DE2408530C2 - - Google Patents
Info
- Publication number
- DE2408530C2 DE2408530C2 DE2408530A DE2408530A DE2408530C2 DE 2408530 C2 DE2408530 C2 DE 2408530C2 DE 2408530 A DE2408530 A DE 2408530A DE 2408530 A DE2408530 A DE 2408530A DE 2408530 C2 DE2408530 C2 DE 2408530C2
- Authority
- DE
- Germany
- Prior art keywords
- aziridine
- carbon atoms
- formula
- radicals
- chloride
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 sulfuryl halide Chemical class 0.000 claims description 26
- 125000004432 carbon atom Chemical group C* 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 22
- 239000007858 starting material Substances 0.000 claims description 21
- 238000006243 chemical reaction Methods 0.000 claims description 20
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 8
- 150000001541 aziridines Chemical class 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims description 4
- 125000002723 alicyclic group Chemical group 0.000 claims description 4
- 239000003960 organic solvent Substances 0.000 claims description 4
- NOWKCMXCCJGMRR-UHFFFAOYSA-N Aziridine Chemical compound C1CN1 NOWKCMXCCJGMRR-UHFFFAOYSA-N 0.000 claims description 2
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 21
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 239000000203 mixture Substances 0.000 description 10
- YBBRCQOCSYXUOC-UHFFFAOYSA-N sulfuryl dichloride Chemical compound ClS(Cl)(=O)=O YBBRCQOCSYXUOC-UHFFFAOYSA-N 0.000 description 10
- 239000007795 chemical reaction product Substances 0.000 description 9
- 239000002904 solvent Substances 0.000 description 9
- 150000003254 radicals Chemical class 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- UBOXGVDOUJQMTN-UHFFFAOYSA-N 1,1,2-trichloroethane Chemical compound ClCC(Cl)Cl UBOXGVDOUJQMTN-UHFFFAOYSA-N 0.000 description 5
- 239000002841 Lewis acid Substances 0.000 description 5
- 150000007517 lewis acids Chemical class 0.000 description 5
- OBTWBSRJZRCYQV-UHFFFAOYSA-N sulfuryl difluoride Chemical compound FS(F)(=O)=O OBTWBSRJZRCYQV-UHFFFAOYSA-N 0.000 description 5
- XLJQPXVBQNJNLW-UHFFFAOYSA-N 1-methylaziridine Chemical compound CN1CC1 XLJQPXVBQNJNLW-UHFFFAOYSA-N 0.000 description 4
- 239000005935 Sulfuryl fluoride Substances 0.000 description 4
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 4
- 229910052736 halogen Inorganic materials 0.000 description 4
- BNMDKFLVWRQKCU-UHFFFAOYSA-N n-(2-chloroethyl)-n-methylsulfamoyl chloride Chemical compound ClS(=O)(=O)N(C)CCCl BNMDKFLVWRQKCU-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- PBKONEOXTCPAFI-UHFFFAOYSA-N 1,2,4-trichlorobenzene Chemical compound ClC1=CC=C(Cl)C(Cl)=C1 PBKONEOXTCPAFI-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 2
- 206010028980 Neoplasm Diseases 0.000 description 2
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- RWZYAGGXGHYGMB-UHFFFAOYSA-N anthranilic acid Chemical compound NC1=CC=CC=C1C(O)=O RWZYAGGXGHYGMB-UHFFFAOYSA-N 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- QARVLSVVCXYDNA-UHFFFAOYSA-N bromobenzene Chemical compound BrC1=CC=CC=C1 QARVLSVVCXYDNA-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 150000001805 chlorine compounds Chemical class 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- 230000007613 environmental effect Effects 0.000 description 2
- 229930195733 hydrocarbon Natural products 0.000 description 2
- QRTSTCCKPFFYDM-UHFFFAOYSA-N n-(2-chloroethyl)-n-methylsulfamoyl fluoride Chemical compound FS(=O)(=O)N(C)CCCl QRTSTCCKPFFYDM-UHFFFAOYSA-N 0.000 description 2
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 2
- 239000011814 protection agent Substances 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- IXPAAHZTOUOJJM-UHFFFAOYSA-N sulfuryl chloride fluoride Chemical compound FS(Cl)(=O)=O IXPAAHZTOUOJJM-UHFFFAOYSA-N 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- QVLAWKAXOMEXPM-UHFFFAOYSA-N 1,1,1,2-tetrachloroethane Chemical compound ClCC(Cl)(Cl)Cl QVLAWKAXOMEXPM-UHFFFAOYSA-N 0.000 description 1
- DVDMSISHJUNIAQ-UHFFFAOYSA-N 1,2,2-trimethylaziridine Chemical compound CN1CC1(C)C DVDMSISHJUNIAQ-UHFFFAOYSA-N 0.000 description 1
- FACHDUAMWHEPML-UHFFFAOYSA-N 1,2,3-trimethylaziridine Chemical compound CC1C(C)N1C FACHDUAMWHEPML-UHFFFAOYSA-N 0.000 description 1
- LZXAPVCEXBDIPY-UHFFFAOYSA-N 1,2-dimethyl-3-(4-nitrophenyl)aziridine Chemical compound CN1C(C)C1C1=CC=C([N+]([O-])=O)C=C1 LZXAPVCEXBDIPY-UHFFFAOYSA-N 0.000 description 1
- MKCZABZZOZOQTK-UHFFFAOYSA-N 1,2-dimethyl-3-phenylaziridine Chemical compound CN1C(C)C1C1=CC=CC=C1 MKCZABZZOZOQTK-UHFFFAOYSA-N 0.000 description 1
- WCNLPGRSKBZWNC-UHFFFAOYSA-N 1,2-dimethyl-3-propan-2-ylaziridine Chemical compound CC(C)C1C(C)N1C WCNLPGRSKBZWNC-UHFFFAOYSA-N 0.000 description 1
- LDUKCCKFNKIVMS-UHFFFAOYSA-N 1,2-dimethylaziridine Chemical compound CC1CN1C LDUKCCKFNKIVMS-UHFFFAOYSA-N 0.000 description 1
- JSRLURSZEMLAFO-UHFFFAOYSA-N 1,3-dibromobenzene Chemical compound BrC1=CC=CC(Br)=C1 JSRLURSZEMLAFO-UHFFFAOYSA-N 0.000 description 1
- ZPQOPVIELGIULI-UHFFFAOYSA-N 1,3-dichlorobenzene Chemical compound ClC1=CC=CC(Cl)=C1 ZPQOPVIELGIULI-UHFFFAOYSA-N 0.000 description 1
- LLUXYVNMHBVGRQ-UHFFFAOYSA-N 1-(1-chloropropyl)-2,3-dimethylaziridine Chemical compound CCC(Cl)N1C(C)C1C LLUXYVNMHBVGRQ-UHFFFAOYSA-N 0.000 description 1
- YZXPJVLVVIQNPF-UHFFFAOYSA-N 1-(2-chloroethyl)aziridine Chemical compound ClCCN1CC1 YZXPJVLVVIQNPF-UHFFFAOYSA-N 0.000 description 1
- ZESWABYAKZEPQB-UHFFFAOYSA-N 1-(2-ethoxyethyl)aziridine Chemical compound CCOCCN1CC1 ZESWABYAKZEPQB-UHFFFAOYSA-N 0.000 description 1
- QESKGSBCEIGZHD-UHFFFAOYSA-N 1-(2-methoxyethyl)aziridine Chemical compound COCCN1CC1 QESKGSBCEIGZHD-UHFFFAOYSA-N 0.000 description 1
- FJLAEPRFEAIKHC-UHFFFAOYSA-N 1-(2-methylbutyl)aziridine Chemical compound CCC(C)CN1CC1 FJLAEPRFEAIKHC-UHFFFAOYSA-N 0.000 description 1
- RHMVGJFZOJLLFX-UHFFFAOYSA-N 1-(3-butoxypropyl)aziridine Chemical compound CCCCOCCCN1CC1 RHMVGJFZOJLLFX-UHFFFAOYSA-N 0.000 description 1
- ORMCMDPTPXUUNQ-UHFFFAOYSA-N 1-(3-ethoxypropyl)aziridine Chemical compound CCOCCCN1CC1 ORMCMDPTPXUUNQ-UHFFFAOYSA-N 0.000 description 1
- BCLOICLXYSBVNH-UHFFFAOYSA-N 1-(3-fluoropropyl)aziridine Chemical compound FCCCN1CC1 BCLOICLXYSBVNH-UHFFFAOYSA-N 0.000 description 1
- HWPQFYNSYAJJOT-UHFFFAOYSA-N 1-(3-hexoxypropyl)aziridine Chemical compound CCCCCCOCCCN1CC1 HWPQFYNSYAJJOT-UHFFFAOYSA-N 0.000 description 1
- ORLFBUHNIIXTFT-UHFFFAOYSA-N 1-(3-methoxypropyl)aziridine Chemical compound COCCCN1CC1 ORLFBUHNIIXTFT-UHFFFAOYSA-N 0.000 description 1
- ALRLOOGIRZGIJI-UHFFFAOYSA-N 1-(4-methoxybutyl)aziridine Chemical compound COCCCCN1CC1 ALRLOOGIRZGIJI-UHFFFAOYSA-N 0.000 description 1
- HORYQQFPUDMCAO-UHFFFAOYSA-N 1-(5-methoxypentyl)aziridine Chemical compound COCCCCCN1CC1 HORYQQFPUDMCAO-UHFFFAOYSA-N 0.000 description 1
- OKFXPPXKRABEBT-UHFFFAOYSA-N 1-(6-butoxyhexyl)aziridine Chemical compound CCCCOCCCCCCN1CC1 OKFXPPXKRABEBT-UHFFFAOYSA-N 0.000 description 1
- ZXWHXBKOFBBKQW-UHFFFAOYSA-N 1-(6-methoxyhexyl)aziridine Chemical compound COCCCCCCN1CC1 ZXWHXBKOFBBKQW-UHFFFAOYSA-N 0.000 description 1
- KBTBSMFQKRRUAO-UHFFFAOYSA-N 1-(7-methoxyheptyl)aziridine Chemical compound COCCCCCCCN1CC1 KBTBSMFQKRRUAO-UHFFFAOYSA-N 0.000 description 1
- VOTTWAIHZXGNCG-UHFFFAOYSA-N 1-(methoxymethyl)aziridine Chemical compound COCN1CC1 VOTTWAIHZXGNCG-UHFFFAOYSA-N 0.000 description 1
- PJNRMWOACZFGCJ-UHFFFAOYSA-N 1-butan-2-ylaziridine Chemical compound CCC(C)N1CC1 PJNRMWOACZFGCJ-UHFFFAOYSA-N 0.000 description 1
- FINNXGKTNBZKBM-UHFFFAOYSA-N 1-butyl-2-methylaziridine Chemical compound CCCCN1CC1C FINNXGKTNBZKBM-UHFFFAOYSA-N 0.000 description 1
- XIEJPTDTTYFCJM-UHFFFAOYSA-N 1-butylaziridine Chemical compound CCCCN1CC1 XIEJPTDTTYFCJM-UHFFFAOYSA-N 0.000 description 1
- VFWCMGCRMGJXDK-UHFFFAOYSA-N 1-chlorobutane Chemical compound CCCCCl VFWCMGCRMGJXDK-UHFFFAOYSA-N 0.000 description 1
- LBTUZIHPJOSGFS-UHFFFAOYSA-N 1-decylaziridine Chemical compound CCCCCCCCCCN1CC1 LBTUZIHPJOSGFS-UHFFFAOYSA-N 0.000 description 1
- VTHSQZWBQSWDHD-UHFFFAOYSA-N 1-dodecylaziridine Chemical compound CCCCCCCCCCCCN1CC1 VTHSQZWBQSWDHD-UHFFFAOYSA-N 0.000 description 1
- LUNWJKXZDYXTDB-UHFFFAOYSA-N 1-ethyl-2,3-dimethylaziridine Chemical compound CCN1C(C)C1C LUNWJKXZDYXTDB-UHFFFAOYSA-N 0.000 description 1
- UJGVUACWGCQEAO-UHFFFAOYSA-N 1-ethylaziridine Chemical compound CCN1CC1 UJGVUACWGCQEAO-UHFFFAOYSA-N 0.000 description 1
- SMQXVVGSDJAJHC-UHFFFAOYSA-N 1-heptylaziridine Chemical compound CCCCCCCN1CC1 SMQXVVGSDJAJHC-UHFFFAOYSA-N 0.000 description 1
- AKNYMGBMJIDSQQ-UHFFFAOYSA-N 1-hexylaziridine Chemical compound CCCCCCN1CC1 AKNYMGBMJIDSQQ-UHFFFAOYSA-N 0.000 description 1
- ZGSKINUTVWDIFH-UHFFFAOYSA-N 1-methyl-2,3-dipropylaziridine Chemical compound CCCC1C(CCC)N1C ZGSKINUTVWDIFH-UHFFFAOYSA-N 0.000 description 1
- GGAYGPXRUVKNBK-UHFFFAOYSA-N 1-methyl-2-pentylaziridine Chemical compound CCCCCC1CN1C GGAYGPXRUVKNBK-UHFFFAOYSA-N 0.000 description 1
- NTWLTKMOHDXNCK-UHFFFAOYSA-N 1-methyl-2-phenylaziridine Chemical compound CN1CC1C1=CC=CC=C1 NTWLTKMOHDXNCK-UHFFFAOYSA-N 0.000 description 1
- OFGUDXIHTSHDIV-UHFFFAOYSA-N 1-methylaziridine-2-carbonitrile Chemical compound CN1CC1C#N OFGUDXIHTSHDIV-UHFFFAOYSA-N 0.000 description 1
- PZTZZKUYPINOIO-UHFFFAOYSA-N 1-nonylaziridine Chemical compound CCCCCCCCCN1CC1 PZTZZKUYPINOIO-UHFFFAOYSA-N 0.000 description 1
- ZPUJFEMAHSZIJA-UHFFFAOYSA-N 1-octylaziridine Chemical compound CCCCCCCCN1CC1 ZPUJFEMAHSZIJA-UHFFFAOYSA-N 0.000 description 1
- BCOPEHCVRGBNBQ-UHFFFAOYSA-N 1-pentan-2-ylaziridine Chemical compound CCCC(C)N1CC1 BCOPEHCVRGBNBQ-UHFFFAOYSA-N 0.000 description 1
- CGZJJNOOVORRPG-UHFFFAOYSA-N 1-pentan-3-ylaziridine Chemical compound CCC(CC)N1CC1 CGZJJNOOVORRPG-UHFFFAOYSA-N 0.000 description 1
- HVORHUUJKHPQQA-UHFFFAOYSA-N 1-pentylaziridine Chemical compound CCCCCN1CC1 HVORHUUJKHPQQA-UHFFFAOYSA-N 0.000 description 1
- MMMPMWQSPXSMAH-UHFFFAOYSA-N 1-propan-2-ylaziridine Chemical compound CC(C)N1CC1 MMMPMWQSPXSMAH-UHFFFAOYSA-N 0.000 description 1
- APKJRCRGAMSYHH-UHFFFAOYSA-N 1-propylaziridine Chemical compound CCCN1CC1 APKJRCRGAMSYHH-UHFFFAOYSA-N 0.000 description 1
- BBFCEQFUUOTJPD-UHFFFAOYSA-N 1-tert-butylaziridine Chemical compound CC(C)(C)N1CC1 BBFCEQFUUOTJPD-UHFFFAOYSA-N 0.000 description 1
- LGCXTJVESOYSTD-UHFFFAOYSA-N 1-tetradecylaziridine Chemical compound CCCCCCCCCCCCCCN1CC1 LGCXTJVESOYSTD-UHFFFAOYSA-N 0.000 description 1
- YYJKQPRWNLWIKD-UHFFFAOYSA-N 1-tridecylaziridine Chemical compound CCCCCCCCCCCCCN1CC1 YYJKQPRWNLWIKD-UHFFFAOYSA-N 0.000 description 1
- WLYQAIJKUUYCKF-UHFFFAOYSA-N 1-undecylaziridine Chemical compound CCCCCCCCCCCN1CC1 WLYQAIJKUUYCKF-UHFFFAOYSA-N 0.000 description 1
- NLOCPTKNDBXYOE-UHFFFAOYSA-N 2,2-dimethyl-1-propylaziridine Chemical compound CCCN1CC1(C)C NLOCPTKNDBXYOE-UHFFFAOYSA-N 0.000 description 1
- DSAJGWOLZBODHA-UHFFFAOYSA-N 2,3-diethyl-1-methylaziridine Chemical compound CCC1C(CC)N1C DSAJGWOLZBODHA-UHFFFAOYSA-N 0.000 description 1
- LLZQNBCFGLTQDL-UHFFFAOYSA-N 2-(1,3-dimethylaziridin-2-yl)benzonitrile Chemical compound CN1C(C)C1C1=CC=CC=C1C#N LLZQNBCFGLTQDL-UHFFFAOYSA-N 0.000 description 1
- WZKIMACENGPRTO-UHFFFAOYSA-N 2-(3-chloropropyl)-1-methylaziridine Chemical compound CN1CC1CCCCl WZKIMACENGPRTO-UHFFFAOYSA-N 0.000 description 1
- YZMXLXWPMFFKSN-UHFFFAOYSA-N 2-(4-chlorophenyl)-1-methyl-3-propylaziridine Chemical compound CN1C(CCC)C1C1=CC=C(Cl)C=C1 YZMXLXWPMFFKSN-UHFFFAOYSA-N 0.000 description 1
- RILZRCJGXSFXNE-UHFFFAOYSA-N 2-[4-(trifluoromethoxy)phenyl]ethanol Chemical compound OCCC1=CC=C(OC(F)(F)F)C=C1 RILZRCJGXSFXNE-UHFFFAOYSA-N 0.000 description 1
- RSBKJYHKDQIYFZ-UHFFFAOYSA-N 2-benzyl-1-methylaziridine Chemical compound CN1CC1CC1=CC=CC=C1 RSBKJYHKDQIYFZ-UHFFFAOYSA-N 0.000 description 1
- YBRYAVKJCQOYQI-UHFFFAOYSA-N 2-butyl-1-methylaziridine Chemical compound CCCCC1CN1C YBRYAVKJCQOYQI-UHFFFAOYSA-N 0.000 description 1
- BSPCSKHALVHRSR-UHFFFAOYSA-N 2-chlorobutane Chemical compound CCC(C)Cl BSPCSKHALVHRSR-UHFFFAOYSA-N 0.000 description 1
- JDXYUTWNVLYVBQ-UHFFFAOYSA-N 2-ethyl-1,3-dimethylaziridine Chemical compound CCC1C(C)N1C JDXYUTWNVLYVBQ-UHFFFAOYSA-N 0.000 description 1
- PJFNNMFXEVADGK-UHFFFAOYSA-N 2-hydroxy-n-phenylacetamide Chemical class OCC(=O)NC1=CC=CC=C1 PJFNNMFXEVADGK-UHFFFAOYSA-N 0.000 description 1
- JLUVYNNUSJOSKB-UHFFFAOYSA-N 2-methyl-1-propan-2-ylaziridine Chemical compound CC(C)N1CC1C JLUVYNNUSJOSKB-UHFFFAOYSA-N 0.000 description 1
- FPUZRUVNKYXTRI-UHFFFAOYSA-N 2-methyl-1-propylaziridine Chemical compound CCCN1CC1C FPUZRUVNKYXTRI-UHFFFAOYSA-N 0.000 description 1
- GCNUJBALSVICIR-UHFFFAOYSA-N 3,3-dimethyl-2h-1-benzofuran-5-ol Chemical class C1=C(O)C=C2C(C)(C)COC2=C1 GCNUJBALSVICIR-UHFFFAOYSA-N 0.000 description 1
- CZGCEKJOLUNIFY-UHFFFAOYSA-N 4-Chloronitrobenzene Chemical compound [O-][N+](=O)C1=CC=C(Cl)C=C1 CZGCEKJOLUNIFY-UHFFFAOYSA-N 0.000 description 1
- NPDACUSDTOMAMK-UHFFFAOYSA-N 4-Chlorotoluene Chemical compound CC1=CC=C(Cl)C=C1 NPDACUSDTOMAMK-UHFFFAOYSA-N 0.000 description 1
- GJNGXPDXRVXSEH-UHFFFAOYSA-N 4-chlorobenzonitrile Chemical compound ClC1=CC=C(C#N)C=C1 GJNGXPDXRVXSEH-UHFFFAOYSA-N 0.000 description 1
- ILXZCROTAHXUBF-UHFFFAOYSA-N 6-methyl-6-azabicyclo[3.1.0]hexane Chemical compound C1CCC2N(C)C21 ILXZCROTAHXUBF-UHFFFAOYSA-N 0.000 description 1
- AUKSCMCYMDCFAB-UHFFFAOYSA-N 7-methyl-7-azabicyclo[4.1.0]heptane Chemical compound C1CCCC2N(C)C21 AUKSCMCYMDCFAB-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 201000009030 Carcinoma Diseases 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 206010039491 Sarcoma Diseases 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- 238000006887 Ullmann reaction Methods 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-N acetic acid Substances CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 229910052797 bismuth Inorganic materials 0.000 description 1
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- KVNRLNFWIYMESJ-UHFFFAOYSA-N butyronitrile Chemical compound CCCC#N KVNRLNFWIYMESJ-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 201000011510 cancer Diseases 0.000 description 1
- 150000001722 carbon compounds Chemical class 0.000 description 1
- 230000000973 chemotherapeutic effect Effects 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Chemical compound CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 150000002222 fluorine compounds Chemical class 0.000 description 1
- 238000004508 fractional distillation Methods 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 230000002363 herbicidal effect Effects 0.000 description 1
- 239000004009 herbicide Substances 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 229910000040 hydrogen fluoride Inorganic materials 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- QTBFPMKWQKYFLR-UHFFFAOYSA-N isobutyl chloride Chemical compound CC(C)CCl QTBFPMKWQKYFLR-UHFFFAOYSA-N 0.000 description 1
- LRDFRRGEGBBSRN-UHFFFAOYSA-N isobutyronitrile Chemical compound CC(C)C#N LRDFRRGEGBBSRN-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012280 lithium aluminium hydride Substances 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- JFCHSQDLLFJHOA-UHFFFAOYSA-N n,n-dimethylsulfamoyl chloride Chemical compound CN(C)S(Cl)(=O)=O JFCHSQDLLFJHOA-UHFFFAOYSA-N 0.000 description 1
- WPVYUVMMYHXFSO-UHFFFAOYSA-N n-(2-chloroethyl)-n-ethylsulfamoyl chloride Chemical compound CCN(S(Cl)(=O)=O)CCCl WPVYUVMMYHXFSO-UHFFFAOYSA-N 0.000 description 1
- RWLSMSVIDUANNO-UHFFFAOYSA-N n-(2-chloroethyl)sulfamoyl fluoride Chemical compound FS(=O)(=O)NCCCl RWLSMSVIDUANNO-UHFFFAOYSA-N 0.000 description 1
- NHPIGLPRLKEFTQ-UHFFFAOYSA-N n-methylethenimine Chemical compound CN=C=C NHPIGLPRLKEFTQ-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- MCSAJNNLRCFZED-UHFFFAOYSA-N nitroethane Chemical compound CC[N+]([O-])=O MCSAJNNLRCFZED-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N phosphoric acid Substances OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- FAIAAWCVCHQXDN-UHFFFAOYSA-N phosphorus trichloride Chemical compound ClP(Cl)Cl FAIAAWCVCHQXDN-UHFFFAOYSA-N 0.000 description 1
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical compound NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical class NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 description 1
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 1
- YOUIDGQAIILFBW-UHFFFAOYSA-J tetrachlorotungsten Chemical compound Cl[W](Cl)(Cl)Cl YOUIDGQAIILFBW-UHFFFAOYSA-J 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- FAQYAMRNWDIXMY-UHFFFAOYSA-N trichloroborane Chemical compound ClB(Cl)Cl FAQYAMRNWDIXMY-UHFFFAOYSA-N 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/78—Halides of sulfonic acids
- C07C309/79—Halides of sulfonic acids having halosulfonyl groups bound to acyclic carbon atoms
- C07C309/80—Halides of sulfonic acids having halosulfonyl groups bound to acyclic carbon atoms of a saturated carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (14)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742408530 DE2408530A1 (de) | 1974-02-22 | 1974-02-22 | Verfahren zur herstellung von betahalogenalkylaminosulfonylhalogeniden |
| IL46625A IL46625A (en) | 1974-02-22 | 1975-02-12 | Process for the preparation of -haloalkylaminosulfonyl halides and certain such novel compounds |
| IT20214/75A IT1031697B (it) | 1974-02-22 | 1975-02-12 | Processo per la preparazione di beta a ogendalchilamino solfonila logenuri |
| US05/549,658 US4014931A (en) | 1974-01-08 | 1975-02-13 | Production of β-haloalkylaminosulfonyl halides |
| BE153351A BE825526A (fr) | 1974-02-22 | 1975-02-14 | Procede de preparation d'halogenures de beta-haloalkylaminosulfonyle |
| NLAANVRAGE7502035,A NL178072C (nl) | 1974-02-22 | 1975-02-20 | Werkwijze ter bereiding van beta-halogeenalkylaminosulfonylhalogeniden. |
| DD184314A DD119581A5 (cg-RX-API-DMAC7.html) | 1974-02-22 | 1975-02-20 | |
| SU752108280A SU604483A3 (ru) | 1974-02-22 | 1975-02-20 | Способ получени галогеналкиламиносульфонилгалогенидов |
| HU75BA00003214A HU171858B (hu) | 1974-02-22 | 1975-02-20 | Sposob poluchenija beta-galogeno-alkilamino-sul'fonil-galogenidov |
| FR7505461A FR2262028B2 (cg-RX-API-DMAC7.html) | 1974-02-22 | 1975-02-21 | |
| CH218275A CH586668A5 (cg-RX-API-DMAC7.html) | 1974-02-22 | 1975-02-21 | |
| JP50021073A JPS5833868B2 (ja) | 1974-02-22 | 1975-02-21 | ベ−タ − ハロゲンアルキルアミノスルホニルハロゲニドノ セイホウ |
| GB7304/75A GB1488186A (en) | 1974-02-22 | 1975-02-21 | Production of beta-haloethylaminosulphonyl halides |
| US05/746,197 US4173580A (en) | 1974-01-08 | 1976-11-30 | Production of β-haloalkylaminosulfonyl halides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742408530 DE2408530A1 (de) | 1974-02-22 | 1974-02-22 | Verfahren zur herstellung von betahalogenalkylaminosulfonylhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2408530A1 DE2408530A1 (de) | 1975-09-04 |
| DE2408530C2 true DE2408530C2 (cg-RX-API-DMAC7.html) | 1987-07-09 |
Family
ID=5908156
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742408530 Granted DE2408530A1 (de) | 1974-01-08 | 1974-02-22 | Verfahren zur herstellung von betahalogenalkylaminosulfonylhalogeniden |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS5833868B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE825526A (cg-RX-API-DMAC7.html) |
| CH (1) | CH586668A5 (cg-RX-API-DMAC7.html) |
| DD (1) | DD119581A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2408530A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2262028B2 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1488186A (cg-RX-API-DMAC7.html) |
| HU (1) | HU171858B (cg-RX-API-DMAC7.html) |
| IL (1) | IL46625A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1031697B (cg-RX-API-DMAC7.html) |
| NL (1) | NL178072C (cg-RX-API-DMAC7.html) |
| SU (1) | SU604483A3 (cg-RX-API-DMAC7.html) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2963400D1 (en) * | 1978-07-01 | 1982-09-16 | Basf Ag | Sulphamic acid halides and method for their preparation |
| EP0982300A3 (en) * | 1998-07-29 | 2000-03-08 | Societe Civile Bioprojet | Non-imidazole alkylamines as histamine H3 - receptor ligands and their therapeutic applications |
| EP1506169B1 (de) | 2002-05-16 | 2009-12-23 | Basf Se | Verfahren zur herstellung von sulfonsäurediamiden |
-
1974
- 1974-02-22 DE DE19742408530 patent/DE2408530A1/de active Granted
-
1975
- 1975-02-12 IT IT20214/75A patent/IT1031697B/it active
- 1975-02-12 IL IL46625A patent/IL46625A/xx unknown
- 1975-02-14 BE BE153351A patent/BE825526A/xx not_active IP Right Cessation
- 1975-02-20 NL NLAANVRAGE7502035,A patent/NL178072C/xx not_active IP Right Cessation
- 1975-02-20 HU HU75BA00003214A patent/HU171858B/hu unknown
- 1975-02-20 DD DD184314A patent/DD119581A5/xx unknown
- 1975-02-20 SU SU752108280A patent/SU604483A3/ru active
- 1975-02-21 FR FR7505461A patent/FR2262028B2/fr not_active Expired
- 1975-02-21 CH CH218275A patent/CH586668A5/xx not_active IP Right Cessation
- 1975-02-21 GB GB7304/75A patent/GB1488186A/en not_active Expired
- 1975-02-21 JP JP50021073A patent/JPS5833868B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FR2262028B2 (cg-RX-API-DMAC7.html) | 1978-04-07 |
| DD119581A5 (cg-RX-API-DMAC7.html) | 1976-05-05 |
| GB1488186A (en) | 1977-10-05 |
| IL46625A (en) | 1978-08-31 |
| NL7502035A (nl) | 1975-08-26 |
| IL46625A0 (en) | 1975-04-25 |
| CH586668A5 (cg-RX-API-DMAC7.html) | 1977-04-15 |
| DE2408530A1 (de) | 1975-09-04 |
| JPS50121224A (cg-RX-API-DMAC7.html) | 1975-09-23 |
| IT1031697B (it) | 1979-05-10 |
| BE825526A (fr) | 1975-08-14 |
| NL178072C (nl) | 1986-01-16 |
| JPS5833868B2 (ja) | 1983-07-22 |
| HU171858B (hu) | 1978-04-28 |
| SU604483A3 (ru) | 1978-04-25 |
| NL178072B (nl) | 1985-08-16 |
| FR2262028A2 (cg-RX-API-DMAC7.html) | 1975-09-19 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CH513136A (de) | Verfahren zur Herstellung N-substituierter, einen Perfluorkohlenstoffrest aufweisender Sulfonamide | |
| DE2408530C2 (cg-RX-API-DMAC7.html) | ||
| EP0132733B1 (de) | Neue Fluorpivalsäurefluoride und Verfahren zu ihrer Herstellung | |
| DE2301207C2 (de) | Verfahren zur Herstellung von β-Halogenalkylaminosulfonylhalogeniden | |
| DD202427A5 (de) | Verfahren zur herstellung von alpha-halogenalkylamiden | |
| EP0024588B1 (de) | Verfahren zur Herstellung von substituierten Cyclopropyl-carbonsäure-(alpha-cyano-3-phenoxy-benzyl)-estern | |
| EP0025935B1 (de) | Verfahren zur Herstellung von 5-(2,2,2-Trihalogenethyl)-dialkyl-tetrahydrofuran-2-onen | |
| DE2553460C2 (de) | Verfahren zur Herstellung von Sulfamidsäurehalogeniden | |
| DE2401819C2 (de) | Verfahren zur Herstellung von Sulfamidsäurehalogeniden | |
| EP0257295B1 (de) | (Z)-2-Cyan-2-oximino-acetyl-chloride sowie ein Verfahren zu ihrer Herstellung | |
| DE2553461A1 (de) | Sulfamidsaeurehalogenide und verfahren zu ihrer herstellung | |
| DE3428476A1 (de) | 4h-pyrido(2,3-d)(1,3)oxazin-4-on-derivate, verfahren zu ihrer herstellung und ihre verwendung zur bekaempfung unerwuenschten pflanzenwuchses | |
| DE1770481C3 (de) | Verfahren zur Herstellung von 33-disubstituierten ß -Lactamen | |
| DE2736403C2 (de) | Verfahren zur Herstellung von Trialkoxy- und Tricycloalkoxy-acetonitrilen | |
| EP0317888B1 (de) | Neue fluorierte Nitroalkylverbindungen und ein Verfahren zur Herstellung von neuen und bekannten fluorierten Nitroalkylverbindungen | |
| AT258264B (de) | Verfahren zur Herstellung von 5-(3'-Methylaminopropyl)-5H-dibenzo[a,d] cyclohepten | |
| DE2752196A1 (de) | N- und o-substituierte alpha-amino- alpha-oxy-acetonitrile und verfahren zu ihrer herstellung | |
| EP0025931B1 (de) | Verfahren zur Herstellung von 5-(2,2,-Dihalogenvinyl)-4,4-dialkyl-tetrahydrofuran-2-onen | |
| DE3718524A1 (de) | Verfahren zur herstellung von fluorsubstituierten carbonsaeurechloriden | |
| EP0273409A1 (de) | Neue Nitrohaloalkoxybenzole, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2901334A1 (de) | Neue harnstoffderivate | |
| AT256825B (de) | Verfahren zur Herstellung von neuen heterocyclischen Benzamidoverbindungen und ihren Salzen | |
| EP0132734A2 (de) | Neopentylisocyanate und ihre Herstellung | |
| DE2045905A1 (de) | Substituierte Thioätherverbindungen | |
| EP0508261A2 (de) | Verfahren zur Herstellung von beta-Halogen-tert.-alkylcarbonsäurechloriden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8110 | Request for examination paragraph 44 | ||
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2301207 Format of ref document f/p: P |
|
| AF | Is addition to no. |
Ref country code: DE Ref document number: 2301207 Format of ref document f/p: P |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8330 | Complete renunciation |