DE2544511C3 - Empfänger mit einer Abstimmschaltung mit einer Sendersuchanordnung - Google Patents
Empfänger mit einer Abstimmschaltung mit einer SendersuchanordnungInfo
- Publication number
- DE2544511C3 DE2544511C3 DE2544511A DE2544511A DE2544511C3 DE 2544511 C3 DE2544511 C3 DE 2544511C3 DE 2544511 A DE2544511 A DE 2544511A DE 2544511 A DE2544511 A DE 2544511A DE 2544511 C3 DE2544511 C3 DE 2544511C3
- Authority
- DE
- Germany
- Prior art keywords
- group
- tuning
- transmitter
- memory
- receiver
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 claims description 7
- BHMLFPOTZYRDKA-IRXDYDNUSA-N (2s)-2-[(s)-(2-iodophenoxy)-phenylmethyl]morpholine Chemical group IC1=CC=CC=C1O[C@@H](C=1C=CC=CC=1)[C@H]1OCCNC1 BHMLFPOTZYRDKA-IRXDYDNUSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000001514 detection method Methods 0.000 description 1
- 238000010586 diagram Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03J—TUNING RESONANT CIRCUITS; SELECTING RESONANT CIRCUITS
- H03J5/00—Discontinuous tuning; Selecting predetermined frequencies; Selecting frequency bands with or without continuous tuning in one or more of the bands, e.g. push-button tuning, turret tuner
- H03J5/02—Discontinuous tuning; Selecting predetermined frequencies; Selecting frequency bands with or without continuous tuning in one or more of the bands, e.g. push-button tuning, turret tuner with variable tuning element having a number of predetermined settings and adjustable to a desired one of these settings
- H03J5/0218—Discontinuous tuning using an electrical variable impedance element, e.g. a voltage variable reactive diode, by selecting the corresponding analogue value between a set of preset values
- H03J5/0227—Discontinuous tuning using an electrical variable impedance element, e.g. a voltage variable reactive diode, by selecting the corresponding analogue value between a set of preset values using a counter
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03J—TUNING RESONANT CIRCUITS; SELECTING RESONANT CIRCUITS
- H03J7/00—Automatic frequency control; Automatic scanning over a band of frequencies
- H03J7/18—Automatic scanning over a band of frequencies
- H03J7/183—Automatic scanning over a band of frequencies combined with selection between different stations transmitting the same programm, e.g. by analysis of the received signal strength
Landscapes
- Channel Selection Circuits, Automatic Tuning Circuits (AREA)
- Circuits Of Receivers In General (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NLAANVRAGE7413161,A NL169008C (nl) | 1974-10-07 | 1974-10-07 | Ontvanger bevattende een afstemschakeling met een zenderzoekinrichting. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2544511A1 DE2544511A1 (de) | 1976-04-15 |
| DE2544511B2 DE2544511B2 (de) | 1979-10-11 |
| DE2544511C3 true DE2544511C3 (de) | 1980-06-26 |
Family
ID=19822225
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2544511A Expired DE2544511C3 (de) | 1974-10-07 | 1975-10-04 | Empfänger mit einer Abstimmschaltung mit einer Sendersuchanordnung |
Country Status (11)
| Country | Link |
|---|---|
| US (1) | US4253194A (enExample) |
| JP (1) | JPS5344767B2 (enExample) |
| AU (1) | AU507229B2 (enExample) |
| CA (1) | CA1059665A (enExample) |
| DE (1) | DE2544511C3 (enExample) |
| FR (1) | FR2287825A1 (enExample) |
| GB (1) | GB1507684A (enExample) |
| HK (1) | HK41979A (enExample) |
| IT (1) | IT1047342B (enExample) |
| NL (1) | NL169008C (enExample) |
| SE (1) | SE412828B (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL176511C (nl) * | 1979-01-17 | 1985-04-16 | Philips Nv | Ontvanger met een zenderzoekschakeling. |
| US4270217A (en) * | 1979-04-30 | 1981-05-26 | Masco Corporation | Processor controlled, service selecting, AM/FM scanning radio receiver |
| US4409688A (en) * | 1979-04-30 | 1983-10-11 | Masco Corporation Of Indiana | Processor controlled, scanning radio receiver including future code developing means |
| NL8000509A (nl) * | 1980-01-28 | 1981-08-17 | Philips Nv | Ontvanger met een zenderzoekschakeling. |
| NL8003087A (nl) * | 1980-05-29 | 1982-01-04 | Philips Nv | Ontvanger met een zenderzoekschakeling. |
| US4347625A (en) * | 1980-06-16 | 1982-08-31 | General Electric Company | Arrangement for cellular operation of a repeater trunking system |
| US4430753A (en) | 1980-07-24 | 1984-02-07 | Mitsubishi Denki Kabushiki Kaisha | Radio receiver |
| SE454227B (sv) * | 1980-08-04 | 1988-04-11 | Mitsubishi Electric Corp | Radiomottagare |
| US4414687A (en) * | 1980-08-04 | 1983-11-08 | Mitsubishi Denki Kabushiki Kaisha | Radio receiver |
| SE458976B (sv) * | 1980-12-04 | 1989-05-22 | Mitsubishi Electric Corp | Flerstationsmottagare |
| US4380826A (en) * | 1980-12-09 | 1983-04-19 | Clarion Co., Ltd. | Control system for channel selection |
| JPS57101417A (en) * | 1980-12-16 | 1982-06-24 | Mitsubishi Electric Corp | Receiver |
| JPS5890684A (ja) * | 1981-11-24 | 1983-05-30 | 株式会社デンソー | 車載ナビゲーション装置 |
| NL8202416A (nl) * | 1982-06-15 | 1984-01-02 | Philips Nv | Ontvanger voor fm-signalen met opslag van zender status code. |
| JPS5916480A (ja) * | 1982-07-19 | 1984-01-27 | Sanyo Electric Co Ltd | 文字多重放送テレビ受像機 |
| US4573210A (en) * | 1983-12-27 | 1986-02-25 | Motorola, Inc. | Null initiated method and system for monitoring a priority channel |
| USRE33157E (en) * | 1983-12-27 | 1990-01-30 | Motorola, Inc. | Null initiated method and system for monitoring a priority channel |
| US5187470A (en) * | 1985-11-27 | 1993-02-16 | Seiko Corp. | Paging system with local channel lists |
| DE3616592A1 (de) * | 1986-05-16 | 1987-11-19 | Blaupunkt Werke Gmbh | Verfahren und schaltungsanordnung zur abstimmung eines autoradios |
| US5732338A (en) * | 1987-07-27 | 1998-03-24 | Prs Corporation | Broadcast receiver capable of autonomous format-scanning, program identification and searching |
| US4969209A (en) * | 1987-07-27 | 1990-11-06 | Prs Corporation | Broadcast receiver capable of selecting stations based upon geographical location and program format |
| US4888815A (en) * | 1987-09-18 | 1989-12-19 | Uniden America Corporation | Scanning radio receiver |
| CA2064821C (en) * | 1989-06-16 | 2001-04-17 | Randolph E. King | Paging system with local channel lists |
| DE4233282A1 (de) * | 1992-10-02 | 1994-04-07 | Becker Autoradio | Verfahren zur Abstimmung eines Rundfunkempfängers unter Verwendung der RDS-Information |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3750030A (en) * | 1970-12-29 | 1973-07-31 | Gen Electric | Frequency switching circuitry for varactor tuned radio receivers |
| US3803494A (en) * | 1972-04-07 | 1974-04-09 | Bendix Corp | Pulse tuning control system for radio receivers |
| US3824475A (en) * | 1973-02-01 | 1974-07-16 | Tennelec | Scanning radio receiver |
| US3895303A (en) * | 1973-09-04 | 1975-07-15 | Gen Res Electronics Inc | Oscillator-actuated bandswitch |
| JPS5325721B2 (enExample) * | 1973-11-07 | 1978-07-28 | ||
| US3942121A (en) * | 1974-09-09 | 1976-03-02 | Texas Instruments Incorporated | Digital tuning method and system |
-
1974
- 1974-10-07 NL NLAANVRAGE7413161,A patent/NL169008C/xx not_active IP Right Cessation
-
1975
- 1975-09-30 CA CA236,770A patent/CA1059665A/en not_active Expired
- 1975-10-03 IT IT69466/75A patent/IT1047342B/it active
- 1975-10-03 SE SE7511101A patent/SE412828B/xx not_active IP Right Cessation
- 1975-10-03 GB GB40574/75A patent/GB1507684A/en not_active Expired
- 1975-10-04 DE DE2544511A patent/DE2544511C3/de not_active Expired
- 1975-10-06 FR FR7530502A patent/FR2287825A1/fr active Granted
- 1975-10-07 AU AU85485/75A patent/AU507229B2/en not_active Expired
- 1975-10-07 JP JP12038875A patent/JPS5344767B2/ja not_active Expired
-
1979
- 1979-01-22 US US06/005,121 patent/US4253194A/en not_active Expired - Lifetime
- 1979-06-28 HK HK419/79A patent/HK41979A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7413161A (nl) | 1976-04-09 |
| SE412828B (sv) | 1980-03-17 |
| FR2287825A1 (fr) | 1976-05-07 |
| AU507229B2 (en) | 1980-02-07 |
| AU8548575A (en) | 1977-04-21 |
| HK41979A (en) | 1979-07-06 |
| NL169008B (nl) | 1981-12-16 |
| GB1507684A (en) | 1978-04-19 |
| IT1047342B (it) | 1980-09-10 |
| US4253194A (en) | 1981-02-24 |
| JPS5164311A (enExample) | 1976-06-03 |
| CA1059665A (en) | 1979-07-31 |
| SE7511101L (sv) | 1976-04-08 |
| FR2287825B1 (enExample) | 1981-02-06 |
| NL169008C (nl) | 1982-05-17 |
| DE2544511A1 (de) | 1976-04-15 |
| DE2544511B2 (de) | 1979-10-11 |
| JPS5344767B2 (enExample) | 1978-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2544511C3 (de) | Empfänger mit einer Abstimmschaltung mit einer Sendersuchanordnung | |
| DE2622956C2 (de) | Elektrische Schaltung zum Melden der Kanalwahl bei einem abstimmbaren Empfänger | |
| DE2313524A1 (de) | Abstimmsteuersystem fuer radioempfaenger | |
| DE3134037C2 (enExample) | ||
| DE2946755A1 (de) | Verfahren und schaltungsanordnung fuer einen rundfunkempfaenger mit sendersuchlauf | |
| DE2838104A1 (de) | Speicherkreis fuer einen tuner | |
| DE2638500C2 (enExample) | ||
| DE2211664A1 (de) | Abstimmeinheit fuer hochfrequenzempfangsgeraete | |
| DE2235938B2 (de) | Kanalwähler für Fernsehempfänger | |
| EP0065552B1 (de) | Schaltungsanordnung zum automatischen anzeigen von alphanumerischen senderkennzeichnungen bei rundfunk- und fernsehempfängern | |
| DE2850733C2 (de) | Rundfunkempfänger, insbesondere UKW- Empfänger, mit einer Einrichtung zur Programm-Direktwahl | |
| DE2556951B2 (de) | Abstimmeinrichtung für Funkempfänger | |
| DE2638816A1 (de) | Verfahren und vorrichtung zur umsetzung eines pluralbitdigitalsignals in ein pulsbreitenmoduliertes signal | |
| DE2933204C2 (enExample) | ||
| DE2804296A1 (de) | Steuerschaltung | |
| DE3236696C2 (de) | HF-Empfänger mit Sendersuchlaufeinrichtung | |
| DE3040465A1 (de) | Empfaenger mit einem speicher fuer abstimmdaten | |
| DE2756828C2 (de) | Abstimmregelanordnung eines Rundfunkempfängers | |
| DE2813727A1 (de) | Empfangsanlage mit anzeige der senderkennung | |
| DE2145386C3 (de) | Kanalwähler | |
| DE2629606A1 (de) | Quasi-analoge-anzeige von kanaelen in rundfunkempfangsgeraeten | |
| DE3200751A1 (de) | Verfahren und empfaenger mit einer abstimmschaltung zur einstellung eines senders | |
| DE2746186A1 (de) | Alphanumerische stationsanzeige an empfaengern fuer hochfrequente elektrische schwingungen | |
| DE3023445A1 (de) | Voreinstellbare abstimmvorrichtung fuer rundfunkempfaenger | |
| DE4233260A1 (de) | Verfahren zur Abstimmung eines Rundfunkempfängers mittels Stationstasten |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |