DE2410527C3 - Elektronisches Zeitanzeigegerät - Google Patents
Elektronisches ZeitanzeigegerätInfo
- Publication number
- DE2410527C3 DE2410527C3 DE2410527A DE2410527A DE2410527C3 DE 2410527 C3 DE2410527 C3 DE 2410527C3 DE 2410527 A DE2410527 A DE 2410527A DE 2410527 A DE2410527 A DE 2410527A DE 2410527 C3 DE2410527 C3 DE 2410527C3
- Authority
- DE
- Germany
- Prior art keywords
- electrodes
- individual
- vcom
- electrode plate
- time
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004973 liquid crystal related substance Substances 0.000 claims description 47
- 229920001971 elastomer Polymers 0.000 claims description 21
- 230000010287 polarization Effects 0.000 claims description 16
- 239000013078 crystal Substances 0.000 claims description 12
- 238000007789 sealing Methods 0.000 claims description 5
- 230000005669 field effect Effects 0.000 claims description 4
- 241000282461 Canis lupus Species 0.000 claims description 2
- 238000001208 nuclear magnetic resonance pulse sequence Methods 0.000 claims 1
- 230000005684 electric field Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 239000003990 capacitor Substances 0.000 description 4
- 238000000034 method Methods 0.000 description 4
- 230000008569 process Effects 0.000 description 4
- 230000008859 change Effects 0.000 description 3
- 239000004020 conductor Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 238000009434 installation Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229920000742 Cotton Polymers 0.000 description 2
- 230000004913 activation Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000000576 coating method Methods 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 238000009413 insulation Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 125000006850 spacer group Chemical group 0.000 description 2
- 210000000707 wrist Anatomy 0.000 description 2
- NYPYHUZRZVSYKL-UHFFFAOYSA-N 2-azaniumyl-3-(4-hydroxy-3,5-diiodophenyl)propanoate Chemical compound OC(=O)C(N)CC1=CC(I)=C(O)C(I)=C1 NYPYHUZRZVSYKL-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 239000004988 Nematic liquid crystal Substances 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 230000006866 deterioration Effects 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 210000004247 hand Anatomy 0.000 description 1
- 239000011810 insulating material Substances 0.000 description 1
- 230000005012 migration Effects 0.000 description 1
- 238000013508 migration Methods 0.000 description 1
- 230000010355 oscillation Effects 0.000 description 1
- 230000002085 persistent effect Effects 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 229920006255 plastic film Polymers 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 230000002123 temporal effect Effects 0.000 description 1
- 239000012780 transparent material Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G9/00—Visual time or date indication means
- G04G9/02—Visual time or date indication means by selecting desired characters out of a number of characters or by selecting indicating elements the position of which represent the time, e.g. by using multiplexing techniques
- G04G9/06—Visual time or date indication means by selecting desired characters out of a number of characters or by selecting indicating elements the position of which represent the time, e.g. by using multiplexing techniques using light valves, e.g. liquid crystals
- G04G9/062—Visual time or date indication means by selecting desired characters out of a number of characters or by selecting indicating elements the position of which represent the time, e.g. by using multiplexing techniques using light valves, e.g. liquid crystals using multiplexing techniques
-
- G—PHYSICS
- G02—OPTICS
- G02F—OPTICAL DEVICES OR ARRANGEMENTS FOR THE CONTROL OF LIGHT BY MODIFICATION OF THE OPTICAL PROPERTIES OF THE MEDIA OF THE ELEMENTS INVOLVED THEREIN; NON-LINEAR OPTICS; FREQUENCY-CHANGING OF LIGHT; OPTICAL LOGIC ELEMENTS; OPTICAL ANALOGUE/DIGITAL CONVERTERS
- G02F1/00—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics
- G02F1/01—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour
- G02F1/13—Devices or arrangements for the control of the intensity, colour, phase, polarisation or direction of light arriving from an independent light source, e.g. switching, gating or modulating; Non-linear optics for the control of the intensity, phase, polarisation or colour based on liquid crystals, e.g. single liquid crystal display cells
- G02F1/133—Constructional arrangements; Operation of liquid crystal cells; Circuit arrangements
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G17/00—Structural details; Housings
- G04G17/02—Component assemblies
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G9/00—Visual time or date indication means
- G04G9/02—Visual time or date indication means by selecting desired characters out of a number of characters or by selecting indicating elements the position of which represent the time, e.g. by using multiplexing techniques
- G04G9/06—Visual time or date indication means by selecting desired characters out of a number of characters or by selecting indicating elements the position of which represent the time, e.g. by using multiplexing techniques using light valves, e.g. liquid crystals
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Chemical & Material Sciences (AREA)
- Crystallography & Structural Chemistry (AREA)
- Nonlinear Science (AREA)
- Mathematical Physics (AREA)
- Optics & Photonics (AREA)
- Electric Clocks (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP48027260A JPS6014317B2 (ja) | 1973-03-08 | 1973-03-08 | 液晶電子時計 |
| JP48033698A JPS6014354B2 (ja) | 1973-03-24 | 1973-03-24 | 液晶表示装置 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2410527A1 DE2410527A1 (de) | 1974-09-12 |
| DE2410527B2 DE2410527B2 (de) | 1976-06-10 |
| DE2410527C3 true DE2410527C3 (de) | 1983-11-03 |
Family
ID=26365167
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2410527A Expired DE2410527C3 (de) | 1973-03-08 | 1974-03-05 | Elektronisches Zeitanzeigegerät |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3969887A (enExample) |
| CA (1) | CA997157A (enExample) |
| CH (1) | CH621913B (enExample) |
| DE (1) | DE2410527C3 (enExample) |
| FR (1) | FR2220822B1 (enExample) |
| GB (1) | GB1464976A (enExample) |
| IT (1) | IT1009679B (enExample) |
| NL (1) | NL165308C (enExample) |
Families Citing this family (31)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4385842A (en) | 1975-03-10 | 1983-05-31 | Timex Corporation | Electronic timepiece for indicating digital subdivisions of time in a substantially conventional format |
| JPS5288370A (en) * | 1976-01-20 | 1977-07-23 | Hitachi Ltd | Electronic watch |
| US4213294A (en) * | 1977-04-12 | 1980-07-22 | Freeman Alfred B | Analog displays for electronic timepieces |
| DE2730069A1 (de) * | 1977-07-02 | 1979-01-11 | Braun Ag | Zeitmesser mit einer anzeigeeinrichtung |
| DE2732877C3 (de) | 1977-07-21 | 1984-10-25 | Braun Ag, 6000 Frankfurt | Zeitmesser mit einer Anzeigeeinrichtung |
| DE2735021A1 (de) * | 1977-08-03 | 1979-02-08 | Siemens Ag | Uhr, insbesondere armbanduhr |
| DE2803899C2 (de) * | 1978-01-30 | 1983-05-26 | Hans Uwe Dipl.-Phys. 8021 Taufkirchen Reif | Verfahren zur Ansteuerung einer quasianalogen Uhren-Anzeigeeinrichtung |
| DE2805646B2 (de) * | 1978-02-10 | 1981-05-07 | Braun Ag, 6000 Frankfurt | Anzeigeeinrichtung für Zeitmesser mit elektrooptischen Elementen |
| GB2014337A (en) * | 1978-02-13 | 1979-08-22 | Texas Instruments Inc | Electronic Timepiece |
| US4212159A (en) * | 1978-02-13 | 1980-07-15 | Texas Instruments Incorporated | Electronic timepiece |
| US4244040A (en) * | 1978-10-10 | 1981-01-06 | Robert Fondiller | Miniature electronic device construction |
| CH620092B (de) * | 1979-02-08 | Centre Electron Horloger | Affichage analogique et digital. | |
| JPS55114986A (en) * | 1979-02-27 | 1980-09-04 | Seikosha Co Ltd | Needle display unit |
| US4435046A (en) | 1980-04-08 | 1984-03-06 | Citizen Watch Company Limited | Liquid crystal display device |
| DE3149521A1 (de) * | 1981-12-14 | 1983-06-16 | Braun Ag, 6000 Frankfurt | Anzeigevorrichtung fuer verschiedene werte |
| FR2583895A1 (fr) * | 1985-06-25 | 1986-12-26 | Graff Bruno | Systeme d'indication de l'heure qu'il est, par la combinaison de symboles graphiques |
| US4647217A (en) * | 1986-01-08 | 1987-03-03 | Karel Havel | Variable color digital timepiece |
| DE8621553U1 (de) * | 1986-08-11 | 1987-06-04 | Zang, Klaus Dieter, Prof.Dr.med., 6650 Homburg | Elektrische Uhr |
| CH685967B5 (fr) * | 1993-11-26 | 1996-05-31 | Asulab Sa | Piéce d'horlogerie à affichage dynamique. |
| DE9413649U1 (de) * | 1994-08-24 | 1994-10-20 | Siemens AG, 80333 München | Anordnung zur Anzeige von Zeiteinheiten mittels eines entlang einer Skala beweglichen Zeigerelementes |
| US5636185A (en) * | 1995-03-10 | 1997-06-03 | Boit Incorporated | Dynamically changing liquid crystal display timekeeping apparatus |
| US6693606B1 (en) * | 1999-09-10 | 2004-02-17 | Sony Computer Entertainment Inc. | Method of and apparatus for displaying measured quantity, recording medium, and program |
| DE10127491A1 (de) * | 2001-06-07 | 2003-01-09 | Siemens Ag | Flüssigkristall-Anzeige |
| US6714488B1 (en) * | 2001-09-04 | 2004-03-30 | Eric J. Vogel | Kinetichrome |
| US20030214885A1 (en) * | 2002-05-17 | 2003-11-20 | Summer Powell | Electronic time-telling device |
| US20040145971A1 (en) * | 2003-01-29 | 2004-07-29 | Lau Cheung Ching | Watch having faceplate that displays decorative image elements in a sequence of patterns |
| USD535206S1 (en) * | 2005-07-01 | 2007-01-16 | Skaggs James R | Face display for a timepiece |
| USD735589S1 (en) * | 2012-02-28 | 2015-08-04 | Movado Llc | Watch case |
| USD720638S1 (en) | 2012-09-13 | 2015-01-06 | Time Timer Llc | Watch face |
| USD830858S1 (en) | 2017-01-23 | 2018-10-16 | Time Timer Llc | Timer |
| USD961410S1 (en) * | 2020-07-10 | 2022-08-23 | Hygiene IQ, LLC | Smart hygiene device |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3505804A (en) * | 1968-04-23 | 1970-04-14 | Rca Corp | Solid state clock |
| US3540209A (en) * | 1968-07-31 | 1970-11-17 | Timex Corp | Horological time display |
| CH697470A4 (enExample) * | 1970-05-11 | 1972-08-31 | ||
| US3748017A (en) * | 1970-06-05 | 1973-07-24 | K Yamamura | Electrodes for liquid crystal display device |
| DE2140536C3 (de) * | 1970-08-14 | 1974-12-19 | K.K. Suncrux Research Office, Kobe (Japan) | Zeiger- und ziffernloses Zeitanzeigegerät |
| IT946051B (it) * | 1970-12-04 | 1973-05-21 | Hoffmann La Roche | Cellula ottica |
| US3839857A (en) * | 1971-06-03 | 1974-10-08 | American Cyanamid Co | Electrochromic information displays |
| US3841083A (en) * | 1971-03-01 | 1974-10-15 | Time Computer | Self-illuminated liquid crystal timepiece |
| US3731986A (en) * | 1971-04-22 | 1973-05-08 | Int Liquid Xtal Co | Display devices utilizing liquid crystal light modulation |
| JPS542116B1 (enExample) * | 1971-06-26 | 1979-02-02 | ||
| US3772874A (en) * | 1971-12-09 | 1973-11-20 | Princeton Materials Science | Display apparatus and chronometer utilizing optically variable liquid |
| US3861135A (en) * | 1973-02-08 | 1975-01-21 | Chomerics Inc | Electrical interconnector and method of making |
-
1974
- 1974-03-05 DE DE2410527A patent/DE2410527C3/de not_active Expired
- 1974-03-06 CH CH314174A patent/CH621913B/xx not_active IP Right Cessation
- 1974-03-06 US US05/448,692 patent/US3969887A/en not_active Expired - Lifetime
- 1974-03-07 CA CA194,415A patent/CA997157A/en not_active Expired
- 1974-03-07 FR FR7407838A patent/FR2220822B1/fr not_active Expired
- 1974-03-08 GB GB1061874A patent/GB1464976A/en not_active Expired
- 1974-03-08 NL NL7403134.A patent/NL165308C/xx not_active IP Right Cessation
- 1974-04-08 IT IT20742/74A patent/IT1009679B/it active
Also Published As
| Publication number | Publication date |
|---|---|
| NL165308C (nl) | 1981-03-16 |
| FR2220822A1 (enExample) | 1974-10-04 |
| CA997157A (en) | 1976-09-21 |
| CH621913B (de) | |
| US3969887A (en) | 1976-07-20 |
| IT1009679B (it) | 1976-12-20 |
| NL7403134A (enExample) | 1974-09-10 |
| GB1464976A (en) | 1977-02-16 |
| CH621913GA3 (enExample) | 1981-03-13 |
| FR2220822B1 (enExample) | 1980-04-04 |
| DE2410527A1 (de) | 1974-09-12 |
| DE2410527B2 (de) | 1976-06-10 |
| NL165308B (nl) | 1980-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2410527C3 (de) | Elektronisches Zeitanzeigegerät | |
| DE69016776T2 (de) | Halbtransparente elektrophoretische Anzeigevorrichtungen mit netzartigen Elektroden. | |
| DE2226959C3 (de) | Farbige Datenanzeige | |
| DE3313804C2 (enExample) | ||
| DE2451626C3 (de) | Flüssigkristall-Anzeigevorrichtung | |
| DE3107827A1 (de) | Grosse elektronisch gesteuerte fluessigkristall-bildschirme mit einer oder mehreren farben | |
| DE2119832A1 (de) | Schaltungsanordnung zur Ansteuerung matrixfbrmig adressierbarer flüssigkristalliner Lichtventilanordnungen | |
| DE2325938C3 (de) | Verfahren zum Betrieb eines Flüssigkristallelementes und Einrichtung zu seiner Durchführung | |
| DE2742954A1 (de) | Fluessigkristallanzeigevorrichtung | |
| DE2459488A1 (de) | Fluessigkristall-verbundanzeigeschirm (-zelle) | |
| DE2402749C3 (de) | Flüssigkristallanzeigeschirm mit Mehrfachelektrodenanordnung | |
| DE2319445A1 (de) | Elektrisch gesteuerte anzeigevorrichtung | |
| DE2834387C3 (de) | Elektro-optische Zeit-Anzeigeeinrichtung | |
| DE2732877C3 (de) | Zeitmesser mit einer Anzeigeeinrichtung | |
| DE2326566C3 (de) | Flüssigkristall-Anzeigevorrichtung | |
| DE2738679C2 (enExample) | ||
| DE2312742C3 (de) | Elektronische Uhr | |
| DE2349208B2 (de) | Elektrooptisches Anzeigegerät | |
| DE2842399C2 (enExample) | ||
| DE2148378C3 (de) | Anordnung zur mehrfarbigen Datenanzeige | |
| DE2651062A1 (de) | Anzeigeeinrichtung | |
| DE2256317B2 (de) | Verfahren zur erzeugung einer homogenen orientierung von fluessigkristallmolekuelen in einer fluessigkristallanordnung | |
| DE2328920A1 (de) | Fluessigkristall-anzeigevorrichtung | |
| DE69303908T2 (de) | Ansteuerung einer matrix-fluessigkristallzelle | |
| DE3422583C2 (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| BGA | New person/name/address of the applicant | ||
| 8225 | Change of the main classification |
Ipc: G09G 3/18 |
|
| 8226 | Change of the secondary classification |
Ipc: G04G 9/06 |
|
| 8227 | New person/name/address of the applicant |
Free format text: CASIO COMPUTER CO., LTD., TOKYO, JP |
|
| C3 | Grant after two publication steps (3rd publication) |