DE2514322A1 - Neue cephalosporinderivate - Google Patents
Neue cephalosporinderivateInfo
- Publication number
- DE2514322A1 DE2514322A1 DE19752514322 DE2514322A DE2514322A1 DE 2514322 A1 DE2514322 A1 DE 2514322A1 DE 19752514322 DE19752514322 DE 19752514322 DE 2514322 A DE2514322 A DE 2514322A DE 2514322 A1 DE2514322 A1 DE 2514322A1
- Authority
- DE
- Germany
- Prior art keywords
- ring
- group
- carboxylic acid
- mixture
- added
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229930186147 Cephalosporin Natural products 0.000 title claims description 10
- 229940124587 cephalosporin Drugs 0.000 title claims description 10
- 150000001780 cephalosporins Chemical class 0.000 title claims description 10
- -1 thiadiazol-2-yl Chemical group 0.000 claims description 41
- 150000001875 compounds Chemical class 0.000 claims description 34
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 11
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 7
- 125000004434 sulfur atom Chemical group 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 6
- 125000004043 oxo group Chemical group O=* 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 4
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 claims description 3
- 125000003545 alkoxy group Chemical group 0.000 claims description 3
- 125000004414 alkyl thio group Chemical group 0.000 claims description 3
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 claims description 2
- 125000002943 quinolinyl group Chemical group N1=C(C=CC2=CC=CC=C12)* 0.000 claims description 2
- UGUHFDPGDQDVGX-UHFFFAOYSA-N 1,2,3-thiadiazole Chemical group C1=CSN=N1 UGUHFDPGDQDVGX-UHFFFAOYSA-N 0.000 claims 1
- QMDFJHAAWUGVKQ-UHFFFAOYSA-N 2h-thiopyran Chemical group C1SC=CC=C1 QMDFJHAAWUGVKQ-UHFFFAOYSA-N 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 239000003242 anti bacterial agent Substances 0.000 claims 1
- 230000003115 biocidal effect Effects 0.000 claims 1
- 239000000969 carrier Substances 0.000 claims 1
- 239000003814 drug Substances 0.000 claims 1
- 238000004519 manufacturing process Methods 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 104
- 239000000203 mixture Substances 0.000 description 97
- 239000000243 solution Substances 0.000 description 86
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 78
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 75
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 75
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 72
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 59
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 56
- 239000002244 precipitate Substances 0.000 description 52
- 238000001914 filtration Methods 0.000 description 50
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 50
- 239000011541 reaction mixture Substances 0.000 description 50
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 48
- 238000000862 absorption spectrum Methods 0.000 description 46
- 150000003952 β-lactams Chemical class 0.000 description 46
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 37
- 235000017557 sodium bicarbonate Nutrition 0.000 description 37
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 37
- YGBFLZPYDUKSPT-MRVPVSSYSA-N cephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C[C@H]21 YGBFLZPYDUKSPT-MRVPVSSYSA-N 0.000 description 36
- 238000006243 chemical reaction Methods 0.000 description 32
- 238000001816 cooling Methods 0.000 description 30
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 27
- 239000000706 filtrate Substances 0.000 description 26
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 24
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 21
- 150000001408 amides Chemical class 0.000 description 19
- 239000011734 sodium Substances 0.000 description 19
- 239000000725 suspension Substances 0.000 description 17
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 16
- 238000002844 melting Methods 0.000 description 16
- 230000008018 melting Effects 0.000 description 16
- 229910052708 sodium Inorganic materials 0.000 description 16
- 239000002253 acid Substances 0.000 description 14
- 238000000354 decomposition reaction Methods 0.000 description 14
- 238000003756 stirring Methods 0.000 description 14
- 229950004030 cefaloglycin Drugs 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 11
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 10
- 239000002904 solvent Substances 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 9
- 235000019341 magnesium sulphate Nutrition 0.000 description 9
- 239000000047 product Substances 0.000 description 9
- VYPDUQYOLCLEGS-UHFFFAOYSA-M sodium;2-ethylhexanoate Chemical compound [Na+].CCCCC(CC)C([O-])=O VYPDUQYOLCLEGS-UHFFFAOYSA-M 0.000 description 9
- FUBBGQLTSCSAON-PBFPGSCMSA-N cefaloglycin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FUBBGQLTSCSAON-PBFPGSCMSA-N 0.000 description 8
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 7
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 7
- 229920006395 saturated elastomer Polymers 0.000 description 7
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 6
- 150000007942 carboxylates Chemical class 0.000 description 6
- 229960000603 cefalotin Drugs 0.000 description 6
- 239000000284 extract Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 description 5
- 150000008065 acid anhydrides Chemical class 0.000 description 5
- XIURVHNZVLADCM-IUODEOHRSA-N cefalotin Chemical compound N([C@H]1[C@@H]2N(C1=O)C(=C(CS2)COC(=O)C)C(O)=O)C(=O)CC1=CC=CS1 XIURVHNZVLADCM-IUODEOHRSA-N 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 241000894006 Bacteria Species 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 4
- 230000000844 anti-bacterial effect Effects 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 201000010099 disease Diseases 0.000 description 4
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 238000001556 precipitation Methods 0.000 description 4
- 239000000523 sample Substances 0.000 description 4
- 239000011780 sodium chloride Substances 0.000 description 4
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 3
- QXNVGIXVLWOKEQ-UHFFFAOYSA-N Disodium Chemical class [Na][Na] QXNVGIXVLWOKEQ-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 3
- 241000589517 Pseudomonas aeruginosa Species 0.000 description 3
- UBQQTDIVCWQNMZ-UHFFFAOYSA-N SC1=NN=C(S1)C(CC(=O)O)C(=O)O Chemical compound SC1=NN=C(S1)C(CC(=O)O)C(=O)O UBQQTDIVCWQNMZ-UHFFFAOYSA-N 0.000 description 3
- 241000191940 Staphylococcus Species 0.000 description 3
- MLYYVTUWGNIJIB-BXKDBHETSA-N cefazolin Chemical compound S1C(C)=NN=C1SCC1=C(C(O)=O)N2C(=O)[C@@H](NC(=O)CN3N=NN=C3)[C@H]2SC1 MLYYVTUWGNIJIB-BXKDBHETSA-N 0.000 description 3
- 229960001139 cefazolin Drugs 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- PBMFSQRYOILNGV-UHFFFAOYSA-N pyridazine Chemical group C1=CC=NN=C1 PBMFSQRYOILNGV-UHFFFAOYSA-N 0.000 description 3
- YGTAZGSLCXNBQL-UHFFFAOYSA-N 1,2,4-thiadiazole Chemical group C=1N=CSN=1 YGTAZGSLCXNBQL-UHFFFAOYSA-N 0.000 description 2
- 125000004521 1,3,4-thiadiazol-2-yl group Chemical group S1C(=NN=C1)* 0.000 description 2
- DZIQDBROLFSEQQ-UHFFFAOYSA-N 2-(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)ethanethioic s-acid Chemical compound OC(=S)CC1=NN=C(S)S1 DZIQDBROLFSEQQ-UHFFFAOYSA-N 0.000 description 2
- UJBXVTJYSIDCIE-UHFFFAOYSA-N 2-[(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)sulfanyl]acetic acid Chemical compound OC(=O)CSC1=NNC(=S)S1 UJBXVTJYSIDCIE-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- 108020004256 Beta-lactamase Proteins 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 241000588769 Proteus <enterobacteria> Species 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 2
- 102000006635 beta-lactamase Human genes 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- RAXXELZNTBOGNW-UHFFFAOYSA-N imidazole Natural products C1=CNC=N1 RAXXELZNTBOGNW-UHFFFAOYSA-N 0.000 description 2
- 125000002883 imidazolyl group Chemical group 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 210000004185 liver Anatomy 0.000 description 2
- 239000010871 livestock manure Substances 0.000 description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 2
- 229960003512 nicotinic acid Drugs 0.000 description 2
- 235000001968 nicotinic acid Nutrition 0.000 description 2
- 239000011664 nicotinic acid Substances 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 125000003373 pyrazinyl group Chemical group 0.000 description 2
- 125000003226 pyrazolyl group Chemical group 0.000 description 2
- 125000005581 pyrene group Chemical group 0.000 description 2
- 125000000714 pyrimidinyl group Chemical group 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000012898 sample dilution Substances 0.000 description 2
- 239000013049 sediment Substances 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- FNEDHAVUXWEPMP-UHFFFAOYSA-M sodium;2-methylhexanoate Chemical compound [Na+].CCCCC(C)C([O-])=O FNEDHAVUXWEPMP-UHFFFAOYSA-M 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- KDYFGRWQOYBRFD-UHFFFAOYSA-N succinic acid Chemical compound OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 2
- 150000003536 tetrazoles Chemical group 0.000 description 2
- 150000004867 thiadiazoles Chemical group 0.000 description 2
- 210000001835 viscera Anatomy 0.000 description 2
- UKQYEYCQIQBHBC-UHFFFAOYSA-N (1-methylpiperidin-4-yl) 3-methyl-2-phenylpentanoate Chemical compound C=1C=CC=CC=1C(C(C)CC)C(=O)OC1CCN(C)CC1 UKQYEYCQIQBHBC-UHFFFAOYSA-N 0.000 description 1
- KXULYXJWSGXTQY-UHFFFAOYSA-N (4-nitrophenyl) 6-oxo-1h-pyridazine-5-carboxylate Chemical compound OC1=NN=CC=C1C(=O)OC1=CC=C([N+]([O-])=O)C=C1 KXULYXJWSGXTQY-UHFFFAOYSA-N 0.000 description 1
- FFOHOZBDRVVZIM-PFBPGKLMSA-N (6r,7r)-3-(acetyloxymethyl)-7-[[(2r)-2-amino-2-phenylacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;hydrate Chemical compound O.C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)COC(=O)C)C(O)=O)=CC=CC=C1 FFOHOZBDRVVZIM-PFBPGKLMSA-N 0.000 description 1
- MBIZXFATKUQOOA-UHFFFAOYSA-N 1,3,4-thiadiazole Chemical group C1=NN=CS1 MBIZXFATKUQOOA-UHFFFAOYSA-N 0.000 description 1
- SNTWKPAKVQFCCF-UHFFFAOYSA-N 2,3-dihydro-1h-triazole Chemical compound N1NC=CN1 SNTWKPAKVQFCCF-UHFFFAOYSA-N 0.000 description 1
- UCMPRUFAFLOKGI-UHFFFAOYSA-N 2,4-dioxo-1h-pyrimidine-5-carbonyl chloride Chemical compound ClC(=O)C1=CNC(=O)NC1=O UCMPRUFAFLOKGI-UHFFFAOYSA-N 0.000 description 1
- MYTWYPWDKHLWED-UHFFFAOYSA-N 2-(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)acetic acid Chemical compound OC(=O)CC1=NN=C(S)S1 MYTWYPWDKHLWED-UHFFFAOYSA-N 0.000 description 1
- ROFRKOBSVLQWQT-UHFFFAOYSA-N 2-(3-oxo-6-sulfanylidene-1h-pyridazin-2-yl)acetic acid Chemical compound OC(=O)CN1N=C(S)C=CC1=O ROFRKOBSVLQWQT-UHFFFAOYSA-N 0.000 description 1
- NOUBWDDQLPMPJJ-UHFFFAOYSA-N 2-(4-methyl-2-sulfanylidene-3h-1,3-thiazol-5-yl)ethanethioic s-acid Chemical compound CC=1N=C(S)SC=1CC(O)=S NOUBWDDQLPMPJJ-UHFFFAOYSA-N 0.000 description 1
- XDALFYDCKIYNOQ-UHFFFAOYSA-N 2-(5-sulfanylidene-2h-1,2,4-thiadiazol-3-yl)ethanethioic s-acid Chemical compound OC(=S)CC1=NSC(S)=N1 XDALFYDCKIYNOQ-UHFFFAOYSA-N 0.000 description 1
- AIPCESCZXUPVLA-UHFFFAOYSA-N 2-[(2-amino-6-sulfanylidene-1h-pyrimidin-4-yl)sulfanyl]acetic acid Chemical compound NC1=NC(S)=CC(SCC(O)=O)=N1 AIPCESCZXUPVLA-UHFFFAOYSA-N 0.000 description 1
- HRQWRDVVMBXGDS-UHFFFAOYSA-N 2-[(2-methyl-6-sulfanylidene-1h-pyrimidin-4-yl)sulfanyl]acetic acid Chemical compound CC1=NC(S)=CC(SCC(O)=O)=N1 HRQWRDVVMBXGDS-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- GMDRUGZBWUTQMX-UHFFFAOYSA-N 2-methylpyrimidine-5-carboxamide Chemical compound CC1=NC=C(C(N)=O)C=N1 GMDRUGZBWUTQMX-UHFFFAOYSA-N 0.000 description 1
- LFJUWCVECPASII-UHFFFAOYSA-N 2-sulfanylidene-3h-1,3,4-thiadiazole-5-carboxylic acid Chemical compound OC(=O)C1=NN=C(S)S1 LFJUWCVECPASII-UHFFFAOYSA-N 0.000 description 1
- RZUBLMCZJPIOPF-UHFFFAOYSA-N 3-methyl-1h-pyridin-4-one Chemical compound CC1=CNC=CC1=O RZUBLMCZJPIOPF-UHFFFAOYSA-N 0.000 description 1
- RBVFLRAWKORMNY-UHFFFAOYSA-N 4-(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)butanoic acid Chemical compound OC(=O)CCCC1=NN=C(S)S1 RBVFLRAWKORMNY-UHFFFAOYSA-N 0.000 description 1
- RQECYBCSZSFGDL-UHFFFAOYSA-N 4-methyl-2-sulfanylidene-3h-1,3-thiazole-5-carboxylic acid Chemical compound CC=1N=C(S)SC=1C(O)=O RQECYBCSZSFGDL-UHFFFAOYSA-N 0.000 description 1
- HXDFIFKXAVCLJS-UHFFFAOYSA-N 4-oxo-1h-pyridine-3-carbonyl chloride Chemical compound OC1=CC=NC=C1C(Cl)=O HXDFIFKXAVCLJS-UHFFFAOYSA-N 0.000 description 1
- CHCUBGPSZDGABM-UHFFFAOYSA-N 4-oxo-1h-pyridine-3-carboxylic acid Chemical compound OC(=O)C1=CNC=CC1=O CHCUBGPSZDGABM-UHFFFAOYSA-N 0.000 description 1
- ADCFALAYJWGOHJ-UHFFFAOYSA-N 4-oxo-4-[(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)amino]butanoic acid Chemical compound OC(=O)CCC(=O)NC1=NN=C(S)S1 ADCFALAYJWGOHJ-UHFFFAOYSA-N 0.000 description 1
- FZQLPYNVCOAXGE-UHFFFAOYSA-N 4-oxothiopyran-3-carbonyl chloride Chemical compound ClC(=O)C1=CSC=CC1=O FZQLPYNVCOAXGE-UHFFFAOYSA-N 0.000 description 1
- GGFJMMODEZOLIY-UHFFFAOYSA-N 5-methyl-4-oxo-1h-pyridine-3-carboxylic acid Chemical compound CC1=CNC=C(C(O)=O)C1=O GGFJMMODEZOLIY-UHFFFAOYSA-N 0.000 description 1
- NXROXNOFBVKYEM-UHFFFAOYSA-N 6-methyl-4-oxo-1h-pyridine-3-carboxylic acid;hydrochloride Chemical compound Cl.CC1=CC(=O)C(C(O)=O)=CN1 NXROXNOFBVKYEM-UHFFFAOYSA-N 0.000 description 1
- 241000194107 Bacillus megaterium Species 0.000 description 1
- 244000063299 Bacillus subtilis Species 0.000 description 1
- 235000014469 Bacillus subtilis Nutrition 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- CEAZRRDELHUEMR-URQXQFDESA-N Gentamicin Chemical compound O1[C@H](C(C)NC)CC[C@@H](N)[C@H]1O[C@H]1[C@H](O)[C@@H](O[C@@H]2[C@@H]([C@@H](NC)[C@@](C)(O)CO2)O)[C@H](N)C[C@@H]1N CEAZRRDELHUEMR-URQXQFDESA-N 0.000 description 1
- 229930182566 Gentamicin Natural products 0.000 description 1
- 241000588748 Klebsiella Species 0.000 description 1
- AHLPHDHHMVZTML-BYPYZUCNSA-N L-Ornithine Chemical class NCCC[C@H](N)C(O)=O AHLPHDHHMVZTML-BYPYZUCNSA-N 0.000 description 1
- KDXKERNSBIXSRK-YFKPBYRVSA-N L-lysine Chemical compound NCCCC[C@H](N)C(O)=O KDXKERNSBIXSRK-YFKPBYRVSA-N 0.000 description 1
- KDXKERNSBIXSRK-UHFFFAOYSA-N Lysine Natural products NCCCCC(N)C(O)=O KDXKERNSBIXSRK-UHFFFAOYSA-N 0.000 description 1
- 239000004472 Lysine Substances 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241000192041 Micrococcus Species 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000588770 Proteus mirabilis Species 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 125000000066 S-methyl group Chemical group [H]C([H])([H])S* 0.000 description 1
- 241001354013 Salmonella enterica subsp. enterica serovar Enteritidis Species 0.000 description 1
- 241000293871 Salmonella enterica subsp. enterica serovar Typhi Species 0.000 description 1
- 241000147000 Shigella flexneri 2a Species 0.000 description 1
- 241000607760 Shigella sonnei Species 0.000 description 1
- 108010021119 Trichosanthin Proteins 0.000 description 1
- DTQVDTLACAAQTR-UHFFFAOYSA-M Trifluoroacetate Chemical compound [O-]C(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-M 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical group 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000005518 carboxamido group Chemical group 0.000 description 1
- 150000001782 cephems Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000013068 control sample Substances 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- VFNGKCDDZUSWLR-UHFFFAOYSA-N disulfuric acid Chemical compound OS(=O)(=O)OS(O)(=O)=O VFNGKCDDZUSWLR-UHFFFAOYSA-N 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 125000000219 ethylidene group Chemical group [H]C(=[*])C([H])([H])[H] 0.000 description 1
- 150000002391 heterocyclic compounds Chemical group 0.000 description 1
- 150000002460 imidazoles Chemical class 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000010253 intravenous injection Methods 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000654 isopropylidene group Chemical group C(C)(C)=* 0.000 description 1
- ZLTPDFXIESTBQG-UHFFFAOYSA-N isothiazole Chemical group C=1C=NSC=1 ZLTPDFXIESTBQG-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 230000002906 microbiologic effect Effects 0.000 description 1
- YBSZEWLCECBDIP-UHFFFAOYSA-N n-[bis(dimethylamino)phosphoryl]-n-methylmethanamine Chemical compound CN(C)P(=O)(N(C)C)N(C)C.CN(C)P(=O)(N(C)C)N(C)C YBSZEWLCECBDIP-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- FJCFFCXMEXZEIM-UHFFFAOYSA-N oxiniacic acid Chemical compound OC(=O)C1=CC=C[N+]([O-])=C1 FJCFFCXMEXZEIM-UHFFFAOYSA-N 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 229910001392 phosphorus oxide Inorganic materials 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- ZUFQCVZBBNZMKD-UHFFFAOYSA-M potassium 2-ethylhexanoate Chemical compound [K+].CCCCC(CC)C([O-])=O ZUFQCVZBBNZMKD-UHFFFAOYSA-M 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- KOODSCBKXPPKHE-UHFFFAOYSA-N propanethioic s-acid Chemical compound CCC(S)=O KOODSCBKXPPKHE-UHFFFAOYSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- KOUKXHPPRFNWPP-UHFFFAOYSA-N pyrazine-2,5-dicarboxylic acid;hydrate Chemical compound O.OC(=O)C1=CN=C(C(O)=O)C=N1 KOUKXHPPRFNWPP-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 229940115939 shigella sonnei Drugs 0.000 description 1
- BYRWCXYBQUYZNW-UHFFFAOYSA-M sodium;2-[(2-sulfanylidene-3h-1,3,4-thiadiazol-5-yl)sulfanyl]ethanesulfonate Chemical compound [Na+].[O-]S(=O)(=O)CCSC1=NNC(=S)S1 BYRWCXYBQUYZNW-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000001384 succinic acid Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- VSAISIQCTGDGPU-UHFFFAOYSA-N tetraphosphorus hexaoxide Chemical compound O1P(O2)OP3OP1OP2O3 VSAISIQCTGDGPU-UHFFFAOYSA-N 0.000 description 1
- VLLMWSRANPNYQX-UHFFFAOYSA-N thiadiazole Chemical compound C1=CSN=N1.C1=CSN=N1 VLLMWSRANPNYQX-UHFFFAOYSA-N 0.000 description 1
- 125000003396 thiol group Chemical group [H]S* 0.000 description 1
- IBBLKSWSCDAPIF-UHFFFAOYSA-N thiopyran Chemical compound S1C=CC=C=C1 IBBLKSWSCDAPIF-UHFFFAOYSA-N 0.000 description 1
- 150000003852 triazoles Chemical group 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/24—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with hydrocarbon radicals, substituted by hetero atoms or hetero rings, attached in position 3
- C07D501/36—Methylene radicals, substituted by sulfur atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Applications Claiming Priority (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP49038545A JPS5953276B2 (ja) | 1974-04-05 | 1974-04-05 | 新セフアロスポリン誘導体の製造方法 |
| JP4188474A JPS50140480A (enrdf_load_stackoverflow) | 1974-04-15 | 1974-04-15 | |
| JP6312474A JPS50154282A (enrdf_load_stackoverflow) | 1974-06-04 | 1974-06-04 | |
| JP6477474A JPS604191B2 (ja) | 1974-06-07 | 1974-06-07 | セフアロスポラン酸新誘導体の合成方法 |
| JP49116976A JPS5143785A (en) | 1974-10-11 | 1974-10-11 | Shinsefuarosuhorinkanrenkagobutsuno goseiho |
| JP11963874A JPS5148686A (ja) | 1974-10-17 | 1974-10-17 | Shinsefuarosuhorinkanrenkagobutsuno goseihoho |
| JP50013200A JPS5188988A (enrdf_load_stackoverflow) | 1975-01-31 | 1975-01-31 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2514322A1 true DE2514322A1 (de) | 1975-10-09 |
Family
ID=27563645
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19752514322 Pending DE2514322A1 (de) | 1974-04-05 | 1975-04-02 | Neue cephalosporinderivate |
Country Status (4)
| Country | Link |
|---|---|
| DE (1) | DE2514322A1 (enrdf_load_stackoverflow) |
| DK (1) | DK143875A (enrdf_load_stackoverflow) |
| FR (1) | FR2266507B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1509074A (enrdf_load_stackoverflow) |
Cited By (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2539664A1 (de) * | 1974-09-06 | 1976-03-18 | Sumitomo Chemical Co | Cephalosporin-derivate |
| US4101656A (en) | 1976-07-12 | 1978-07-18 | Smithkline Corporation | 7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them |
| US4112088A (en) * | 1976-03-11 | 1978-09-05 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4118490A (en) | 1976-05-19 | 1978-10-03 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins and pharmaceutical compositions containing them |
| US4286089A (en) | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| US4576937A (en) * | 1984-02-29 | 1986-03-18 | Smithkline Beckman Corporation | 7-D-Mandelamido-3(1-sulfomethyltetrazol-5-yl)thiomethyl-3-cephem-4-carboxylic acid monosodium salt |
| US5180719A (en) * | 1988-10-24 | 1993-01-19 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactam esters |
| US5328908A (en) * | 1988-10-24 | 1994-07-12 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolone thioureas |
| US5387748A (en) * | 1988-10-24 | 1995-02-07 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial dithiocarbamoyl quinolones |
| US5434147A (en) * | 1988-10-24 | 1995-07-18 | Proctor & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactam esters |
| US5491139A (en) * | 1988-10-24 | 1996-02-13 | The Procter & Gamble Company | Antimicrobial quinolonyl lactams |
| US5530116A (en) * | 1990-04-18 | 1996-06-25 | The Procter & Gamble Company | Antimicrobial quinolonyl lactams |
| US5637580A (en) * | 1988-10-24 | 1997-06-10 | The Procter & Gamble Company | Antimicrobial penem-quinolones |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS545974A (en) * | 1977-06-16 | 1979-01-17 | Ajinomoto Co Inc | Imidazoledicaroboxylic acid derivatives |
| US4117124A (en) * | 1977-06-30 | 1978-09-26 | Smithkline Corporation | 7-Acylamino-3-[[3-(carboxymethyl)thio-1H-1,2,4-triazol-5-yl]thiomethyl]-3-cephem-4-carboxylic acids |
| JPS55129287A (en) * | 1979-03-27 | 1980-10-06 | Ajinomoto Co Inc | Imidazole-dicarboxylic acid derivative |
| CN114671892B (zh) * | 2022-04-24 | 2023-04-11 | 江苏海洋大学 | 含7-氨基头孢烷酸的1,3,4-噻二唑衍生物及制法与用途 |
-
1975
- 1975-03-27 GB GB1302875A patent/GB1509074A/en not_active Expired
- 1975-04-02 DE DE19752514322 patent/DE2514322A1/de active Pending
- 1975-04-03 FR FR7510474A patent/FR2266507B1/fr not_active Expired
- 1975-04-04 DK DK143875A patent/DK143875A/da not_active IP Right Cessation
Cited By (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2539664A1 (de) * | 1974-09-06 | 1976-03-18 | Sumitomo Chemical Co | Cephalosporin-derivate |
| US4286089A (en) | 1974-12-27 | 1981-08-25 | Smithkline Corporation | 7-Acyl-3-(substituted tetrazolyl thiomethyl)cephalosporins |
| US4112088A (en) * | 1976-03-11 | 1978-09-05 | Smithkline Corporation | 7-Acyl-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4130644A (en) | 1976-03-11 | 1978-12-19 | Smithkline Corporation | 7-Acylamine-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins and pharmaceutical compositions containing them |
| US4138556A (en) | 1976-03-11 | 1979-02-06 | Smithkline Corporation | 7-Amino-3-(sulfoalkyl substituted oxadiazolylthiomethyl) cephalosporins |
| US4118490A (en) | 1976-05-19 | 1978-10-03 | Smithkline Corporation | 7-Acyl-3-(sulfonic acid and sulfamoyl substituted tetrazolyl thiomethyl)cephalosporins and pharmaceutical compositions containing them |
| US4101656A (en) | 1976-07-12 | 1978-07-18 | Smithkline Corporation | 7β-Acylamino-3-(alkanesulfonamidoalkyl substituted tetrazolylthiomethyl) cephalosporins, antibacterial compositions containing them and methods of treating bacterial infections with them |
| US4576937A (en) * | 1984-02-29 | 1986-03-18 | Smithkline Beckman Corporation | 7-D-Mandelamido-3(1-sulfomethyltetrazol-5-yl)thiomethyl-3-cephem-4-carboxylic acid monosodium salt |
| US5387748A (en) * | 1988-10-24 | 1995-02-07 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial dithiocarbamoyl quinolones |
| US5328908A (en) * | 1988-10-24 | 1994-07-12 | Procter & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolone thioureas |
| US5180719A (en) * | 1988-10-24 | 1993-01-19 | Norwich Eaton Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactam esters |
| US5434147A (en) * | 1988-10-24 | 1995-07-18 | Proctor & Gamble Pharmaceuticals, Inc. | Antimicrobial quinolonyl lactam esters |
| US5491139A (en) * | 1988-10-24 | 1996-02-13 | The Procter & Gamble Company | Antimicrobial quinolonyl lactams |
| US5631256A (en) * | 1988-10-24 | 1997-05-20 | The Procter & Gamble Company | Antimicrobial quinolone thioureas |
| US5637580A (en) * | 1988-10-24 | 1997-06-10 | The Procter & Gamble Company | Antimicrobial penem-quinolones |
| US5646139A (en) * | 1988-10-24 | 1997-07-08 | The Procter & Gamble Company | Antimicrobial carbapenem quinolones |
| US5648346A (en) * | 1988-10-24 | 1997-07-15 | The Procter & Gamble Company | Antimicrobial carbacephem-quinolones |
| US5656623A (en) * | 1988-10-24 | 1997-08-12 | The Procter & Gamble Company | Antimicrobial lactam-quinolones |
| US5672600A (en) * | 1988-10-24 | 1997-09-30 | The Procter & Gamble Company | Antimicrobial dithiocarbamoyl quinolones |
| US5530116A (en) * | 1990-04-18 | 1996-06-25 | The Procter & Gamble Company | Antimicrobial quinolonyl lactams |
Also Published As
| Publication number | Publication date |
|---|---|
| GB1509074A (en) | 1978-04-26 |
| FR2266507B1 (enrdf_load_stackoverflow) | 1978-11-10 |
| DK143875A (enrdf_load_stackoverflow) | 1975-10-06 |
| FR2266507A1 (enrdf_load_stackoverflow) | 1975-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2514322A1 (de) | Neue cephalosporinderivate | |
| DE2461478C2 (de) | Cephalosporinderivate und Verfahren zu deren Herstellung | |
| CH630386A5 (de) | Verfahren zur herstellung von neuen cephalosporinderivaten. | |
| DE1795838B2 (de) | Cephalosporinderivate | |
| DE2439880C3 (de) | (6R, 7R)-3-Carbamoyloxymethyl-7- [2-(fur-2-yl)-2methoxyiminoacetamido] -ceph-S-em^carbonsäure und Verfahren zur ihrer Herstellung | |
| DE3233376A1 (de) | Cephalosporinchinoliniumbetaine und sie enthaltende pharmazeutische mittel | |
| DE2922036C2 (de) | 7-[2-(2-Amino-4-thiazolyl)-2-methoxyimino-acetamido]- cephalosporansäure-Derivate | |
| CH648317A5 (de) | 7alpha-methoxy-7betha-(1,3-dithietan-2- carboxamido)cephalosporansaeurederivate und verfahren zu ihrer herstellung. | |
| DE2362816A1 (de) | Mit heterocyclischer acylgruppe substituierte cephalosporinderivate | |
| DE3233377A1 (de) | Cephalosporinisochinoliniumbetaine und sie enthaltende pharmazeutische mittel | |
| DD215552A5 (de) | Verfahren zur herstellung von kristallisierten cephem-saeureadditionssalzen | |
| DD209633A5 (de) | Verfahren zur herstellung von 3-thienopyridinium- und 3-furopyridiniumcephalosporinen | |
| CH654313A5 (de) | Cephalosporinverbindungen, verfahren zu ihrer herstellung und pharmazeutische mittel, die diese verbindungen enthalten. | |
| US4068074A (en) | Cephalosporin derivatives having at the 3-position of the cephem ring a heterocyclic thiomethyl group with a carboxy or sulfo group and at the 7-position of the cephem ring an α-heterocylic acylaminophenyl-acetamide group | |
| DE2739448A1 (de) | 7-substituierte aminoacetamido- oxadethiacephalosporine, verfahren zu deren herstellung und deren verwendung bei der behandlung bakterieller erkrankungen | |
| DE2738711A1 (de) | Cephalosporinderivate | |
| DE2715038A1 (de) | Neue antibakterielle verbindungen | |
| DE2727325A1 (de) | 7- eckige klammer auf alpha-(2,3- dihydro-2-oxo-1h-benzimidazol-1-ylcarbonylamino)arylacetamido eckige klammer zu cephalosporine | |
| DE2700271A1 (de) | Thienopyridinderivate | |
| DE3037284A1 (de) | Penicillinverbindungen und verfahren zu deren herstellung, sowie arzneimittel welche diese enthalten | |
| DD204257A5 (de) | Verfahren zur herstellung von cephalosporinen, die in position 3 substituiert sind | |
| DE2638028A1 (de) | Neue cephalosporinverbindungen | |
| DE2714419C2 (de) | Cephalosporinderivate, Verfahren zu deren Herstellung und Arzneimittel | |
| DE2544243A1 (de) | Cephalosporansaeurederivate | |
| DE3043865A1 (de) | N-substituierte thiazolylderivate von oxy-imino-substituierten cephalosporinen, verfahren zu ihrer herstellung und sie enthaltende pharmazeutische und veterinaermedizinische mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |