DE2364947C2 - Elektrischer Heizwiderstand - Google Patents
Elektrischer HeizwiderstandInfo
- Publication number
- DE2364947C2 DE2364947C2 DE2364947A DE2364947A DE2364947C2 DE 2364947 C2 DE2364947 C2 DE 2364947C2 DE 2364947 A DE2364947 A DE 2364947A DE 2364947 A DE2364947 A DE 2364947A DE 2364947 C2 DE2364947 C2 DE 2364947C2
- Authority
- DE
- Germany
- Prior art keywords
- resistance
- electrodes
- carbon black
- temperature
- heating resistor
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000010438 heat treatment Methods 0.000 title claims description 26
- 239000000203 mixture Substances 0.000 claims description 30
- 239000002861 polymer material Substances 0.000 claims description 16
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 claims description 5
- 229920000642 polymer Polymers 0.000 description 29
- 239000006229 carbon black Substances 0.000 description 16
- 239000011159 matrix material Substances 0.000 description 15
- 150000001412 amines Chemical class 0.000 description 12
- 239000000463 material Substances 0.000 description 11
- 229920006112 polar polymer Polymers 0.000 description 11
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 10
- 239000002253 acid Substances 0.000 description 10
- -1 alkaline earth metal salt Chemical class 0.000 description 10
- 239000011248 coating agent Substances 0.000 description 9
- 238000000576 coating method Methods 0.000 description 9
- ZNRLMGFXSPUZNR-UHFFFAOYSA-N 2,2,4-trimethyl-1h-quinoline Chemical compound C1=CC=C2C(C)=CC(C)(C)NC2=C1 ZNRLMGFXSPUZNR-UHFFFAOYSA-N 0.000 description 8
- 229910052799 carbon Inorganic materials 0.000 description 8
- 239000004071 soot Substances 0.000 description 8
- 239000004698 Polyethylene Substances 0.000 description 7
- 239000000654 additive Substances 0.000 description 7
- 229920000573 polyethylene Polymers 0.000 description 7
- 238000000137 annealing Methods 0.000 description 6
- 229920001577 copolymer Polymers 0.000 description 6
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 5
- 230000008859 change Effects 0.000 description 5
- 239000011162 core material Substances 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- 229920001897 terpolymer Polymers 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 4
- 125000002843 carboxylic acid group Chemical group 0.000 description 4
- 229910052802 copper Inorganic materials 0.000 description 4
- 239000010949 copper Substances 0.000 description 4
- 239000008367 deionised water Substances 0.000 description 4
- 229910021641 deionized water Inorganic materials 0.000 description 4
- 238000001125 extrusion Methods 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 238000005496 tempering Methods 0.000 description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 3
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 3
- 239000005977 Ethylene Substances 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- 239000003963 antioxidant agent Substances 0.000 description 3
- 239000004020 conductor Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 229920006242 ethylene acrylic acid copolymer Polymers 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- 239000004743 Polypropylene Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 2
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 2
- 230000002411 adverse Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 125000003277 amino group Chemical group 0.000 description 2
- 230000003078 antioxidant effect Effects 0.000 description 2
- 230000015556 catabolic process Effects 0.000 description 2
- 239000008119 colloidal silica Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 238000006731 degradation reaction Methods 0.000 description 2
- 239000005038 ethylene vinyl acetate Substances 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 229920001903 high density polyethylene Polymers 0.000 description 2
- 230000006872 improvement Effects 0.000 description 2
- 229920001684 low density polyethylene Polymers 0.000 description 2
- 239000000155 melt Substances 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 229920003023 plastic Polymers 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 2
