DE2446004C3 - Verfahren zur Herstellung besonders reiner aromatischer Cyansäureester - Google Patents
Verfahren zur Herstellung besonders reiner aromatischer CyansäureesterInfo
- Publication number
- DE2446004C3 DE2446004C3 DE2446004A DE2446004A DE2446004C3 DE 2446004 C3 DE2446004 C3 DE 2446004C3 DE 2446004 A DE2446004 A DE 2446004A DE 2446004 A DE2446004 A DE 2446004A DE 2446004 C3 DE2446004 C3 DE 2446004C3
- Authority
- DE
- Germany
- Prior art keywords
- cyanate
- acid esters
- cyanic acid
- solution
- aqueous
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 aromatic cyanic acid esters Chemical class 0.000 title claims description 34
- 238000000034 method Methods 0.000 title claims description 11
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 239000000243 solution Substances 0.000 description 24
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 15
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- ISWSIDIOOBJBQZ-UHFFFAOYSA-M phenolate Chemical compound [O-]C1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-M 0.000 description 15
- 229940031826 phenolate Drugs 0.000 description 15
- JMANVNJQNLATNU-UHFFFAOYSA-N glycolonitrile Natural products N#CC#N JMANVNJQNLATNU-UHFFFAOYSA-N 0.000 description 12
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N phenol group Chemical group C1(=CC=CC=C1)O ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 9
- 239000002904 solvent Substances 0.000 description 8
- 150000001412 amines Chemical class 0.000 description 7
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- XLJMAIOERFSOGZ-UHFFFAOYSA-N cyanic acid Chemical class OC#N XLJMAIOERFSOGZ-UHFFFAOYSA-N 0.000 description 5
- QPJDMGCKMHUXFD-UHFFFAOYSA-N cyanogen chloride Chemical compound ClC#N QPJDMGCKMHUXFD-UHFFFAOYSA-N 0.000 description 5
- 229930195733 hydrocarbon Natural products 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 4
- 235000013824 polyphenols Nutrition 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 239000004215 Carbon black (E152) Substances 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- AHZMUXQJTGRNHT-UHFFFAOYSA-N [4-[2-(4-cyanatophenyl)propan-2-yl]phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(C)(C)C1=CC=C(OC#N)C=C1 AHZMUXQJTGRNHT-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- QPFMBZIOSGYJDE-UHFFFAOYSA-N 1,1,2,2-tetrachloroethane Chemical compound ClC(Cl)C(Cl)Cl QPFMBZIOSGYJDE-UHFFFAOYSA-N 0.000 description 2
- NXXYKOUNUYWIHA-UHFFFAOYSA-N 2,6-Dimethylphenol Chemical compound CC1=CC=CC(C)=C1O NXXYKOUNUYWIHA-UHFFFAOYSA-N 0.000 description 2
- ASHGTJPOSUFTGB-UHFFFAOYSA-N 3-methoxyphenol Chemical compound COC1=CC=CC(O)=C1 ASHGTJPOSUFTGB-UHFFFAOYSA-N 0.000 description 2
- NPFYZDNDJHZQKY-UHFFFAOYSA-N 4-Hydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=CC=C1 NPFYZDNDJHZQKY-UHFFFAOYSA-N 0.000 description 2
- OAHMVZYHIJQTQC-UHFFFAOYSA-N 4-cyclohexylphenol Chemical compound C1=CC(O)=CC=C1C1CCCCC1 OAHMVZYHIJQTQC-UHFFFAOYSA-N 0.000 description 2
- RGHHSNMVTDWUBI-UHFFFAOYSA-N 4-hydroxybenzaldehyde Chemical compound OC1=CC=C(C=O)C=C1 RGHHSNMVTDWUBI-UHFFFAOYSA-N 0.000 description 2
- FUGYGGDSWSUORM-UHFFFAOYSA-N 4-hydroxystyrene Chemical compound OC1=CC=C(C=C)C=C1 FUGYGGDSWSUORM-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- HEJGXMCFSSDPOA-UHFFFAOYSA-N [4-(4-cyanatophenyl)phenyl] cyanate Chemical group C1=CC(OC#N)=CC=C1C1=CC=C(OC#N)C=C1 HEJGXMCFSSDPOA-UHFFFAOYSA-N 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 125000002947 alkylene group Chemical group 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- 150000007529 inorganic bases Chemical class 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- QWVGKYWNOKOFNN-UHFFFAOYSA-N o-cresol Chemical compound CC1=CC=CC=C1O QWVGKYWNOKOFNN-UHFFFAOYSA-N 0.000 description 2
- OIPPWFOQEKKFEE-UHFFFAOYSA-N orcinol Chemical compound CC1=CC(O)=CC(O)=C1 OIPPWFOQEKKFEE-UHFFFAOYSA-N 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- IWDCLRJOBJJRNH-UHFFFAOYSA-N p-cresol Chemical compound CC1=CC=C(O)C=C1 IWDCLRJOBJJRNH-UHFFFAOYSA-N 0.000 description 2
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- YTZKOQUCBOVLHL-UHFFFAOYSA-N tert-butylbenzene Chemical compound CC(C)(C)C1=CC=CC=C1 YTZKOQUCBOVLHL-UHFFFAOYSA-N 0.000 description 2
- 150000003512 tertiary amines Chemical class 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 150000003918 triazines Chemical class 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- OGPKMXHRBCKKLQ-UHFFFAOYSA-N (2,4-diethylphenyl) cyanate Chemical compound CCC1=CC=C(OC#N)C(CC)=C1 OGPKMXHRBCKKLQ-UHFFFAOYSA-N 0.000 description 1
- JRBJLOCMQWBLDF-UHFFFAOYSA-N (2,6-dichlorophenyl) cyanate Chemical compound ClC1=CC=CC(Cl)=C1OC#N JRBJLOCMQWBLDF-UHFFFAOYSA-N 0.000 description 1
- NSEZUSFKACELMB-UHFFFAOYSA-N (2,6-dimethylphenyl) cyanate Chemical compound CC1=CC=CC(C)=C1OC#N NSEZUSFKACELMB-UHFFFAOYSA-N 0.000 description 1
- VSHAQOZVUZJKCO-UHFFFAOYSA-N (2,6-ditert-butylphenyl) cyanate Chemical compound CC(C)(C)C1=CC=CC(C(C)(C)C)=C1OC#N VSHAQOZVUZJKCO-UHFFFAOYSA-N 0.000 description 1
- MSWSOVMHQQAFJG-UHFFFAOYSA-N (2-acetylphenyl) cyanate Chemical compound CC(=O)C1=CC=CC=C1OC#N MSWSOVMHQQAFJG-UHFFFAOYSA-N 0.000 description 1
- GYIUFGWIHNSVCN-UHFFFAOYSA-N (2-chlorophenyl) cyanate Chemical compound ClC1=CC=CC=C1OC#N GYIUFGWIHNSVCN-UHFFFAOYSA-N 0.000 description 1
- ULYBHRQVCDELMO-UHFFFAOYSA-N (2-ethyl-4-nitrophenyl) cyanate Chemical compound CCC1=CC([N+]([O-])=O)=CC=C1OC#N ULYBHRQVCDELMO-UHFFFAOYSA-N 0.000 description 1
- GWBSCOKVLHUIHQ-UHFFFAOYSA-N (2-methylphenyl) cyanate Chemical compound CC1=CC=CC=C1OC#N GWBSCOKVLHUIHQ-UHFFFAOYSA-N 0.000 description 1
- SHBUQGBESNZMCH-UHFFFAOYSA-N (2-nitrophenyl) cyanate Chemical compound [O-][N+](=O)C1=CC=CC=C1OC#N SHBUQGBESNZMCH-UHFFFAOYSA-N 0.000 description 1
- MFOZVXLXUDSJMU-UHFFFAOYSA-N (2-nonylphenyl) cyanate Chemical compound CCCCCCCCCC1=CC=CC=C1OC#N MFOZVXLXUDSJMU-UHFFFAOYSA-N 0.000 description 1
- ZRYOWZHGKOVICO-UHFFFAOYSA-N (2-tert-butylphenyl) cyanate Chemical compound CC(C)(C)C1=CC=CC=C1OC#N ZRYOWZHGKOVICO-UHFFFAOYSA-N 0.000 description 1
- UFKLQICEQCIWNE-UHFFFAOYSA-N (3,5-dicyanatophenyl) cyanate Chemical compound N#COC1=CC(OC#N)=CC(OC#N)=C1 UFKLQICEQCIWNE-UHFFFAOYSA-N 0.000 description 1
- QSMZSCNZPOTAQR-UHFFFAOYSA-N (3,5-dimethylphenyl) cyanate Chemical compound CC1=CC(C)=CC(OC#N)=C1 QSMZSCNZPOTAQR-UHFFFAOYSA-N 0.000 description 1
- UBWVCMYZYWVZFK-UHFFFAOYSA-N (3-chloro-2-methylphenyl) cyanate Chemical compound CC1=C(Cl)C=CC=C1OC#N UBWVCMYZYWVZFK-UHFFFAOYSA-N 0.000 description 1
- YVOQQUGUJXFKOC-UHFFFAOYSA-N (3-chlorophenyl) cyanate Chemical compound ClC1=CC=CC(OC#N)=C1 YVOQQUGUJXFKOC-UHFFFAOYSA-N 0.000 description 1
- OSHDNORJIBTCJW-UHFFFAOYSA-N (3-cyanato-5-methylphenyl) cyanate Chemical compound CC1=CC(OC#N)=CC(OC#N)=C1 OSHDNORJIBTCJW-UHFFFAOYSA-N 0.000 description 1
- QQZZMAPJAKOSNG-UHFFFAOYSA-N (3-cyanatophenyl) cyanate Chemical compound N#COC1=CC=CC(OC#N)=C1 QQZZMAPJAKOSNG-UHFFFAOYSA-N 0.000 description 1
- PHXJQMUDUQRVAV-UHFFFAOYSA-N (3-methoxyphenyl) cyanate Chemical compound COC1=CC=CC(OC#N)=C1 PHXJQMUDUQRVAV-UHFFFAOYSA-N 0.000 description 1
- MUAFEFAYKJZTHJ-UHFFFAOYSA-N (4-acetylphenyl) cyanate Chemical compound CC(=O)C1=CC=C(OC#N)C=C1 MUAFEFAYKJZTHJ-UHFFFAOYSA-N 0.000 description 1
- VESOYJBKIYTTEL-UHFFFAOYSA-N (4-benzoylphenyl) cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(=O)C1=CC=CC=C1 VESOYJBKIYTTEL-UHFFFAOYSA-N 0.000 description 1
- GUGZCSAPOLLKNG-UHFFFAOYSA-N (4-cyanatophenyl) cyanate Chemical compound N#COC1=CC=C(OC#N)C=C1 GUGZCSAPOLLKNG-UHFFFAOYSA-N 0.000 description 1
- FFUGFEZHSFMOTP-UHFFFAOYSA-N (4-cyclohexylphenyl) cyanate Chemical compound C1=CC(OC#N)=CC=C1C1CCCCC1 FFUGFEZHSFMOTP-UHFFFAOYSA-N 0.000 description 1
- LKOYFNVMCUKOJD-UHFFFAOYSA-N (4-ethenylphenyl) cyanate Chemical compound C=CC1=CC=C(OC#N)C=C1 LKOYFNVMCUKOJD-UHFFFAOYSA-N 0.000 description 1
- BYMZMVNQWJIIDN-UHFFFAOYSA-N (4-formylphenyl) cyanate Chemical compound O=CC1=CC=C(OC#N)C=C1 BYMZMVNQWJIIDN-UHFFFAOYSA-N 0.000 description 1
- RMNOKYKUILWHMR-UHFFFAOYSA-N (4-methyl-2-sulfanylphenyl) cyanate Chemical compound CC1=CC(=C(C=C1)OC#N)S RMNOKYKUILWHMR-UHFFFAOYSA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- OCJBOOLMMGQPQU-UHFFFAOYSA-N 1,4-dichlorobenzene Chemical compound ClC1=CC=C(Cl)C=C1 OCJBOOLMMGQPQU-UHFFFAOYSA-N 0.000 description 1
- NFDXQGNDWIPXQL-UHFFFAOYSA-N 1-cyclooctyldiazocane Chemical compound C1CCCCCCC1N1NCCCCCC1 NFDXQGNDWIPXQL-UHFFFAOYSA-N 0.000 description 1
- QZEDXQFZACVDJE-UHFFFAOYSA-N 2,3-dibutylnaphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(CCCC)C(CCCC)=CC2=C1 QZEDXQFZACVDJE-UHFFFAOYSA-N 0.000 description 1
- DKCPKDPYUFEZCP-UHFFFAOYSA-N 2,6-di-tert-butylphenol Chemical compound CC(C)(C)C1=CC=CC(C(C)(C)C)=C1O DKCPKDPYUFEZCP-UHFFFAOYSA-N 0.000 description 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 1
- JECYUBVRTQDVAT-UHFFFAOYSA-N 2-acetylphenol Chemical compound CC(=O)C1=CC=CC=C1O JECYUBVRTQDVAT-UHFFFAOYSA-N 0.000 description 1
- ISPYQTSUDJAMAB-UHFFFAOYSA-N 2-chlorophenol Chemical compound OC1=CC=CC=C1Cl ISPYQTSUDJAMAB-UHFFFAOYSA-N 0.000 description 1
- YKTXVKQLETVLJG-UHFFFAOYSA-N 2-ethyl-4-nitrophenol Chemical compound CCC1=CC([N+]([O-])=O)=CC=C1O YKTXVKQLETVLJG-UHFFFAOYSA-N 0.000 description 1
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- WJQOZHYUIDYNHM-UHFFFAOYSA-N 2-tert-Butylphenol Chemical compound CC(C)(C)C1=CC=CC=C1O WJQOZHYUIDYNHM-UHFFFAOYSA-N 0.000 description 1
- UGEJOEBBMPOJMT-UHFFFAOYSA-N 3-(trifluoromethyl)phenol Chemical compound OC1=CC=CC(C(F)(F)F)=C1 UGEJOEBBMPOJMT-UHFFFAOYSA-N 0.000 description 1
- WADQOGCINABPRT-UHFFFAOYSA-N 3-chloro-2-methylphenol Chemical compound CC1=C(O)C=CC=C1Cl WADQOGCINABPRT-UHFFFAOYSA-N 0.000 description 1
- HORNXRXVQWOLPJ-UHFFFAOYSA-N 3-chlorophenol Chemical compound OC1=CC=CC(Cl)=C1 HORNXRXVQWOLPJ-UHFFFAOYSA-N 0.000 description 1
- TXFPEBPIARQUIG-UHFFFAOYSA-N 4'-hydroxyacetophenone Chemical compound CC(=O)C1=CC=C(O)C=C1 TXFPEBPIARQUIG-UHFFFAOYSA-N 0.000 description 1
- RXNYJUSEXLAVNQ-UHFFFAOYSA-N 4,4'-Dihydroxybenzophenone Chemical compound C1=CC(O)=CC=C1C(=O)C1=CC=C(O)C=C1 RXNYJUSEXLAVNQ-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical compound C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- NZGQHKSLKRFZFL-UHFFFAOYSA-N 4-(4-hydroxyphenoxy)phenol Chemical compound C1=CC(O)=CC=C1OC1=CC=C(O)C=C1 NZGQHKSLKRFZFL-UHFFFAOYSA-N 0.000 description 1
- QASBCTGZKABPKX-UHFFFAOYSA-N 4-(methylsulfanyl)phenol Chemical compound CSC1=CC=C(O)C=C1 QASBCTGZKABPKX-UHFFFAOYSA-N 0.000 description 1
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 1
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- RZVAJINKPMORJF-UHFFFAOYSA-N Acetaminophen Chemical compound CC(=O)NC1=CC=C(O)C=C1 RZVAJINKPMORJF-UHFFFAOYSA-N 0.000 description 1
- HTVITOHKHWFJKO-UHFFFAOYSA-N Bisphenol B Chemical compound C=1C=C(O)C=CC=1C(C)(CC)C1=CC=C(O)C=C1 HTVITOHKHWFJKO-UHFFFAOYSA-N 0.000 description 1
- IDOBXYOADCCQAT-UHFFFAOYSA-N C1(=CC=CC=C1)C.CC1=CC=CC=C1.C(Cl)Cl Chemical compound C1(=CC=CC=C1)C.CC1=CC=CC=C1.C(Cl)Cl IDOBXYOADCCQAT-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- NHTMVDHEPJAVLT-UHFFFAOYSA-N Isooctane Chemical compound CC(C)CC(C)(C)C NHTMVDHEPJAVLT-UHFFFAOYSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- JPYHHZQJCSQRJY-UHFFFAOYSA-N Phloroglucinol Natural products CCC=CCC=CCC=CCC=CCCCCC(=O)C1=C(O)C=C(O)C=C1O JPYHHZQJCSQRJY-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- CMHBPGYKMXHYBG-UHFFFAOYSA-N [3-(trifluoromethyl)phenyl] cyanate Chemical compound FC(F)(F)C1=CC=CC(OC#N)=C1 CMHBPGYKMXHYBG-UHFFFAOYSA-N 0.000 description 1
- KHBNIEBZWXZEPA-UHFFFAOYSA-N [4-[2-(4-cyanato-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenyl] cyanate Chemical compound CC1=C(OC#N)C(C)=CC(C(C)(C)C=2C=C(C)C(OC#N)=C(C)C=2)=C1 KHBNIEBZWXZEPA-UHFFFAOYSA-N 0.000 description 1
- UPCZANMLPOWPAD-UHFFFAOYSA-N [4-[2-(4-cyanatophenyl)butan-2-yl]phenyl] cyanate Chemical compound C=1C=C(OC#N)C=CC=1C(C)(CC)C1=CC=C(OC#N)C=C1 UPCZANMLPOWPAD-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- JPICKYUTICNNNJ-UHFFFAOYSA-N anthrarufin Chemical compound O=C1C2=C(O)C=CC=C2C(=O)C2=C1C=CC=C2O JPICKYUTICNNNJ-UHFFFAOYSA-N 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 239000003849 aromatic solvent Substances 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- VCCBEIPGXKNHFW-UHFFFAOYSA-N biphenyl-4,4'-diol Chemical group C1=CC(O)=CC=C1C1=CC=C(O)C=C1 VCCBEIPGXKNHFW-UHFFFAOYSA-N 0.000 description 1
- YXVFYQXJAXKLAK-UHFFFAOYSA-N biphenyl-4-ol Chemical group C1=CC(O)=CC=C1C1=CC=CC=C1 YXVFYQXJAXKLAK-UHFFFAOYSA-N 0.000 description 1
- RDHPKYGYEGBMSE-UHFFFAOYSA-N bromoethane Chemical compound CCBr RDHPKYGYEGBMSE-UHFFFAOYSA-N 0.000 description 1
- 230000005587 bubbling Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000001651 cyanato group Chemical group [*]OC#N 0.000 description 1
- ATDGTVJJHBUTRL-UHFFFAOYSA-N cyanogen bromide Chemical compound BrC#N ATDGTVJJHBUTRL-UHFFFAOYSA-N 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 239000012973 diazabicyclooctane Substances 0.000 description 1
