DE2432686A1 - Verfahren zur herstellung von brompyridinen - Google Patents
Verfahren zur herstellung von brompyridinenInfo
- Publication number
- DE2432686A1 DE2432686A1 DE2432686A DE2432686A DE2432686A1 DE 2432686 A1 DE2432686 A1 DE 2432686A1 DE 2432686 A DE2432686 A DE 2432686A DE 2432686 A DE2432686 A DE 2432686A DE 2432686 A1 DE2432686 A1 DE 2432686A1
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen
- chlorine atom
- nitro
- species
- dichloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 15
- 238000004519 manufacturing process Methods 0.000 title description 5
- 239000000460 chlorine Substances 0.000 claims description 36
- 239000004480 active ingredient Substances 0.000 claims description 26
- 229910052801 chlorine Inorganic materials 0.000 claims description 23
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 22
- 229910052739 hydrogen Inorganic materials 0.000 claims description 22
- 239000003795 chemical substances by application Substances 0.000 claims description 18
- 239000001257 hydrogen Substances 0.000 claims description 18
- 150000005752 bromopyridines Chemical class 0.000 claims description 17
- -1 -CHO Chemical group 0.000 claims description 16
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 16
- 238000006243 chemical reaction Methods 0.000 claims description 14
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 claims description 12
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 11
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- 150000002431 hydrogen Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000002689 soil Substances 0.000 claims description 8
- 125000001424 substituent group Chemical group 0.000 claims description 7
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 6
- 229910000042 hydrogen bromide Inorganic materials 0.000 claims description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 5
- 241000233866 Fungi Species 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- IMRWILPUOVGIMU-UHFFFAOYSA-N 2-bromopyridine Chemical compound BrC1=CC=CC=N1 IMRWILPUOVGIMU-UHFFFAOYSA-N 0.000 claims description 4
- 150000005753 chloropyridines Chemical class 0.000 claims description 4
- 230000000855 fungicidal effect Effects 0.000 claims description 4
- 239000000417 fungicide Substances 0.000 claims description 4
- 230000003032 phytopathogenic effect Effects 0.000 claims description 3
- FJNNGKMAGDPVIU-UHFFFAOYSA-N 2,4,6-trichloropyridine Chemical class ClC1=CC(Cl)=NC(Cl)=C1 FJNNGKMAGDPVIU-UHFFFAOYSA-N 0.000 claims description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 16
- 239000000243 solution Substances 0.000 description 14
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- 241000894007 species Species 0.000 description 10
- 239000008187 granular material Substances 0.000 description 9
- 239000013078 crystal Substances 0.000 description 8
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 8
- 239000011541 reaction mixture Substances 0.000 description 8
- 241000196324 Embryophyta Species 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 235000013339 cereals Nutrition 0.000 description 6
- 229910052757 nitrogen Inorganic materials 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 5
- 238000002156 mixing Methods 0.000 description 5
- 239000003921 oil Substances 0.000 description 5
- 239000003960 organic solvent Substances 0.000 description 5
- 239000006072 paste Substances 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000007787 solid Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- FNRMMDCDHWCQTH-UHFFFAOYSA-N 2-chloropyridine;3-chloropyridine;4-chloropyridine Chemical compound ClC1=CC=NC=C1.ClC1=CC=CN=C1.ClC1=CC=CC=N1 FNRMMDCDHWCQTH-UHFFFAOYSA-N 0.000 description 4
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 4
- 239000000969 carrier Substances 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 230000000694 effects Effects 0.000 description 4
- XMJRZCYSCMZVJQ-UHFFFAOYSA-N 2,5,6-trichloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=C(Cl)N=C1Cl XMJRZCYSCMZVJQ-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 241000221787 Erysiphe Species 0.000 description 3
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 3
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 3
- 229910052794 bromium Inorganic materials 0.000 description 3
- 235000019993 champagne Nutrition 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 3
- 238000001291 vacuum drying Methods 0.000 description 3
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 description 2
- YIKWKLYQRFRGPM-UHFFFAOYSA-N 1-dodecylguanidine acetate Chemical compound CC(O)=O.CCCCCCCCCCCCN=C(N)N YIKWKLYQRFRGPM-UHFFFAOYSA-N 0.000 description 2
- KPXAMNWVBHLRRG-UHFFFAOYSA-N 2,3,6-trichloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Cl)N=C1Cl KPXAMNWVBHLRRG-UHFFFAOYSA-N 0.000 description 2
- DISJSVBEEGHXTC-UHFFFAOYSA-N 2,6-dibromo-3-chloro-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC(Cl)=C(Br)N=C1Br DISJSVBEEGHXTC-UHFFFAOYSA-N 0.000 description 2
- GFDGSOAAFDXXDO-UHFFFAOYSA-N 2,6-dibromo-3-chloropyridine Chemical compound ClC1=CC=C(Br)N=C1Br GFDGSOAAFDXXDO-UHFFFAOYSA-N 0.000 description 2
- FEYDZHNIIMENOB-UHFFFAOYSA-N 2,6-dibromopyridine Chemical compound BrC1=CC=CC(Br)=N1 FEYDZHNIIMENOB-UHFFFAOYSA-N 0.000 description 2
- UPWAAFFFSGQECJ-UHFFFAOYSA-N 2,6-dichloro-3-(trifluoromethyl)pyridine Chemical compound FC(F)(F)C1=CC=C(Cl)N=C1Cl UPWAAFFFSGQECJ-UHFFFAOYSA-N 0.000 description 2
- FILKGCRCWDMBKA-UHFFFAOYSA-N 2,6-dichloropyridine Chemical compound ClC1=CC=CC(Cl)=N1 FILKGCRCWDMBKA-UHFFFAOYSA-N 0.000 description 2
- 235000001674 Agaricus brunnescens Nutrition 0.000 description 2
- 239000005995 Aluminium silicate Substances 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- 241001123530 Cronartium Species 0.000 description 2
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000001856 Ethyl cellulose Substances 0.000 description 2
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 2
- 241000223218 Fusarium Species 0.000 description 2
- 241000461774 Gloeosporium Species 0.000 description 2
- 239000005909 Kieselgur Substances 0.000 description 2
- 241001518729 Monilinia Species 0.000 description 2
- 241000190509 Ophiobolus Species 0.000 description 2
- 241000228143 Penicillium Species 0.000 description 2
- 241001223281 Peronospora Species 0.000 description 2
- 241001533598 Septoria Species 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- 241000722093 Tilletia caries Species 0.000 description 2
- 241000317942 Venturia <ichneumonid wasp> Species 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 2
- 230000001070 adhesive effect Effects 0.000 description 2
- 235000012211 aluminium silicate Nutrition 0.000 description 2
- 239000002518 antifoaming agent Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 238000005660 chlorination reaction Methods 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- PYZSVQVRHDXQSL-UHFFFAOYSA-N dithianon Chemical compound S1C(C#N)=C(C#N)SC2=C1C(=O)C1=CC=CC=C1C2=O PYZSVQVRHDXQSL-UHFFFAOYSA-N 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 235000013399 edible fruits Nutrition 0.000 description 2
- 229920001249 ethyl cellulose Polymers 0.000 description 2
- 235000019325 ethyl cellulose Nutrition 0.000 description 2
- 229910052731 fluorine Inorganic materials 0.000 description 2
- 230000002538 fungal effect Effects 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- LKPLKUMXSAEKID-UHFFFAOYSA-N pentachloronitrobenzene Chemical compound [O-][N+](=O)C1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl LKPLKUMXSAEKID-UHFFFAOYSA-N 0.000 description 2
- 238000005554 pickling Methods 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- UGNWTBMOAKPKBL-UHFFFAOYSA-N tetrachloro-1,4-benzoquinone Chemical compound ClC1=C(Cl)C(=O)C(Cl)=C(Cl)C1=O UGNWTBMOAKPKBL-UHFFFAOYSA-N 0.000 description 2
- 239000008096 xylene Substances 0.000 description 2
- 150000003738 xylenes Chemical class 0.000 description 2
- VCRZMGPQAQGELB-UHFFFAOYSA-N (2,6-dichloropyridin-3-yl)methyl acetate Chemical compound CC(=O)OCC1=CC=C(Cl)N=C1Cl VCRZMGPQAQGELB-UHFFFAOYSA-N 0.000 description 1
- YEGGTTBLVORABJ-UXBLZVDNSA-N (2-butan-2-yl-4,6-dinitrophenyl) (e)-2-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C(\C)=C\C YEGGTTBLVORABJ-UXBLZVDNSA-N 0.000 description 1
- ODNBVEIAQAZNNM-UHFFFAOYSA-N 1-(6-chloroimidazo[1,2-b]pyridazin-3-yl)ethanone Chemical compound C1=CC(Cl)=NN2C(C(=O)C)=CN=C21 ODNBVEIAQAZNNM-UHFFFAOYSA-N 0.000 description 1
- ZQXCQTAELHSNAT-UHFFFAOYSA-N 1-chloro-3-nitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(Cl)=CC(C(F)(F)F)=C1 ZQXCQTAELHSNAT-UHFFFAOYSA-N 0.000 description 1
- ZEVICHWDUHTEDT-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-naphthalen-1-ylpyridine Chemical compound ClC1=C(Cl)C(Cl)=NC(C=2C3=CC=CC=C3C=CC=2)=C1Cl ZEVICHWDUHTEDT-UHFFFAOYSA-N 0.000 description 1
- BTEHYWLEORTNEQ-UHFFFAOYSA-N 2,3,4,5-tetrachloro-6-phenylpyridine Chemical compound ClC1=C(Cl)C(Cl)=NC(C=2C=CC=CC=2)=C1Cl BTEHYWLEORTNEQ-UHFFFAOYSA-N 0.000 description 1
- DLOOKZXVYJHDIY-UHFFFAOYSA-N 2,3,4,5-tetrachloropyridine Chemical compound ClC1=CN=C(Cl)C(Cl)=C1Cl DLOOKZXVYJHDIY-UHFFFAOYSA-N 0.000 description 1
- DGRWKOIUYLWSEV-UHFFFAOYSA-N 2,3,6-trichloro-5-(chloromethyl)pyridine Chemical compound ClCC1=CC(Cl)=C(Cl)N=C1Cl DGRWKOIUYLWSEV-UHFFFAOYSA-N 0.000 description 1
- GPAKJVMKNDXBHH-UHFFFAOYSA-N 2,3,6-trichloropyridine Chemical compound ClC1=CC=C(Cl)C(Cl)=N1 GPAKJVMKNDXBHH-UHFFFAOYSA-N 0.000 description 1
- SVPKNMBRVBMTLB-UHFFFAOYSA-N 2,3-dichloronaphthalene-1,4-dione Chemical compound C1=CC=C2C(=O)C(Cl)=C(Cl)C(=O)C2=C1 SVPKNMBRVBMTLB-UHFFFAOYSA-N 0.000 description 1
- WALXYTCBNHJWER-UHFFFAOYSA-N 2,4,6-tribromopyridine Chemical class BrC1=CC(Br)=NC(Br)=C1 WALXYTCBNHJWER-UHFFFAOYSA-N 0.000 description 1
- GWBHJHIZHNTJLA-UHFFFAOYSA-N 2,4-dichloropyridine-3-carbaldehyde Chemical compound ClC1=CC=NC(Cl)=C1C=O GWBHJHIZHNTJLA-UHFFFAOYSA-N 0.000 description 1
- RDKOFPGNUGKUPE-UHFFFAOYSA-N 2,5,6-trichloropyridin-3-amine Chemical compound NC1=CC(Cl)=C(Cl)N=C1Cl RDKOFPGNUGKUPE-UHFFFAOYSA-N 0.000 description 1
- NZKNZMNTPXCGHG-UHFFFAOYSA-N 2,6-dibromo-3,5-dichloropyridine Chemical compound ClC1=CC(Cl)=C(Br)N=C1Br NZKNZMNTPXCGHG-UHFFFAOYSA-N 0.000 description 1
- FFRFTURYWWFKIC-UHFFFAOYSA-N 2,6-dibromo-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Br)N=C1Br FFRFTURYWWFKIC-UHFFFAOYSA-N 0.000 description 1
- UZLWUHWZLKEKLW-UHFFFAOYSA-N 2,6-dibromo-5-chloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC(Cl)=C(Br)N=C1Br UZLWUHWZLKEKLW-UHFFFAOYSA-N 0.000 description 1
- NKMZKPJIEVZLQX-UHFFFAOYSA-N 2,6-dichloro-3-(chloromethyl)-5-nitropyridine Chemical compound [O-][N+](=O)C1=CC(CCl)=C(Cl)N=C1Cl NKMZKPJIEVZLQX-UHFFFAOYSA-N 0.000 description 1
- CMPPTKONDXHDBF-UHFFFAOYSA-N 2,6-dichloro-3-(chloromethyl)pyridine Chemical compound ClCC1=CC=C(Cl)N=C1Cl CMPPTKONDXHDBF-UHFFFAOYSA-N 0.000 description 1
- SHCWQWRTKPNTEM-UHFFFAOYSA-N 2,6-dichloro-3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=C(Cl)N=C1Cl SHCWQWRTKPNTEM-UHFFFAOYSA-N 0.000 description 1
- AJPKQSSFYHPYMH-UHFFFAOYSA-N 2,6-dichloropyridine-3-carboxylic acid Chemical compound OC(=O)C1=CC=C(Cl)N=C1Cl AJPKQSSFYHPYMH-UHFFFAOYSA-N 0.000 description 1
- FPZWZCWUIYYYBU-UHFFFAOYSA-N 2-(2-ethoxyethoxy)ethyl acetate Chemical compound CCOCCOCCOC(C)=O FPZWZCWUIYYYBU-UHFFFAOYSA-N 0.000 description 1
- QJEBJKXTNSYBGE-UHFFFAOYSA-N 2-(2-heptadecyl-4,5-dihydroimidazol-1-yl)ethanol Chemical compound CCCCCCCCCCCCCCCCCC1=NCCN1CCO QJEBJKXTNSYBGE-UHFFFAOYSA-N 0.000 description 1
- OHRBKZHLPZJDLM-UHFFFAOYSA-N 2-(4,6-dibromo-1h-triazin-2-yl)phenol Chemical compound OC1=CC=CC=C1N1N=C(Br)C=C(Br)N1 OHRBKZHLPZJDLM-UHFFFAOYSA-N 0.000 description 1
- OIMQLXQDHOFORS-UHFFFAOYSA-N 2-chloro-2-(chloromethyl)pentanedinitrile Chemical compound ClCC(Cl)(C#N)CCC#N OIMQLXQDHOFORS-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- ZRDUSMYWDRPZRM-UHFFFAOYSA-N 2-sec-butyl-4,6-dinitrophenyl 3-methylbut-2-enoate Chemical compound CCC(C)C1=CC([N+]([O-])=O)=CC([N+]([O-])=O)=C1OC(=O)C=C(C)C ZRDUSMYWDRPZRM-UHFFFAOYSA-N 0.000 description 1
- UOPCVXGPNIFRMW-UHFFFAOYSA-N 3,5-diethoxy-2,6-dinitropyridine Chemical compound CCOC1=CC(OCC)=C([N+]([O-])=O)N=C1[N+]([O-])=O UOPCVXGPNIFRMW-UHFFFAOYSA-N 0.000 description 1
- DTZZORVJMAGUDK-UHFFFAOYSA-N 3,5-diethoxy-2-nitropyridine Chemical compound CCOC1=CN=C([N+]([O-])=O)C(OCC)=C1 DTZZORVJMAGUDK-UHFFFAOYSA-N 0.000 description 1
- QLILRKBRWXALIE-UHFFFAOYSA-N 3-nitropyridine Chemical compound [O-][N+](=O)C1=CC=CN=C1 QLILRKBRWXALIE-UHFFFAOYSA-N 0.000 description 1
- BXVKGWQEEXPBAW-UHFFFAOYSA-N 4,6-dichloro-2,5-dimethylpyrimidine Chemical compound CC1=NC(Cl)=C(C)C(Cl)=N1 BXVKGWQEEXPBAW-UHFFFAOYSA-N 0.000 description 1
- FBGVTWONYOCYGA-UHFFFAOYSA-N 4,6-dichloropyridin-3-amine Chemical compound NC1=CN=C(Cl)C=C1Cl FBGVTWONYOCYGA-UHFFFAOYSA-N 0.000 description 1
- AYGGQJHJRFZDFH-UHFFFAOYSA-N 5,7-dichloro-1h-indole-2,3-dione Chemical compound ClC1=CC(Cl)=CC2=C1NC(=O)C2=O AYGGQJHJRFZDFH-UHFFFAOYSA-N 0.000 description 1
- OXVYPUHFVFBLBO-UHFFFAOYSA-N 7-bromo-5-chloro-1h-indole-2,3-dione Chemical compound BrC1=CC(Cl)=CC2=C1NC(=O)C2=O OXVYPUHFVFBLBO-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005725 8-Hydroxyquinoline Substances 0.000 description 1
- 241000223600 Alternaria Species 0.000 description 1
- 241000213004 Alternaria solani Species 0.000 description 1
- GUNJVIDCYZYFGV-UHFFFAOYSA-K Antimony trifluoride Inorganic materials F[Sb](F)F GUNJVIDCYZYFGV-UHFFFAOYSA-K 0.000 description 1
- 241001444083 Aphanomyces Species 0.000 description 1
- 241000228212 Aspergillus Species 0.000 description 1
- 241000123650 Botrytis cinerea Species 0.000 description 1
- 241000233684 Bremia Species 0.000 description 1
- 241000233685 Bremia lactucae Species 0.000 description 1
- 241000221866 Ceratocystis Species 0.000 description 1
- 241000228437 Cochliobolus Species 0.000 description 1
- 241000222199 Colletotrichum Species 0.000 description 1
- 241000609458 Corynespora Species 0.000 description 1
- 241000461780 Diplocarpon Species 0.000 description 1
- 241000663351 Diplocarpon rosae Species 0.000 description 1
- 239000005764 Dithianon Substances 0.000 description 1
- 239000005766 Dodine Substances 0.000 description 1
- 241000221785 Erysiphales Species 0.000 description 1
- 241000510928 Erysiphe necator Species 0.000 description 1
- 241000228427 Eurotiales Species 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 206010017533 Fungal infection Diseases 0.000 description 1
- 241000223221 Fusarium oxysporum Species 0.000 description 1
- 241000221661 Helotiales Species 0.000 description 1
- 241001181537 Hemileia Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- 241000190144 Lasiodiplodia theobromae Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- WAEMQWOKJMHJLA-UHFFFAOYSA-N Manganese(2+) Chemical compound [Mn+2] WAEMQWOKJMHJLA-UHFFFAOYSA-N 0.000 description 1
- 241000862466 Monilinia laxa Species 0.000 description 1
- 241001459558 Monographella nivalis Species 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- 241001226034 Nectria <echinoderm> Species 0.000 description 1
- 241000556984 Neonectria galligena Species 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 241001507673 Penicillium digitatum Species 0.000 description 1
- 241001387976 Pera Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 241000222831 Phialophora <Chaetothyriales> Species 0.000 description 1
- 241001503951 Phoma Species 0.000 description 1
- 241000975369 Phoma betae Species 0.000 description 1
- 241001409766 Phragmidium Species 0.000 description 1
- 241000499488 Phragmidium mucronatum Species 0.000 description 1
- 241001149949 Phytophthora cactorum Species 0.000 description 1
- 241000233622 Phytophthora infestans Species 0.000 description 1
- 241000233626 Plasmopara Species 0.000 description 1
- 241001281803 Plasmopara viticola Species 0.000 description 1
- 241000896203 Podosphaera pannosa Species 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 241000222383 Polyporales Species 0.000 description 1
- 241001281802 Pseudoperonospora Species 0.000 description 1
- 241000342307 Pseudoperonospora humuli Species 0.000 description 1
- 241001480433 Pseudopeziza Species 0.000 description 1
- 241000221300 Puccinia Species 0.000 description 1
- 241000540505 Puccinia dispersa f. sp. tritici Species 0.000 description 1
- 241000221535 Pucciniales Species 0.000 description 1
- 241000231139 Pyricularia Species 0.000 description 1
- 241000233639 Pythium Species 0.000 description 1
- 241000813090 Rhizoctonia solani Species 0.000 description 1
- 241000221662 Sclerotinia Species 0.000 description 1
- 241001558929 Sclerotium <basidiomycota> Species 0.000 description 1
- 241000228446 Taphrina Species 0.000 description 1
- 241000228448 Taphrina deformans Species 0.000 description 1
- 241000228395 Taphrinales Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 241000865903 Thielaviopsis Species 0.000 description 1
- 241000722133 Tilletia Species 0.000 description 1
- 241000209140 Triticum Species 0.000 description 1
- 235000021307 Triticum Nutrition 0.000 description 1
- 241000221576 Uromyces Species 0.000 description 1
- 241000221577 Uromyces appendiculatus Species 0.000 description 1
- 241000221566 Ustilago Species 0.000 description 1
- 241000514371 Ustilago avenae Species 0.000 description 1
- 241000082085 Verticillium <Phyllachorales> Species 0.000 description 1
- 241001123669 Verticillium albo-atrum Species 0.000 description 1
- 241001523973 Xylariales Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- DNEHKUCSURWDGO-UHFFFAOYSA-N aluminum sodium Chemical compound [Na].[Al] DNEHKUCSURWDGO-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 239000003788 bath preparation Substances 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 230000031709 bromination Effects 0.000 description 1
- 238000005893 bromination reaction Methods 0.000 description 1
- JHRWWRDRBPCWTF-OLQVQODUSA-N captafol Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)C(Cl)Cl)C(=O)[C@H]21 JHRWWRDRBPCWTF-OLQVQODUSA-N 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000008119 colloidal silica Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 150000004816 dichlorobenzenes Chemical class 0.000 description 1
- 239000012990 dithiocarbamate Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 230000007717 exclusion Effects 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 125000001207 fluorophenyl group Chemical group 0.000 description 1
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 238000005658 halogenation reaction Methods 0.000 description 1
- 125000005059 halophenyl group Chemical group 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- ORTFAQDWJHRMNX-UHFFFAOYSA-N hydroxidooxidocarbon(.) Chemical compound O[C]=O ORTFAQDWJHRMNX-UHFFFAOYSA-N 0.000 description 1
- JGJLWPGRMCADHB-UHFFFAOYSA-N hypobromite Inorganic materials Br[O-] JGJLWPGRMCADHB-UHFFFAOYSA-N 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 239000002917 insecticide Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 230000002262 irrigation Effects 0.000 description 1
- 238000003973 irrigation Methods 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- YKSNLCVSTHTHJA-UHFFFAOYSA-L maneb Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S YKSNLCVSTHTHJA-UHFFFAOYSA-L 0.000 description 1
- 229920000940 maneb Polymers 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000004570 mortar (masonry) Substances 0.000 description 1
- UQJQVUOTMVCFHX-UHFFFAOYSA-L nabam Chemical compound [Na+].[Na+].[S-]C(=S)NCCNC([S-])=S UQJQVUOTMVCFHX-UHFFFAOYSA-L 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 229960003540 oxyquinoline Drugs 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- IZUPBVBPLAPZRR-UHFFFAOYSA-N pentachlorophenol Chemical compound OC1=C(Cl)C(Cl)=C(Cl)C(Cl)=C1Cl IZUPBVBPLAPZRR-UHFFFAOYSA-N 0.000 description 1
- 239000012071 phase Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- UHZYTMXLRWXGPK-UHFFFAOYSA-N phosphorus pentachloride Chemical compound ClP(Cl)(Cl)(Cl)Cl UHZYTMXLRWXGPK-UHFFFAOYSA-N 0.000 description 1
- XKJCHHZQLQNZHY-UHFFFAOYSA-N phthalimide Chemical compound C1=CC=C2C(=O)NC(=O)C2=C1 XKJCHHZQLQNZHY-UHFFFAOYSA-N 0.000 description 1
- 231100000208 phytotoxic Toxicity 0.000 description 1
- 230000000885 phytotoxic effect Effects 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 description 1
- 230000036647 reaction Effects 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- SRAWNDFHGTVUNZ-UHFFFAOYSA-M sodium;3,6-dibutylnaphthalene-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1=CC(CCCC)=CC2=CC(CCCC)=CC=C21 SRAWNDFHGTVUNZ-UHFFFAOYSA-M 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 1
- 239000011573 trace mineral Substances 0.000 description 1
- 235000013619 trace mineral Nutrition 0.000 description 1
- 229940035339 tri-chlor Drugs 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000004563 wettable powder Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/72—Nitrogen atoms
- C07D213/73—Unsubstituted amino or imino radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/44—Radicals substituted by doubly-bound oxygen, sulfur, or nitrogen atoms, or by two such atoms singly-bound to the same carbon atom
- C07D213/46—Oxygen atoms
- C07D213/48—Aldehydo radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/61—Halogen atoms or nitro radicals
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/60—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D213/78—Carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, e.g. ester or nitrile radicals
- C07D213/79—Acids; Esters
- C07D213/80—Acids; Esters in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1002073 | 1973-07-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2432686A1 true DE2432686A1 (de) | 1975-01-30 |
Family
ID=4358480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2432686A Pending DE2432686A1 (de) | 1973-07-10 | 1974-07-08 | Verfahren zur herstellung von brompyridinen |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3974166A (enExample) |
| JP (1) | JPS5037784A (enExample) |
| DE (1) | DE2432686A1 (enExample) |
| FR (1) | FR2236861A1 (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH603860A5 (enExample) * | 1976-09-21 | 1978-08-31 | Saurer Ag Adolph | |
| US4753673A (en) * | 1977-07-22 | 1988-06-28 | The Dow Chemical Company | Trifluoromethyl pyridinyloxyphenoxy and pyridinylthiophenoxy propanoic acids and propanols and derivatives thereof and methods of herbicidal use |
| EP0021453B1 (en) * | 1977-08-12 | 1985-04-10 | Imperial Chemical Industries Plc | 2-chloro-5-trichloromethylpyridine |
| JPS55124763A (en) * | 1979-03-19 | 1980-09-26 | Ishihara Sangyo Kaisha Ltd | 5-trifluoromethyl-2-pyridone derivative |
| US4631081A (en) * | 1982-09-29 | 1986-12-23 | Ici Australia Limited | Herbicidal cyclohexane-1,3-dione derivatives |
| NZ205525A (en) * | 1982-09-29 | 1985-12-13 | Ici Australia Ltd | 5-(pyridyl)-cyclohexene-1,3-dione derivatives and herbicidal compositions |
| US4521603A (en) * | 1983-02-01 | 1985-06-04 | Olin Corporation | Continuous process for the production of polybromopyridine compounds |
| WO1985004553A1 (en) * | 1984-04-13 | 1985-10-24 | Fmc Corporation | Fluoropyridinylmethyl cyclopropanecarboxylate insecticides and intermediates |
| CN116199624A (zh) * | 2021-12-01 | 2023-06-02 | 都创(上海)医药开发有限公司 | 一种2,5,6-三氯烟酸的合成方法 |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1038530A (en) * | 1966-07-27 | 1966-08-10 | Shell Int Research | Novel nematocidal compositions |
| US3809695A (en) * | 1967-04-19 | 1974-05-07 | Degussa | 2,6-dichloro-3-nitro-pyridine |
| US3694332A (en) * | 1971-03-05 | 1972-09-26 | Dow Chemical Co | Electrolytic reduction of halogenated pyridines |
| BE790563A (fr) * | 1971-10-27 | 1973-04-26 | Ciba Geigy | Derives de la pyridine utilisables comme matieres actives de produits phytopharmaceutiques |
| DE2314664A1 (de) * | 1972-03-27 | 1973-10-04 | Ciba Geigy Ag | 2,6-dichlor-3-chlormethyl-5-nitropyridin |
-
1974
- 1974-06-17 US US05/479,920 patent/US3974166A/en not_active Expired - Lifetime
- 1974-07-06 JP JP49077764A patent/JPS5037784A/ja active Pending
- 1974-07-08 DE DE2432686A patent/DE2432686A1/de active Pending
- 1974-07-10 FR FR7423983A patent/FR2236861A1/fr not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5037784A (enExample) | 1975-04-08 |
| US3974166A (en) | 1976-08-10 |
| FR2236861A1 (enExample) | 1975-02-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE887506C (de) | Verfahren zur Herstellung von organischen Verbindungen | |
| DE3786185T2 (de) | 5H-1,3,4-Thiazol[3,2-a]pyrimidin-5-on-Derivate und diese enthaltende fungizide Zubereitungen. | |
| EP0450355B1 (de) | Verbindungen zur Bekämpfung von Pflanzenkrankheiten | |
| DE3883739T2 (de) | Herbizide Heterozyklisch-alkylen-Chinoxalinyloxyphenoxy Propansäureester. | |
| DE2250077C2 (de) | Pflanzenschutzmittel auf Basis eines s-Triazolo[3,4-b]benzoxazols oder s-Triazolo[3,4-b]benzthiazols und neue s-Triazolo[3,4-b]benzthiazole | |
| DE2134146A1 (de) | Tetrazolo(l,5-a)chinolineenthaltende Mittel zur Bekämpfung von pflanzenpathogenen Organismen | |
| DE2227012C2 (de) | 3-(2,4-Dichlor-5-propargyloxyphenyl)-5-tert.-butyl-1,3,4-oxadiazolon-(2), seine Herstellung und die Zusammensetzungen, die es enthält | |
| EP0041476A2 (de) | Neue Aryl-Phenyl-Acetylen-Verbindungen | |
| DE1518432A1 (de) | Pesticide Mittel und Verfahren zu ihrer Herstellung | |
| DE2432686A1 (de) | Verfahren zur herstellung von brompyridinen | |
| DE2527639A1 (de) | 2,3-dihydro-1,4-dithiin-1,1,4,4tetroxid-antimikrobielle mittel | |
| DE2801868C2 (de) | Benzthiazolon- und Benzoxazolon-Derivate | |
| DE69018847T2 (de) | Maleimidverbindungen und diese enthaltende Fungizide. | |
| DE2637886A1 (de) | 3-pyridyl-oxy-alkancarbonsaeureamide | |
| DE69707363T2 (de) | 1,2,3-Benzothiadiazolderivate und ihre Verwendung als Mikrobizide | |
| DE2252063A1 (de) | Pyridinderivate | |
| EP0108908B1 (de) | Neue Benzotriazole, ihre Herstellung und ihre Verwendung als biozide Wirkstoffe | |
| EP0007089A1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE3618715A1 (de) | Phenanthren-9,10-dion-9-oximderivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende fungizide und arzneimittel sowie ihre verwendung | |
| DE3030926A1 (de) | Substituierte bernsteinsaeureimide | |
| DE2114018C3 (de) | 3-(2-Tetrahydropyranyl)-l,23,4tetrahydropyrimidin-2,4-dione, Verfahren zu ihrer Herstellung und pesticide Zusammensetzungen | |
| DE2025412A1 (de) | Amidophenylisothiohamstoffe, Verfahren zu ihrer Herstellung und ihre fungizide Verwendung | |
| EP0094539A1 (de) | Halogenpropargylformamide | |
| DE3889167T2 (de) | Pyridinon-Derivate und diese enthaltende fungizide Zusammenstellungen für die Landwirtschaft und Gartenbau. | |
| DE2331183A1 (de) | 1-alkoxycarbonyl-2-(n-alkoxycarbonyln-acyl-amino)-benzimidazole, verfahren zu ihrer herstellung, sowie ihre verwendung als fungizide |