DE2454260A1 - Metalloxyd-varistor mit diskreten metallkoerpern darin und verfahren zu dessen herstellung - Google Patents
Metalloxyd-varistor mit diskreten metallkoerpern darin und verfahren zu dessen herstellungInfo
- Publication number
- DE2454260A1 DE2454260A1 DE19742454260 DE2454260A DE2454260A1 DE 2454260 A1 DE2454260 A1 DE 2454260A1 DE 19742454260 DE19742454260 DE 19742454260 DE 2454260 A DE2454260 A DE 2454260A DE 2454260 A1 DE2454260 A1 DE 2454260A1
- Authority
- DE
- Germany
- Prior art keywords
- varistor
- metallic material
- metal oxide
- discrete
- contacts
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 23
- 230000008569 process Effects 0.000 title claims description 11
- 229910052751 metal Inorganic materials 0.000 title claims description 10
- 239000002184 metal Substances 0.000 title claims description 10
- 229910044991 metal oxide Inorganic materials 0.000 claims description 34
- 150000004706 metal oxides Chemical class 0.000 claims description 34
- 239000007769 metal material Substances 0.000 claims description 25
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical group [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 22
- 239000000654 additive Substances 0.000 claims description 22
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 14
- 230000000996 additive effect Effects 0.000 claims description 11
- 239000011787 zinc oxide Substances 0.000 claims description 11
- 238000005245 sintering Methods 0.000 claims description 9
- 238000004519 manufacturing process Methods 0.000 claims description 8
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 6
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052787 antimony Inorganic materials 0.000 claims description 6
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 6
- 229910052788 barium Inorganic materials 0.000 claims description 6
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000011651 chromium Substances 0.000 claims description 6
- 229910052732 germanium Inorganic materials 0.000 claims description 6
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 6
- 229910052759 nickel Inorganic materials 0.000 claims description 6
- 229910052710 silicon Inorganic materials 0.000 claims description 6
- 239000010703 silicon Substances 0.000 claims description 6
- 229910052718 tin Inorganic materials 0.000 claims description 6
- 229910052797 bismuth Inorganic materials 0.000 claims description 5
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 claims description 5
- 239000000843 powder Substances 0.000 claims description 5
- 239000010936 titanium Substances 0.000 claims description 5
- 229910052723 transition metal Inorganic materials 0.000 claims description 5
- 150000003624 transition metals Chemical class 0.000 claims description 5
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 claims description 4
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 claims description 4
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 4
- 229910052804 chromium Inorganic materials 0.000 claims description 4
- 229910017052 cobalt Inorganic materials 0.000 claims description 4
- 239000010941 cobalt Substances 0.000 claims description 4
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 claims description 4
- 229910052744 lithium Inorganic materials 0.000 claims description 4
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 claims description 4
- 239000010970 precious metal Substances 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- ZSLUVFAKFWKJRC-IGMARMGPSA-N 232Th Chemical compound [232Th] ZSLUVFAKFWKJRC-IGMARMGPSA-N 0.000 claims description 3
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 claims description 3
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052688 Gadolinium Inorganic materials 0.000 claims description 3
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 claims description 3
- 229910052776 Thorium Inorganic materials 0.000 claims description 3
- 229910052790 beryllium Inorganic materials 0.000 claims description 3
- ATBAMAFKBVZNFJ-UHFFFAOYSA-N beryllium atom Chemical compound [Be] ATBAMAFKBVZNFJ-UHFFFAOYSA-N 0.000 claims description 3
- 229910052796 boron Inorganic materials 0.000 claims description 3
- 229910052802 copper Inorganic materials 0.000 claims description 3
- 239000010949 copper Substances 0.000 claims description 3
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 claims description 3
- 229910052738 indium Inorganic materials 0.000 claims description 3
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 claims description 3
- 150000002739 metals Chemical class 0.000 claims description 3
- 229910052711 selenium Inorganic materials 0.000 claims description 3
- 239000011669 selenium Substances 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052715 tantalum Inorganic materials 0.000 claims description 3
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052721 tungsten Inorganic materials 0.000 claims description 3
- 239000010937 tungsten Substances 0.000 claims description 3
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 claims description 2
- 229910052749 magnesium Inorganic materials 0.000 claims description 2
- 239000011777 magnesium Substances 0.000 claims description 2
- 238000007493 shaping process Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 11
- 230000009471 action Effects 0.000 description 6
- 239000000126 substance Substances 0.000 description 5
- 230000007246 mechanism Effects 0.000 description 4
- 239000011135 tin Substances 0.000 description 4
- 239000013068 control sample Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000012255 powdered metal Substances 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 239000001301 oxygen Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910000416 bismuth oxide Inorganic materials 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 229910000428 cobalt oxide Inorganic materials 0.000 description 1
- IVMYJDGYRUAWML-UHFFFAOYSA-N cobalt(ii) oxide Chemical compound [Co]=O IVMYJDGYRUAWML-UHFFFAOYSA-N 0.000 description 1
- 230000001427 coherent effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- TYIXMATWDRGMPF-UHFFFAOYSA-N dibismuth;oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Bi+3].[Bi+3] TYIXMATWDRGMPF-UHFFFAOYSA-N 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 1
- 229910052737 gold Inorganic materials 0.000 description 1
- 239000010931 gold Substances 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 210000003127 knee Anatomy 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000002923 metal particle Substances 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- CJJMLLCUQDSZIZ-UHFFFAOYSA-N oxobismuth Chemical class [Bi]=O CJJMLLCUQDSZIZ-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910000679 solder Inorganic materials 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/10—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material voltage responsive, i.e. varistors
- H01C7/105—Varistor cores
- H01C7/108—Metal oxide
- H01C7/112—ZnO type
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Physics & Mathematics (AREA)
- Electromagnetism (AREA)
- Thermistors And Varistors (AREA)
- Compositions Of Oxide Ceramics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US417274A US3928242A (en) | 1973-11-19 | 1973-11-19 | Metal oxide varistor with discrete bodies of metallic material therein and method for the manufacture thereof |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2454260A1 true DE2454260A1 (de) | 1975-06-19 |
Family
ID=23653282
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742454260 Pending DE2454260A1 (de) | 1973-11-19 | 1974-11-15 | Metalloxyd-varistor mit diskreten metallkoerpern darin und verfahren zu dessen herstellung |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3928242A (enExample) |
| JP (1) | JPS5080496A (enExample) |
| CA (1) | CA1019464A (enExample) |
| DE (1) | DE2454260A1 (enExample) |
| FR (1) | FR2251894A1 (enExample) |
| GB (1) | GB1488157A (enExample) |
| NL (1) | NL7414865A (enExample) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4033906A (en) * | 1974-06-03 | 1977-07-05 | Fuji Electric Company Ltd. | Ceramics having nonlinear voltage characteristics and method for producing same |
| US4038217A (en) * | 1974-07-25 | 1977-07-26 | Fuji Electric Company Ltd. | Ceramics having non-linear voltage characteristics and method of producing the same |
| US4122232A (en) * | 1975-04-21 | 1978-10-24 | Engelhard Minerals & Chemicals Corporation | Air firable base metal conductors |
| US4069061A (en) * | 1975-06-30 | 1978-01-17 | Fuji Electric Co., Ltd. | Ceramics having nonlinear voltage characteristics |
| US4041436A (en) * | 1975-10-24 | 1977-08-09 | Allen-Bradley Company | Cermet varistors |
| US4072771A (en) * | 1975-11-28 | 1978-02-07 | Bala Electronics Corporation | Copper thick film conductor |
| US4172922A (en) * | 1977-08-18 | 1979-10-30 | Trw, Inc. | Resistor material, resistor made therefrom and method of making the same |
| US4265844A (en) * | 1979-05-16 | 1981-05-05 | Marcon Electronics Co. Ltd. | Method of manufacturing a voltage-nonlinear resistor |
| US4383237A (en) * | 1980-05-07 | 1983-05-10 | Matsushita Electric Industrial Co., Ltd. | Voltage-dependent resistor |
| US4374049A (en) * | 1980-06-06 | 1983-02-15 | General Electric Company | Zinc oxide varistor composition not containing silica |
| US4317749A (en) * | 1980-08-22 | 1982-03-02 | Ferro Corporation | Thick film conductor employing cobalt oxide |
| US4521800A (en) * | 1982-10-15 | 1985-06-04 | Standard Oil Company (Indiana) | Multilayer photoelectrodes utilizing exotic materials |
| JPS61216305A (ja) * | 1985-03-20 | 1986-09-26 | 富士電機株式会社 | 電圧非直線抵抗体 |
| DE3619620A1 (de) * | 1986-06-11 | 1987-12-17 | Siemens Ag | Verfahren zur herstellung keramischen zinkoxid-varistormaterials und verwendung des nach diesem verfahren hergestellten materials |
| JPH0773082B2 (ja) * | 1986-12-04 | 1995-08-02 | 松下電器産業株式会社 | 酸化亜鉛形バリスタの製造方法 |
| DE3823698A1 (de) * | 1988-07-13 | 1990-01-18 | Philips Patentverwaltung | Nichtlinearer spannungsabhaengiger widerstand |
| JPH0685363B2 (ja) * | 1991-09-30 | 1994-10-26 | ソマール株式会社 | 高電圧用バリスタ及びその製造方法 |
| US5345212A (en) * | 1993-07-07 | 1994-09-06 | National Starch And Chemical Investment Holding Corporation | Power surge resistor with palladium and silver composition |
| DE102008024479A1 (de) * | 2008-05-21 | 2009-12-03 | Epcos Ag | Elektrische Bauelementanordnung |
| DE102008024480A1 (de) | 2008-05-21 | 2009-12-03 | Epcos Ag | Elektrische Bauelementanordnung |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA831691A (en) * | 1967-10-09 | 1970-01-06 | Matsuoka Michio | Non-linear resistors of bulk type |
-
1973
- 1973-11-19 US US417274A patent/US3928242A/en not_active Expired - Lifetime
-
1974
- 1974-11-12 CA CA213,468A patent/CA1019464A/en not_active Expired
- 1974-11-14 NL NL7414865A patent/NL7414865A/xx not_active Application Discontinuation
- 1974-11-15 DE DE19742454260 patent/DE2454260A1/de active Pending
- 1974-11-18 JP JP49132118A patent/JPS5080496A/ja active Pending
- 1974-11-19 GB GB50085/74A patent/GB1488157A/en not_active Expired
- 1974-11-19 FR FR7438057A patent/FR2251894A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| FR2251894A1 (enExample) | 1975-06-13 |
| GB1488157A (en) | 1977-10-05 |
| US3928242A (en) | 1975-12-23 |
| CA1019464A (en) | 1977-10-18 |
| JPS5080496A (enExample) | 1975-06-30 |
| NL7414865A (nl) | 1975-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2453065C2 (de) | Varistor und Verfahren zu seiner Herstellung | |
| DE2235783C2 (de) | Metalloxid-Varistorelement | |
| DE2247643A1 (de) | Varistor mit integralem temperaturfuehler | |
| DE2308073B2 (de) | Keramischer elektrischer widerstandskoerper mit positivem temperaturkoeffizienten des elektrischen widerstandswertes und verfahren zu seiner herstellung | |
| DE2445627C2 (de) | Verfahren zum Herstellen eines Varistorkörpers und nach diesem Verfahren hergestellter Varistorkörper | |
| EP0560436A1 (de) | Kathode mit einem Festkörperelement | |
| DE2445626A1 (de) | Metalloxid-varistor mit einer die kontakt-adhaesion verstaerkenden beschichtung | |
| EP0040881A2 (de) | Spannungsabhängiger Widerstand und Verfahren zu seiner Herstellung | |
| DE1646987A1 (de) | Keramischer Koerper aus ferroelektrischem Material mit Perowskitstruktur,der teilweise p- und teilweise n-leitend ist | |
| DE2633567C2 (de) | Keramischer elektrischer Widerstand mit nichtlinearer, spannungsabhängiger Charakteristik und Verfahren zu seiner Herstellung | |
| DE2910841C2 (de) | Spannungsabhängiger Widerstandskörper und Verfahren zu dessen Herstellung | |
| EP0066333B1 (de) | Nichtlinearer Widerstand und Verfahren zu seiner Herstellung | |
| DE2739848C2 (enExample) | ||
| EP0065806B1 (de) | Spannungsabhängiger Widerstand und Verfahren zu seiner Herstellung | |
| DE2824117A1 (de) | Verfahren zum herstellen eines anisotropen sinterverbundwerkstoffes mit richtgefuege | |
| DE2636954C3 (de) | Spannungsabhängiger Widerstand (Varistor) und Verfahren zu seiner Herstellung | |
| DE2303050A1 (de) | Zusammengesetztes elektrisches kontaktmaterial | |
| DE2445659A1 (de) | Metalloxyd-varistor mit einer passivierenden beschichtung | |
| DE60305852T2 (de) | Sinterkörper für Thermistoren, Thermistor und Temperatursensor | |
| DE1765097B2 (de) | Spannungsabhaengiger widerstand aus einer gesinterten scheibe aus zinkoxid | |
| DE1065065B (de) | Spannungsabhaengiger Widerstand auf Siliziumcarbidbasis | |
| DE652202C (de) | Potentiometer mit auf einer isolierenden Unterlage aufgetragener Widerstandsschicht | |
| DE2627191C2 (de) | Verfahren zur Herstellung eines nichtlinearen keramischen Widerstandsmaterials | |
| DE2657434A1 (de) | Gesinterter, elektrisch leitender gegenstand und verfahren zu seiner herstellung | |
| DE2525054A1 (de) | Verfahren zur herstellung nichtlinearer widerstaende |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |