DE2434531C3 - - Google Patents
Info
- Publication number
- DE2434531C3 DE2434531C3 DE2434531A DE2434531A DE2434531C3 DE 2434531 C3 DE2434531 C3 DE 2434531C3 DE 2434531 A DE2434531 A DE 2434531A DE 2434531 A DE2434531 A DE 2434531A DE 2434531 C3 DE2434531 C3 DE 2434531C3
- Authority
- DE
- Germany
- Prior art keywords
- sodium carbonate
- sodium
- hydrogen peroxide
- percarbonate
- bulk density
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 45
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 41
- 238000000034 method Methods 0.000 claims description 24
- VTIIJXUACCWYHX-UHFFFAOYSA-L disodium;carboxylatooxy carbonate Chemical compound [Na+].[Na+].[O-]C(=O)OOC([O-])=O VTIIJXUACCWYHX-UHFFFAOYSA-L 0.000 claims description 22
- 229940045872 sodium percarbonate Drugs 0.000 claims description 22
- 239000011734 sodium Substances 0.000 claims description 19
- 229940001593 sodium carbonate Drugs 0.000 claims description 19
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 19
- MQRJBSHKWOFOGF-UHFFFAOYSA-L disodium;carbonate;hydrate Chemical compound O.[Na+].[Na+].[O-]C([O-])=O MQRJBSHKWOFOGF-UHFFFAOYSA-L 0.000 claims description 13
- 239000002245 particle Substances 0.000 claims description 12
- 229940076133 sodium carbonate monohydrate Drugs 0.000 claims description 11
- 229910052708 sodium Inorganic materials 0.000 claims description 8
- 238000002156 mixing Methods 0.000 claims description 4
- 239000000376 reactant Substances 0.000 claims description 3
- 239000007858 starting material Substances 0.000 claims description 3
- JYYOBHFYCIDXHH-UHFFFAOYSA-N carbonic acid;hydrate Chemical compound O.OC(O)=O JYYOBHFYCIDXHH-UHFFFAOYSA-N 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000047 product Substances 0.000 description 11
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 10
- 239000001301 oxygen Substances 0.000 description 10
- 229910052760 oxygen Inorganic materials 0.000 description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 7
- MWNQXXOSWHCCOZ-UHFFFAOYSA-L sodium;oxido carbonate Chemical compound [Na+].[O-]OC([O-])=O MWNQXXOSWHCCOZ-UHFFFAOYSA-L 0.000 description 7
- 238000005299 abrasion Methods 0.000 description 6
- 239000003570 air Substances 0.000 description 6
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 230000000704 physical effect Effects 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 239000012452 mother liquor Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 238000009621 Solvay process Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000000875 corresponding effect Effects 0.000 description 2
- 239000003085 diluting agent Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- XYQRXRFVKUPBQN-UHFFFAOYSA-L Sodium carbonate decahydrate Chemical compound O.O.O.O.O.O.O.O.O.O.[Na+].[Na+].[O-]C([O-])=O XYQRXRFVKUPBQN-UHFFFAOYSA-L 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000007376 cm-medium Substances 0.000 description 1
- 239000000567 combustion gas Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000003599 detergent Substances 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000010763 heavy fuel oil Substances 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 159000000003 magnesium salts Chemical class 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 229940072033 potash Drugs 0.000 description 1
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 1
- 235000015320 potassium carbonate Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229940018038 sodium carbonate decahydrate Drugs 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 235000011121 sodium hydroxide Nutrition 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 238000003892 spreading Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C01—INORGANIC CHEMISTRY
- C01B—NON-METALLIC ELEMENTS; COMPOUNDS THEREOF; METALLOIDS OR COMPOUNDS THEREOF NOT COVERED BY SUBCLASS C01C
- C01B15/00—Peroxides; Peroxyhydrates; Peroxyacids or salts thereof; Superoxides; Ozonides
- C01B15/055—Peroxyhydrates; Peroxyacids or salts thereof
- C01B15/10—Peroxyhydrates; Peroxyacids or salts thereof containing carbon
- C01B15/103—Peroxyhydrates; Peroxyacids or salts thereof containing carbon containing only alkali metals as metals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Inorganic Chemistry (AREA)
- Detergent Compositions (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Saccharide Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7326674A FR2237833B1 (enExample) | 1973-07-20 | 1973-07-20 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2434531A1 DE2434531A1 (de) | 1975-02-13 |
| DE2434531B2 DE2434531B2 (de) | 1978-08-24 |
| DE2434531C3 true DE2434531C3 (enExample) | 1979-07-19 |
Family
ID=9122901
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2434531A Granted DE2434531B2 (de) | 1973-07-20 | 1974-07-18 | Verfahren zur Herstellung von Natriumpercarbonat |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US4022874A (enExample) |
| JP (1) | JPS5113760B2 (enExample) |
| AT (1) | AT382594B (enExample) |
| BE (1) | BE816418A (enExample) |
| BR (1) | BR7405967D0 (enExample) |
| CA (1) | CA1033533A (enExample) |
| CH (1) | CH597093A5 (enExample) |
| DE (1) | DE2434531B2 (enExample) |
| DK (1) | DK141994B (enExample) |
| ES (1) | ES428424A1 (enExample) |
| FR (1) | FR2237833B1 (enExample) |
| GB (1) | GB1479738A (enExample) |
| IE (1) | IE39579B1 (enExample) |
| IT (1) | IT1014466B (enExample) |
| LU (1) | LU70565A1 (enExample) |
| NL (1) | NL185659C (enExample) |
| NO (1) | NO138845C (enExample) |
| SE (1) | SE400540B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2380221A1 (fr) * | 1977-02-11 | 1978-09-08 | Ugine Kuhlmann | Perfectionnement au procede de preparation du percarbonate de sodium |
| FR2410627A1 (fr) * | 1977-12-02 | 1979-06-29 | Ugine Kuhlmann | Persels mixtes stables en melange lixiviel |
| JPS5644863A (en) * | 1979-09-20 | 1981-04-24 | Toshiba Corp | Characteristic testing terminal device for electronic equipment |
| JPS5833164B2 (ja) * | 1980-07-04 | 1983-07-18 | 花王株式会社 | 中空顆粒状過炭酸塩及びその製造方法 |
| US5328721A (en) * | 1992-07-30 | 1994-07-12 | Fmc Corporation | Process for manufacturing sodium carbonate perhydrate particles and coating them with sodium borosilicate |
| US5756445A (en) * | 1993-11-11 | 1998-05-26 | The Proctor & Gamble Company | Granular detergent composition comprising a low bulk density component |
| IT1290477B1 (it) * | 1997-03-26 | 1998-12-04 | Solvay Interox | Processo per produrre un persale |
| EP0944549B1 (de) * | 1996-12-16 | 2011-03-30 | Solvay Chemicals GmbH | Verfahren zur herstellung von natriumpercarbonat |
| KR100494814B1 (ko) * | 2003-02-17 | 2005-06-13 | 동양제철화학 주식회사 | 입상 과탄산나트륨의 제조방법 |
| CN105060497B (zh) * | 2015-07-16 | 2017-06-20 | 华南理工大学 | 一种去除养殖水体亚硝酸盐的复合增氧剂及制备方法 |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE560460C (de) * | 1927-07-27 | 1932-10-03 | Fritz Schlotterbeck Dr | Herstellung technisch stabiler, aktiven Sauerstoff abgebender Praeparate |
| FR869104A (fr) * | 1940-09-13 | 1942-01-24 | Electrochimie Soc | Procédé de préparation des combinaisons oxygénees du carbonate de soude |
| BE448934A (enExample) * | 1942-01-15 | |||
| BE456688A (enExample) * | 1943-07-09 | |||
| US2986448A (en) * | 1958-12-18 | 1961-05-30 | Allied Chem | Preparation of sodium percarbonate |
| GB1165154A (en) * | 1965-12-10 | 1969-09-24 | Laporte Chemical | Peroxygen Compounds |
| NL169296C (nl) * | 1968-11-20 | 1982-07-01 | Solvay | Werkwijze voor het bereiden van natriumcarbonaatperoxohydraat. |
| GB1312514A (en) * | 1970-07-06 | 1973-04-04 | Laporte Industries Ltd | Process for the preparation of peroxygen compounds |
| IT986371B (it) * | 1972-06-02 | 1975-01-30 | Degussa | Procedimento per la produzione di percarbonato alcalino |
| US3860694A (en) * | 1972-08-31 | 1975-01-14 | Du Pont | Process for the preparation of perhydrates |
-
1973
- 1973-07-20 FR FR7326674A patent/FR2237833B1/fr not_active Expired
-
1974
- 1974-06-17 BE BE145494A patent/BE816418A/xx not_active IP Right Cessation
- 1974-07-01 IE IE1384/74A patent/IE39579B1/xx unknown
- 1974-07-04 GB GB29734/74A patent/GB1479738A/en not_active Expired
- 1974-07-04 IT IT69140/74A patent/IT1014466B/it active
- 1974-07-11 US US05/487,613 patent/US4022874A/en not_active Expired - Lifetime
- 1974-07-17 CA CA205,105A patent/CA1033533A/en not_active Expired
- 1974-07-18 LU LU70565A patent/LU70565A1/xx unknown
- 1974-07-18 DE DE2434531A patent/DE2434531B2/de active Granted
- 1974-07-19 CH CH1001874A patent/CH597093A5/xx not_active IP Right Cessation
- 1974-07-19 BR BR5967/74A patent/BR7405967D0/pt unknown
- 1974-07-19 NO NO74742630A patent/NO138845C/no unknown
- 1974-07-19 DK DK390174AA patent/DK141994B/da not_active IP Right Cessation
- 1974-07-19 AT AT0599274A patent/AT382594B/de not_active IP Right Cessation
- 1974-07-19 SE SE7409467A patent/SE400540B/xx not_active IP Right Cessation
- 1974-07-19 ES ES428424A patent/ES428424A1/es not_active Expired
- 1974-07-19 NL NLAANVRAGE7409804,A patent/NL185659C/xx not_active IP Right Cessation
- 1974-07-20 JP JP49082762A patent/JPS5113760B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1479738A (en) | 1977-07-13 |
| LU70565A1 (enExample) | 1974-11-28 |
| IE39579B1 (en) | 1978-11-08 |
| NL185659C (nl) | 1990-06-18 |
| JPS5113760B2 (enExample) | 1976-05-01 |
| NL7409804A (nl) | 1975-01-22 |
| NO138845B (no) | 1978-08-14 |
| ATA599274A (de) | 1986-08-15 |
| DK141994B (da) | 1980-08-04 |
| IT1014466B (it) | 1977-04-20 |
| ES428424A1 (es) | 1977-05-16 |
| DE2434531A1 (de) | 1975-02-13 |
| IE39579L (en) | 1975-01-20 |
| BE816418A (fr) | 1974-10-16 |
| NO742630L (enExample) | 1975-02-17 |
| FR2237833A1 (enExample) | 1975-02-14 |
| DK390174A (enExample) | 1975-03-24 |
| SE400540B (sv) | 1978-04-03 |
| DK141994C (enExample) | 1980-12-22 |
| SE7409467L (enExample) | 1975-01-21 |
| CH597093A5 (enExample) | 1978-03-31 |
| CA1033533A (en) | 1978-06-27 |
| AU7252674A (en) | 1976-02-26 |
| US4022874A (en) | 1977-05-10 |
| BR7405967D0 (pt) | 1975-05-13 |
| NL185659B (nl) | 1990-01-16 |
| NO138845C (no) | 1978-11-22 |
| FR2237833B1 (enExample) | 1976-04-30 |
| JPS5044199A (enExample) | 1975-04-21 |
| DE2434531B2 (de) | 1978-08-24 |
| AT382594B (de) | 1987-03-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69801884T2 (de) | Zeolith des Faujasitstyps mit niedrigem Kiedelsäuregehalts und Methode zu dessen Herstellung | |
| EP0592969B1 (de) | Durch Beschichtung stabilisierte Natriumpercarbonate | |
| DE68902383T2 (de) | Verfahren zur Herstllung eines Peroxy-Sodiumkarbonat Anhydrid. | |
| DE1567714A1 (de) | Verfahren zur Herstellung eines kristallinen Aluminosilicatzeoliths | |
| DE2531670A1 (de) | Zeolith und verfahren zu dessen herstellung | |
| DE19608000B4 (de) | Verfahren zur Herstellung von körnigem Natriumpercarbonat | |
| DE2434531C3 (enExample) | ||
| DE3879046T2 (de) | Zsm-5 und seine synthese. | |
| DE3803055C2 (de) | Synthetischer Stevensit, Verfahren zu seiner Herstellung und Verwendung | |
| DE2824342A1 (de) | Kristallines natriumalumosilicat vom typ 4a, seine herstellung und verwendung | |
| DE69615358T2 (de) | Zeolith des typs p mit kleiner teilchengrösse | |
| DE1134783B (de) | Verfahren zur Herstellung von mit Siliciumdioxyd ueberzogenen Bariummetaborat-Pigmenten | |
| DE69618806T2 (de) | Verfahren zur herstellung von calciumborat | |
| EP0220488B1 (de) | Verfahren zur Herstellung einer Impfmischung für die Faujasit-Synthese | |
| DE2857424C2 (enExample) | ||
| DE68921957T2 (de) | Teilchenförmige Zusammensetzung mit Bleichmittel und optischem Aufheller und deren Herstellung. | |
| DE4107955C2 (de) | Verfahren zum Herstellen von Phyllosilikat vom Kenyait-Typ | |
| DE1256634B (de) | Verfahren zur Herstellung von Zeolithen | |
| DE2926380C2 (enExample) | ||
| EP0446597B1 (de) | Verfahren zur Herstellung von Peroxoborat-Agglemeraten. | |
| DE2421924C2 (de) | Verfahren zum Herstellen von kugelförmigen Natriumperboratkörnern | |
| DE2708861C3 (de) | Verfahren zur Herstellung eines Carbonates von Aluminium und einem Alkali-oder Erdalkalimetall l | |
| DE1293730B (de) | Verfahren zur Herstellung von synthetischem kristallinem Zeolith | |
| AT391121B (de) | Verfahren zur herstellung von granuliertem stabilisiertem natriumperkarbonat | |
| DE2115965C3 (de) | Verfahren zur Herstellung von Mordenit und dessen Verwendung als Trager für Katalysatoren fur Kohlenwasserstoff-Umwandlungsverfahren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |