DE2425704A1 - Substituierte phenylmercapto-benzimidazole - Google Patents
Substituierte phenylmercapto-benzimidazoleInfo
- Publication number
- DE2425704A1 DE2425704A1 DE19742425704 DE2425704A DE2425704A1 DE 2425704 A1 DE2425704 A1 DE 2425704A1 DE 19742425704 DE19742425704 DE 19742425704 DE 2425704 A DE2425704 A DE 2425704A DE 2425704 A1 DE2425704 A1 DE 2425704A1
- Authority
- DE
- Germany
- Prior art keywords
- alkyl
- formula
- phenyl
- general formula
- substituted
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- IHOFRNVUIOVDJP-UHFFFAOYSA-N 2-phenylsulfanyl-1h-benzimidazole Chemical class N=1C2=CC=CC=C2NC=1SC1=CC=CC=C1 IHOFRNVUIOVDJP-UHFFFAOYSA-N 0.000 title 1
- -1 phenyl- Chemical group 0.000 claims description 22
- 150000001875 compounds Chemical class 0.000 claims description 11
- 238000000034 method Methods 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 9
- 239000000460 chlorine Substances 0.000 claims description 8
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 8
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 claims description 6
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- LYSPITZTNMFQBM-UHFFFAOYSA-N 4-phenyl-1,3-dihydrobenzimidazole-2-thione Chemical class C=12NC(S)=NC2=CC=CC=1C1=CC=CC=C1 LYSPITZTNMFQBM-UHFFFAOYSA-N 0.000 claims description 4
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 4
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 4
- 229910052794 bromium Inorganic materials 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- 244000045947 parasite Species 0.000 claims description 4
- 238000002360 preparation method Methods 0.000 claims description 4
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 3
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000006526 (C1-C2) alkyl group Chemical group 0.000 claims description 2
- FPLYMSUAUOSKLM-UHFFFAOYSA-N 2-phenylsulfanyl-1h-imidazole Chemical compound C=1C=CC=CC=1SC1=NC=CN1 FPLYMSUAUOSKLM-UHFFFAOYSA-N 0.000 claims description 2
- 241000251730 Chondrichthyes Species 0.000 claims description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 230000008569 process Effects 0.000 claims description 2
- 125000001424 substituent group Chemical group 0.000 claims description 2
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims 1
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims 1
- 239000008177 pharmaceutical agent Substances 0.000 claims 1
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 12
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 241001465754 Metazoa Species 0.000 description 9
- 239000007795 chemical reaction product Substances 0.000 description 9
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 241000244206 Nematoda Species 0.000 description 5
- 150000001556 benzimidazoles Chemical class 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 239000012442 inert solvent Substances 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 241001494479 Pecora Species 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- 241001465677 Ancylostomatoidea Species 0.000 description 3
- 241000282472 Canis lupus familiaris Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 230000000507 anthelmentic effect Effects 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 230000002496 gastric effect Effects 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 150000007530 organic bases Chemical group 0.000 description 3
- 239000012074 organic phase Substances 0.000 description 3
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 150000003254 radicals Chemical group 0.000 description 3
- WJCNZQLZVWNLKY-UHFFFAOYSA-N thiabendazole Chemical compound S1C=NC(C=2NC3=CC=CC=C3N=2)=C1 WJCNZQLZVWNLKY-UHFFFAOYSA-N 0.000 description 3
- 239000004308 thiabendazole Substances 0.000 description 3
- 229960004546 thiabendazole Drugs 0.000 description 3
- 235000010296 thiabendazole Nutrition 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 125000006583 (C1-C3) haloalkyl group Chemical group 0.000 description 2
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 2
- YRWLZFXJFBZBEY-UHFFFAOYSA-N N-(6-butyl-1H-benzimidazol-2-yl)carbamic acid methyl ester Chemical compound CCCCC1=CC=C2N=C(NC(=O)OC)NC2=C1 YRWLZFXJFBZBEY-UHFFFAOYSA-N 0.000 description 2
- 208000030852 Parasitic disease Diseases 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 230000000973 chemotherapeutic effect Effects 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 235000013601 eggs Nutrition 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 125000001153 fluoro group Chemical group F* 0.000 description 2
- 210000001035 gastrointestinal tract Anatomy 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229950007337 parbendazole Drugs 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 description 1
- YHMYGUUIMTVXNW-UHFFFAOYSA-N 1,3-dihydrobenzimidazole-2-thione Chemical compound C1=CC=C2NC(S)=NC2=C1 YHMYGUUIMTVXNW-UHFFFAOYSA-N 0.000 description 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 description 1
- YTQQIHUQLOZOJI-UHFFFAOYSA-N 2,3-dihydro-1,2-thiazole Chemical compound C1NSC=C1 YTQQIHUQLOZOJI-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- OJDMYVLGXHUDMW-UHFFFAOYSA-N 6-phenylsulfanyl-1h-benzimidazol-2-amine Chemical compound C1=C2NC(N)=NC2=CC=C1SC1=CC=CC=C1 OJDMYVLGXHUDMW-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 241001466804 Carnivora Species 0.000 description 1
- 241001494503 Darnis Species 0.000 description 1
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 1
- 241000243974 Haemonchus contortus Species 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 206010061217 Infestation Diseases 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 241000282849 Ruminantia Species 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 206010042566 Superinfection Diseases 0.000 description 1
- 241000243797 Trichostrongylus Species 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940124339 anthelmintic agent Drugs 0.000 description 1
- 239000000921 anthelmintic agent Substances 0.000 description 1
- 239000002246 antineoplastic agent Substances 0.000 description 1
- 239000007900 aqueous suspension Substances 0.000 description 1
- ZWIPGARCRSFMHK-UHFFFAOYSA-N benzene;1h-imidazole Chemical class C1=CNC=N1.C1=CC=CC=C1 ZWIPGARCRSFMHK-UHFFFAOYSA-N 0.000 description 1
- 230000037396 body weight Effects 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- AOGYCOYQMAVAFD-UHFFFAOYSA-N chlorocarbonic acid Chemical group OC(Cl)=O AOGYCOYQMAVAFD-UHFFFAOYSA-N 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 229940127089 cytotoxic agent Drugs 0.000 description 1
- 125000004188 dichlorophenyl group Chemical group 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 230000029142 excretion Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 230000036541 health Effects 0.000 description 1
- 125000002883 imidazolyl group Chemical group 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 150000007529 inorganic bases Chemical class 0.000 description 1
- 230000000968 intestinal effect Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- HRDXJKGNWSUIBT-UHFFFAOYSA-N methoxybenzene Chemical group [CH2]OC1=CC=CC=C1 HRDXJKGNWSUIBT-UHFFFAOYSA-N 0.000 description 1
- YLGXILFCIXHCMC-JHGZEJCSSA-N methyl cellulose Chemical compound COC1C(OC)C(OC)C(COC)O[C@H]1O[C@H]1C(OC)C(OC)C(OC)OC1COC YLGXILFCIXHCMC-JHGZEJCSSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 description 1
- 235000015497 potassium bicarbonate Nutrition 0.000 description 1
- 239000011736 potassium bicarbonate Substances 0.000 description 1
- 235000011181 potassium carbonates Nutrition 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 230000001568 sexual effect Effects 0.000 description 1
- 235000017550 sodium carbonate Nutrition 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D235/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings
- C07D235/02—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, condensed with other rings condensed with carbocyclic rings or ring systems
- C07D235/04—Benzimidazoles; Hydrogenated benzimidazoles
- C07D235/06—Benzimidazoles; Hydrogenated benzimidazoles with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached in position 2
- C07D235/12—Radicals substituted by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742425704 DE2425704A1 (de) | 1974-05-28 | 1974-05-28 | Substituierte phenylmercapto-benzimidazole |
| NL7506087A NL7506087A (nl) | 1974-05-28 | 1975-05-23 | Werkwijze voor het bereiden van gesubstitueerde fenylmercaptobenzimidazolen. |
| DD186258A DD122681A5 (enExample) | 1974-05-28 | 1975-05-26 | |
| IL47350A IL47350A0 (en) | 1974-05-28 | 1975-05-26 | Substituted phenylmercapto-benzimidizoles |
| IT23737/75A IT1038415B (it) | 1974-05-28 | 1975-05-26 | Fenilmercapto benzimidazoli sostituitti |
| LU72581A LU72581A1 (enExample) | 1974-05-28 | 1975-05-26 | |
| FI751522A FI751522A7 (enExample) | 1974-05-28 | 1975-05-26 | |
| ZA00753405A ZA753405B (en) | 1974-05-28 | 1975-05-27 | Substituted phenylmercapto-benzimidazoles |
| AU81552/75A AU8155275A (en) | 1974-05-28 | 1975-05-27 | Substituted phenylmercapto benzimidazoles and process for manufacture |
| DK233375A DK233375A (da) | 1974-05-28 | 1975-05-27 | Fremgangsmade til fremstilling af substituerede phenylmercapto-benzimidazoler |
| SE7506015A SE7506015L (sv) | 1974-05-28 | 1975-05-27 | Substituerade fenylmerkaptobensimidazoler |
| GB2314775A GB1454469A (en) | 1974-05-28 | 1975-05-27 | Substituted phenylmercapto-benzimidazoles |
| NO751871A NO751871L (enExample) | 1974-05-28 | 1975-05-27 | |
| US05/582,227 US3980796A (en) | 1974-05-28 | 1975-05-27 | Substituted 2-alkoxycarbonylamine-5-(6)-phenylmercapto-benzimidazoles |
| FR7516637A FR2272667A1 (enExample) | 1974-05-28 | 1975-05-28 | |
| BE156800A BE829597A (fr) | 1974-05-28 | 1975-05-28 | Phenylmercapto-benzimidazoles substitues, leur procede de preparation et leurs applications |
| JP50063129A JPS511471A (enExample) | 1974-05-28 | 1975-05-28 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742425704 DE2425704A1 (de) | 1974-05-28 | 1974-05-28 | Substituierte phenylmercapto-benzimidazole |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2425704A1 true DE2425704A1 (de) | 1975-12-18 |
Family
ID=5916641
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742425704 Pending DE2425704A1 (de) | 1974-05-28 | 1974-05-28 | Substituierte phenylmercapto-benzimidazole |
Country Status (17)
| Country | Link |
|---|---|
| US (1) | US3980796A (enExample) |
| JP (1) | JPS511471A (enExample) |
| AU (1) | AU8155275A (enExample) |
| BE (1) | BE829597A (enExample) |
| DD (1) | DD122681A5 (enExample) |
| DE (1) | DE2425704A1 (enExample) |
| DK (1) | DK233375A (enExample) |
| FI (1) | FI751522A7 (enExample) |
| FR (1) | FR2272667A1 (enExample) |
| GB (1) | GB1454469A (enExample) |
| IL (1) | IL47350A0 (enExample) |
| IT (1) | IT1038415B (enExample) |
| LU (1) | LU72581A1 (enExample) |
| NL (1) | NL7506087A (enExample) |
| NO (1) | NO751871L (enExample) |
| SE (1) | SE7506015L (enExample) |
| ZA (1) | ZA753405B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993010101A1 (en) * | 1991-11-12 | 1993-05-27 | Pfizer Limited | Benzimidazole anthelmintic agents |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPH0613575B2 (ja) * | 1988-01-08 | 1994-02-23 | 信越化学工業株式会社 | 塩化ビニル系重合体の製造方法 |
| JPH0613577B2 (ja) * | 1988-12-23 | 1994-02-23 | 信越化学工業株式会社 | 塩化ビニル系重合体の製造方法 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3541213A (en) * | 1966-05-06 | 1970-11-17 | Du Pont | Fungicidal and mite ovicidal substituted 2-aminobenzimidazoles |
| US3636005A (en) * | 1966-05-06 | 1972-01-18 | Du Pont | Acyl substituted 2-benzimidazolecarbamates |
| US3637733A (en) * | 1968-11-21 | 1972-01-25 | Du Pont | 2-benzimidazolecarbamic acid esters from o-phenylenediamines cyanamide and dialkyl carbonates |
| US3694454A (en) * | 1970-07-17 | 1972-09-26 | Boehringer Sohn Ingelheim | 1-{8 1{40 -carboxylic acylamino-2{40 ,2{40 ,2{40 -trichloro)-ethyl{9 -2-(hydrocarbyloxycarbonyl-amino)-benzimidazoles |
| BE787412A (fr) * | 1971-08-14 | 1973-02-12 | Bayer Ag | Nouveaux derives d'acides aminobenzimidazole-carboxyliques leurprocede de preparation et leur application comme fongicides systemiques et bactericides |
| US3965113A (en) * | 1972-12-29 | 1976-06-22 | Syntex (U.S.A.) Inc. | 5(6)-Benzene ring substituted benzimidazole-2-carbamate derivatives having anthelmintic activity |
-
1974
- 1974-05-28 DE DE19742425704 patent/DE2425704A1/de active Pending
-
1975
- 1975-05-23 NL NL7506087A patent/NL7506087A/xx unknown
- 1975-05-26 DD DD186258A patent/DD122681A5/xx unknown
- 1975-05-26 IL IL47350A patent/IL47350A0/xx unknown
- 1975-05-26 FI FI751522A patent/FI751522A7/fi not_active Application Discontinuation
- 1975-05-26 IT IT23737/75A patent/IT1038415B/it active
- 1975-05-26 LU LU72581A patent/LU72581A1/xx unknown
- 1975-05-27 SE SE7506015A patent/SE7506015L/xx not_active Application Discontinuation
- 1975-05-27 ZA ZA00753405A patent/ZA753405B/xx unknown
- 1975-05-27 NO NO751871A patent/NO751871L/no unknown
- 1975-05-27 GB GB2314775A patent/GB1454469A/en not_active Expired
- 1975-05-27 DK DK233375A patent/DK233375A/da unknown
- 1975-05-27 US US05/582,227 patent/US3980796A/en not_active Expired - Lifetime
- 1975-05-27 AU AU81552/75A patent/AU8155275A/en not_active Expired
- 1975-05-28 JP JP50063129A patent/JPS511471A/ja active Pending
- 1975-05-28 FR FR7516637A patent/FR2272667A1/fr not_active Withdrawn
- 1975-05-28 BE BE156800A patent/BE829597A/xx unknown
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1993010101A1 (en) * | 1991-11-12 | 1993-05-27 | Pfizer Limited | Benzimidazole anthelmintic agents |
| US5475005A (en) * | 1991-11-12 | 1995-12-12 | Pfizer Inc. | Benzimidazole anthelmintic agents |
Also Published As
| Publication number | Publication date |
|---|---|
| IT1038415B (it) | 1979-11-20 |
| BE829597A (fr) | 1975-11-28 |
| SE7506015L (sv) | 1975-12-01 |
| LU72581A1 (enExample) | 1977-02-10 |
| NL7506087A (nl) | 1975-12-02 |
| FR2272667A1 (enExample) | 1975-12-26 |
| US3980796A (en) | 1976-09-14 |
| DK233375A (da) | 1975-11-29 |
| GB1454469A (en) | 1976-11-03 |
| NO751871L (enExample) | 1975-12-01 |
| FI751522A7 (enExample) | 1975-11-29 |
| DD122681A5 (enExample) | 1976-10-20 |
| ZA753405B (en) | 1976-04-28 |
| AU8155275A (en) | 1976-12-02 |
| IL47350A0 (en) | 1975-07-28 |
| JPS511471A (enExample) | 1976-01-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2733001A1 (de) | Pyrimidin-derivate, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| AT391864B (de) | Verfahren zur herstellung von neuen 5-pyrimidincarboxamiden und deren additionssalzen | |
| DE2206010A1 (de) | 1-aminosulfonyl-2-amino-benzimidazole, verfahren zu ihrer herstellung und ihre fungizide verwendung | |
| DE2206011A1 (de) | 1-acyl-3-aminosulfonyl-2-imino-benzimidazoline, verfahren zu ihrer herstellung und ihre fungizide verwendung | |
| DE2709886A1 (de) | 2-iminothiazolinverbindungen und ihre 4,5-dihydroderivate, verfahren zur herstellung und verwendung in schaedlingsbekaempfungsmitteln | |
| DE2434183C2 (de) | Substituierte Phenylisothioharnstoffe, ein Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| CH644854A5 (de) | Salze von thiazolyliden-oxo-propionitrilen, insektizides mittel, enthaltend diese salze sowie verfahren zu ihrer herstellung. | |
| DE2425704A1 (de) | Substituierte phenylmercapto-benzimidazole | |
| DE2441202C2 (de) | 2-Carbalkoxyamino-benzimidazolyl-5(6)-sulfonsäure-phenylester, Verfahren zu ihrer Herstellung und diese enthaltende anthelmintische Mittel | |
| DE2019536A1 (de) | Oximcarbamate | |
| DE2934355A1 (de) | (alpha)-acyl(thioacyl)amino-lactame, verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel, futterzusatzstoffe und konservierungsmittel | |
| DE2443297A1 (de) | Anthelminthisch wirksame basisch substituierte 2-carbalkoxy-amino-benzimidazolyl-5(6)-phenylaether und -ketone sowie verfahren zu ihrer herstellung | |
| DE2531606A1 (de) | Substituierte 2-phenylimino-thiazoline, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitizide | |
| DD210909A5 (de) | Verfahren zur herstellung von substituierten 3,4-diamino-1,2,5-thiadiazolverbindungen | |
| DE1960026A1 (de) | Neue Derivate des 3-Amino-1,2-benzisothiazols und ein Verfahren zu ihrer Herstellung sowie ihre Verwendung als Arzneimittel | |
| DE2304764A1 (de) | Benzoylphenylguanidine, ein verfahren zu ihrer herstellung sowie ihre verwendung als arzneimittel | |
| DE3129719C2 (de) | Pharmazeutisches Mittel | |
| DE2343787A1 (de) | N-(2- und 3-pyridyl)-1-polymethyleniminothiocarboxamide | |
| DE2356258A1 (de) | Substituierte triazino-benzimidazole und ihre herstellung | |
| DE2553270A1 (de) | Ektoparasitizide mittel enthaltend diphenylcarbodiimide | |
| DE2305517B2 (de) | 2-imino-1,3-dithiacyclobutane, verfahren zu ihrer herstellung und sie enthaltende warmblueterschutzmittel gegen schildzecken | |
| DE3328438A1 (de) | Neue oxamidsaeure-derivaten, verfahren zu ihrer herstellung und diese enthaltende therapeutische mittel | |
| DE1057112B (de) | Verfahren zur Herstellung von Thionophosphonsaeureestern | |
| DE2242785A1 (de) | 1-alkylsulfonyl-2-trifluormethylbenzimidazole, verfahren zu ihrer herstellung sowie ihre verwendung als ektoparasitenmittel | |
| DE2257184A1 (de) | Neue benzimidazolverbindungen |