AT341085B - Verfahren zur herstellung eines bis-dimethylformamid-solvats von 7beta- (d-2-amino-2-phenylacetamido)-3-methylceph-3-em-4-carbonsaure (cephalexin) - Google Patents
Verfahren zur herstellung eines bis-dimethylformamid-solvats von 7beta- (d-2-amino-2-phenylacetamido)-3-methylceph-3-em-4-carbonsaure (cephalexin)Info
- Publication number
- AT341085B AT341085B AT552774A AT552774A AT341085B AT 341085 B AT341085 B AT 341085B AT 552774 A AT552774 A AT 552774A AT 552774 A AT552774 A AT 552774A AT 341085 B AT341085 B AT 341085B
- Authority
- AT
- Austria
- Prior art keywords
- methylceph
- solvat
- 7beta
- phenylacetamido
- cephalexin
- Prior art date
Links
- -1 D-2-AMINO-2-PHENYLACETAMIDO Chemical class 0.000 title 1
- ZAIPMKNFIOOWCQ-UEKVPHQBSA-N cephalexin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@@H]3N(C2=O)C(=C(CS3)C)C(O)=O)=CC=CC=C1 ZAIPMKNFIOOWCQ-UEKVPHQBSA-N 0.000 title 1
- 229940106164 cephalexin Drugs 0.000 title 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N dimethylformamide Substances CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/20—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids
- C07D501/22—7-Acylaminocephalosporanic or substituted 7-acylaminocephalosporanic acids in which the acyl radicals are derived from carboxylic acids with radicals containing only hydrogen and carbon atoms, attached in position 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB3211173A GB1472746A (en) | 1973-07-05 | 1973-07-05 | Cephalosporin compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| ATA552774A ATA552774A (de) | 1977-05-15 |
| AT341085B true AT341085B (de) | 1978-01-25 |
Family
ID=10333421
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| AT552774A AT341085B (de) | 1973-07-05 | 1974-07-04 | Verfahren zur herstellung eines bis-dimethylformamid-solvats von 7beta- (d-2-amino-2-phenylacetamido)-3-methylceph-3-em-4-carbonsaure (cephalexin) |
Country Status (19)
| Country | Link |
|---|---|
| US (1) | US3957773A (enExample) |
| JP (1) | JPS5318517B2 (enExample) |
| AT (1) | AT341085B (enExample) |
| BE (1) | BE817266A (enExample) |
| CA (1) | CA1027555A (enExample) |
| CH (1) | CH601315A5 (enExample) |
| DE (1) | DE2432485C3 (enExample) |
| DK (1) | DK144915C (enExample) |
| ES (1) | ES427961A1 (enExample) |
| FR (1) | FR2235943B1 (enExample) |
| GB (1) | GB1472746A (enExample) |
| HU (1) | HU169318B (enExample) |
| IE (1) | IE39590B1 (enExample) |
| LU (1) | LU70467A1 (enExample) |
| NL (1) | NL169478C (enExample) |
| PL (1) | PL91389B1 (enExample) |
| SE (1) | SE428565B (enExample) |
| YU (1) | YU39525B (enExample) |
| ZA (1) | ZA744314B (enExample) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IT1053312B (it) * | 1976-01-15 | 1981-08-31 | Ankerfarm Spa | Procedimento per la produzione di antibiotici di penicillina semisintetici |
| GB1532682A (en) * | 1976-04-27 | 1978-11-22 | Bristol Myers Co | Process for the preparation of cephadroxil |
| US4160863A (en) * | 1977-04-07 | 1979-07-10 | Bristol-Myers Company | Process for the preparation of the crystalline monohydrate of 7-[D-α-aα-(p-hydroxyphenyl)acetamido]-3-methyl-3-cephem-4-carboxylic acid |
| AT363594B (de) * | 1978-02-01 | 1981-08-10 | Biochemie Gmbh | Verfahren zur herstellung eines neuen formamidkomplexes von 7-beta-(d-2-amino-2-phenylacetamido)-3-methylceph-3-emcarbonsaeure |
| US4237279A (en) * | 1979-07-27 | 1980-12-02 | Eli Lilly And Company | Crystalline 3-hydroxycephalosporin solvates |
| IT1126544B (it) * | 1979-12-07 | 1986-05-21 | Dobfar Spa | Procedimento per la preparazione di derivati dell'acido 7-amino-desacetossi cefalosporanico |
| YU44832B (en) * | 1981-08-03 | 1991-04-30 | Pliva Pharm & Chem Works | Process for preparing semisynthetic cephalosporins |
| IT1180207B (it) * | 1984-07-30 | 1987-09-23 | Istituto Biochimico Italiano | Procedimento per la preparazione, con resa e purezza elevate, di antibiotici beta-lattamici |
| JPS6444608U (enExample) * | 1987-09-11 | 1989-03-16 | ||
| US5091525A (en) * | 1987-10-07 | 1992-02-25 | Eli Lilly And Company | Monohydrate and DMF solvates of a new carbacephem antibiotic |
| YU46700B (sh) * | 1987-10-07 | 1994-04-05 | Eli Lilly And Co. | Kristalni monohidrat i kristalni mono- i bis (n-n'-dimetilformamid) solvati beta-laktamskog antibiotika |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| IE34822B1 (en) * | 1969-12-26 | 1975-08-20 | Univ Osaka | Process for producing 6-amino penicillanic acid |
| US3694437A (en) * | 1970-08-19 | 1972-09-26 | Lilly Co Eli | Process for preparing cephalosporin compounds |
| BE788582A (fr) * | 1971-09-11 | 1973-03-08 | Lilly Industries Ltd | Procede de preparation de derives de cephalosporine |
| US3743644A (en) * | 1972-02-28 | 1973-07-03 | Bristol Myers Co | 7-(d-(alpha-amino-alpha-phenyl-,2-thienyl-and 3-thienyl-acetamido))-3-(s-(isothiazol-3-,4-and 5-yl)carbonyl(thiomethyl-3-cephem-4-carboxylic acids |
| US3843639A (en) * | 1973-02-08 | 1974-10-22 | Bristol Myers Co | Production of cephalexin via methoxymethyl ester |
-
1973
- 1973-07-05 GB GB3211173A patent/GB1472746A/en not_active Expired
-
1974
- 1974-07-02 US US05/485,236 patent/US3957773A/en not_active Expired - Lifetime
- 1974-07-02 YU YU1862/74A patent/YU39525B/xx unknown
- 1974-07-04 DE DE2432485A patent/DE2432485C3/de not_active Expired
- 1974-07-04 PL PL1974172423A patent/PL91389B1/pl unknown
- 1974-07-04 DK DK358874A patent/DK144915C/da not_active IP Right Cessation
- 1974-07-04 ES ES427961A patent/ES427961A1/es not_active Expired
- 1974-07-04 LU LU70467A patent/LU70467A1/xx unknown
- 1974-07-04 CH CH916574A patent/CH601315A5/xx not_active IP Right Cessation
- 1974-07-04 IE IE1419/74A patent/IE39590B1/xx unknown
- 1974-07-04 AT AT552774A patent/AT341085B/de active
- 1974-07-04 HU HUGA1163A patent/HU169318B/hu not_active IP Right Cessation
- 1974-07-04 NL NLAANVRAGE7409050,A patent/NL169478C/xx not_active IP Right Cessation
- 1974-07-04 FR FR7423251A patent/FR2235943B1/fr not_active Expired
- 1974-07-04 ZA ZA00744314A patent/ZA744314B/xx unknown
- 1974-07-04 BE BE146232A patent/BE817266A/xx not_active IP Right Cessation
- 1974-07-04 JP JP7590574A patent/JPS5318517B2/ja not_active Expired
- 1974-07-04 SE SE7408833A patent/SE428565B/xx not_active IP Right Cessation
- 1974-07-04 CA CA204,112A patent/CA1027555A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| AU7072274A (en) | 1976-01-08 |
| NL7409050A (nl) | 1975-01-07 |
| JPS5318517B2 (enExample) | 1978-06-15 |
| SE428565B (sv) | 1983-07-11 |
| DE2432485B2 (de) | 1980-05-14 |
| YU186274A (en) | 1982-06-30 |
| DK144915C (da) | 1982-11-22 |
| LU70467A1 (enExample) | 1974-11-28 |
| DK358874A (enExample) | 1975-03-03 |
| FR2235943A1 (enExample) | 1975-01-31 |
| FR2235943B1 (enExample) | 1978-11-24 |
| DK144915B (da) | 1982-07-05 |
| ES427961A1 (es) | 1976-12-01 |
| HU169318B (enExample) | 1976-11-28 |
| ATA552774A (de) | 1977-05-15 |
| IE39590B1 (en) | 1978-11-08 |
| YU39525B (en) | 1984-12-31 |
| US3957773A (en) | 1976-05-18 |
| IE39590L (en) | 1975-01-05 |
| CH601315A5 (enExample) | 1978-07-14 |
| CA1027555A (en) | 1978-03-07 |
| DE2432485A1 (de) | 1975-01-30 |
| NL169478C (nl) | 1982-07-16 |
| BE817266A (fr) | 1975-01-06 |
| NL169478B (nl) | 1982-02-16 |
| JPS5069092A (enExample) | 1975-06-09 |
| DE2432485C3 (de) | 1981-01-22 |
| ZA744314B (en) | 1975-07-30 |
| SE7408833L (enExample) | 1975-01-07 |
| PL91389B1 (enExample) | 1977-02-28 |
| GB1472746A (en) | 1977-05-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AT341504B (de) | Verfahren zur herstellung von alfa-arylpropionsauren | |
| DD128297A5 (de) | Verfahren zur herstellung von cyclopropancarbonsaeureestern | |
| AT363255B (de) | Verfahren zur herstellung eines polyketons | |
| AT341085B (de) | Verfahren zur herstellung eines bis-dimethylformamid-solvats von 7beta- (d-2-amino-2-phenylacetamido)-3-methylceph-3-em-4-carbonsaure (cephalexin) | |
| AT344914B (de) | Verfahren zur herstellung von n- (2-furfuryl)-4-chlor-5-sulfamoyl-anthranilsaeure-zubereitungen | |
| AT336634B (de) | Verfahren zur herstellung von poly-n-alkyliminoalanen | |
| AT351167B (de) | Verfahren zur herstellung von allopurinol- haltigen tabletten | |
| AT340546B (de) | Verfahren zur herstellung von sauremassen | |
| AT343629B (de) | Verfahren zur herstellung von 2-arylpropionaldehyden | |
| ATA932875A (de) | Verfahren zur herstellung von salzen von monoestern der kohlensaure | |
| AT329525B (de) | Verfahren zur herstellung von polyalkenen | |
| DD122976A5 (de) | Verfahren zur herstellung von pyridoepoxyaethanen | |
| AT344893B (de) | Verfahren zur herstellung von 7-acylamido-3-methyl-3-cephem-4-carbonsaeureestern | |
| AT335416B (de) | Verfahren zur herstellung von oxalsaurediamid | |
| AT338775B (de) | Verfahren zur herstellung von 4-oxa-5-hydroxypolycycloalken-3-onen | |
| AT344666B (de) | Verfahren zur herstellung eines oxychlorierungskatalysators | |
| ATA932975A (de) | Verfahren zur herstellung von salzen von monoestern der kohlensaure | |
| AT346275B (de) | Verfahren zur herstellung von briketts | |
| ATA652574A (de) | Verfahren zur herstellung von 6-methyl-5-hepten-2-onverfahren zur herstellung von 6-methyl-5-hepten-2-on | |
| AT340858B (de) | Verfahren zur herstellung von l-lysin | |
| AT340044B (de) | Verfahren zur herstellung von cephalosporansaurederivaten | |
| AT338227B (de) | Verfahren zur herstellung von weinsaure | |
| AT327136B (de) | Verfahren zur herstellung von citronensaure | |
| AT346309B (de) | Verfahren zur herstellung von neuen bis- phenolalkansaeureamiden | |
| AT337708B (de) | Verfahren zur herstellung von phthalobis-guanaminen |