DE2432485C3 - Verfahren zur Herstellung von Cefalexin - Google Patents
Verfahren zur Herstellung von CefalexinInfo
- Publication number
- DE2432485C3 DE2432485C3 DE2432485A DE2432485A DE2432485C3 DE 2432485 C3 DE2432485 C3 DE 2432485C3 DE 2432485 A DE2432485 A DE 2432485A DE 2432485 A DE2432485 A DE 2432485A DE 2432485 C3 DE2432485 C3 DE 2432485C3
- Authority
- DE
- Germany
- Prior art keywords
- cefalexin
- dimethylformamide
- amino
- carboxylic acid
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 title claims description 34
- 229940106164 cephalexin Drugs 0.000 title claims description 34
- 238000000034 method Methods 0.000 title claims description 26
- 238000004519 manufacturing process Methods 0.000 title description 13
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 claims description 59
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 239000012453 solvate Substances 0.000 claims description 21
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 16
- 229910052757 nitrogen Inorganic materials 0.000 claims description 15
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 11
- DVMQNHACVBLYQH-UHFFFAOYSA-N 2-anilinoacetyl chloride;hydrochloride Chemical compound Cl.ClC(=O)CNC1=CC=CC=C1 DVMQNHACVBLYQH-UHFFFAOYSA-N 0.000 claims description 10
- 239000002253 acid Substances 0.000 claims description 8
- 238000007865 diluting Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 3
- 125000000738 acetamido group Chemical group [H]C([H])([H])C(=O)N([H])[*] 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 238000005917 acylation reaction Methods 0.000 description 21
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 20
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- 230000010933 acylation Effects 0.000 description 16
- 238000006884 silylation reaction Methods 0.000 description 14
- 239000003795 chemical substances by application Substances 0.000 description 13
- 239000002904 solvent Substances 0.000 description 13
- -1 phenylglycyl Chemical group 0.000 description 12
- 239000007787 solid Substances 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 239000000725 suspension Substances 0.000 description 11
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 10
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 10
- 150000003839 salts Chemical class 0.000 description 9
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 8
- 125000003277 amino group Chemical group 0.000 description 8
- 150000001875 compounds Chemical class 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- NVIAYEIXYQCDAN-CLZZGJSISA-N 7beta-aminodeacetoxycephalosporanic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)[C@@H](N)[C@@H]12 NVIAYEIXYQCDAN-CLZZGJSISA-N 0.000 description 6
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 6
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 235000011114 ammonium hydroxide Nutrition 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000006239 protecting group Chemical group 0.000 description 6
- 238000003756 stirring Methods 0.000 description 6
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 5
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 5
- 239000000706 filtrate Substances 0.000 description 5
- 238000001914 filtration Methods 0.000 description 5
- 239000012433 hydrogen halide Substances 0.000 description 5
- 229910000039 hydrogen halide Inorganic materials 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- 239000011230 binding agent Substances 0.000 description 4
- 239000011928 denatured alcohol Substances 0.000 description 4
- FFUAGWLWBBFQJT-UHFFFAOYSA-N hexamethyldisilazane Chemical compound C[Si](C)(C)N[Si](C)(C)C FFUAGWLWBBFQJT-UHFFFAOYSA-N 0.000 description 4
- MEAZEHJUPLREOQ-UHFFFAOYSA-N 2-amino-2-phenylacetyl chloride Chemical compound ClC(=O)C(N)C1=CC=CC=C1 MEAZEHJUPLREOQ-UHFFFAOYSA-N 0.000 description 3
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZGUNAGUHMKGQNY-ZETCQYMHSA-N L-alpha-phenylglycine zwitterion Chemical compound OC(=O)[C@@H](N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-ZETCQYMHSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 3
- 238000005119 centrifugation Methods 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 239000003153 chemical reaction reagent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- LWFWUJCJKPUZLV-UHFFFAOYSA-N n-trimethylsilylacetamide Chemical compound CC(=O)N[Si](C)(C)C LWFWUJCJKPUZLV-UHFFFAOYSA-N 0.000 description 3
- 238000000746 purification Methods 0.000 description 3
- 238000007086 side reaction Methods 0.000 description 3
- 238000005406 washing Methods 0.000 description 3
- OISVCGZHLKNMSJ-UHFFFAOYSA-N 2,6-dimethylpyridine Chemical compound CC1=CC=CC(C)=N1 OISVCGZHLKNMSJ-UHFFFAOYSA-N 0.000 description 2
- GVVFCAFBYHYGEE-UHFFFAOYSA-N 2-amino-2-phenylacetyl chloride;hydron;chloride Chemical compound Cl.ClC(=O)C(N)C1=CC=CC=C1 GVVFCAFBYHYGEE-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- 229930186147 Cephalosporin Natural products 0.000 description 2
- JLTDJTHDQAWBAV-UHFFFAOYSA-N N,N-dimethylaniline Chemical compound CN(C)C1=CC=CC=C1 JLTDJTHDQAWBAV-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 229910021529 ammonia Inorganic materials 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229940124587 cephalosporin Drugs 0.000 description 2
- 150000001780 cephalosporins Chemical class 0.000 description 2
- DCFKHNIGBAHNSS-UHFFFAOYSA-N chloro(triethyl)silane Chemical compound CC[Si](Cl)(CC)CC DCFKHNIGBAHNSS-UHFFFAOYSA-N 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000006073 displacement reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- PSXRWZBTVAZNSF-UHFFFAOYSA-N hydron;quinoline;chloride Chemical compound Cl.N1=CC=CC2=CC=CC=C21 PSXRWZBTVAZNSF-UHFFFAOYSA-N 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001181 organosilyl group Chemical group [SiH3]* 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- SMUQFGGVLNAIOZ-UHFFFAOYSA-N quinaldine Chemical compound C1=CC=CC2=NC(C)=CC=C21 SMUQFGGVLNAIOZ-UHFFFAOYSA-N 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- 238000000926 separation method Methods 0.000 description 2
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 description 2
- 239000005051 trimethylchlorosilane Substances 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- MEAZEHJUPLREOQ-SSDOTTSWSA-N (2r)-2-amino-2-phenylacetyl chloride Chemical compound ClC(=O)[C@H](N)C1=CC=CC=C1 MEAZEHJUPLREOQ-SSDOTTSWSA-N 0.000 description 1
- GVVFCAFBYHYGEE-OGFXRTJISA-N (2r)-2-amino-2-phenylacetyl chloride;hydron;chloride Chemical compound Cl.ClC(=O)[C@H](N)C1=CC=CC=C1 GVVFCAFBYHYGEE-OGFXRTJISA-N 0.000 description 1
- NLZHNYNXJJFHRW-ZCFIWIBFSA-N (6r)-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(C)=C(C(O)=O)N2C(=O)C[C@H]21 NLZHNYNXJJFHRW-ZCFIWIBFSA-N 0.000 description 1
- KXWHDOPHWKBQHB-YTSMVRMISA-N (6r,7r)-7-[[(2r)-2-[[(2r)-2-amino-2-phenylacetyl]amino]-2-phenylacetyl]amino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound C1([C@@H](N)C(=O)N[C@@H](C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)C=2C=CC=CC=2)=CC=CC=C1 KXWHDOPHWKBQHB-YTSMVRMISA-N 0.000 description 1
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- QSPBUUIVOLBPBO-UHFFFAOYSA-N 1-[bis(4-methylphenyl)-[tris(4-methylphenyl)silylamino]silyl]-4-methylbenzene Chemical compound C1(=CC=C(C=C1)[Si](N[Si](C1=CC=C(C=C1)C)(C1=CC=C(C=C1)C)C1=CC=C(C=C1)C)(C1=CC=C(C=C1)C)C1=CC=C(C=C1)C)C QSPBUUIVOLBPBO-UHFFFAOYSA-N 0.000 description 1
- UYKXJEVQVZFVPB-UHFFFAOYSA-N 2-[(2-amino-2-phenylacetyl)amino]-2-phenylacetic acid Chemical compound C=1C=CC=CC=1C(N)C(=O)NC(C(O)=O)C1=CC=CC=C1 UYKXJEVQVZFVPB-UHFFFAOYSA-N 0.000 description 1
- ADVRQQNYDMZTEW-UHFFFAOYSA-N C[Si](N[Si](CC)(CC)C)(C)C Chemical compound C[Si](N[Si](CC)(CC)C)(C)C ADVRQQNYDMZTEW-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N Ethyl urethane Chemical compound CCOC(N)=O JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- APDDLLVYBXGBRF-UHFFFAOYSA-N [diethyl-(triethylsilylamino)silyl]ethane Chemical compound CC[Si](CC)(CC)N[Si](CC)(CC)CC APDDLLVYBXGBRF-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- CSGFFYNMTALICU-ZWNOBZJWSA-N adipyl-7-aminodesacetoxycephalosporanic acid Natural products CC1=C(N2[C@H](SC1)[C@H](NC(=O)CCCCC(O)=O)C2=O)C(O)=O CSGFFYNMTALICU-ZWNOBZJWSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 125000006615 aromatic heterocyclic group Chemical group 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- PVMPLCBJGFSFSH-UHFFFAOYSA-N benzyl-chloro-ethyl-methylsilane Chemical compound CC[Si](C)(Cl)CC1=CC=CC=C1 PVMPLCBJGFSFSH-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- UCKORWKZRPKRQE-UHFFFAOYSA-N bromo(triethyl)silane Chemical compound CC[Si](Br)(CC)CC UCKORWKZRPKRQE-UHFFFAOYSA-N 0.000 description 1
- CBOXQJGHYXSYFT-UHFFFAOYSA-N bromo-dimethyl-phenylsilane Chemical compound C[Si](C)(Br)C1=CC=CC=C1 CBOXQJGHYXSYFT-UHFFFAOYSA-N 0.000 description 1
- CAURZYXCQQWBJO-UHFFFAOYSA-N bromomethyl-chloro-dimethylsilane Chemical compound C[Si](C)(Cl)CBr CAURZYXCQQWBJO-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000007942 carboxylates Chemical class 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- MNKYQPOFRKPUAE-UHFFFAOYSA-N chloro(triphenyl)silane Chemical compound C=1C=CC=CC=1[Si](C=1C=CC=CC=1)(Cl)C1=CC=CC=C1 MNKYQPOFRKPUAE-UHFFFAOYSA-N 0.000 description 1
- ACTAPAGNZPZLEF-UHFFFAOYSA-N chloro(tripropyl)silane Chemical compound CCC[Si](Cl)(CCC)CCC ACTAPAGNZPZLEF-UHFFFAOYSA-N 0.000 description 1
- PDNUHAXBKKDGAM-UHFFFAOYSA-N chloro-diethyl-methylsilane Chemical compound CC[Si](C)(Cl)CC PDNUHAXBKKDGAM-UHFFFAOYSA-N 0.000 description 1
- AVDUEHWPPXIAEB-UHFFFAOYSA-N chloro-ethyl-dimethylsilane Chemical compound CC[Si](C)(C)Cl AVDUEHWPPXIAEB-UHFFFAOYSA-N 0.000 description 1
- HPQGAYBKOJXAEZ-UHFFFAOYSA-N chloro-tris(2-methylphenyl)silane Chemical compound CC1=CC=CC=C1[Si](Cl)(C=1C(=CC=CC=1)C)C1=CC=CC=C1C HPQGAYBKOJXAEZ-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005828 desilylation reaction Methods 0.000 description 1
- UFCXHBIETZKGHB-UHFFFAOYSA-N dichloro(diethoxy)silane Chemical compound CCO[Si](Cl)(Cl)OCC UFCXHBIETZKGHB-UHFFFAOYSA-N 0.000 description 1
- GGSUCNLOZRCGPQ-UHFFFAOYSA-N diethylaniline Chemical compound CCN(CC)C1=CC=CC=C1 GGSUCNLOZRCGPQ-UHFFFAOYSA-N 0.000 description 1
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 1
- HPYNZHMRTTWQTB-UHFFFAOYSA-N dimethylpyridine Natural products CC1=CC=CN=C1C HPYNZHMRTTWQTB-UHFFFAOYSA-N 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000002198 insoluble material Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- OLXYLDUSSBULGU-UHFFFAOYSA-N methyl pyridine-4-carboxylate Chemical compound COC(=O)C1=CC=NC=C1 OLXYLDUSSBULGU-UHFFFAOYSA-N 0.000 description 1
- 239000005055 methyl trichlorosilane Substances 0.000 description 1
- JLUFWMXJHAVVNN-UHFFFAOYSA-N methyltrichlorosilane Chemical compound C[Si](Cl)(Cl)Cl JLUFWMXJHAVVNN-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 239000002808 molecular sieve Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 125000001477 organic nitrogen group Chemical group 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 238000004816 paper chromatography Methods 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000005331 phenylglycines Chemical class 0.000 description 1
- 108010029244 phenylglycyl-phenylglycine Proteins 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 235000015067 sauces Nutrition 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical compound [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 125000005931 tert-butyloxycarbonyl group Chemical group [H]C([H])([H])C(OC(*)=O)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- JSQJUDVTRRCSRU-UHFFFAOYSA-N tributyl(chloro)silane Chemical compound CCCC[Si](Cl)(CCCC)CCCC JSQJUDVTRRCSRU-UHFFFAOYSA-N 0.000 description 1
- ZUJHPDSXDJCNNL-UHFFFAOYSA-N triethylsilylurea Chemical compound CC[Si](CC)(CC)NC(N)=O ZUJHPDSXDJCNNL-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/22—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with radicals containing only hydrogen and carbon atoms, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3211173A GB1472746A (en) | 1973-07-05 | 1973-07-05 | Cephalosporin compounds |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2432485A1 DE2432485A1 (de) | 1975-01-30 |
| DE2432485B2 DE2432485B2 (de) | 1980-05-14 |
| DE2432485C3 true DE2432485C3 (de) | 1981-01-22 |
Family
ID=10333421
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2432485A Expired DE2432485C3 (de) | 1973-07-05 | 1974-07-04 | Verfahren zur Herstellung von Cefalexin |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3957773A (enExample) |
| JP (1) | JPS5318517B2 (enExample) |
| AT (1) | AT341085B (enExample) |
| BE (1) | BE817266A (enExample) |
| CA (1) | CA1027555A (enExample) |
| CH (1) | CH601315A5 (enExample) |
| DE (1) | DE2432485C3 (enExample) |
| DK (1) | DK144915C (enExample) |
| ES (1) | ES427961A1 (enExample) |
| FR (1) | FR2235943B1 (enExample) |
| GB (1) | GB1472746A (enExample) |
| HU (1) | HU169318B (enExample) |
| IE (1) | IE39590B1 (enExample) |
| LU (1) | LU70467A1 (enExample) |
| NL (1) | NL169478C (enExample) |
| PL (1) | PL91389B1 (enExample) |
| SE (1) | SE428565B (enExample) |
| YU (1) | YU39525B (enExample) |
| ZA (1) | ZA744314B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1053312B (it) * | 1976-01-15 | 1981-08-31 | Ankerfarm Spa | Procedimento per la produzione di antibiotici di penicillina semisintetici |
| GB1532682A (en) * | 1976-04-27 | 1978-11-22 | Bristol Myers Co | Process for the preparation of cephadroxil |
| US4160863A (en) * | 1977-04-07 | 1979-07-10 | Bristol-Myers Company | Process for the preparation of the crystalline monohydrate of 7-[D-α-aα-(p-hydroxyphenyl)acetamido]-3-methyl-3-cephem-4-carboxylic acid |
| AT363594B (de) * | 1978-02-01 | 1981-08-10 | Biochemie Gmbh | Verfahren zur herstellung eines neuen formamidkomplexes von 7-beta-(d-2-amino-2-phenylacetamido)-3-methylceph-3-emcarbonsaeure |
| US4237279A (en) * | 1979-07-27 | 1980-12-02 | Eli Lilly And Company | Crystalline 3-hydroxycephalosporin solvates |
| IT1126544B (it) * | 1979-12-07 | 1986-05-21 | Dobfar Spa | Procedimento per la preparazione di derivati dell'acido 7-amino-desacetossi cefalosporanico |
| YU44832B (en) * | 1981-08-03 | 1991-04-30 | Pliva Pharm & Chem Works | Process for preparing semisynthetic cephalosporins |
| IT1180207B (it) * | 1984-07-30 | 1987-09-23 | Istituto Biochimico Italiano | Procedimento per la preparazione, con resa e purezza elevate, di antibiotici beta-lattamici |
| JPS6444608U (enExample) * | 1987-09-11 | 1989-03-16 | ||
| US5091525A (en) * | 1987-10-07 | 1992-02-25 | Eli Lilly And Company | Monohydrate and DMF solvates of a new carbacephem antibiotic |
| MY103554A (en) * | 1987-10-07 | 1993-07-31 | Lilly Co Eli | Manohydrate and solvates of a new (beta)-lactam antibiotic. |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE34822B1 (en) * | 1969-12-26 | 1975-08-20 | Univ Osaka | Process for producing 6-amino penicillanic acid |
| US3694437A (en) * | 1970-08-19 | 1972-09-26 | Lilly Co Eli | Process for preparing cephalosporin compounds |
| BE788582A (fr) * | 1971-09-11 | 1973-03-08 | Lilly Industries Ltd | Procede de preparation de derives de cephalosporine |
| US3743644A (en) * | 1972-02-28 | 1973-07-03 | Bristol Myers Co | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-(s-(isothiazol-3-,4-and 5-yl)carbonyl(thiomethyl-3-cephem-4-carboxylic acids |
| US3843639A (en) * | 1973-02-08 | 1974-10-22 | Bristol Myers Co | Production of cephalexin via methoxymethyl ester |
-
1973
- 1973-07-05 GB GB3211173A patent/GB1472746A/en not_active Expired
-
1974
- 1974-07-02 US US05/485,236 patent/US3957773A/en not_active Expired - Lifetime
- 1974-07-02 YU YU1862/74A patent/YU39525B/xx unknown
- 1974-07-04 PL PL1974172423A patent/PL91389B1/pl unknown
- 1974-07-04 AT AT552774A patent/AT341085B/de active
- 1974-07-04 JP JP7590574A patent/JPS5318517B2/ja not_active Expired
- 1974-07-04 DK DK358874A patent/DK144915C/da not_active IP Right Cessation
- 1974-07-04 BE BE146232A patent/BE817266A/xx not_active IP Right Cessation
- 1974-07-04 CA CA204,112A patent/CA1027555A/en not_active Expired
- 1974-07-04 IE IE1419/74A patent/IE39590B1/xx unknown
- 1974-07-04 HU HUGA1163A patent/HU169318B/hu not_active IP Right Cessation
- 1974-07-04 CH CH916574A patent/CH601315A5/xx not_active IP Right Cessation
- 1974-07-04 SE SE7408833A patent/SE428565B/xx not_active IP Right Cessation
- 1974-07-04 ES ES427961A patent/ES427961A1/es not_active Expired
- 1974-07-04 DE DE2432485A patent/DE2432485C3/de not_active Expired
- 1974-07-04 FR FR7423251A patent/FR2235943B1/fr not_active Expired
- 1974-07-04 ZA ZA00744314A patent/ZA744314B/xx unknown
- 1974-07-04 LU LU70467A patent/LU70467A1/xx unknown
- 1974-07-04 NL NLAANVRAGE7409050,A patent/NL169478C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IE39590L (en) | 1975-01-05 |
| DK358874A (enExample) | 1975-03-03 |
| GB1472746A (en) | 1977-05-04 |
| CH601315A5 (enExample) | 1978-07-14 |
| US3957773A (en) | 1976-05-18 |
| FR2235943B1 (enExample) | 1978-11-24 |
| PL91389B1 (enExample) | 1977-02-28 |
| LU70467A1 (enExample) | 1974-11-28 |
| NL169478B (nl) | 1982-02-16 |
| ATA552774A (de) | 1977-05-15 |
| DK144915C (da) | 1982-11-22 |
| IE39590B1 (en) | 1978-11-08 |
| ZA744314B (en) | 1975-07-30 |
| HU169318B (enExample) | 1976-11-28 |
| DK144915B (da) | 1982-07-05 |
| SE428565B (sv) | 1983-07-11 |
| SE7408833L (enExample) | 1975-01-07 |
| DE2432485B2 (de) | 1980-05-14 |
| CA1027555A (en) | 1978-03-07 |
| BE817266A (fr) | 1975-01-06 |
| ES427961A1 (es) | 1976-12-01 |
| YU186274A (en) | 1982-06-30 |
| NL169478C (nl) | 1982-07-16 |
| FR2235943A1 (enExample) | 1975-01-31 |
| AU7072274A (en) | 1976-01-08 |
| AT341085B (de) | 1978-01-25 |
| JPS5318517B2 (enExample) | 1978-06-15 |
| JPS5069092A (enExample) | 1975-06-09 |
| NL7409050A (nl) | 1975-01-07 |
| DE2432485A1 (de) | 1975-01-30 |
| YU39525B (en) | 1984-12-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2432485C3 (de) | Verfahren zur Herstellung von Cefalexin | |
| DE3427859A1 (de) | Verbesserungen betreffend antibiotika | |
| DE2065236A1 (enExample) | ||
| DE2462383A1 (de) | Verfahren zur herstellung von antibiotischen mitteln | |
| DE2318852C3 (de) | Verfahren zur Herstellung von 7-Acylamido-3-halogen-3-methyl--cepham-4-carbonsäureestern | |
| DE69233042T2 (de) | Herstellung eines Cephalosporin-Antibiotikums unter Verwendung des Syn-Isomers einer Thiazolylzwischenverbindung | |
| DE3012669C2 (enExample) | ||
| DE2726394C2 (enExample) | ||
| DE68926148T2 (de) | Solvate von einem Beta-Lactam-Antibiotikum | |
| DE2107650C3 (enExample) | ||
| DE2822876C2 (enExample) | ||
| DE2215039A1 (de) | Neue Acyloxyalkylesterderivate von Penicillin und Cephalosporin | |
| AT395854B (de) | Neues verfahren zur herstellung von 7-amino-3azidomethyl-3-cephem-4-carbonsaeure und deren derivate | |
| AT366386B (de) | Verfahren zur herstellung von cephalexin-monohydrat | |
| DE1695049B2 (de) | Verfahren zur Herstellung von Cephalosporinderivaten | |
| DE3444367C2 (enExample) | ||
| DE1906194C3 (de) | 3-Brommethyl-A2 -cephalosporine und Verfahren zu ihrer Herstellung | |
| DE2528622A1 (de) | Verfahren zur reinigung der bei der enzymatischen spaltung von beta-lactam- antibiotika anfallenden produkte | |
| DE19846449A1 (de) | Verfahren zur Herstellung von oral aktivem Cephalosporin-Antibiotikum-Cefixim | |
| DE2701407A1 (de) | Verfahren zur herstellung halbsynthetischer penicillinantibiotika | |
| DE2408171C3 (de) | Silyl-oxazolidinon-Verbindungen und Verfahren zu ihrer Herstellung | |
| DE60001748T2 (de) | Verfahren zur synthese von beta-laktamderivaten | |
| DE2029195B2 (de) | Verfahren zur herstellung von ampicillin | |
| DE3339667A1 (de) | Cephalosporinverbindungen fuer orale verabreichung | |
| EP0068370A1 (de) | Verfahren zur Herstellung von Heteroaryl- und Dibenzoxepinalkansäuren |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |