DE2329923C3 - Verfahren zur Herstellung von 5-Oxohexannitri! - Google Patents
Verfahren zur Herstellung von 5-Oxohexannitri!Info
- Publication number
- DE2329923C3 DE2329923C3 DE2329923A DE2329923A DE2329923C3 DE 2329923 C3 DE2329923 C3 DE 2329923C3 DE 2329923 A DE2329923 A DE 2329923A DE 2329923 A DE2329923 A DE 2329923A DE 2329923 C3 DE2329923 C3 DE 2329923C3
- Authority
- DE
- Germany
- Prior art keywords
- acrylonitrile
- acetone
- water
- percent
- weight
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 7
- 238000002360 preparation method Methods 0.000 title claims description 3
- -1 5-oxohexane nitride Chemical class 0.000 title 1
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 58
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 27
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 20
- 238000006243 chemical reaction Methods 0.000 claims description 15
- AEVMBQIIZGKQRB-UHFFFAOYSA-N 5-oxohexanenitrile Chemical compound CC(=O)CCCC#N AEVMBQIIZGKQRB-UHFFFAOYSA-N 0.000 claims description 14
- 239000011541 reaction mixture Substances 0.000 claims description 8
- 239000002253 acid Substances 0.000 claims description 6
- 125000002924 primary amino group Chemical class [H]N([H])* 0.000 claims 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 11
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 8
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 8
- 150000003141 primary amines Chemical class 0.000 description 7
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Chemical compound CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 6
- 150000002576 ketones Chemical class 0.000 description 5
- 239000005711 Benzoic acid Substances 0.000 description 4
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 4
- 235000010233 benzoic acid Nutrition 0.000 description 4
- 239000003054 catalyst Substances 0.000 description 4
- 238000007278 cyanoethylation reaction Methods 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- OZXIZRZFGJZWBF-UHFFFAOYSA-N 1,3,5-trimethyl-2-(2,4,6-trimethylphenoxy)benzene Chemical compound CC1=CC(C)=CC(C)=C1OC1=C(C)C=C(C)C=C1C OZXIZRZFGJZWBF-UHFFFAOYSA-N 0.000 description 2
- XBAXAJAODIQLCI-UHFFFAOYSA-N 3-(propan-2-ylamino)propanenitrile Chemical compound CC(C)NCCC#N XBAXAJAODIQLCI-UHFFFAOYSA-N 0.000 description 2
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical compound NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 150000004658 ketimines Chemical class 0.000 description 2
- SHOJXDKTYKFBRD-UHFFFAOYSA-N mesityl oxide Natural products CC(C)=CC(C)=O SHOJXDKTYKFBRD-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000000203 mixture Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- NZQWLOOEEUGXBA-UHFFFAOYSA-N 1,4-dioxane-2-carbonitrile Chemical compound N#CC1COCCO1 NZQWLOOEEUGXBA-UHFFFAOYSA-N 0.000 description 1
- NTFJXDRAVMOYBG-UHFFFAOYSA-N 2-(2,2-dicyanoethoxymethyl)propanedinitrile Chemical compound N#CC(C#N)COCC(C#N)C#N NTFJXDRAVMOYBG-UHFFFAOYSA-N 0.000 description 1
- BSKHPKMHTQYZBB-UHFFFAOYSA-N 2-methylpyridine Chemical compound CC1=CC=CC=N1 BSKHPKMHTQYZBB-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- WOFDVDFSGLBFAC-UHFFFAOYSA-N lactonitrile Chemical compound CC(O)C#N WOFDVDFSGLBFAC-UHFFFAOYSA-N 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- DPBLXKKOBLCELK-UHFFFAOYSA-N pentan-1-amine Chemical compound CCCCCN DPBLXKKOBLCELK-UHFFFAOYSA-N 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- XDAGXZXKTKRFMT-UHFFFAOYSA-N propan-2-imine Chemical class CC(C)=N XDAGXZXKTKRFMT-UHFFFAOYSA-N 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 239000012048 reactive intermediate Substances 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C255/00—Carboxylic acid nitriles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (12)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329923A DE2329923C3 (de) | 1973-06-13 | 1973-06-13 | Verfahren zur Herstellung von 5-Oxohexannitri! |
| ZA00743473A ZA743473B (en) | 1973-06-13 | 1974-05-30 | Process for preparing 5-oxohexanenitrile |
| CA201,306A CA1024995A (en) | 1973-06-13 | 1974-05-30 | Process for preparing 5-oxohexane-nitrile |
| NL7407681A NL7407681A (enExample) | 1973-06-13 | 1974-06-07 | |
| CH790274A CH602604A5 (enExample) | 1973-06-13 | 1974-06-10 | |
| US05/478,263 US3931278A (en) | 1973-06-13 | 1974-06-11 | Process for preparing 5-oxohexane-nitrile |
| JP49065652A JPS5761031B2 (enExample) | 1973-06-13 | 1974-06-11 | |
| IT23882/74A IT1014978B (it) | 1973-06-13 | 1974-06-11 | Processo per la preparazione di 5 ossoesannitrile |
| GB2605474A GB1476341A (en) | 1973-06-13 | 1974-06-12 | 5-oxohexane-nitrile |
| BR4834/74A BR7404834D0 (pt) | 1973-06-13 | 1974-06-12 | Processo para a fabricacao de 5-oxohcxanonitrila |
| BE145394A BE816298A (fr) | 1973-06-13 | 1974-06-13 | Procede de preparation d'oxo-5 hexanenitrile |
| FR7420494A FR2233316B1 (enExample) | 1973-06-13 | 1974-06-13 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329923A DE2329923C3 (de) | 1973-06-13 | 1973-06-13 | Verfahren zur Herstellung von 5-Oxohexannitri! |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2329923A1 DE2329923A1 (de) | 1975-01-09 |
| DE2329923B2 DE2329923B2 (de) | 1979-05-23 |
| DE2329923C3 true DE2329923C3 (de) | 1980-01-17 |
Family
ID=5883778
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2329923A Expired DE2329923C3 (de) | 1973-06-13 | 1973-06-13 | Verfahren zur Herstellung von 5-Oxohexannitri! |
Country Status (12)
| Country | Link |
|---|---|
| US (1) | US3931278A (enExample) |
| JP (1) | JPS5761031B2 (enExample) |
| BE (1) | BE816298A (enExample) |
| BR (1) | BR7404834D0 (enExample) |
| CA (1) | CA1024995A (enExample) |
| CH (1) | CH602604A5 (enExample) |
| DE (1) | DE2329923C3 (enExample) |
| FR (1) | FR2233316B1 (enExample) |
| GB (1) | GB1476341A (enExample) |
| IT (1) | IT1014978B (enExample) |
| NL (1) | NL7407681A (enExample) |
| ZA (1) | ZA743473B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL7609478A (nl) * | 1976-08-26 | 1978-02-28 | Stamicarbon | Werkwijze voor de bereiding van 4-oxocaproni- tril. |
| NL7808605A (nl) * | 1978-08-19 | 1980-02-21 | Stamicarbon | Werkwijze voor de bereiding van delta-ketozuren en derivaten hiervan. |
| US4331549A (en) * | 1980-04-21 | 1982-05-25 | The Dow Chemical Company | Hydraulic fluids containing cyano derivatives of ketones |
| DE3047482A1 (de) * | 1980-12-17 | 1982-07-22 | Hoechst Ag, 6000 Frankfurt | Verfahren zur herstellung von 5-oxohexansaeurealkylester und 5-oxohexannitril |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2768962A (en) * | 1953-08-24 | 1956-10-30 | Bayer Ag | Process for the manufacture of 2-cyanoethylated n-substituted imines |
| DE1002342C2 (de) * | 1955-10-13 | 1957-07-18 | Bayer Ag | Verfahren zur Herstellung von ª‡-monocyanaethylierten Ketonen |
| NL6902028A (enExample) * | 1969-02-08 | 1970-08-11 | ||
| BE756580A (fr) * | 1969-09-26 | 1971-03-24 | Stamicarbon | Preparation de (2-cyano-ethyl)-cetones |
| NL7013453A (enExample) * | 1970-09-11 | 1972-03-14 | ||
| US3821274A (en) * | 1971-02-18 | 1974-06-28 | Stamicarbon | Process for preparing 2-(beta-cyanoethyl)-n-substituted acetaldimines |
| NL7102202A (enExample) * | 1971-02-19 | 1972-08-22 | ||
| BE789235A (fr) * | 1971-09-29 | 1973-03-26 | Stamicarbon | Procede pour la preparation de (2-cyano-ethyl)-cetones |