- 229920001155 polypropylene Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000009736 wetting Methods 0.000 description 2
- 229910052725 zinc Inorganic materials 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- IRFSXVIRXMYULF-UHFFFAOYSA-N 1,2-dihydroquinoline Chemical compound C1=CC=C2C=CCNC2=C1 IRFSXVIRXMYULF-UHFFFAOYSA-N 0.000 description 1
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 125000000174 L-prolyl group Chemical group [H]N1C([H])([H])C([H])([H])C([H])([H])[C@@]1([H])C(*)=O 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 239000002033 PVDF binder Substances 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- 238000002441 X-ray diffraction Methods 0.000 description 1
- 239000006230 acetylene black Substances 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000000908 ammonium hydroxide Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 230000033228 biological regulation Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 210000002808 connective tissue Anatomy 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 238000004132 cross linking Methods 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 230000004069 differentiation Effects 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 235000013601 eggs Nutrition 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N ethyl acetate Substances CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 1
- 229920006244 ethylene-ethyl acrylate Polymers 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- 230000020169 heat generation Effects 0.000 description 1
- 239000004700 high-density polyethylene Substances 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 230000007774 longterm Effects 0.000 description 1
- 239000004702 low-density polyethylene Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229920001179 medium density polyethylene Polymers 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012544 monitoring process Methods 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 238000010606 normalization Methods 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 230000000704 physical effect Effects 0.000 description 1
- 229920001083 polybutene Polymers 0.000 description 1
- 229920002959 polymer blend Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920002635 polyurethane Polymers 0.000 description 1
- 239000004814 polyurethane Substances 0.000 description 1
- 229920002981 polyvinylidene fluoride Polymers 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000012815 thermoplastic material Substances 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 229920001567 vinyl ester resin Polymers 0.000 description 1
- 229910001868 water Inorganic materials 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B3/00—Ohmic-resistance heating
- H05B3/10—Heating elements characterised by the composition or nature of the materials or by the arrangement of the conductor
- H05B3/12—Heating elements characterised by the composition or nature of the materials or by the arrangement of the conductor characterised by the composition or nature of the conductive material
- H05B3/14—Heating elements characterised by the composition or nature of the materials or by the arrangement of the conductor characterised by the composition or nature of the conductive material the material being non-metallic
- H05B3/146—Conductive polymers, e.g. polyethylene, thermoplastics
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01B—CABLES; CONDUCTORS; INSULATORS; SELECTION OF MATERIALS FOR THEIR CONDUCTIVE, INSULATING OR DIELECTRIC PROPERTIES
- H01B3/00—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties
- H01B3/18—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances
- H01B3/30—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances plastics; resins; waxes
- H01B3/44—Insulators or insulating bodies characterised by the insulating materials; Selection of materials for their insulating or dielectric properties mainly consisting of organic substances plastics; resins; waxes vinyl resins; acrylic resins
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01C—RESISTORS
- H01C7/00—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material
- H01C7/02—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient
- H01C7/027—Non-adjustable resistors formed as one or more layers or coatings; Non-adjustable resistors made from powdered conducting material or powdered semi-conducting material with or without insulating material having positive temperature coefficient consisting of conducting or semi-conducting material dispersed in a non-conductive organic material
-
- H—ELECTRICITY
- H05—ELECTRIC TECHNIQUES NOT OTHERWISE PROVIDED FOR
- H05B—ELECTRIC HEATING; ELECTRIC LIGHT SOURCES NOT OTHERWISE PROVIDED FOR; CIRCUIT ARRANGEMENTS FOR ELECTRIC LIGHT SOURCES, IN GENERAL
- H05B3/00—Ohmic-resistance heating
- H05B3/02—Details
- H05B3/06—Heater elements structurally combined with coupling elements or holders
Landscapes
- Engineering & Computer Science (AREA)
- Physics & Mathematics (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Spectroscopy & Molecular Physics (AREA)
- Chemical & Material Sciences (AREA)
- Dispersion Chemistry (AREA)
- Ceramic Engineering (AREA)
- Electromagnetism (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Resistance Heating (AREA)
- Conductive Materials (AREA)
- Thermistors And Varistors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00319492A US3858144A (en) | 1972-12-29 | 1972-12-29 | Voltage stress-resistant conductive articles |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2364947A1 DE2364947A1 (de) | 1974-07-25 |
| DE2364947C2 true DE2364947C2 (de) | 1985-04-18 |
Family
ID=23242462
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2364947A Expired DE2364947C2 (de) | 1972-12-29 | 1973-12-28 | Elektrischer Heizwiderstand |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3858144A (enExample) |
| BE (1) | BE809287A (enExample) |
| CA (1) | CA1017395A (enExample) |
| DE (1) | DE2364947C2 (enExample) |
| FR (1) | FR2212617B1 (enExample) |
| GB (2) | GB1456047A (enExample) |
Families Citing this family (92)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1521460A (en) * | 1974-08-30 | 1978-08-16 | Raychem Corp | Self-limiting electrically resistive article and process for its manufacture |
| US4177376A (en) * | 1974-09-27 | 1979-12-04 | Raychem Corporation | Layered self-regulating heating article |
| FI64482C (fi) * | 1974-09-27 | 1983-11-10 | Raychem Corp | Vaermeaoterhaemtbar anordning och anordning av densamma foer en kabelskarv |
| US4058704A (en) * | 1974-12-27 | 1977-11-15 | Taeo Kim | Coilable and severable heating element |
| US4560498A (en) * | 1975-08-04 | 1985-12-24 | Raychem Corporation | Positive temperature coefficient of resistance compositions |
| NL7511173A (nl) * | 1975-09-23 | 1977-03-25 | Philips Nv | Zelfregelend verwarmingselement. |
| ES454025A1 (es) * | 1975-12-08 | 1977-11-16 | Raychem Corp | Perfeccionamientos en elementos de calentamiento. |
| NL7603997A (nl) * | 1976-04-15 | 1977-10-18 | Philips Nv | Elektrische verhittingsinrichting omvattende een weerstandslichaam uit p.t.c.-materiaal. |
| DE2760408C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Heizstreifen und Verfahren zu seiner Herstellung |
| DE2760471C2 (de) * | 1976-12-13 | 1996-04-04 | Raychem Corp | Verfahren zur Herstellung einer aus einer Elektrode und einer elektrisch leitfähigen Polymermasse bestehenden elektrischen Vorrichtung |
| US4764664A (en) * | 1976-12-13 | 1988-08-16 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4866253A (en) * | 1976-12-13 | 1989-09-12 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| US4876440A (en) * | 1976-12-13 | 1989-10-24 | Raychem Corporation | Electrical devices comprising conductive polymer compositions |
| DE2919436A1 (de) * | 1978-05-18 | 1979-11-22 | Hotfoil Ltd | Gegenstand aus einem polymeren elektrischen widerstandsmaterial |
| DE2923495A1 (de) * | 1978-06-15 | 1980-01-03 | Hotfoil Ltd | Heizband |
| US4237441A (en) * | 1978-12-01 | 1980-12-02 | Raychem Corporation | Low resistivity PTC compositions |
| US4238812A (en) * | 1978-12-01 | 1980-12-09 | Raychem Corporation | Circuit protection devices comprising PTC elements |
| US4242573A (en) * | 1979-01-24 | 1980-12-30 | Raychem Corporation | Water immersible heater |
| NZ193661A (en) * | 1979-05-10 | 1983-06-17 | Sunbeam Corp | Heating element conductive and ptc material |
| US4547659A (en) * | 1979-08-17 | 1985-10-15 | Raychem Corporation | PTC Heater assembly |
| US4425497A (en) | 1979-08-17 | 1984-01-10 | Raychem Corporation | PTC Heater assembly |
| US4673801A (en) * | 1979-08-17 | 1987-06-16 | Raychem Corporation | PTC heater assembly |
| US4250400A (en) * | 1979-11-19 | 1981-02-10 | The Scott & Fetzer Company | Flexible temperature self regulating heating cable |
| US4304044A (en) * | 1979-11-19 | 1981-12-08 | The Scott & Fetzer Company | Method for forming self-regulating heat trace cable |
| US4475138A (en) * | 1980-04-21 | 1984-10-02 | Raychem Corporation | Circuit protection devices comprising PTC element |
| US4413301A (en) * | 1980-04-21 | 1983-11-01 | Raychem Corporation | Circuit protection devices comprising PTC element |
| US4352083A (en) * | 1980-04-21 | 1982-09-28 | Raychem Corporation | Circuit protection devices |
| US4271350A (en) * | 1980-05-19 | 1981-06-02 | Sunbeam Corporation | Blanket wire utilizing positive temperature coefficient resistance heater |
| US4309597A (en) * | 1980-05-19 | 1982-01-05 | Sunbeam Corporation | Blanket wire utilizing positive temperature coefficient resistance heater |
| US4309596A (en) * | 1980-06-24 | 1982-01-05 | Sunbeam Corporation | Flexible self-limiting heating cable |
| US4951382A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4845838A (en) * | 1981-04-02 | 1989-07-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5195013A (en) * | 1981-04-02 | 1993-03-16 | Raychem Corporation | PTC conductive polymer compositions |
| US4955267A (en) * | 1981-04-02 | 1990-09-11 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US4951384A (en) * | 1981-04-02 | 1990-08-28 | Raychem Corporation | Method of making a PTC conductive polymer electrical device |
| US5140297A (en) * | 1981-04-02 | 1992-08-18 | Raychem Corporation | PTC conductive polymer compositions |
| US5227946A (en) * | 1981-04-02 | 1993-07-13 | Raychem Corporation | Electrical device comprising a PTC conductive polymer |
| US4560524A (en) * | 1983-04-15 | 1985-12-24 | Smuckler Jack H | Method of manufacturing a positive temperature coefficient resistive heating element |
| US4560443A (en) * | 1983-05-31 | 1985-12-24 | Chevron Research Company | Gas diffusion anode |
| EP0250776B1 (en) | 1983-06-30 | 1992-06-10 | RAYCHEM CORPORATION (a Delaware corporation) | Method for detecting and obtaining information about changes in variables |
| US4471215A (en) * | 1983-08-24 | 1984-09-11 | Eaton Corporation | Self-regulating heating cable having radiation grafted jacket |
| US4514620A (en) * | 1983-09-22 | 1985-04-30 | Raychem Corporation | Conductive polymers exhibiting PTC characteristics |
| US4761541A (en) * | 1984-01-23 | 1988-08-02 | Raychem Corporation | Devices comprising conductive polymer compositions |
| US4668857A (en) * | 1985-08-16 | 1987-05-26 | Belton Corporation | Temperature self-regulating resistive heating element |
| EP0242029B1 (en) | 1986-02-20 | 1991-12-11 | RAYCHEM CORPORATION (a Delaware corporation) | Method and articles employing ion exchange material |
| US5057673A (en) * | 1988-05-19 | 1991-10-15 | Fluorocarbon Company | Self-current-limiting devices and method of making same |
| US5250226A (en) * | 1988-06-03 | 1993-10-05 | Raychem Corporation | Electrical devices comprising conductive polymers |
| US5111032A (en) * | 1989-03-13 | 1992-05-05 | Raychem Corporation | Method of making an electrical device comprising a conductive polymer |
| GB8920283D0 (en) * | 1989-09-07 | 1989-10-18 | Hill Robert G Q | Self temperature limiting electro-conducting composites |
| US5925276A (en) * | 1989-09-08 | 1999-07-20 | Raychem Corporation | Conductive polymer device with fuse capable of arc suppression |
| US5002501A (en) * | 1989-10-02 | 1991-03-26 | Raychem Corporation | Electrical plug |
| US5004432A (en) * | 1989-10-02 | 1991-04-02 | Raychem Corporation | Electrical connector |
| JPH04272680A (ja) * | 1990-09-20 | 1992-09-29 | Thermon Mfg Co | スイッチ制御形ゾーン式加熱ケーブル及びその組み立て方法 |
| US6111234A (en) * | 1991-05-07 | 2000-08-29 | Batliwalla; Neville S. | Electrical device |
| US5517003A (en) * | 1993-06-29 | 1996-05-14 | Metagal Industria E Comercio Ltd. | Self-regulating heater including a polymeric semiconductor substrate containing porous conductive lampblack |
| US5756972A (en) * | 1994-10-25 | 1998-05-26 | Raychem Corporation | Hinged connector for heating cables of various sizes |
| US5622642A (en) * | 1995-02-06 | 1997-04-22 | Raychem Corporation | Sealing apparatus for elongate cables having movable insert with gripping members |
| DE953992T1 (de) * | 1995-08-15 | 2000-04-20 | Bourns, Multifuse (Hong Kong) Ltd. | Oberflächenmontierte leitfähige Polymer-Bauelemente und Verfahren zur Herstellung derselben |
| TW309619B (enExample) * | 1995-08-15 | 1997-07-01 | Mourns Multifuse Hong Kong Ltd | |
| US5792987A (en) * | 1995-08-28 | 1998-08-11 | Raychem Corporation | Sealing device |
| US6059997A (en) * | 1995-09-29 | 2000-05-09 | Littlelfuse, Inc. | Polymeric PTC compositions |
| DE19548741A1 (de) | 1995-12-23 | 1997-06-26 | Abb Research Ltd | Verfahren zur Herstellung eines Materials für PTC-Widerstände |
| US5718600A (en) * | 1996-01-17 | 1998-02-17 | Raychem Corporation | Electrical plug |
| US5814264A (en) * | 1996-04-12 | 1998-09-29 | Littelfuse, Inc. | Continuous manufacturing methods for positive temperature coefficient materials |
| US6023403A (en) * | 1996-05-03 | 2000-02-08 | Littlefuse, Inc. | Surface mountable electrical device comprising a PTC and fusible element |
| US6005232A (en) * | 1996-06-28 | 1999-12-21 | Raychem Corporation | Heating cable |
| US5767448A (en) * | 1996-09-30 | 1998-06-16 | Raychem Corporation | Sealing device |
| US5841111A (en) * | 1996-12-19 | 1998-11-24 | Eaton Corporation | Low resistance electrical interface for current limiting polymers by plasma processing |
| US6020808A (en) * | 1997-09-03 | 2000-02-01 | Bourns Multifuse (Hong Kong) Ltd. | Multilayer conductive polymer positive temperature coefficent device |
| US6282072B1 (en) | 1998-02-24 | 2001-08-28 | Littelfuse, Inc. | Electrical devices having a polymer PTC array |
| KR20010079908A (ko) | 1998-09-25 | 2001-08-22 | 추후보정 | 정의 온도 계수 폴리머 재료 제조 방법 |
| US6582647B1 (en) | 1998-10-01 | 2003-06-24 | Littelfuse, Inc. | Method for heat treating PTC devices |
| DE69928274T2 (de) | 1998-10-15 | 2006-06-01 | Tyco Electronics Corp., Menlo Park | Verbinder für ein elektrisches kabel |
| US6358438B1 (en) | 1999-07-30 | 2002-03-19 | Tyco Electronics Corporation | Electrically conductive polymer composition |
| DE19963893A1 (de) * | 1999-12-30 | 2001-07-12 | Bison Stematec Maschb Und Huba | Antriebsvorrichtung |
| SE518872C2 (sv) * | 2000-01-28 | 2002-12-03 | Polyohm Ab | Anordning för golvuppvärmning |
| US7214757B2 (en) | 2000-03-09 | 2007-05-08 | Eastman Kodak Company | Polyurethane elastomers and shaped articles prepared therefrom |
| US6531950B1 (en) | 2000-06-28 | 2003-03-11 | Tyco Electronics Corporation | Electrical devices containing conductive polymers |
| US6593843B1 (en) | 2000-06-28 | 2003-07-15 | Tyco Electronics Corporation | Electrical devices containing conductive polymers |
| US6628498B2 (en) | 2000-08-28 | 2003-09-30 | Steven J. Whitney | Integrated electrostatic discharge and overcurrent device |
| US7183891B2 (en) | 2002-04-08 | 2007-02-27 | Littelfuse, Inc. | Direct application voltage variable material, devices employing same and methods of manufacturing such devices |
| US7132922B2 (en) | 2002-04-08 | 2006-11-07 | Littelfuse, Inc. | Direct application voltage variable material, components thereof and devices employing same |
| WO2003088356A1 (en) | 2002-04-08 | 2003-10-23 | Littelfuse, Inc. | Voltage variable material for direct application and devices employing same |
| US7371459B2 (en) * | 2004-09-03 | 2008-05-13 | Tyco Electronics Corporation | Electrical devices having an oxygen barrier coating |
| EP1634896A1 (en) * | 2004-09-10 | 2006-03-15 | Borealis Technology Oy | Polymer composition |
| EP2116778B1 (de) * | 2008-05-09 | 2016-03-16 | Kronoplus Technical AG | Beheizbares Belagsystem |
| US9603196B2 (en) * | 2012-12-14 | 2017-03-21 | Tech Design Llc | Self-regulating semi-conductive flexible heating element |
| CA3011250A1 (en) | 2016-01-12 | 2017-07-20 | 3M Innovative Properties Company | Heating tape and system |
| CN109313968A (zh) | 2016-04-29 | 2019-02-05 | 恩文特服务有限责任公司 | 电压调平整体式自调节加热器电缆 |
| CN106409451B (zh) * | 2016-06-18 | 2018-03-27 | 芜湖长启炉业有限公司 | 基于聚苯硫醚的ptc电阻及其制备方法 |
| GB2604908A (en) * | 2021-03-18 | 2022-09-21 | Nobel Gemlik Otomotiv Sanayi Veticaret Anonim Sirketi | A type of battery thermal management system |
| WO2025224186A1 (en) * | 2024-04-23 | 2025-10-30 | Borealis Gmbh | Method for predicting the properties of a semiconductive composition |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1305140A (fr) * | 1961-11-09 | 1962-09-28 | Montedison Spa | Mélanges à base de polyoléfines cristallines et éléments électriques de conductance variable formés de tels mélanges |
| US3243753A (en) * | 1962-11-13 | 1966-03-29 | Kohler Fred | Resistance element |
| GB1144316A (en) * | 1965-08-13 | 1969-03-05 | Dunlop Co Ltd | Improved emulsions of alkali-soluble copolymers |
| JPS534238B1 (enExample) * | 1967-08-23 | 1978-02-15 | ||
| US3673121A (en) * | 1970-01-27 | 1972-06-27 | Texas Instruments Inc | Process for making conductive polymers and resulting compositions |
-
1972
- 1972-12-29 US US00319492A patent/US3858144A/en not_active Expired - Lifetime
-
1973
- 1973-12-21 GB GB5963773A patent/GB1456047A/en not_active Expired
- 1973-12-21 GB GB2343876A patent/GB1456048A/en not_active Expired
- 1973-12-28 DE DE2364947A patent/DE2364947C2/de not_active Expired
- 1973-12-28 FR FR7346976A patent/FR2212617B1/fr not_active Expired
- 1973-12-28 CA CA189,180A patent/CA1017395A/en not_active Expired
- 1973-12-28 BE BE139428A patent/BE809287A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US3858144A (en) | 1974-12-31 |
| DE2364947A1 (de) | 1974-07-25 |
| FR2212617A1 (enExample) | 1974-07-26 |
| CA1017395A (en) | 1977-09-13 |
| GB1456047A (en) | 1976-11-17 |
| GB1456048A (enExample) | 1976-11-17 |
| BE809287A (fr) | 1974-06-28 |
| FR2212617B1 (enExample) | 1979-06-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2364947C2 (de) | Elektrischer Heizwiderstand | |
| DE2948350C2 (enExample) | ||
| DE2345303C2 (de) | Sich selbst regulierender elektrischer Widerstandskörper und Verfahren zu dessen Herstellung | |
| DE2402475A1 (de) | Elektrischer widerstandskoerper mit verminderter schwankung des widerstandswertes und verfahren zu dessen herstellung | |
| DE3011754C2 (de) | Elektrisch leitfähige Zusammensetzung mit positiven Temperaturkoeffizienten des elektrischen Widerstandes, sowie Verfahren zu ihrer Herstellung | |
| DE3701814A1 (de) | Elektrisch leitende polymerzusammensetzung mit positivem temperaturkoeffizienten sowie verfahren zu ihrer herstellung | |
| EP1274102B1 (de) | Polymercompound mit nichtlinearer Strom-Spannungs-Kennlinie und Verfahren zur Herstellung eines Polymercompounds | |
| DE69633718T2 (de) | Leitfähige polymerzusammensetzung und vorrichtung | |
| DE2103319C3 (de) | Elektrisches Heizelement aus einem Polymer mit elektrisch leitenden Teilchen | |
| DE3017826A1 (de) | Flexible heizelemente und verfahren zu deren herstellung | |
| DE3512483C2 (enExample) | ||
| DE3707503C2 (de) | PTC-Zusammensetzung | |
| DE3177291T2 (de) | Schaltungsschutzeinrichtung. | |
| DE69606316T2 (de) | Verbesserte polymer ptc-zusammensetzungen | |
| DE3789785T2 (de) | Resistive Paste, elektrischer Heizwiderstand und Herstellungsverfahren das diese Paste benutzt. | |
| DE2345320C2 (de) | Verfahren zur Herstellung eines sich selbst regulierenden elektrischen Widerstandskörpers | |
| DE69621498T2 (de) | Zusammensetzung mit positivem Temperaturkoeffizienten | |
| DE2513362A1 (de) | Flaches heizelement und verfahren zu dessen herstellung | |
| DE2821750A1 (de) | Elektrisch leitfaehiges silikongummi | |
| DE3889177T2 (de) | Leitfähige Kunststoffzusammensetzung. | |
| DE7737676U1 (de) | Selbstregulierende elektrische Heizvorrichtung | |
| DE68920479T2 (de) | Heizmasse zur Selbstregelung der Temperatur. | |
| DE2755077C2 (enExample) | ||
| DE3233732A1 (de) | Thermistoren mit negativem temperaturkoeffizienten und verfahren zu ihrer herstellung | |
| DE2422914C2 (de) | Elektrisches Hoch- oder Höchstspannungskabel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8128 | New person/name/address of the agent |
Representative=s name: ABITZ, W., DIPL.-ING.DR.-ING. MORF, D., DR., PAT.- |
|
| 8141 | Disposal/no request for examination | ||
| 8110 | Request for examination paragraph 44 | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |