DE2441504A1 - Verfahren zur herstellung von 3,5disubstituierten pyrazolen durch katalytische dehydrierung - Google Patents
Verfahren zur herstellung von 3,5disubstituierten pyrazolen durch katalytische dehydrierungInfo
- Publication number
- DE2441504A1 DE2441504A1 DE2441504A DE2441504A DE2441504A1 DE 2441504 A1 DE2441504 A1 DE 2441504A1 DE 2441504 A DE2441504 A DE 2441504A DE 2441504 A DE2441504 A DE 2441504A DE 2441504 A1 DE2441504 A1 DE 2441504A1
- Authority
- DE
- Germany
- Prior art keywords
- reaction mixture
- carbon
- catalyst
- solvent
- cooled
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 238000000034 method Methods 0.000 title claims description 24
- 150000003217 pyrazoles Chemical class 0.000 title claims description 11
- 230000003197 catalytic effect Effects 0.000 title claims description 7
- 230000018044 dehydration Effects 0.000 title description 3
- 238000006297 dehydration reaction Methods 0.000 title description 3
- 238000004519 manufacturing process Methods 0.000 title description 2
- 239000011541 reaction mixture Substances 0.000 claims description 69
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 36
- -1 3,5-disubstituted Pyrazole Chemical class 0.000 claims description 32
- 239000003054 catalyst Substances 0.000 claims description 32
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 claims description 30
- 239000008096 xylene Substances 0.000 claims description 26
- 238000006243 chemical reaction Methods 0.000 claims description 23
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims description 22
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 claims description 22
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 21
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 239000002904 solvent Substances 0.000 claims description 17
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 16
- 239000000203 mixture Substances 0.000 claims description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 14
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 12
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 claims description 12
- 238000006356 dehydrogenation reaction Methods 0.000 claims description 12
- 150000002576 ketones Chemical class 0.000 claims description 12
- JXHKUYQCEJILEI-UHFFFAOYSA-N 3,5-diphenyl-1h-pyrazole Chemical compound C=1C(C=2C=CC=CC=2)=NNC=1C1=CC=CC=C1 JXHKUYQCEJILEI-UHFFFAOYSA-N 0.000 claims description 11
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 11
- 238000010992 reflux Methods 0.000 claims description 11
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 10
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 10
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 claims description 8
- 125000000217 alkyl group Chemical group 0.000 claims description 7
- 239000000706 filtrate Substances 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 7
- 229910052757 nitrogen Inorganic materials 0.000 claims description 7
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 150000008280 chlorinated hydrocarbons Chemical class 0.000 claims description 6
- 238000001914 filtration Methods 0.000 claims description 6
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 claims description 6
- 230000001681 protective effect Effects 0.000 claims description 6
- 150000003738 xylenes Chemical class 0.000 claims description 6
- 150000001299 aldehydes Chemical class 0.000 claims description 5
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 229910052786 argon Inorganic materials 0.000 claims description 5
- 239000001569 carbon dioxide Substances 0.000 claims description 5
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 5
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 claims description 5
- 239000001307 helium Substances 0.000 claims description 5
- 229910052734 helium Inorganic materials 0.000 claims description 5
- SWQJXJOGLNCZEY-UHFFFAOYSA-N helium atom Chemical compound [He] SWQJXJOGLNCZEY-UHFFFAOYSA-N 0.000 claims description 5
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 5
- 239000011707 mineral Substances 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- 239000003849 aromatic solvent Substances 0.000 claims description 4
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 claims description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 3
- 150000004292 cyclic ethers Chemical class 0.000 claims description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000011261 inert gas Substances 0.000 claims description 3
- 125000003118 aryl group Chemical group 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000003880 polar aprotic solvent Substances 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims 2
- 150000001875 compounds Chemical class 0.000 claims 2
- 244000292411 Excoecaria agallocha Species 0.000 claims 1
- 238000010531 catalytic reduction reaction Methods 0.000 claims 1
- 239000012153 distilled water Substances 0.000 claims 1
- 125000004435 hydrogen atom Chemical class [H]* 0.000 claims 1
- 239000000126 substance Substances 0.000 claims 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 14
- 239000000047 product Substances 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 239000002585 base Substances 0.000 description 9
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 description 7
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 6
- 239000002168 alkylating agent Substances 0.000 description 6
- 229940100198 alkylating agent Drugs 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 4
- SVDTUJAQNAQGGW-UHFFFAOYSA-N 1-methyl-3,5-diphenylpyrazole Chemical compound CN1N=C(C=2C=CC=CC=2)C=C1C1=CC=CC=C1 SVDTUJAQNAQGGW-UHFFFAOYSA-N 0.000 description 4
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 238000004458 analytical method Methods 0.000 description 4
- 239000006184 cosolvent Substances 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- DQFBYFPFKXHELB-UHFFFAOYSA-N Chalcone Natural products C=1C=CC=CC=1C(=O)C=CC1=CC=CC=C1 DQFBYFPFKXHELB-UHFFFAOYSA-N 0.000 description 3
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 3
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 3
- 229910019142 PO4 Inorganic materials 0.000 description 3
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 3
- 150000001350 alkyl halides Chemical class 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 235000005513 chalcones Nutrition 0.000 description 3
- 150000008050 dialkyl sulfates Chemical class 0.000 description 3
- 238000001030 gas--liquid chromatography Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 235000021317 phosphate Nutrition 0.000 description 3
- 150000003219 pyrazolines Chemical class 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 150000001450 anions Chemical group 0.000 description 2
- 239000000010 aprotic solvent Substances 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 239000011737 fluorine Substances 0.000 description 2
- 150000004820 halides Chemical group 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-M hydrogensulfate Chemical group OS([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 239000012044 organic layer Substances 0.000 description 2
- 230000020477 pH reduction Effects 0.000 description 2
- 239000010452 phosphate Chemical group 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical group [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 2
- 229960005235 piperonyl butoxide Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000010802 sludge Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- DQFBYFPFKXHELB-VAWYXSNFSA-N trans-chalcone Chemical compound C=1C=CC=CC=1C(=O)\C=C\C1=CC=CC=C1 DQFBYFPFKXHELB-VAWYXSNFSA-N 0.000 description 2
- XQEMNBNCQVQXMO-UHFFFAOYSA-M 1,2-dimethyl-3,5-diphenylpyrazol-1-ium;methyl sulfate Chemical compound COS([O-])(=O)=O.C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 XQEMNBNCQVQXMO-UHFFFAOYSA-M 0.000 description 1
- YHUYQIXWRAWXMY-UHFFFAOYSA-N 2-(1-methyl-5-phenylpyrazol-3-yl)phenol Chemical compound CN1N=C(C=2C(=CC=CC=2)O)C=C1C1=CC=CC=C1 YHUYQIXWRAWXMY-UHFFFAOYSA-N 0.000 description 1
- WZFUQSJFWNHZHM-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)CC(=O)N1CC2=C(CC1)NN=N2 WZFUQSJFWNHZHM-UHFFFAOYSA-N 0.000 description 1
- YJLUBHOZZTYQIP-UHFFFAOYSA-N 2-[5-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-1,3,4-oxadiazol-2-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C1=NN=C(O1)CC(=O)N1CC2=C(CC1)NN=N2 YJLUBHOZZTYQIP-UHFFFAOYSA-N 0.000 description 1
- LBLYYCQCTBFVLH-UHFFFAOYSA-M 2-methylbenzenesulfonate Chemical compound CC1=CC=CC=C1S([O-])(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-M 0.000 description 1
- CONKBQPVFMXDOV-QHCPKHFHSA-N 6-[(5S)-5-[[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]piperazin-1-yl]methyl]-2-oxo-1,3-oxazolidin-3-yl]-3H-1,3-benzoxazol-2-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)N1CCN(CC1)C[C@H]1CN(C(O1)=O)C1=CC2=C(NC(O2)=O)C=C1 CONKBQPVFMXDOV-QHCPKHFHSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 235000007319 Avena orientalis Nutrition 0.000 description 1
- 240000002791 Brassica napus Species 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- FIPWRIJSWJWJAI-UHFFFAOYSA-N Butyl carbitol 6-propylpiperonyl ether Chemical compound C1=C(CCC)C(COCCOCCOCCCC)=CC2=C1OCO2 FIPWRIJSWJWJAI-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- NIPNSKYNPDTRPC-UHFFFAOYSA-N N-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidine-5-carboxamide Chemical compound O=C(CNC(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F)N1CC2=C(CC1)NN=N2 NIPNSKYNPDTRPC-UHFFFAOYSA-N 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 235000007238 Secale cereale Nutrition 0.000 description 1
- 244000082988 Secale cereale Species 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 150000001788 chalcone derivatives Chemical class 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- HHFAWKCIHAUFRX-UHFFFAOYSA-N ethoxide Chemical compound CC[O-] HHFAWKCIHAUFRX-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000002431 hydrogen Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical class CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- VUQUOGPMUUJORT-UHFFFAOYSA-N methyl 4-methylbenzenesulfonate Chemical compound COS(=O)(=O)C1=CC=C(C)C=C1 VUQUOGPMUUJORT-UHFFFAOYSA-N 0.000 description 1
- CAAULPUQFIIOTL-UHFFFAOYSA-N methyl dihydrogen phosphate Chemical compound COP(O)(O)=O CAAULPUQFIIOTL-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000011356 non-aqueous organic solvent Substances 0.000 description 1
- 238000010899 nucleation Methods 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- IKNCGYCHMGNBCP-UHFFFAOYSA-N propan-1-olate Chemical compound CCC[O-] IKNCGYCHMGNBCP-UHFFFAOYSA-N 0.000 description 1
- DNXIASIHZYFFRO-UHFFFAOYSA-N pyrazoline Chemical compound C1CN=NC1 DNXIASIHZYFFRO-UHFFFAOYSA-N 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 229950011008 tetrachloroethylene Drugs 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US39828473A | 1973-09-17 | 1973-09-17 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2441504A1 true DE2441504A1 (de) | 1975-03-20 |
| DE2441504C2 DE2441504C2 (enExample) | 1987-11-26 |
Family
ID=23574783
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2441504A Granted DE2441504A1 (de) | 1973-09-17 | 1974-08-30 | Verfahren zur herstellung von 3,5disubstituierten pyrazolen durch katalytische dehydrierung |
Country Status (20)
| Country | Link |
|---|---|
| JP (1) | JPS5855143B2 (enExample) |
| AR (1) | AR225264A1 (enExample) |
| AT (1) | AT339893B (enExample) |
| BE (1) | BE819948A (enExample) |
| BR (1) | BR7407147D0 (enExample) |
| CA (1) | CA1037048A (enExample) |
| CH (1) | CH596185A5 (enExample) |
| CS (1) | CS178177B2 (enExample) |
| DD (1) | DD115667A5 (enExample) |
| DE (1) | DE2441504A1 (enExample) |
| DK (1) | DK134643B (enExample) |
| ES (1) | ES430129A1 (enExample) |
| FR (1) | FR2243943B1 (enExample) |
| GB (1) | GB1477020A (enExample) |
| IL (1) | IL45399A (enExample) |
| IT (1) | IT1029578B (enExample) |
| NL (1) | NL168832C (enExample) |
| SE (1) | SE416648B (enExample) |
| SU (1) | SU645567A3 (enExample) |
| ZA (1) | ZA744908B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0045394A3 (en) * | 1980-08-01 | 1982-09-08 | Basf Aktiengesellschaft | Process for preparing pyrazoles |
| US4749812A (en) * | 1985-05-27 | 1988-06-07 | Mitsui Toatsu Chemicals, Inc. | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| WO2000007996A3 (en) * | 1998-08-07 | 2000-08-31 | Chiron Corp | Pyrazoles as estrogen receptor modulators |
| US6262098B1 (en) | 1998-08-07 | 2001-07-17 | Chiron Corporation | Estrogen receptor modulators |
| USRE39708E1 (en) | 1998-08-07 | 2007-06-26 | Chiron Corporation | Estrogen receptor modulators |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3910949A (en) * | 1974-12-09 | 1975-10-07 | American Cyanamid Co | Manufacture of 1,2-dimethyl-3,5-diphenylpyrazolium methylsulfate in a single reaction zone |
| WO2006033943A2 (en) * | 2004-09-17 | 2006-03-30 | Exelixis, Inc | Pyrazole kinase modulators and methods of use |
| HUE043090T2 (hu) * | 2008-06-09 | 2019-08-28 | Univ Muenchen Ludwig Maximilians | Gyógyszerek fehérjék aggregálódásának gátlására olyan betegségeknél, amelyek fehérje-aggregálódással és/vagy neurodegeneratív megbetegedésekkel függnek össze |
Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2260485A1 (de) * | 1971-12-17 | 1973-06-28 | American Cyanamid Co | Neue herbicide zusammensetzungen |
| DE3209148A1 (de) * | 1982-03-13 | 1983-09-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von pyrazolen durch katalytische dehydrierung von pyrazolinen |
-
1974
- 1974-07-31 ZA ZA00744908A patent/ZA744908B/xx unknown
- 1974-08-04 IL IL45399A patent/IL45399A/xx unknown
- 1974-08-15 GB GB3603874A patent/GB1477020A/en not_active Expired
- 1974-08-22 CA CA207,577A patent/CA1037048A/en not_active Expired
- 1974-08-22 AR AR255275A patent/AR225264A1/es active
- 1974-08-28 BR BR7147/74A patent/BR7407147D0/pt unknown
- 1974-08-30 DE DE2441504A patent/DE2441504A1/de active Granted
- 1974-09-06 IT IT52913/74A patent/IT1029578B/it active
- 1974-09-11 CH CH1237174A patent/CH596185A5/xx not_active IP Right Cessation
- 1974-09-11 DD DD181031A patent/DD115667A5/xx unknown
- 1974-09-12 NL NLAANVRAGE7412119,A patent/NL168832C/xx not_active IP Right Cessation
- 1974-09-12 AT AT738174A patent/AT339893B/de not_active IP Right Cessation
- 1974-09-16 BE BE148556A patent/BE819948A/xx not_active IP Right Cessation
- 1974-09-16 FR FR7431248A patent/FR2243943B1/fr not_active Expired
- 1974-09-16 CS CS6341A patent/CS178177B2/cs unknown
- 1974-09-16 SU SU742059902A patent/SU645567A3/ru active
- 1974-09-16 DK DK487274AA patent/DK134643B/da not_active IP Right Cessation
- 1974-09-16 SE SE7411650A patent/SE416648B/xx not_active IP Right Cessation
- 1974-09-17 JP JP49107068A patent/JPS5855143B2/ja not_active Expired
- 1974-09-17 ES ES430129A patent/ES430129A1/es not_active Expired
Patent Citations (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2260485A1 (de) * | 1971-12-17 | 1973-06-28 | American Cyanamid Co | Neue herbicide zusammensetzungen |
| DE3209148A1 (de) * | 1982-03-13 | 1983-09-22 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von pyrazolen durch katalytische dehydrierung von pyrazolinen |
Non-Patent Citations (9)
| Title |
|---|
| BEHR/FUSCO/JARBOE: Pyrazoles, Pyrazolines, Indazoles and Condensed Rings (1967), S. 189 und 45 * |
| Chemische Zentralblatt (1916), Bd.I, S.1063 * |
| EIDERFIELD, R.C.: Heterocyclic Compounds, (1957), S. 110 * |
| FIESER/FIESER: Reagents for Organic Synthesis I, (1967), S. 156 * |
| HOUBEN/WEYL: Allgemeine Methoden, Bd.2, (1955), S. 338 * |
| J.Amer.Chem.Soc.66 (1944), S. 488 * |
| J.Prakt.Chem.W.F.126 (1930), S. 171-173 * |
| Organikum, 9.Aufl. (1969), S.504 * |
| RYLANDER P.N.: Organic Synthesis with Noble Metal Catalysts (1973), S. 7-9 * |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0045394A3 (en) * | 1980-08-01 | 1982-09-08 | Basf Aktiengesellschaft | Process for preparing pyrazoles |
| US4749812A (en) * | 1985-05-27 | 1988-06-07 | Mitsui Toatsu Chemicals, Inc. | N-(3-chloro-4-isopropylphenyl) carboxamide derivative and selective herbicide |
| WO2000007996A3 (en) * | 1998-08-07 | 2000-08-31 | Chiron Corp | Pyrazoles as estrogen receptor modulators |
| US6262098B1 (en) | 1998-08-07 | 2001-07-17 | Chiron Corporation | Estrogen receptor modulators |
| US6291505B1 (en) | 1998-08-07 | 2001-09-18 | Chiron Corporation | Estrogen receptor modulators |
| US6387920B2 (en) | 1998-08-07 | 2002-05-14 | Chiron Corporation | Estrogen receptor modulators |
| US6727273B2 (en) | 1998-08-07 | 2004-04-27 | Chiron Corporation | Estrogen receptor modulators |
| US6743815B2 (en) | 1998-08-07 | 2004-06-01 | Chiron Corporation | Estrogen receptor modulators |
| US6869969B2 (en) | 1998-08-07 | 2005-03-22 | Chiron Corporation | Estrogen receptor modulators |
| USRE39708E1 (en) | 1998-08-07 | 2007-06-26 | Chiron Corporation | Estrogen receptor modulators |
Also Published As
| Publication number | Publication date |
|---|---|
| SU645567A3 (ru) | 1979-01-30 |
| IT1029578B (it) | 1979-03-20 |
| IL45399A (en) | 1979-01-31 |
| ES430129A1 (es) | 1977-01-16 |
| SE416648B (sv) | 1981-01-26 |
| IL45399A0 (en) | 1974-11-29 |
| NL168832B (nl) | 1981-12-16 |
| DK134643C (enExample) | 1977-05-16 |
| BR7407147D0 (pt) | 1975-07-29 |
| AT339893B (de) | 1977-11-10 |
| FR2243943A1 (enExample) | 1975-04-11 |
| AU7202874A (en) | 1976-03-11 |
| JPS5058068A (enExample) | 1975-05-20 |
| JPS5855143B2 (ja) | 1983-12-08 |
| NL7412119A (nl) | 1975-03-19 |
| GB1477020A (en) | 1977-06-22 |
| DK487274A (enExample) | 1975-05-12 |
| ATA738174A (de) | 1977-03-15 |
| DK134643B (da) | 1976-12-13 |
| AR225264A1 (es) | 1982-03-15 |
| CS178177B2 (enExample) | 1977-08-31 |
| CA1037048A (en) | 1978-08-22 |
| FR2243943B1 (enExample) | 1986-07-04 |
| NL168832C (nl) | 1982-05-17 |
| ZA744908B (en) | 1975-08-27 |
| BE819948A (fr) | 1975-03-17 |
| SE7411650L (enExample) | 1975-03-18 |
| DD115667A5 (enExample) | 1975-10-12 |
| CH596185A5 (enExample) | 1978-03-15 |
| DE2441504C2 (enExample) | 1987-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3002678C2 (enExample) | ||
| EP0711756B1 (de) | Verfahren zur Herstellung von Benzyl-piperidylmethylindanonen | |
| DE1958919C3 (de) | l-Oxo-5-indanyloxy essigsäure n und solche Verbindungen enthaltende Arzneimittel | |
| DE3010195A1 (de) | Verfahren zur herstellung von 2,5-bis(2,2,2-trifluoraethoxy)-n- (2-piperidylmethyl)benzamid | |
| DE2441504A1 (de) | Verfahren zur herstellung von 3,5disubstituierten pyrazolen durch katalytische dehydrierung | |
| DE2425979A1 (de) | Verfahren zur herstellung von pyrazolen | |
| DE3028369A1 (de) | Verfahren zur herstellung von 7-alkoxycarbonyl-6,8-dimethyl-4-hydroxymethyl-1-phthalazon und die dabei auftretenden zwischenprodukte | |
| EP0735016A1 (de) | Verfahren zur Herstellung von Alpha-Chloralkylarylketonen | |
| DE10035010A1 (de) | Verfahren zur Herstellung von Hydrazodicarbonamid (HDC) über Ketimine | |
| DE2804115C2 (enExample) | ||
| DE2855279C2 (de) | Cheliertes 1,8-Naphthyridinderivat, Verfahren zu seiner Herstellung und Verfahren zur Herstellung von 1,8-Naphthyridinderivaten | |
| EP0039795B1 (de) | Verfahren zur Herstellung von 1,2-Benzisothiazolen | |
| DE10332684B3 (de) | Verfahren zur Herstellung von Bifonazol | |
| CH638516A5 (en) | Process for preparing substituted aminoquinazoline derivatives | |
| DE3140632A1 (de) | Verfahren zur herstellung von (alpha)-dicyano-trimethylsilyloxy-verbindungen (i) | |
| DE1906087A1 (de) | Oxodihydrobenzoxazinderivate und Verfahren zu ihrer Herstellung | |
| EP0250897B1 (de) | Verfahren zur Herstellung von Hydroxybenzaldoxim-O-ethern | |
| DE2948885C2 (enExample) | ||
| EP0031416A1 (de) | Verfahren zur Herstellung substituierter Benzaldehyde | |
| DE2804723C2 (enExample) | ||
| DE955769C (de) | Verfahren zur Racemisierung von optisch aktiven 1-(p-Methoxybenzyl)-2-methyl-octahydroisochinolinen | |
| DE69711397T2 (de) | Herstellung von einem hydrazon-beta-ketoester durch reaktion mit einem diazoester | |
| DE19523448A1 (de) | Verfahren zur Herstellung von 2-substituierten Cyclopentanonen | |
| AT256856B (de) | Verfahren zur Herstellung von neuen heterocyclischen Verbindungen | |
| AT282609B (de) | Verfahren zur herstellung von 3-aminoalkyl-3-arylindanolen-(1) und 1-aminoalkyl-1-arylindenen, deren derivaten und ihren saeureadditionssalzen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| 8128 | New person/name/address of the agent |
Representative=s name: SPOTT, G., DIPL.-CHEM. DR.RER.NAT., PAT.-ANW., 800 |
|
| AG | Has addition no. |
Ref country code: DE Ref document number: 2602965 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| AG | Has addition no. |
Ref country code: DE Ref document number: 2602965 Format of ref document f/p: P |
|
| 8339 | Ceased/non-payment of the annual fee |