- FJBFPHVGVWTDIP-UHFFFAOYSA-N dibromomethane Chemical compound BrCBr FJBFPHVGVWTDIP-UHFFFAOYSA-N 0.000 description 1
- 229940117389 dichlorobenzene Drugs 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- JVSWJIKNEAIKJW-UHFFFAOYSA-N dimethyl-hexane Natural products CCCCCC(C)C JVSWJIKNEAIKJW-UHFFFAOYSA-N 0.000 description 1
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 1
- OASFYFTVWALXTH-UHFFFAOYSA-L disodium;diphenoxide Chemical compound [Na+].[Na+].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 OASFYFTVWALXTH-UHFFFAOYSA-L 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910017053 inorganic salt Inorganic materials 0.000 description 1
- 239000007791 liquid phase Substances 0.000 description 1
- SODPLIPUBHWQPC-UHFFFAOYSA-N methyl 4-cyanatobenzoate Chemical compound COC(=O)C1=CC=C(OC#N)C=C1 SODPLIPUBHWQPC-UHFFFAOYSA-N 0.000 description 1
- MXHTZQSKTCCMFG-UHFFFAOYSA-N n,n-dibenzyl-1-phenylmethanamine Chemical compound C=1C=CC=CC=1CN(CC=1C=CC=CC=1)CC1=CC=CC=C1 MXHTZQSKTCCMFG-UHFFFAOYSA-N 0.000 description 1
- FRQONEWDWWHIPM-UHFFFAOYSA-N n,n-dicyclohexylcyclohexanamine Chemical compound C1CCCCC1N(C1CCCCC1)C1CCCCC1 FRQONEWDWWHIPM-UHFFFAOYSA-N 0.000 description 1
- CIXSDMKDSYXUMJ-UHFFFAOYSA-N n,n-diethylcyclohexanamine Chemical compound CCN(CC)C1CCCCC1 CIXSDMKDSYXUMJ-UHFFFAOYSA-N 0.000 description 1
- YWFWDNVOPHGWMX-UHFFFAOYSA-N n,n-dimethyldodecan-1-amine Chemical compound CCCCCCCCCCCCN(C)C YWFWDNVOPHGWMX-UHFFFAOYSA-N 0.000 description 1
- OOHAUGDGCWURIT-UHFFFAOYSA-N n,n-dipentylpentan-1-amine Chemical compound CCCCCN(CCCCC)CCCCC OOHAUGDGCWURIT-UHFFFAOYSA-N 0.000 description 1
- MTHFROHDIWGWFD-UHFFFAOYSA-N n-butyl-n-methylbutan-1-amine Chemical compound CCCCN(C)CCCC MTHFROHDIWGWFD-UHFFFAOYSA-N 0.000 description 1
- WOLFCKKMHUVEPN-UHFFFAOYSA-N n-ethyl-n-methylbutan-1-amine Chemical compound CCCCN(C)CC WOLFCKKMHUVEPN-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- NOHFYJWXIIYRIP-UHFFFAOYSA-N phenyl 4-cyanatobenzoate Chemical compound C=1C=C(OC#N)C=CC=1C(=O)OC1=CC=CC=C1 NOHFYJWXIIYRIP-UHFFFAOYSA-N 0.000 description 1
- GJLNWLVPAHNBQN-UHFFFAOYSA-N phenyl 4-hydroxybenzoate Chemical compound C1=CC(O)=CC=C1C(=O)OC1=CC=CC=C1 GJLNWLVPAHNBQN-UHFFFAOYSA-N 0.000 description 1
- CWHFDTWZHFRTAB-UHFFFAOYSA-N phenyl cyanate Chemical compound N#COC1=CC=CC=C1 CWHFDTWZHFRTAB-UHFFFAOYSA-N 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 239000001294 propane Substances 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- GYESAYHWISMZOK-UHFFFAOYSA-N quinolin-5-ol Chemical compound C1=CC=C2C(O)=CC=CC2=N1 GYESAYHWISMZOK-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C261/00—Derivatives of cyanic acid
- C07C261/02—Cyanates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2446004A DE2446004C3 (de) | 1974-09-26 | 1974-09-26 | Verfahren zur Herstellung besonders reiner aromatischer Cyansäureester |
| SU752171203A SU591138A3 (ru) | 1974-09-26 | 1975-09-15 | Способ получени ароматических эфиров циановой кислоты |
| US05/613,755 US3994949A (en) | 1974-09-26 | 1975-09-16 | Production of aromatic cyanic acid esters |
| GB3853575A GB1458344A (en) | 1974-09-26 | 1975-09-19 | Process for the production of aromatic cyanic acid esters |
| CH1226175A CH620199A5 (enExample) | 1974-09-26 | 1975-09-22 | |
| IT51458/75A IT1047090B (it) | 1974-09-26 | 1975-09-23 | Procedimento per la produzione di esteri aromatici di acido cianico particolarmente puri e prodotti cosi ottenuti |
| AT731375A AT337670B (de) | 1974-09-26 | 1975-09-24 | Verfahren zur herstellung von, insbesondere reinen, aromatischen cyansaureestern |
| CA236,218A CA1040645A (en) | 1974-09-26 | 1975-09-24 | Process for the production of particularly pure aromatic cyanic acid esters |
| BE160316A BE833752A (fr) | 1974-09-26 | 1975-09-24 | Procede de production d'esters aromatiques d'acide cyanique particulierement purs |
| SE7510765A SE424317B (sv) | 1974-09-26 | 1975-09-25 | Sett att framstella vissa angivna aromatiska cyansyraestrar |
| NLAANVRAGE7511309,A NL175409C (nl) | 1974-09-26 | 1975-09-25 | Werkwijze voor de bereiding van aromatische cyaanzuuresters. |
| JP11572875A JPS563859B2 (enExample) | 1974-09-26 | 1975-09-26 | |
| FR7529648A FR2286129A1 (fr) | 1974-09-26 | 1975-09-26 | Procede de production d'esters aromatiques d'acide cyanique particulierement purs |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2446004A DE2446004C3 (de) | 1974-09-26 | 1974-09-26 | Verfahren zur Herstellung besonders reiner aromatischer Cyansäureester |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2446004A1 DE2446004A1 (de) | 1976-04-08 |
| DE2446004B2 DE2446004B2 (de) | 1979-05-17 |
| DE2446004C3 true DE2446004C3 (de) | 1980-01-10 |
Family
ID=5926813
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2446004A Expired DE2446004C3 (de) | 1974-09-26 | 1974-09-26 | Verfahren zur Herstellung besonders reiner aromatischer Cyansäureester |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3994949A (enExample) |
| JP (1) | JPS563859B2 (enExample) |
| AT (1) | AT337670B (enExample) |
| BE (1) | BE833752A (enExample) |
| CA (1) | CA1040645A (enExample) |
| CH (1) | CH620199A5 (enExample) |
| DE (1) | DE2446004C3 (enExample) |
| FR (1) | FR2286129A1 (enExample) |
| GB (1) | GB1458344A (enExample) |
| IT (1) | IT1047090B (enExample) |
| NL (1) | NL175409C (enExample) |
| SE (1) | SE424317B (enExample) |
| SU (1) | SU591138A3 (enExample) |
Families Citing this family (24)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4713442A (en) * | 1983-11-16 | 1987-12-15 | The Dow Chemical Company | Polyaromatic cyanate |
| US4748270A (en) * | 1983-11-16 | 1988-05-31 | The Dow Chemical Company | Preparation of aromatic cyanates |
| US4751323A (en) * | 1983-11-16 | 1988-06-14 | The Dow Chemical Company | Novel polyaromatic cyanates |
| JPS62201954A (ja) * | 1986-03-03 | 1987-09-05 | Mitsubishi Gas Chem Co Inc | 強化ポリオレフイン樹脂組成物. |
| US4746754A (en) * | 1986-05-16 | 1988-05-24 | The Dow Chemical Company | Preparation of carbonate diisocyanates and related compounds |
| US4709008A (en) * | 1986-06-30 | 1987-11-24 | Interez, Inc. | Blend of tris (cyanatophenyl) alkane and bis(cyanatophenyl) alkane |
| US5284968A (en) * | 1986-11-24 | 1994-02-08 | Ciba-Geigy Corporation | Process for preparing bis (4-cyanatophenyl)-1,1-ethane |
| US5162574A (en) * | 1986-11-24 | 1992-11-10 | Hi-Tek Polymers, Inc. | Bis(4-cyanatophenyl)-1,1-ethane |
| US4940848A (en) * | 1987-05-04 | 1990-07-10 | Hi-Tek Polymers, Inc. | Stable solutions of prepolymers of thiodi(phenylcyanate) and laminating method employing same |
| US5428125A (en) * | 1989-07-17 | 1995-06-27 | The Dow Chemical Company | Mesogenic polycyanates and thermosets thereof |
| US5442039A (en) * | 1989-07-17 | 1995-08-15 | The Dow Chemical Company | Mesogenic polycyanates and thermosets thereof |
| US4981994A (en) * | 1989-07-31 | 1991-01-01 | Shell Oil Company | Preparation of cyanate esters |
| US5206321A (en) * | 1991-10-03 | 1993-04-27 | The Dow Chemical Company | Polycyanates containing mesogenic moieties as lateral substituents |
| JPH05301852A (ja) * | 1991-12-27 | 1993-11-16 | Kanegafuchi Chem Ind Co Ltd | シアン酸エステルおよびシアン酸エステルプレポリマーならびにそれから製造した電気用積層板 |
| US5932762A (en) * | 1994-05-27 | 1999-08-03 | Lonza, Ltd. | Process for the production of aryl cyanates |
| TW319778B (enExample) * | 1995-04-24 | 1997-11-11 | Sumitomo Chemical Co | |
| US5903046A (en) | 1996-02-20 | 1999-05-11 | Micron Technology, Inc. | Integrated circuit device having cyanate ester buffer coat |
| US5969036A (en) * | 1997-06-20 | 1999-10-19 | The Dexter Corporation | Epoxy-containing die-attach compositions |
| US6242638B1 (en) | 1999-03-12 | 2001-06-05 | Vantico Inc. | Cyanate esters having flame resistant properties |
| US6396143B1 (en) * | 1999-04-30 | 2002-05-28 | Mitsubishi Gas Chemical Company, Inc. | Ball grid array type printed wiring board having exellent heat diffusibility and printed wiring board |
| US7892651B2 (en) | 2004-09-14 | 2011-02-22 | Mitsubishi Gas Chemical Company, Inc. | Resin composite metal foil, laminate and process for the production of printed wiring board using the laminate |
| JP5026727B2 (ja) * | 2006-04-03 | 2012-09-19 | 三菱瓦斯化学株式会社 | 高純度シアン酸エステルの製造方法 |
| TWI501865B (zh) | 2009-07-24 | 2015-10-01 | Mitsubishi Gas Chemical Co | 樹脂複合電解銅箔、銅箔積層板以及印刷配線板 |
| WO2016021511A1 (ja) * | 2014-08-08 | 2016-02-11 | 三菱瓦斯化学株式会社 | リソグラフィー用下層膜形成用組成物、リソグラフィー用下層膜及びパターン形成方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3107261A (en) * | 1958-11-28 | 1963-10-15 | Bayer Ag | Process for the production of phenyl cyanates and phenyl cyanates |
| DE1248667B (enExample) * | 1963-02-16 | 1967-08-31 | Farbenfabriken Bayer Aktiengesellschaft Leverkusen | |
| US3595900A (en) * | 1968-07-01 | 1971-07-27 | Minnesota Mining & Mfg | Cyanatophenyl-terminated polyarylene ethers |
-
1974
- 1974-09-26 DE DE2446004A patent/DE2446004C3/de not_active Expired
-
1975
- 1975-09-15 SU SU752171203A patent/SU591138A3/ru active
- 1975-09-16 US US05/613,755 patent/US3994949A/en not_active Expired - Lifetime
- 1975-09-19 GB GB3853575A patent/GB1458344A/en not_active Expired
- 1975-09-22 CH CH1226175A patent/CH620199A5/de not_active IP Right Cessation
- 1975-09-23 IT IT51458/75A patent/IT1047090B/it active
- 1975-09-24 AT AT731375A patent/AT337670B/de not_active IP Right Cessation
- 1975-09-24 BE BE160316A patent/BE833752A/xx not_active IP Right Cessation
- 1975-09-24 CA CA236,218A patent/CA1040645A/en not_active Expired
- 1975-09-25 SE SE7510765A patent/SE424317B/xx not_active IP Right Cessation
- 1975-09-25 NL NLAANVRAGE7511309,A patent/NL175409C/xx not_active IP Right Cessation
- 1975-09-26 JP JP11572875A patent/JPS563859B2/ja not_active Expired
- 1975-09-26 FR FR7529648A patent/FR2286129A1/fr active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| AT337670B (de) | 1977-07-11 |
| NL7511309A (nl) | 1976-03-30 |
| SE7510765L (sv) | 1976-03-29 |
| BE833752A (fr) | 1976-03-24 |
| GB1458344A (en) | 1976-12-15 |
| FR2286129B1 (enExample) | 1978-10-27 |
| JPS563859B2 (enExample) | 1981-01-27 |
| JPS5163149A (enExample) | 1976-06-01 |
| DE2446004A1 (de) | 1976-04-08 |
| NL175409B (nl) | 1984-06-01 |
| SE424317B (sv) | 1982-07-12 |
| ATA731375A (de) | 1976-11-15 |
| SU591138A3 (ru) | 1978-01-30 |
| FR2286129A1 (fr) | 1976-04-23 |
| DE2446004B2 (de) | 1979-05-17 |
| US3994949A (en) | 1976-11-30 |
| CA1040645A (en) | 1978-10-17 |
| IT1047090B (it) | 1980-09-10 |
| NL175409C (nl) | 1984-11-01 |
| CH620199A5 (enExample) | 1980-11-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2446004C3 (de) | Verfahren zur Herstellung besonders reiner aromatischer Cyansäureester | |
| DE2754887C2 (enExample) | ||
| DE2509036C2 (de) | Verfahren zur Herstellung von symmetrischen Diarylcarbonaten | |
| DE2612312A1 (de) | Formmassen aus mischungen halogenhaltiger und halogenfreier, polyfunktioneller, aromatischer cyansaeureester | |
| EP0099965B1 (de) | Verfahren zur Herstellung von hochmolekularen Polyphenylenoxiden | |
| EP0026318B1 (de) | Verfahren zur Herstellung reiner 4,4'-Dihydroxydiphenylalkane bzw. -cycloalkane | |
| DE2655826C2 (de) | Verfahren zur Herstellung von Alkylaryläthern | |
| EP0444293A1 (de) | Verfahren zur Herstellung von mindestens eine aromatische Estergruppe enthaltenden Kohlensäurediestern | |
| DE4121791C2 (de) | Verfahren zur Herstellung von substituierten Cycloalkylidenbisphenolen | |
| DE2255639C3 (de) | Ester der phosphorigen Säure | |
| EP0001823A2 (de) | Verwendung von Borsäureestern zum Stabilisieren von phosphitfreien Polycarbonaten und die erhaltenen stabilisierten Polycarbonatformmassen | |
| DE2457081A1 (de) | S-triazin-vorpolymerisate | |
| EP0121671B2 (de) | Verfahren zur Herstellung von Dihydroxybenzolen | |
| DE2025891C3 (de) | Verfahren zur Herstellung von Tris-(3,5-dialkyl-4-hydroxy-benzyl)-isocyanuraten | |
| DE4029198C2 (enExample) | ||
| EP0387820B1 (de) | Verfahren zur Herstellung von 2,3,5-Trimethyl-p-benzochinon | |
| DE1668848A1 (de) | Verfahren zur Herstellung von AEtherperoxyden aus alpha-substituierten Vinylaethern und neue AEtherperoxyde | |
| DE3410385A1 (de) | Verfahren zur herstellung von polyphenylenoxid unter verwendung eines kupfer-halogenid-amin-katalysators | |
| DE2945179A1 (de) | Verfahren zur herstellung von 2-(4'- hydroxyaryl)-2-(4'-aminoaryl)-propanen | |
| EP0245792A2 (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| DD149371A5 (de) | Verfahren zur herstellung von polyglycidylaethern von polyphenolen | |
| DE3844443A1 (de) | Chlorformiate aromatischer ketone und verfahren zu deren herstellung | |
| DE69910224T2 (de) | Phosphinligandaktivierte herstellung von tetraaryloxyalkane und diarylcarbonate | |
| AT243787B (de) | Verfahren zur Herstellung von neuen Cyansäureestern | |
| EP0004021B1 (de) | Verfahren zur Herstellung perhalogenierter Diarylcarbonate und die Verwendung der so erhaltenen Carbonate zur Flammschutzausrüstung von Kunststoffen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) |