DE2333201A1 - Bleichverfahren und -mittel - Google Patents
Bleichverfahren und -mittelInfo
- Publication number
- DE2333201A1 DE2333201A1 DE19732333201 DE2333201A DE2333201A1 DE 2333201 A1 DE2333201 A1 DE 2333201A1 DE 19732333201 DE19732333201 DE 19732333201 DE 2333201 A DE2333201 A DE 2333201A DE 2333201 A1 DE2333201 A1 DE 2333201A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- hydrogen peroxide
- salt
- bleaching
- agent
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004061 bleaching Methods 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 6
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 52
- 239000007844 bleaching agent Substances 0.000 claims description 18
- 239000000203 mixture Substances 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 12
- 239000002253 acid Substances 0.000 claims description 8
- 150000003863 ammonium salts Chemical class 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 230000003113 alkalizing effect Effects 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 125000005402 stannate group Chemical group 0.000 claims description 5
- 150000007524 organic acids Chemical class 0.000 claims description 3
- KCXVZYZYPLLWCC-UHFFFAOYSA-N EDTA Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(O)=O)CC(O)=O KCXVZYZYPLLWCC-UHFFFAOYSA-N 0.000 claims description 2
- QPCDCPDFJACHGM-UHFFFAOYSA-N N,N-bis{2-[bis(carboxymethyl)amino]ethyl}glycine Chemical compound OC(=O)CN(CC(O)=O)CCN(CC(=O)O)CCN(CC(O)=O)CC(O)=O QPCDCPDFJACHGM-UHFFFAOYSA-N 0.000 claims description 2
- YDONNITUKPKTIG-UHFFFAOYSA-N [Nitrilotris(methylene)]trisphosphonic acid Chemical compound OP(O)(=O)CN(CP(O)(O)=O)CP(O)(O)=O YDONNITUKPKTIG-UHFFFAOYSA-N 0.000 claims description 2
- 229960003330 pentetic acid Drugs 0.000 claims description 2
- 125000000217 alkyl group Chemical group 0.000 claims 1
- 239000007864 aqueous solution Substances 0.000 claims 1
- 239000000470 constituent Substances 0.000 claims 1
- 238000010979 pH adjustment Methods 0.000 claims 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 9
- 239000000908 ammonium hydroxide Substances 0.000 description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 238000005406 washing Methods 0.000 description 6
- 229910019142 PO4 Inorganic materials 0.000 description 4
- -1 ammonium ions Chemical class 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 239000003599 detergent Substances 0.000 description 4
- 150000002500 ions Chemical class 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 230000009286 beneficial effect Effects 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 229910017604 nitric acid Inorganic materials 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 2
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000012190 activator Substances 0.000 description 2
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 2
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 2
- 235000011130 ammonium sulphate Nutrition 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000003247 decreasing effect Effects 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 150000002823 nitrates Chemical class 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000011121 sodium hydroxide Nutrition 0.000 description 2
- 239000003381 stabilizer Substances 0.000 description 2
- 239000002023 wood Substances 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- 102100033070 Histone acetyltransferase KAT6B Human genes 0.000 description 1
- 101000944174 Homo sapiens Histone acetyltransferase KAT6B Proteins 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- ABLZXFCXXLZCGV-UHFFFAOYSA-N Phosphorous acid Chemical compound OP(O)=O ABLZXFCXXLZCGV-UHFFFAOYSA-N 0.000 description 1
- 241000711981 Sais Species 0.000 description 1
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000003915 air pollution Methods 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 210000000709 aorta Anatomy 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 239000002738 chelating agent Substances 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- XQRLCLUYWUNEEH-UHFFFAOYSA-N diphosphonic acid Chemical compound OP(=O)OP(O)=O XQRLCLUYWUNEEH-UHFFFAOYSA-N 0.000 description 1
- SFXJSNATBHJIDS-UHFFFAOYSA-N disodium;dioxido(oxo)tin;trihydrate Chemical compound O.O.O.[Na+].[Na+].[O-][Sn]([O-])=O SFXJSNATBHJIDS-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 238000004453 electron probe microanalysis Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000002979 fabric softener Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 230000002070 germicidal effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009897 hydrogen peroxide bleaching Methods 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 238000010409 ironing Methods 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- KJPHTXTWFHVJIG-UHFFFAOYSA-N n-ethyl-2-[(6-methoxypyridin-3-yl)-(2-methylphenyl)sulfonylamino]-n-(pyridin-3-ylmethyl)acetamide Chemical compound C=1C=C(OC)N=CC=1N(S(=O)(=O)C=1C(=CC=CC=1)C)CC(=O)N(CC)CC1=CC=CN=C1 KJPHTXTWFHVJIG-UHFFFAOYSA-N 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- 229940071182 stannate Drugs 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
Classifications
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/10—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen
- D06L4/12—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen combined with specific additives
Landscapes
- Engineering & Computer Science (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00268051A US3811833A (en) | 1972-06-30 | 1972-06-30 | Stabilized hydrogen peroxide compositions containing ammonium ions,and process for bleaching therewith |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2333201A1 true DE2333201A1 (de) | 1974-01-24 |
Family
ID=23021260
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19732333201 Pending DE2333201A1 (de) | 1972-06-30 | 1973-06-29 | Bleichverfahren und -mittel |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3811833A (enExample) |
| JP (1) | JPS4952784A (enExample) |
| BE (1) | BE801681A (enExample) |
| CA (1) | CA1003605A (enExample) |
| DE (1) | DE2333201A1 (enExample) |
| FR (1) | FR2190912B1 (enExample) |
| GB (1) | GB1419184A (enExample) |
| IT (1) | IT990818B (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2274105A (en) * | 1992-11-27 | 1994-07-13 | Unilever Plc | Bleaching process. |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2506799B2 (de) * | 1975-02-18 | 1977-03-31 | Basf Ag, 6700 Ludwigshafen | Verfahren zur stabilisierung alkalischer, silikat und erdalkalimetallhaltige peroxidstabilisatoren enthaltender peroxidbleichflotten |
| US4238192A (en) * | 1979-01-22 | 1980-12-09 | S. C. Johnson & Son, Inc. | Hydrogen peroxide bleach composition |
| JPS55103362A (en) * | 1979-01-26 | 1980-08-07 | Mitsubishi Gas Chemical Co | Bleaching of fibrous substance by hydrogen peroxide |
| CA1156404A (en) * | 1980-04-01 | 1983-11-08 | Eileen Smith | Aqueous bleach compositions |
| US4362639A (en) * | 1981-04-03 | 1982-12-07 | Warner-Lambert Company | Cleanser with improved afterodor and tarnish resistance |
| JPS60212500A (ja) * | 1984-04-06 | 1985-10-24 | 三井東圧化学株式会社 | 過酸化水素漂白方法およびそれに用いる漂白剤組成物 |
| JPS6160799A (ja) * | 1984-08-31 | 1986-03-28 | 株式会社東芝 | 洗浄液 |
| US4847089A (en) * | 1986-07-16 | 1989-07-11 | David N. Kramer | Cleansing and distinfecting compositions, including bleaching agents, and sponges and other applicators incorporating the same |
| US5348556A (en) * | 1988-06-14 | 1994-09-20 | Basf Corporation | Volatile carpet sanitizing shampoo containing hydrogen peroxide |
| TR24867A (tr) * | 1989-08-23 | 1992-07-01 | Unilever Nv | CAMASIR MUAMELE MAMULü |
| JP2602563B2 (ja) * | 1989-12-15 | 1997-04-23 | 花王株式会社 | 液体酸素系漂白剤組成物 |
| US5006124A (en) | 1989-12-15 | 1991-04-09 | Fmc Corporation | Wet processing of denim |
| US5259848A (en) * | 1990-06-11 | 1993-11-09 | Interface, Inc. | Method for removing stains from carpet and textiles |
| US5736497A (en) * | 1995-05-05 | 1998-04-07 | Degussa Corporation | Phosphorus free stabilized alkaline peroxygen solutions |
| US5814304A (en) * | 1996-08-02 | 1998-09-29 | Colgate Palmolive Company | Stable aqueous abrasive peroxide tooth whitening dentifrice |
| US20040244871A1 (en) * | 2003-06-04 | 2004-12-09 | Min-Ju Chung | Method for forming a colored red oak product |
| EP3427719B1 (en) * | 2017-07-14 | 2024-03-06 | Kao Germany GmbH | Aqueous bleaching and dyeing composition for keratin fibers, process, kit and use thereof |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3687627A (en) * | 1970-06-25 | 1972-08-29 | Du Pont | Stabilized hydrogen peroxide solutions |
-
1972
- 1972-06-30 US US00268051A patent/US3811833A/en not_active Expired - Lifetime
-
1973
- 1973-06-13 CA CA173,982A patent/CA1003605A/en not_active Expired
- 1973-06-28 IT IT26029/73A patent/IT990818B/it active
- 1973-06-29 DE DE19732333201 patent/DE2333201A1/de active Pending
- 1973-06-29 BE BE132921A patent/BE801681A/xx unknown
- 1973-06-29 FR FR7323905A patent/FR2190912B1/fr not_active Expired
- 1973-06-30 JP JP48073343A patent/JPS4952784A/ja active Pending
- 1973-07-02 GB GB3149373A patent/GB1419184A/en not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2274105A (en) * | 1992-11-27 | 1994-07-13 | Unilever Plc | Bleaching process. |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2190912A1 (enExample) | 1974-02-01 |
| GB1419184A (en) | 1975-12-24 |
| BE801681A (fr) | 1973-10-15 |
| IT990818B (it) | 1975-07-10 |
| CA1003605A (en) | 1977-01-18 |
| FR2190912B1 (enExample) | 1977-02-18 |
| JPS4952784A (enExample) | 1974-05-22 |
| US3811833A (en) | 1974-05-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2333201A1 (de) | Bleichverfahren und -mittel | |
| DE2226784C3 (de) | Mittel zum Stabilisieren von Peroxyverbindungen in wäßrig-alkalischer Lösung und seine Verwendung | |
| DE2207979C2 (de) | Trockenes Bleichmittel auf der Basis von Peroxy-Bleichverbindungen | |
| DE1519484A1 (de) | Stabilisatoren fuer Loesungen von Peroxyverbindungen | |
| DE1444024A1 (de) | Bleich- und Reinigungsmittel | |
| DE2933969C2 (de) | N-(Hydroxymethyl)-aminoalkan-diphosphonsäuren sowie diese Verbindungen enthaltende Stabilisatoren | |
| DE2420009C3 (enExample) | ||
| DE2849717A1 (de) | Bleichmittelzusammensetzung, die keine farbveraenderung oder ausbleichen von gefaerbten oder gemusterten geweben verursacht | |
| DE2506799B2 (de) | Verfahren zur stabilisierung alkalischer, silikat und erdalkalimetallhaltige peroxidstabilisatoren enthaltender peroxidbleichflotten | |
| DE69601591T2 (de) | Phosphorfreie stabilisierte alkalische Peroxylösungen | |
| DE2530539C3 (de) | Addukt aus Natriumsulfat, Wasserstoffperoxyd und Natriumchlorid und dessen Verwendung | |
| DE1617161A1 (de) | Verstaerkungsmittel fuer synthetische Detergentien | |
| DE1815170A1 (de) | Herstellung und Verwendung von aliphatische Carbonsaeuren als Oxydationsbeschleuniger enthaltenden Peroxymonosulfat-Zusammensetzungen | |
| DE69206291T2 (de) | Färbebadzusatzstoffe und Verfahren zum Färben eines Gewebes. | |
| DE2510184A1 (de) | Schaeumende bleichmittelmischung | |
| DE2214500C2 (de) | Bleichendes Waschmittel | |
| DE721317C (de) | Verfahren zum Stabilisieren von Perverbindungen enthaltenden Textilbehandlungsflotten | |
| DE1289815B (de) | Stabile waessrige Bleichmittelloesung | |
| CH676256A5 (enExample) | ||
| DE3009473A1 (de) | Natriumhydrosulfitzusammensetzung | |
| DE2453982A1 (de) | Waschmittelmischung | |
| DE69329089T2 (de) | Basische Silikatlösung | |
| DE69312434T2 (de) | Verfahren zum Erhöhen der Bleichwirksamkeit eines anorganischen Persalts oder Wasserstoffperoxids | |
| DE2456212C3 (de) | Pulverförmige Reinigungsmittel-Mischung | |
| DE1060849B (de) | Stabilisierung von Perborat |