-04 | 1975-07-14 | ||
| US3892472A (en) * | 1973-12-26 | 1975-07-01 | American Cyanamid Co | Self-supporting pigment layers for electrochromic display |
| CA1038071A (en) * | 1974-09-03 | 1978-09-05 | American Cyanamid Company | Acid wetted "solid" electrochromic structure |
-
1975
- 1975-01-13 US US05/540,481 patent/US3944333A/en not_active Expired - Lifetime
- 1975-08-27 CA CA234,286A patent/CA1027221A/en not_active Expired
- 1975-09-02 MX MX100235U patent/MX3163E/es unknown
- 1975-09-12 GB GB37664/75A patent/GB1494955A/en not_active Expired
- 1975-10-10 DE DE19752545391 patent/DE2545391A1/de not_active Withdrawn
- 1975-10-14 CH CH1333075A patent/CH588713A5/xx not_active IP Right Cessation
-
1976
- 1976-01-05 FR FR7600079A patent/FR2297471A1/fr active Granted
- 1976-01-12 JP JP51002685A patent/JPS5199057A/ja active Pending
-
1978
- 1978-06-01 HK HK276/78A patent/HK27678A/xx unknown
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2802728A1 (de) * | 1977-01-24 | 1978-07-27 | Sharp Kk | Elektrochrome anzeigezelle |
| DE2902106A1 (de) * | 1978-01-23 | 1979-07-26 | Sharp Kk | Elektrochrome anzeigevorrichtung mit einem elektrolytimpraegnierten trennelement und verfahren zur verbesserung der elektrolyt-aufnahmefaehigkeit des trennelements |
| DE3034525A1 (de) * | 1979-10-12 | 1981-04-23 | Sumitomo Electric Industries, Ltd., Osaka | Elektrochrome anzeige-einrichtung |
Also Published As
| Publication number | Publication date |
|---|---|
| US3944333A (en) | 1976-03-16 |
| AU8438875A (en) | 1977-03-03 |
| HK27678A (en) | 1978-06-09 |
| CA1027221A (en) | 1978-02-28 |
| JPS5199057A (https=) | 1976-09-01 |
| GB1494955A (en) | 1977-12-14 |
| FR2297471B1 (https=) | 1981-09-18 |
| FR2297471A1 (fr) | 1976-08-06 |
| CH588713A5 (https=) | 1977-06-15 |
| MX3163E (es) | 1980-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2545391A1 (de) | Elektrochrome anzeigeeinheit | |
| DE3886609T2 (de) | Zelle für Lichtmodulation. | |
| DE3586742T2 (de) | Fluessigkristall-mehrfarbenanzeigevorrichtung. | |
| DE2752191C2 (de) | Elektrophoretische Bildwiedergabevorrichtung | |
| DE2164155C3 (https=) | ||
| DE2854175C2 (de) | Wiedergabevorrichtung mit einem flüssigen Wiedergabemedium | |
| DE3886610T2 (de) | Herstellungstechnik einer Lichtmodulationsvorrichtung. | |
| DE2737031C2 (de) | Ansteuerschaltung für elektrochrome Anzeigeelemente | |
| DE2828185C2 (de) | Elektrochrome Anzeigevorrichtung mit einer Zusatzelektrode | |
| DE3886841T2 (de) | Verfahren zur Herstellung einer Lichtmodulationsvorrichtung. | |
| DE2401974B2 (de) | Fluessigkristallanzeigeelement | |
| DE3123697A1 (de) | "elektrochromes ganzfestkoerper-anzeigebauelement" | |
| DE3237323A1 (de) | Anzeigevorrichtung | |
| DE2731718C3 (de) | Elektrochrome Anzeigevorrichtung | |
| DE2922473C2 (de) | Elektrochrome Anzeigevorrichtung | |
| DE4438597A1 (de) | Zifferblattstruktur für eine Uhr | |
| DE2638775A1 (de) | Elektrochrome anzeigeeinheit und verfahren zu ihrer herstellung | |
| DE3885809T2 (de) | Verfahren zur Lichtmodulation. | |
| DE2715632A1 (de) | Elektrochrome anzeigeeinheit | |
| DE2750387C2 (de) | Elektrochrome Anzeigevorrichtung | |
| DE3812030C2 (https=) | ||
| DE2756551A1 (de) | Elektrochrome anzeige | |
| DE2902511A1 (de) | Elektrochrome anzeigevorrichtung | |
| DE2858076C2 (de) | Verfahren zur Ansteuerung einer elektrochromen Anzeigevorrichtung | |
| DE2803604A1 (de) | Elektrochrome anzeigevorrichtung fuer negativanzeige |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8178 | Suspension cancelled | ||
| 8130 | Withdrawal |