| NL7207939A (enExample) * | 1972-06-12 | 1973-12-14 |
-
1973
- 1973-06-13 DE DE2329923A patent/DE2329923C3/de not_active Expired
-
1974
- 1974-05-30 ZA ZA00743473A patent/ZA743473B/xx unknown
- 1974-05-30 CA CA201,306A patent/CA1024995A/en not_active Expired
- 1974-06-07 NL NL7407681A patent/NL7407681A/xx not_active Application Discontinuation
- 1974-06-10 CH CH790274A patent/CH602604A5/xx not_active IP Right Cessation
- 1974-06-11 US US05/478,263 patent/US3931278A/en not_active Expired - Lifetime
- 1974-06-11 IT IT23882/74A patent/IT1014978B/it active
- 1974-06-11 JP JP49065652A patent/JPS5761031B2/ja not_active Expired
- 1974-06-12 GB GB2605474A patent/GB1476341A/en not_active Expired
- 1974-06-12 BR BR4834/74A patent/BR7404834D0/pt unknown
- 1974-06-13 FR FR7420494A patent/FR2233316B1/fr not_active Expired
- 1974-06-13 BE BE145394A patent/BE816298A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IT1014978B (it) | 1977-04-30 |
| US3931278A (en) | 1976-01-06 |
| FR2233316B1 (enExample) | 1977-10-07 |
| DE2329923B2 (de) | 1979-05-23 |
| DE2329923A1 (de) | 1975-01-09 |
| JPS5035112A (enExample) | 1975-04-03 |
| ZA743473B (en) | 1975-05-28 |
| JPS5761031B2 (enExample) | 1982-12-22 |
| NL7407681A (enExample) | 1974-12-17 |
| GB1476341A (en) | 1977-06-10 |
| CA1024995A (en) | 1978-01-24 |
| CH602604A5 (enExample) | 1978-07-31 |
| FR2233316A1 (enExample) | 1975-01-10 |
| BE816298A (fr) | 1974-12-13 |
| BR7404834D0 (pt) | 1975-01-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0058927B1 (de) | Verfahren zur Herstellung von alpha-Alkylacroleinen | |
| DE2855504B2 (de) | Verfahren zur Herstellung von Methacrolein | |
| DE69206250T2 (de) | Verfahren zur herstellung von nitrilen. | |
| DE2329923C3 (de) | Verfahren zur Herstellung von 5-Oxohexannitri! | |
| EP0352504B1 (de) | Verfahren zur gemeinschaftlichen Herstellung von 3-Dialkylaminopropionitrilen, Bis-(2-cyanoethyl)-ether und gewünschtenfalls Ethylencyanhydrin | |
| DE3025350A1 (de) | Verfahren zur herstellung von 2-methylenaldehyden | |
| DE69028833T2 (de) | Verfahren zur herstellung ungesättigter ketone | |
| DE1014089B (de) | Verfahren zur Herstellung von 2,2-Dimethylpropandiol-(1,3) | |
| DE2715208C3 (de) | Verfahren zur Herstellung von 3-Methyl-2-buten-l-al | |
| DE3884495T2 (de) | Alkoholkondensierungsverfahren. | |
| EP0135833A2 (de) | Verfahren zur Herstellung von 2-Amino-alkylpyridinen | |
| DE2246284A1 (de) | Verfahren zur herstellung cyanaethylierter ketone | |
| DE2348536C3 (de) | Verfahren zur Herstellung von 5-Oxocarbonsäuren | |
| DE1793512A1 (de) | Verfahren zur Herstellung von 2,2-Dimethyl-3-hydroxypropanal | |
| DE2430192A1 (de) | Verfahren zur herstellung von ungesaettigten ketonen | |
| DE2540972A1 (de) | Verfahren zur herstellung von 5-oxohexansaeure und deren derivaten | |
| DE2217494C2 (de) | Verfahren zur Herstellung von Alkoxypropionitrilen | |
| DE3128575A1 (de) | "verfahren zur herstellung von n,3-disubstituierten propanamiden" | |
| DE2005515B2 (de) | Verfahren zur Herstellung von γ -Cyanburyraldiminen | |
| DE922167C (de) | Verfahren zur Herstellung von Cyclohexylidencyclohexanonen | |
| DE2109267C3 (de) | Herstellung N-substituierter Acetaldimine | |
| DE2940256A1 (de) | N,n-dimethyl-n'-(beta)-hydroxyethyl-propylendiamin und verfahren zu seiner herstellung | |
| DE637730C (de) | Verfahren zur Herstellung von N-Alkylderivaten des Ammoniaks | |
| AT274760B (de) | Verfahren zur Herstellung von Alkoholen | |
| DE3402997A1 (de) | Verfahren zur herstellung von 3-n-dialkylaminophenolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |