DE2331960A1 - Verfahren zur herstellung von diphenylamin und derivaten davon - Google Patents
Verfahren zur herstellung von diphenylamin und derivaten davonInfo
- Publication number
- DE2331960A1 DE2331960A1 DE2331960A DE2331960A DE2331960A1 DE 2331960 A1 DE2331960 A1 DE 2331960A1 DE 2331960 A DE2331960 A DE 2331960A DE 2331960 A DE2331960 A DE 2331960A DE 2331960 A1 DE2331960 A1 DE 2331960A1
- Authority
- DE
- Germany
- Prior art keywords
- carried out
- reaction
- silicon dioxide
- oxygen
- diphenylamine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 title claims description 22
- 238000000034 method Methods 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title description 4
- 238000006243 chemical reaction Methods 0.000 claims description 18
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 17
- 239000003054 catalyst Substances 0.000 claims description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 9
- 239000000377 silicon dioxide Substances 0.000 claims description 7
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 5
- 239000001301 oxygen Substances 0.000 claims description 5
- 229910052760 oxygen Inorganic materials 0.000 claims description 5
- 235000012239 silicon dioxide Nutrition 0.000 claims description 5
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 claims description 4
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 3
- 150000001412 amines Chemical class 0.000 claims description 3
- 239000003153 chemical reaction reagent Substances 0.000 claims description 3
- 229910052710 silicon Inorganic materials 0.000 claims description 3
- 239000010703 silicon Substances 0.000 claims description 3
- -1 Steam Chemical compound 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 229910052786 argon Inorganic materials 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- 150000001875 compounds Chemical class 0.000 claims description 2
- 239000007789 gas Substances 0.000 claims description 2
- 229910052736 halogen Inorganic materials 0.000 claims description 2
- 150000002367 halogens Chemical class 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 239000003701 inert diluent Substances 0.000 claims description 2
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 2
- 229910052753 mercury Inorganic materials 0.000 claims description 2
- 229910052751 metal Inorganic materials 0.000 claims description 2
- 239000002184 metal Substances 0.000 claims description 2
- 150000002739 metals Chemical class 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 claims description 2
- 230000000737 periodic effect Effects 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 108090000623 proteins and genes Proteins 0.000 claims description 2
- 229930195734 saturated hydrocarbon Natural products 0.000 claims description 2
- 150000002466 imines Chemical class 0.000 description 13
- 229940035422 diphenylamine Drugs 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- 239000000463 material Substances 0.000 description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 description 3
- 229910001882 dioxygen Inorganic materials 0.000 description 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- RPFGCUFAJAQNLJ-UHFFFAOYSA-N n-phenylcyclohexanimine Chemical compound C1CCCCC1=NC1=CC=CC=C1 RPFGCUFAJAQNLJ-UHFFFAOYSA-N 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000012808 vapor phase Substances 0.000 description 2
- VPRIGCVCJPKVFZ-UHFFFAOYSA-N 4-chloro-n-phenylaniline Chemical compound C1=CC(Cl)=CC=C1NC1=CC=CC=C1 VPRIGCVCJPKVFZ-UHFFFAOYSA-N 0.000 description 1
- OBHGSIGHEBGGFS-UHFFFAOYSA-N 4-methoxy-n-phenylaniline Chemical compound C1=CC(OC)=CC=C1NC1=CC=CC=C1 OBHGSIGHEBGGFS-UHFFFAOYSA-N 0.000 description 1
- 229910004298 SiO 2 Inorganic materials 0.000 description 1
- HHUIAYDQMNHELC-UHFFFAOYSA-N [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O Chemical compound [O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O HHUIAYDQMNHELC-UHFFFAOYSA-N 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 238000000889 atomisation Methods 0.000 description 1
- 229940075614 colloidal silicon dioxide Drugs 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- ONWDRYHADDRYDR-UHFFFAOYSA-N n-(4-methoxyphenyl)cyclohexanimine Chemical compound C1=CC(OC)=CC=C1N=C1CCCCC1 ONWDRYHADDRYDR-UHFFFAOYSA-N 0.000 description 1
- KUDPGZONDFORKU-UHFFFAOYSA-N n-chloroaniline Chemical compound ClNC1=CC=CC=C1 KUDPGZONDFORKU-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 102220080905 rs780280433 Human genes 0.000 description 1
- 238000002317 scanning near-field acoustic microscopy Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/68—Preparation of compounds containing amino groups bound to a carbon skeleton from amines, by reactions not involving amino groups, e.g. reduction of unsaturated amines, aromatisation, or substitution of the carbon skeleton
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Catalysts (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT26169/72A IT961239B (it) | 1972-06-24 | 1972-06-24 | Processo per la produzione di difenilammina e suoi derivati |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2331960A1 true DE2331960A1 (de) | 1974-01-10 |
Family
ID=11218819
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2331960A Pending DE2331960A1 (de) | 1972-06-24 | 1973-06-22 | Verfahren zur herstellung von diphenylamin und derivaten davon |
Country Status (27)
| Country | Link |
|---|---|
| JP (1) | JPS4949924A (https=) |
| AR (1) | AR197133A1 (https=) |
| AT (1) | AT323716B (https=) |
| AU (1) | AU477211B2 (https=) |
| BE (1) | BE801095A (https=) |
| BG (1) | BG25983A3 (https=) |
| BR (1) | BR7304613D0 (https=) |
| CA (1) | CA998692A (https=) |
| CH (1) | CH574901A5 (https=) |
| DD (1) | DD104507A5 (https=) |
| DE (1) | DE2331960A1 (https=) |
| EG (2) | EG11382A (https=) |
| ES (1) | ES416625A1 (https=) |
| FR (1) | FR2189376B1 (https=) |
| GB (1) | GB1426929A (https=) |
| IE (1) | IE38690B1 (https=) |
| IT (1) | IT961239B (https=) |
| LU (1) | LU67837A1 (https=) |
| NL (1) | NL152542B (https=) |
| NO (1) | NO137193C (https=) |
| PH (1) | PH9588A (https=) |
| PL (1) | PL81085B1 (https=) |
| RO (1) | RO62808A (https=) |
| SE (1) | SE396595B (https=) |
| TR (1) | TR17184A (https=) |
| ZA (1) | ZA733780B (https=) |
| ZM (1) | ZM9973A1 (https=) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4100514A1 (de) * | 1991-01-10 | 1992-07-16 | Bayer Ag | Verfahren zur herstellung von diphenylaminen |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA1244836A (en) * | 1984-03-14 | 1988-11-15 | Teruyuki Nagata | Process for producing diphenylamines or n,n'-diphenyl- phenylenediamines |
| JPS60193949A (ja) * | 1984-03-14 | 1985-10-02 | Mitsui Toatsu Chem Inc | ジフエニルアミンまたはその核置換体の製造方法 |
| US5536878A (en) * | 1992-08-11 | 1996-07-16 | Mitsui Toatsu Chemicals, Inc. | Method for preparing aromatic secondary amino compound |
| US5382690A (en) * | 1992-08-11 | 1995-01-17 | Mitsui Toatsu Chemicals, Incorporated | Method for preparing aromatic secondary amino compound |
| KR100193156B1 (ko) * | 1992-10-28 | 1999-06-15 | 사또 아끼오 | 디페닐아민 또는 그의 핵-치환 유도체의 제조 방법 |
-
1972
- 1972-06-24 IT IT26169/72A patent/IT961239B/it active
-
1973
- 1973-04-04 AR AR247398A patent/AR197133A1/es active
- 1973-05-16 AU AU55762/73A patent/AU477211B2/en not_active Expired
- 1973-05-22 TR TR17184A patent/TR17184A/xx unknown
- 1973-05-27 EG EG196/73A patent/EG11382A/xx active
- 1973-05-29 EG EG202/73A patent/EG11504A/xx active
- 1973-06-05 ZA ZA733780A patent/ZA733780B/xx unknown
- 1973-06-05 BG BG023797A patent/BG25983A3/xx unknown
- 1973-06-06 IE IE912/73A patent/IE38690B1/xx unknown
- 1973-06-11 RO RO7300075103A patent/RO62808A/ro unknown
- 1973-06-12 GB GB2797273A patent/GB1426929A/en not_active Expired
- 1973-06-15 PH PH14728*UA patent/PH9588A/en unknown
- 1973-06-18 FR FR7322028A patent/FR2189376B1/fr not_active Expired
- 1973-06-19 BE BE1005173A patent/BE801095A/xx unknown
- 1973-06-20 LU LU67837A patent/LU67837A1/xx unknown
- 1973-06-20 BR BR4613/73A patent/BR7304613D0/pt unknown
- 1973-06-21 NO NO732573A patent/NO137193C/no unknown
- 1973-06-21 CH CH900273A patent/CH574901A5/xx not_active IP Right Cessation
- 1973-06-21 CA CA174,597A patent/CA998692A/en not_active Expired
- 1973-06-21 SE SE7308846A patent/SE396595B/xx unknown
- 1973-06-22 AT AT552673A patent/AT323716B/de not_active IP Right Cessation
- 1973-06-22 JP JP48069953A patent/JPS4949924A/ja active Pending
- 1973-06-22 DE DE2331960A patent/DE2331960A1/de active Pending
- 1973-06-22 DD DD171771A patent/DD104507A5/xx unknown
- 1973-06-23 ES ES416625A patent/ES416625A1/es not_active Expired
- 1973-06-25 NL NL737308823A patent/NL152542B/xx unknown
- 1973-06-26 PL PL1973163513A patent/PL81085B1/pl unknown
- 1973-07-01 ZM ZM99/73*7A patent/ZM9973A1/xx unknown
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE4100514A1 (de) * | 1991-01-10 | 1992-07-16 | Bayer Ag | Verfahren zur herstellung von diphenylaminen |
Also Published As
| Publication number | Publication date |
|---|---|
| AT323716B (de) | 1975-07-25 |
| TR17184A (tr) | 1974-04-25 |
| AU5576273A (en) | 1974-11-21 |
| JPS4949924A (https=) | 1974-05-15 |
| BG25983A3 (bg) | 1979-01-12 |
| PL81085B1 (https=) | 1975-08-30 |
| IE38690L (en) | 1973-12-24 |
| CA998692A (en) | 1976-10-19 |
| NO137193B (no) | 1977-10-10 |
| AR197133A1 (es) | 1974-03-15 |
| EG11504A (en) | 1977-08-15 |
| BE801095A (fr) | 1973-10-15 |
| NL152542B (nl) | 1977-03-15 |
| FR2189376A1 (https=) | 1974-01-25 |
| IE38690B1 (en) | 1978-05-10 |
| NL7308823A (https=) | 1973-12-28 |
| BR7304613D0 (pt) | 1974-08-29 |
| GB1426929A (en) | 1976-03-03 |
| ZM9973A1 (https=) | 1974-05-21 |
| EG11382A (en) | 1977-12-31 |
| FR2189376B1 (https=) | 1976-06-11 |
| SE396595B (sv) | 1977-09-26 |
| ES416625A1 (es) | 1976-02-01 |
| NO137193C (no) | 1978-01-18 |
| PH9588A (en) | 1976-01-19 |
| DD104507A5 (https=) | 1974-03-12 |
| ZA733780B (en) | 1974-05-29 |
| IT961239B (it) | 1973-12-10 |
| RO62808A (fr) | 1977-10-15 |
| AU477211B2 (en) | 1976-10-21 |
| CH574901A5 (https=) | 1976-04-30 |
| LU67837A1 (https=) | 1973-08-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2350212C3 (de) | Verfahren zur Herstellung von Cyanwasserstoff | |
| US3644522A (en) | Catalytic hydrogenation of nitrogen containing compounds over supported ruthenium catalysts | |
| DE1289530B (de) | Verfahren zur Herstellung von Aminobenzolen | |
| DE2138692A1 (de) | Verfahren zur Herstellung von Maiein saureanhydnd | |
| DE2331960A1 (de) | Verfahren zur herstellung von diphenylamin und derivaten davon | |
| CH628060A5 (de) | Verfahren zur herstellung von silicium-stickstoff-verbindungen. | |
| DE2331878A1 (de) | Verfahren zur herstellung von diphenylamin und dessen derivaten | |
| EP3004041B1 (de) | Verfahren zur herstellung von acrolein | |
| DE2303383A1 (de) | Verfahren zur herstellung ungesaettigter saeuren | |
| DE2335906B2 (de) | Verfahren zur kontinuierlichen herstellung von n-alkylarylaminen | |
| DE69019301T2 (de) | Herstellungsverfahren von Indolen. | |
| EP0059907B1 (de) | Verfahren zur Herstellung von Hydroxylammoniumsalzen | |
| DE2223018A1 (de) | Verfahren zur Herstellung stickstoffhaltiger heterocyclischer Verbindungen | |
| DE2264529A1 (de) | Verfahren zur synthese von diolefinen | |
| WO2019192903A1 (de) | Verfahren zur herstellung von aminen | |
| DE3811849A1 (de) | Verfahren zur herstellung von tertiaerem butanol | |
| DE60122104T2 (de) | Einstufige Hydrierung von Nitrobenzol zu p-Aminophenol | |
| DE2143846A1 (de) | Verfahren zur Herstellung von heterocyclischen Verbindungen | |
| DE2013948A1 (de) | Verfahren zur Herstellung von hexagonalem Bornitrid | |
| DE1161874B (de) | Verfahren zur Herstellung von aromatischen Nitrilen | |
| DE2161450A1 (https=) | ||
| DE2154482C3 (de) | Verfahren zur Herstellung von Indolderivaten | |
| DE441433C (de) | Verfahren zur Gewinnung organischer Verbindungen durch katalytische Gasreaktionen | |
| DE19647795A1 (de) | Verfahren zur Herstellung aromatischer Nitrile | |
| DE2211194C3 (de) | Katalysator und Verfahren zur Herstellung von Methacrylnitril aus Isobuten |