DE2351235A1 - Zusammenlegbares kraftfahrzeugpannenwarndreieck - Google Patents
Zusammenlegbares kraftfahrzeugpannenwarndreieckInfo
- Publication number
- DE2351235A1 DE2351235A1 DE19732351235 DE2351235A DE2351235A1 DE 2351235 A1 DE2351235 A1 DE 2351235A1 DE 19732351235 DE19732351235 DE 19732351235 DE 2351235 A DE2351235 A DE 2351235A DE 2351235 A1 DE2351235 A1 DE 2351235A1
- Authority
- DE
- Germany
- Prior art keywords
- warning triangle
- breakdown warning
- triangle according
- leg
- breakdown
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000015556 catabolic process Effects 0.000 title claims description 35
- 239000000463 material Substances 0.000 claims description 9
- 230000001154 acute effect Effects 0.000 claims description 3
- DOETVZCFKJCYJV-UHFFFAOYSA-N 6-(4,5-dihydro-1h-imidazol-2-yl)-2-[4-(4,5-dihydro-1h-imidazol-2-yl)phenyl]-1h-indole Chemical compound N1CCN=C1C1=CC=C(C=2NC3=CC(=CC=C3C=2)C=2NCCN=2)C=C1 DOETVZCFKJCYJV-UHFFFAOYSA-N 0.000 claims 1
- 101100286286 Dictyostelium discoideum ipi gene Proteins 0.000 claims 1
- 238000005267 amalgamation Methods 0.000 claims 1
- 210000002414 leg Anatomy 0.000 description 26
- 230000006378 damage Effects 0.000 description 2
- 230000005855 radiation Effects 0.000 description 2
- 230000004308 accommodation Effects 0.000 description 1
- 230000002950 deficient Effects 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 230000002787 reinforcement Effects 0.000 description 1
- 210000000689 upper leg Anatomy 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B60—VEHICLES IN GENERAL
- B60Q—ARRANGEMENT OF SIGNALLING OR LIGHTING DEVICES, THE MOUNTING OR SUPPORTING THEREOF OR CIRCUITS THEREFOR, FOR VEHICLES IN GENERAL
- B60Q7/00—Arrangement or adaptation of portable emergency signal devices on vehicles
- B60Q7/005—Devices without lamps
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- Road Signs Or Road Markings (AREA)
- Illuminated Signs And Luminous Advertising (AREA)
- Refuge Islands, Traffic Blockers, Or Guard Fence (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00297630A US3806234A (en) | 1972-10-16 | 1972-10-16 | Foldable emergency reflecting device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2351235A1 true DE2351235A1 (de) | 1974-04-25 |
Family
ID=23147105
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732351235 Pending DE2351235A1 (de) | 1972-10-16 | 1973-10-12 | Zusammenlegbares kraftfahrzeugpannenwarndreieck |
Country Status (7)
| Country | Link |
|---|---|
| US (2) | US3806234A (enExample) |
| JP (1) | JPS4974899A (enExample) |
| CA (1) | CA985662A (enExample) |
| DE (1) | DE2351235A1 (enExample) |
| FR (1) | FR2203559A5 (enExample) |
| GB (1) | GB1452124A (enExample) |
| IT (1) | IT996304B (enExample) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9214680U1 (de) * | 1992-10-29 | 1993-02-04 | Frielingsdorf, Christa, 6100 Darmstadt | Zusammenlegbares Warndreieck |
| DE19628746A1 (de) * | 1996-07-17 | 1998-01-22 | Geka Guenther & Kastl Gmbh | Warndreieck |
| DE19721222A1 (de) * | 1996-11-26 | 1998-06-04 | Burger Soehne | Warntafel für den Straßenverkehr, insbesondere Warndreieck |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4177749A (en) * | 1978-12-15 | 1979-12-11 | Beatrice Foods Co. | Demountable two-component roadway signal assembly |
| USD314353S (en) | 1987-05-21 | 1991-02-05 | Dino Betti | Bicycle reflector |
| CH675862A5 (enExample) * | 1990-01-03 | 1990-11-15 | Armido Beretta | |
| US5114266A (en) * | 1990-08-22 | 1992-05-19 | Cocina Jr Joseph | Barrier apparatus and method of mounting same |
| DE4238180C1 (de) * | 1992-11-12 | 1994-04-14 | Raderschad Gebra Plastik | Warndreieck |
| US5551370A (en) * | 1995-01-23 | 1996-09-03 | Hwang; Wen-Chin | Warning triangle assembly |
| USD383080S (en) * | 1995-10-26 | 1997-09-02 | Seg Corporation | Caution signal |
| US6659681B1 (en) * | 1999-02-10 | 2003-12-09 | Traf Fix Devices, Inc. | Laterally stable vertical panel system |
| US6402422B1 (en) | 1999-02-10 | 2002-06-11 | Traffix Devices, Inc. | Laterally stable vertical panel system |
| EP1377484A2 (en) * | 2001-04-12 | 2004-01-07 | Quinn, Richard Keith | Reflective device |
| DE10311005B4 (de) * | 2003-03-13 | 2007-07-05 | Adam Opel Ag | Sonnenblende für ein Kraftfahrzeug |
| US6928951B2 (en) * | 2003-06-02 | 2005-08-16 | Sunny En Liung Huang | Foldable triangular caution device |
| USD557625S1 (en) * | 2007-03-19 | 2007-12-18 | Hejian Yu | Portable traffic warning sign |
| US20090084306A1 (en) * | 2007-10-01 | 2009-04-02 | Noonan Ii Donald F | Foldable traffic safety marker |
| US20090308304A1 (en) * | 2008-06-11 | 2009-12-17 | Jung-Yung Ho | Warning triangle |
| US20150203045A1 (en) * | 2014-01-17 | 2015-07-23 | GM Global Technology Operations LLC | Storage bin having integrated reflective triangles |
| GB201507822D0 (en) * | 2015-05-07 | 2015-06-17 | Road Safety Designs Ltd | Foldable warning triangle assembly |
| USD793890S1 (en) * | 2016-01-08 | 2017-08-08 | Shanghai Kazheng Energy Technology Co., Ltd. | Collapsible triangular warning frame |
| TWD181717S (zh) * | 2016-04-26 | 2017-03-11 | 鴻海精密工業股份有限公司 | 交通警示裝置 |
| GB2554858A (en) * | 2016-09-30 | 2018-04-18 | Road Safety Designs Ltd | Foldable warning triangle assembly |
| US10730432B1 (en) | 2020-01-15 | 2020-08-04 | Joseph D. Johnson | Traffic emergency signalling device |
| USD964199S1 (en) * | 2021-03-02 | 2022-09-20 | Nite Beams Technology, LLC | Safety beacon |
| USD1066497S1 (en) * | 2022-09-07 | 2025-03-11 | Donald Pariga | Sign |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR495840A (fr) * | 1917-11-14 | 1919-10-18 | James Joseph Murray | Perfectionnements aux aéroplanes |
| US1895173A (en) * | 1924-12-03 | 1933-01-24 | Jonathan C Stimson | Reflecting device |
| FR1266448A (fr) * | 1960-09-05 | 1961-07-07 | Triangle de pré-signalisation routière repliable | |
| GB985881A (en) * | 1962-11-14 | 1965-03-10 | Hubert Percival Schofield | Improvements in or relating to road signs |
| US3292569A (en) * | 1964-12-18 | 1966-12-20 | Gaetano T Trigilio | Warning device for disabled highway vehicles |
| GB1096926A (en) * | 1965-07-09 | 1967-12-29 | Humphrey Thompson Entpr Ltd | Triangular road signs |
| GB1167085A (en) * | 1967-01-12 | 1969-10-15 | Spacesaver Signs | Collapsible Road Sign. |
| US3734595A (en) * | 1971-08-06 | 1973-05-22 | Cities Service Co | Folding highway emergency device |
-
1972
- 1972-10-16 US US00297630A patent/US3806234A/en not_active Expired - Lifetime
-
1973
- 1973-10-12 GB GB4771673A patent/GB1452124A/en not_active Expired
- 1973-10-12 CA CA183,201A patent/CA985662A/en not_active Expired
- 1973-10-12 DE DE19732351235 patent/DE2351235A1/de active Pending
- 1973-10-15 IT IT53121/73A patent/IT996304B/it active
- 1973-10-15 FR FR7336774A patent/FR2203559A5/fr not_active Expired
- 1973-10-15 JP JP48115660A patent/JPS4974899A/ja active Pending
-
1976
- 1976-07-21 US US05/707,223 patent/USRE29566E/en not_active Expired - Lifetime
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE9214680U1 (de) * | 1992-10-29 | 1993-02-04 | Frielingsdorf, Christa, 6100 Darmstadt | Zusammenlegbares Warndreieck |
| DE19628746A1 (de) * | 1996-07-17 | 1998-01-22 | Geka Guenther & Kastl Gmbh | Warndreieck |
| DE19721222A1 (de) * | 1996-11-26 | 1998-06-04 | Burger Soehne | Warntafel für den Straßenverkehr, insbesondere Warndreieck |
| DE19721222C2 (de) * | 1996-11-26 | 2000-09-21 | Burger Soehne | Warntafel für den Straßenverkehr, insbesondere Warndreieck |
Also Published As
| Publication number | Publication date |
|---|---|
| US3806234A (en) | 1974-04-23 |
| USRE29566E (en) | 1978-03-07 |
| CA985662A (en) | 1976-03-16 |
| IT996304B (it) | 1975-12-10 |
| GB1452124A (en) | 1976-10-13 |
| JPS4974899A (enExample) | 1974-07-19 |
| FR2203559A5 (enExample) | 1974-05-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2351235A1 (de) | Zusammenlegbares kraftfahrzeugpannenwarndreieck | |
| EP0997346A1 (de) | Aussenrückspiegel für Fahrzeuge, insbesondere Kraftfahrzeuge | |
| DE4417695A1 (de) | Kraftfahrzeugleuchte | |
| DE2737282C2 (de) | Warnlicht für Einsatzfahrzeuge | |
| EP0049502B1 (de) | Rückleuchten-Kombination, insbesondere für Anhänger von Kraftfahrzeugen | |
| DE69409509T2 (de) | Auf der dritten Bremsleuchte eines Fahrzeuges montierte, zusammenklappbare dreieckige Warnleuchte | |
| DE10054656C2 (de) | Zusammenklappbares Warndreieck | |
| DE60303880T2 (de) | Reflektoreinrichtung für ein Fahrrad | |
| DE19624175C1 (de) | Kraftfahrzeug-Dachzeichen | |
| DE557218C (de) | Scheinwerferanordnung fuer Fahrzeuge | |
| DE29708006U1 (de) | Vorrichtung zum Vertreiben von Wild | |
| EP1936582B1 (de) | Signalgeberoptik zum Einbau in eine Verkehrsampel | |
| DE69624754T2 (de) | Kfz-Multifunktionssignalleuchte mit Rückstrahlern und Pseudorückstrahlern | |
| DE9215157U1 (de) | Warngerät | |
| DE441800C (de) | Kraftwagenlaterne | |
| DE548243C (de) | Beleuchtungsanlage fuer Fahrzeuge, insbesondere Kraftfahrzeuge | |
| DE1892255U (de) | Warnzeichen fuer kraftfahrzeuge. | |
| DE102021117133A1 (de) | Vorrichtung zur Ausbildung von Blinker- und/oder Rückleuchten an einem Kraftfahrzeug | |
| DE532837C (de) | Scheinwerfer fuer Kraftfahrzeuge | |
| DE1975647U (de) | Warndreieck. | |
| DE1639112U (de) | Zusammenklappbares warngeraet fuer parkende fahrzeuge. | |
| DE570670C (de) | Scheinwerfer fuer Kraftfahrzeuge | |
| DE1960690A1 (de) | Warnvorrichtung fuer Kraftfahrzeuge | |
| DE1931548U (de) | Warnpyramide. | |
| EP0838630A2 (de) | Fahrzeugrückleuchte mit Blendrahmen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |