DE2329585C2 - Polycarbonat-Formmassen - Google Patents
Polycarbonat-FormmassenInfo
- Publication number
- DE2329585C2 DE2329585C2 DE2329585A DE2329585A DE2329585C2 DE 2329585 C2 DE2329585 C2 DE 2329585C2 DE 2329585 A DE2329585 A DE 2329585A DE 2329585 A DE2329585 A DE 2329585A DE 2329585 C2 DE2329585 C2 DE 2329585C2
- Authority
- DE
- Germany
- Prior art keywords
- weight
- polycarbonate
- styrene
- rubber
- polymer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004417 polycarbonate Substances 0.000 title claims description 134
- 229920000515 polycarbonate Polymers 0.000 title claims description 98
- 238000000465 moulding Methods 0.000 title claims description 25
- 150000001875 compounds Chemical class 0.000 title claims description 11
- 239000000203 mixture Substances 0.000 claims description 94
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 claims description 90
- 229920000642 polymer Polymers 0.000 claims description 68
- 229920001971 elastomer Polymers 0.000 claims description 66
- 239000005060 rubber Substances 0.000 claims description 66
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 30
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 claims description 28
- 239000000178 monomer Substances 0.000 claims description 19
- 229920001577 copolymer Polymers 0.000 claims description 16
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 claims description 13
- 229930185605 Bisphenol Natural products 0.000 claims description 13
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 claims description 13
- 229920005992 thermoplastic resin Polymers 0.000 claims description 10
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 9
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 claims description 7
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical compound COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 6
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 claims description 6
- GYCMBHHDWRMZGG-UHFFFAOYSA-N Methylacrylonitrile Chemical compound CC(=C)C#N GYCMBHHDWRMZGG-UHFFFAOYSA-N 0.000 claims description 5
- 125000005395 methacrylic acid group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 3
- 229920000459 Nitrile rubber Polymers 0.000 claims description 2
- NTXGQCSETZTARF-UHFFFAOYSA-N buta-1,3-diene;prop-2-enenitrile Chemical compound C=CC=C.C=CC#N NTXGQCSETZTARF-UHFFFAOYSA-N 0.000 claims description 2
- 238000009757 thermoplastic moulding Methods 0.000 claims description 2
- 229920003246 polypentenamer Polymers 0.000 claims 1
- 229920000122 acrylonitrile butadiene styrene Polymers 0.000 description 51
- 239000004676 acrylonitrile butadiene styrene Substances 0.000 description 51
- XECAHXYUAAWDEL-UHFFFAOYSA-N acrylonitrile butadiene styrene Chemical compound C=CC=C.C=CC#N.C=CC1=CC=CC=C1 XECAHXYUAAWDEL-UHFFFAOYSA-N 0.000 description 50
- 229920002959 polymer blend Polymers 0.000 description 46
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 35
- 239000002245 particle Substances 0.000 description 26
- 229920002857 polybutadiene Polymers 0.000 description 14
- 239000005062 Polybutadiene Substances 0.000 description 13
- 239000004793 Polystyrene Substances 0.000 description 13
- 238000012360 testing method Methods 0.000 description 13
- 229920000578 graft copolymer Polymers 0.000 description 12
- 238000002156 mixing Methods 0.000 description 12
- 229920002223 polystyrene Polymers 0.000 description 12
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 10
- 238000006116 polymerization reaction Methods 0.000 description 9
- 238000012545 processing Methods 0.000 description 9
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 238000007127 saponification reaction Methods 0.000 description 7
- -1 3,5-dimethyl-4-hydroxyphenyl Chemical group 0.000 description 6
- 229920002943 EPDM rubber Polymers 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000001788 irregular Effects 0.000 description 6
- 238000004519 manufacturing process Methods 0.000 description 6
- 230000008569 process Effects 0.000 description 6
- 239000001294 propane Substances 0.000 description 6
- 239000000243 solution Substances 0.000 description 6
- ODJUOZPKKHIEOZ-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 ODJUOZPKKHIEOZ-UHFFFAOYSA-N 0.000 description 5
- 229920000126 latex Polymers 0.000 description 5
- 239000000155 melt Substances 0.000 description 5
- HJZJMARGPNJHHG-UHFFFAOYSA-N 2,6-dimethyl-4-propylphenol Chemical compound CCCC1=CC(C)=C(O)C(C)=C1 HJZJMARGPNJHHG-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 4
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 235000011114 ammonium hydroxide Nutrition 0.000 description 4
- 230000001055 chewing effect Effects 0.000 description 4
- 238000009826 distribution Methods 0.000 description 4
- 238000002474 experimental method Methods 0.000 description 4
- 239000004816 latex Substances 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- SCUZVMOVTVSBLE-UHFFFAOYSA-N prop-2-enenitrile;styrene Chemical compound C=CC#N.C=CC1=CC=CC=C1 SCUZVMOVTVSBLE-UHFFFAOYSA-N 0.000 description 4
- 229920000638 styrene acrylonitrile Polymers 0.000 description 4
- 150000003440 styrenes Chemical class 0.000 description 4
- BTXXTMOWISPQSJ-UHFFFAOYSA-N 4,4,4-trifluorobutan-2-one Chemical compound CC(=O)CC(F)(F)F BTXXTMOWISPQSJ-UHFFFAOYSA-N 0.000 description 3
- BQACOLQNOUYJCE-FYZZASKESA-N Abietic acid Natural products CC(C)C1=CC2=CC[C@]3(C)[C@](C)(CCC[C@@]3(C)C(=O)O)[C@H]2CC1 BQACOLQNOUYJCE-FYZZASKESA-N 0.000 description 3
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 3
- 230000000052 comparative effect Effects 0.000 description 3
- 150000001993 dienes Chemical class 0.000 description 3
- 230000008014 freezing Effects 0.000 description 3
- 238000007710 freezing Methods 0.000 description 3
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 3
- 238000002347 injection Methods 0.000 description 3
- 239000007924 injection Substances 0.000 description 3
- 229920005989 resin Polymers 0.000 description 3
- 239000011347 resin Substances 0.000 description 3
- 159000000000 sodium salts Chemical class 0.000 description 3
- 238000003860 storage Methods 0.000 description 3
- 229920003051 synthetic elastomer Polymers 0.000 description 3
- 239000005061 synthetic rubber Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- MYRTYDVEIRVNKP-UHFFFAOYSA-N 1,2-Divinylbenzene Chemical compound C=CC1=CC=CC=C1C=C MYRTYDVEIRVNKP-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- SMZOUWXMTYCWNB-UHFFFAOYSA-N 2-(2-methoxy-5-methylphenyl)ethanamine Chemical compound COC1=CC=C(C)C=C1CCN SMZOUWXMTYCWNB-UHFFFAOYSA-N 0.000 description 2
- VEORPZCZECFIRK-UHFFFAOYSA-N 3,3',5,5'-tetrabromobisphenol A Chemical compound C=1C(Br)=C(O)C(Br)=CC=1C(C)(C)C1=CC(Br)=C(O)C(Br)=C1 VEORPZCZECFIRK-UHFFFAOYSA-N 0.000 description 2
- AZZWZMUXHALBCQ-UHFFFAOYSA-N 4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1 AZZWZMUXHALBCQ-UHFFFAOYSA-N 0.000 description 2
- CIIUIRUKNKELEO-UHFFFAOYSA-N 4-[2,5-di(propan-2-yl)phenyl]-2,6-dimethylphenol Chemical compound CC(C)C1=CC=C(C(C)C)C(C=2C=C(C)C(O)=C(C)C=2)=C1 CIIUIRUKNKELEO-UHFFFAOYSA-N 0.000 description 2
- RQQYPGZACLPRDX-UHFFFAOYSA-N 4-butyl-2,6-dimethylphenol Chemical compound CCCCC1=CC(C)=C(O)C(C)=C1 RQQYPGZACLPRDX-UHFFFAOYSA-N 0.000 description 2
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- BAPJBEWLBFYGME-UHFFFAOYSA-N Methyl acrylate Chemical compound COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 description 2
- 229920003006 Polybutadiene acrylonitrile Polymers 0.000 description 2
- 235000011034 Rubus glaucus Nutrition 0.000 description 2
- 244000235659 Rubus idaeus Species 0.000 description 2
- 235000009122 Rubus idaeus Nutrition 0.000 description 2
- 229920006328 Styrofoam Polymers 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- XYLMUPLGERFSHI-UHFFFAOYSA-N alpha-Methylstyrene Chemical compound CC(=C)C1=CC=CC=C1 XYLMUPLGERFSHI-UHFFFAOYSA-N 0.000 description 2
- 238000007098 aminolysis reaction Methods 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000011324 bead Substances 0.000 description 2
- 230000008901 benefit Effects 0.000 description 2
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 238000007334 copolymerization reaction Methods 0.000 description 2
- 238000005336 cracking Methods 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 238000007720 emulsion polymerization reaction Methods 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 230000009477 glass transition Effects 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 229920001519 homopolymer Polymers 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- 150000002736 metal compounds Chemical class 0.000 description 2
- 229920003052 natural elastomer Polymers 0.000 description 2
- 229920001194 natural rubber Polymers 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 229920003229 poly(methyl methacrylate) Polymers 0.000 description 2
- 239000004926 polymethyl methacrylate Substances 0.000 description 2
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 2
- 230000001376 precipitating effect Effects 0.000 description 2
- 230000035945 sensitivity Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 239000008261 styrofoam Substances 0.000 description 2
- PMJHHCWVYXUKFD-SNAWJCMRSA-N (E)-1,3-pentadiene Chemical group C\C=C\C=C PMJHHCWVYXUKFD-SNAWJCMRSA-N 0.000 description 1
- KTZVZZJJVJQZHV-UHFFFAOYSA-N 1-chloro-4-ethenylbenzene Chemical compound ClC1=CC=C(C=C)C=C1 KTZVZZJJVJQZHV-UHFFFAOYSA-N 0.000 description 1
- OMNYXCUDBQKCMU-UHFFFAOYSA-N 2,4-dichloro-1-ethenylbenzene Chemical compound ClC1=CC=C(C=C)C(Cl)=C1 OMNYXCUDBQKCMU-UHFFFAOYSA-N 0.000 description 1
- MAQOZOILPAMFSW-UHFFFAOYSA-N 2,6-bis[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=C(CC=3C(=CC=C(C)C=3)O)C=C(C)C=2)O)=C1 MAQOZOILPAMFSW-UHFFFAOYSA-N 0.000 description 1
- VXHYVVAUHMGCEX-UHFFFAOYSA-N 2-(2-hydroxyphenoxy)phenol Chemical class OC1=CC=CC=C1OC1=CC=CC=C1O VXHYVVAUHMGCEX-UHFFFAOYSA-N 0.000 description 1
- BLDLRWQLBOJPEB-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfanylphenol Chemical class OC1=CC=CC=C1SC1=CC=CC=C1O BLDLRWQLBOJPEB-UHFFFAOYSA-N 0.000 description 1
- XSVZEASGNTZBRQ-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfinylphenol Chemical class OC1=CC=CC=C1S(=O)C1=CC=CC=C1O XSVZEASGNTZBRQ-UHFFFAOYSA-N 0.000 description 1
- QUWAJPZDCZDTJS-UHFFFAOYSA-N 2-(2-hydroxyphenyl)sulfonylphenol Chemical class OC1=CC=CC=C1S(=O)(=O)C1=CC=CC=C1O QUWAJPZDCZDTJS-UHFFFAOYSA-N 0.000 description 1
- GOXQRTZXKQZDDN-UHFFFAOYSA-N 2-Ethylhexyl acrylate Chemical compound CCCCC(CC)COC(=O)C=C GOXQRTZXKQZDDN-UHFFFAOYSA-N 0.000 description 1
- AKNMPWVTPUHKCG-UHFFFAOYSA-N 2-cyclohexyl-6-[(3-cyclohexyl-2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound OC=1C(C2CCCCC2)=CC(C)=CC=1CC(C=1O)=CC(C)=CC=1C1CCCCC1 AKNMPWVTPUHKCG-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- KQSIVRHDEPHUII-UHFFFAOYSA-N 4-(4-hydroxy-3,5-dimethylphenoxy)-2,6-dimethylphenol Chemical class CC1=C(O)C(C)=CC(OC=2C=C(C)C(O)=C(C)C=2)=C1 KQSIVRHDEPHUII-UHFFFAOYSA-N 0.000 description 1
- JLBJTVDPSNHSKJ-UHFFFAOYSA-N 4-Methylstyrene Chemical compound CC1=CC=C(C=C)C=C1 JLBJTVDPSNHSKJ-UHFFFAOYSA-N 0.000 description 1
- KLSLBUSXWBJMEC-UHFFFAOYSA-N 4-Propylphenol Chemical compound CCCC1=CC=C(O)C=C1 KLSLBUSXWBJMEC-UHFFFAOYSA-N 0.000 description 1
- GFAPAUDMILQRBD-UHFFFAOYSA-N 4-[2,6-di(propan-2-yl)phenyl]-2,6-dimethylphenol Chemical compound CC=1C=C(C=C(C1O)C)C1=C(C=CC=C1C(C)C)C(C)C GFAPAUDMILQRBD-UHFFFAOYSA-N 0.000 description 1
- MGGVALXERJRIRO-UHFFFAOYSA-N 4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-2-[2-oxo-2-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethyl]-1H-pyrazol-5-one Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)O MGGVALXERJRIRO-UHFFFAOYSA-N 0.000 description 1
- SBBQPTIZYVMKFV-UHFFFAOYSA-N 4-[2-(4-hydroxy-3,5-dimethylphenyl)decan-2-yl]-2,6-dimethylphenol Chemical compound C=1C(C)=C(O)C(C)=CC=1C(C)(CCCCCCCC)C1=CC(C)=C(O)C(C)=C1 SBBQPTIZYVMKFV-UHFFFAOYSA-N 0.000 description 1
- XJGTVJRTDRARGO-UHFFFAOYSA-N 4-[2-(4-hydroxyphenyl)propan-2-yl]benzene-1,3-diol Chemical compound C=1C=C(O)C=C(O)C=1C(C)(C)C1=CC=C(O)C=C1 XJGTVJRTDRARGO-UHFFFAOYSA-N 0.000 description 1
- FDFQUUNJWPJSBQ-UHFFFAOYSA-N 4-[3-(4-hydroxy-3,5-dimethylphenyl)-3-methylbutyl]-2,6-dimethylphenol;4-[(4-hydroxy-3,5-dimethylphenyl)methyl]-2,6-dimethylphenol;4-[2-(4-hydroxy-3,5-dimethylphenyl)propan-2-yl]-2,6-dimethylphenol Chemical compound CC1=C(O)C(C)=CC(CC=2C=C(C)C(O)=C(C)C=2)=C1.CC1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1.CC1=C(O)C(C)=CC(CCC(C)(C)C=2C=C(C)C(O)=C(C)C=2)=C1 FDFQUUNJWPJSBQ-UHFFFAOYSA-N 0.000 description 1
- VRBCXGSFUDATQS-UHFFFAOYSA-N 4-[3-(4-hydroxy-3,5-dimethylphenyl)hexan-3-yl]-2,6-dimethylphenol Chemical compound C=1C(C)=C(O)C(C)=CC=1C(CC)(CCC)C1=CC(C)=C(O)C(C)=C1 VRBCXGSFUDATQS-UHFFFAOYSA-N 0.000 description 1
- PMZXJPLGCUVUDN-UHFFFAOYSA-N 4-ethenyl-1,2-dimethylbenzene Chemical compound CC1=CC=C(C=C)C=C1C PMZXJPLGCUVUDN-UHFFFAOYSA-N 0.000 description 1
- 101100029848 Arabidopsis thaliana PIP1-2 gene Proteins 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- JIGUQPWFLRLWPJ-UHFFFAOYSA-N Ethyl acrylate Chemical compound CCOC(=O)C=C JIGUQPWFLRLWPJ-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 244000043261 Hevea brasiliensis Species 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- FFCTVKPAIBWRDX-UHFFFAOYSA-N OC1=CC=C(C=C1)C1=C(C=CC(=C1)C(C)C)O Chemical compound OC1=CC=C(C=C1)C1=C(C=CC(=C1)C(C)C)O FFCTVKPAIBWRDX-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical class ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 1
- 239000004952 Polyamide Substances 0.000 description 1
- 229920000265 Polyparaphenylene Polymers 0.000 description 1
- 239000004721 Polyphenylene oxide Substances 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- 229920007962 Styrene Methyl Methacrylate Polymers 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- IAXXETNIOYFMLW-COPLHBTASA-N [(1s,3s,4s)-4,7,7-trimethyl-3-bicyclo[2.2.1]heptanyl] 2-methylprop-2-enoate Chemical compound C1C[C@]2(C)[C@@H](OC(=O)C(=C)C)C[C@H]1C2(C)C IAXXETNIOYFMLW-COPLHBTASA-N 0.000 description 1
- QROGIFZRVHSFLM-QHHAFSJGSA-N [(e)-prop-1-enyl]benzene Chemical compound C\C=C\C1=CC=CC=C1 QROGIFZRVHSFLM-QHHAFSJGSA-N 0.000 description 1
- JAWMENYCRQKKJY-UHFFFAOYSA-N [3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-ylmethyl)-1-oxa-2,8-diazaspiro[4.5]dec-2-en-8-yl]-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]methanone Chemical compound N1N=NC=2CN(CCC=21)CC1=NOC2(C1)CCN(CC2)C(=O)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F JAWMENYCRQKKJY-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003929 acidic solution Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000005054 agglomeration Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940114055 beta-resorcylic acid Drugs 0.000 description 1
- JWAPUVVSOVJCJB-UHFFFAOYSA-N bis(4-hydroxy-3,5-dimethylphenyl)methanone Chemical group CC1=C(O)C(C)=CC(C(=O)C=2C=C(C)C(O)=C(C)C=2)=C1 JWAPUVVSOVJCJB-UHFFFAOYSA-N 0.000 description 1
- DQXBYHZEEUGOBF-UHFFFAOYSA-N but-3-enoic acid;ethene Chemical compound C=C.OC(=O)CC=C DQXBYHZEEUGOBF-UHFFFAOYSA-N 0.000 description 1
- WWNGFHNQODFIEX-UHFFFAOYSA-N buta-1,3-diene;methyl 2-methylprop-2-enoate;styrene Chemical compound C=CC=C.COC(=O)C(C)=C.C=CC1=CC=CC=C1 WWNGFHNQODFIEX-UHFFFAOYSA-N 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- YACLQRRMGMJLJV-UHFFFAOYSA-N chloroprene Chemical compound ClC(=C)C=C YACLQRRMGMJLJV-UHFFFAOYSA-N 0.000 description 1
- 101150116749 chuk gene Proteins 0.000 description 1
- 238000000975 co-precipitation Methods 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 229920003244 diene elastomer Polymers 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- WNAHIZMDSQCWRP-UHFFFAOYSA-N dodecane-1-thiol Chemical compound CCCCCCCCCCCCS WNAHIZMDSQCWRP-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000005038 ethylene vinyl acetate Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000010419 fine particle Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000000446 fuel Substances 0.000 description 1
- 239000003365 glass fiber Substances 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229940119545 isobornyl methacrylate Drugs 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Chemical class 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
- ADFPJHOAARPYLP-UHFFFAOYSA-N methyl 2-methylprop-2-enoate;styrene Chemical compound COC(=O)C(C)=C.C=CC1=CC=CC=C1 ADFPJHOAARPYLP-UHFFFAOYSA-N 0.000 description 1
- 239000008267 milk Substances 0.000 description 1
- 210000004080 milk Anatomy 0.000 description 1
- 235000013336 milk Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 229920005623 miscible polymer blend Polymers 0.000 description 1
- 239000006082 mold release agent Substances 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002894 organic compounds Chemical class 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- QCDYQQDYXPDABM-UHFFFAOYSA-N phloroglucinol Chemical compound OC1=CC(O)=CC(O)=C1 QCDYQQDYXPDABM-UHFFFAOYSA-N 0.000 description 1
- 229960001553 phloroglucinol Drugs 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 239000000049 pigment Substances 0.000 description 1
- PMJHHCWVYXUKFD-UHFFFAOYSA-N piperylene Natural products CC=CC=C PMJHHCWVYXUKFD-UHFFFAOYSA-N 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001200 poly(ethylene-vinyl acetate) Polymers 0.000 description 1
- 229920002647 polyamide Polymers 0.000 description 1
- 229920000570 polyether Polymers 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920003225 polyurethane elastomer Polymers 0.000 description 1
- 235000019394 potassium persulphate Nutrition 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 238000012673 precipitation polymerization Methods 0.000 description 1
- LYBIZMNPXTXVMV-UHFFFAOYSA-N propan-2-yl prop-2-enoate Chemical compound CC(C)OC(=O)C=C LYBIZMNPXTXVMV-UHFFFAOYSA-N 0.000 description 1
- PNXMTCDJUBJHQJ-UHFFFAOYSA-N propyl prop-2-enoate Chemical compound CCCOC(=O)C=C PNXMTCDJUBJHQJ-UHFFFAOYSA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000010526 radical polymerization reaction Methods 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000009958 sewing Methods 0.000 description 1
- 229920002379 silicone rubber Polymers 0.000 description 1
- 239000004945 silicone rubber Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000012085 test solution Substances 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- WVLBCYQITXONBZ-UHFFFAOYSA-N trimethyl phosphate Chemical compound COP(=O)(OC)OC WVLBCYQITXONBZ-UHFFFAOYSA-N 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L21/00—Compositions of unspecified rubbers
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L57/00—Compositions of unspecified polymers obtained by reactions only involving carbon-to-carbon unsaturated bonds
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L83/00—Compositions of macromolecular compounds obtained by reactions forming in the main chain of the macromolecule a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon only; Compositions of derivatives of such polymers
- C08L83/04—Polysiloxanes
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G77/00—Macromolecular compounds obtained by reactions forming a linkage containing silicon with or without sulfur, nitrogen, oxygen or carbon in the main chain of the macromolecule
- C08G77/04—Polysiloxanes
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Priority Applications (19)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329585A DE2329585C2 (de) | 1973-06-09 | 1973-06-09 | Polycarbonat-Formmassen |
| AU63168/73A AU489405B2 (en) | 1973-06-09 | 1973-12-03 | Polycarbonate moulding compounds |
| CA187,280A CA1031481A (en) | 1973-06-09 | 1973-12-04 | Polycarbonate moulding compounds |
| SU7301975619A SU584797A3 (ru) | 1973-06-09 | 1973-12-04 | Формовочна композици |
| JP13496173A JPS5615669B2 (enExample) | 1973-06-09 | 1973-12-04 | |
| IT54075/73A IT1000186B (it) | 1973-06-09 | 1973-12-05 | Composti da stampaggio a base di policarbonati |
| NO4645/73A NO464573L (enExample) | 1973-06-09 | 1973-12-05 | |
| BR9567/73A BR7309567D0 (pt) | 1973-06-09 | 1973-12-05 | Composicao termoplastica para moldagem |
| BE138519A BE808228A (fr) | 1973-06-09 | 1973-12-05 | Compositions de moulage en polycarbonates |
| SE7316430A SE7316430L (enExample) | 1973-06-09 | 1973-12-05 | |
| DK658973A DK658973A (enExample) | 1973-06-09 | 1973-12-05 | |
| ES421175A ES421175A1 (es) | 1973-06-09 | 1973-12-05 | Procedimiento para la obtencion de masas moldeables termo- plasticas. |
| DD175123A DD112466A5 (enExample) | 1973-06-09 | 1973-12-05 | |
| NLAANVRAGE7316734,A NL177224C (nl) | 1973-06-09 | 1973-12-06 | Werkwijze ter bereiding van thermoplastische vormmassa's, die een aromatisch polycarbonaat en een ander polymeer bevatten. |
| GB5649273A GB1452141A (en) | 1973-06-09 | 1973-12-06 | Polycarbonate moulding compositions |
| CH1711973A CH590896A5 (enExample) | 1973-06-09 | 1973-12-06 | |
| FR7343619A FR2234349B1 (enExample) | 1973-06-09 | 1973-12-06 | |
| AT1023573A AT337992B (de) | 1973-06-09 | 1973-12-06 | Polycarbonat-formmassen |
| US05/827,103 US4172103A (en) | 1973-06-09 | 1977-08-23 | Polycarbonate moulding compounds |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2329585A DE2329585C2 (de) | 1973-06-09 | 1973-06-09 | Polycarbonat-Formmassen |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2329585A1 DE2329585A1 (de) | 1975-01-02 |
| DE2329585C2 true DE2329585C2 (de) | 1984-01-05 |
Family
ID=5883611
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2329585A Expired DE2329585C2 (de) | 1973-06-09 | 1973-06-09 | Polycarbonat-Formmassen |
Country Status (17)
| Country | Link |
|---|---|
| JP (1) | JPS5615669B2 (enExample) |
| AT (1) | AT337992B (enExample) |
| BE (1) | BE808228A (enExample) |
| BR (1) | BR7309567D0 (enExample) |
| CA (1) | CA1031481A (enExample) |
| CH (1) | CH590896A5 (enExample) |
| DD (1) | DD112466A5 (enExample) |
| DE (1) | DE2329585C2 (enExample) |
| DK (1) | DK658973A (enExample) |
| ES (1) | ES421175A1 (enExample) |
| FR (1) | FR2234349B1 (enExample) |
| GB (1) | GB1452141A (enExample) |
| IT (1) | IT1000186B (enExample) |
| NL (1) | NL177224C (enExample) |
| NO (1) | NO464573L (enExample) |
| SE (1) | SE7316430L (enExample) |
| SU (1) | SU584797A3 (enExample) |
Families Citing this family (33)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51122157A (en) * | 1975-04-17 | 1976-10-26 | Sumitomo Chem Co Ltd | Thermoplastic resin composition |
| NL184903C (nl) * | 1976-06-11 | 1989-12-01 | Monsanto Co | Werkwijze voor de bereiding van een elastoplastisch materiaal, dat een thermoplastische, lineaire, kristallijne polyester en een verknoopte rubber bevat. |
| DE2653145A1 (de) * | 1976-11-23 | 1978-05-24 | Bayer Ag | Formmassen |
| DE2653143C2 (de) * | 1976-11-23 | 1985-01-31 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen |
| US4537930A (en) * | 1977-09-14 | 1985-08-27 | General Electric Company | Composition of a polycarbonate resin and a selectively hydrogenated copolymer of a vinyl aromatic compound and an olefinic elastomer |
| US4122131A (en) | 1977-09-14 | 1978-10-24 | General Electric Company | Polyblend composition comprising aromatic polycarbonate, polyolefin, selectively hydrogenated block copolymer and olefinic copolymer |
| US4223096A (en) * | 1977-12-27 | 1980-09-16 | Monsanto Company | Rubber-modified terpolymer with improved molding characteristics |
| US4197376A (en) * | 1977-12-27 | 1980-04-08 | Monsanto Company | Tough polyblends with improved heat distortion resistance |
| DE2818679A1 (de) * | 1978-04-27 | 1979-10-31 | Bayer Ag | Thermoplastische formmassen |
| WO1980000027A1 (en) * | 1978-06-09 | 1980-01-10 | Gen Electric | Binary and ternary thermoplastic polycarbonate alloys |
| BR7808510A (pt) * | 1978-07-24 | 1980-05-20 | Monsanto Co | Composicao polimera |
| DE2853571A1 (de) * | 1978-12-12 | 1980-07-03 | Bayer Ag | Thermoplastisch-elastomere polymermischung |
| DE2928464A1 (de) * | 1979-07-13 | 1981-01-29 | Bayer Ag | Verwendung von speziellen rohbisphenolen zur herstellung von polycarbonaten |
| US4260693A (en) * | 1979-08-27 | 1981-04-07 | General Electric Company | Polycarbonate compositions |
| CA1165037A (en) * | 1981-01-09 | 1984-04-03 | David E. Henton | Blends of aromatic polycarbonate with random copolymers of a monovinylidene aromatic and an unsaturated carboxylic acid |
| DE3274252D1 (en) * | 1981-02-23 | 1987-01-02 | Sumitomo Naugatuck | Thermoplastic resin composition excellent in color development |
| DE3114494A1 (de) * | 1981-04-10 | 1982-11-04 | Basf Ag, 6700 Ludwigshafen | Thermoplastische formmassen |
| US4420584A (en) * | 1981-04-29 | 1983-12-13 | Mobay Chemical Corporation | Glass-filled polycarbonate of improved impact strength |
| DE3118697A1 (de) * | 1981-05-12 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | "thermoplastische formmassen auf basis von polycarbonat, polyalkylenterephthalat und gegebenenfalls einem oder mehreren polymerisaten" |
| DE3118861A1 (de) * | 1981-05-13 | 1982-12-02 | Bayer Ag, 5090 Leverkusen | "thermoplastische formmassen aus aromatischem polycarbonat und pfropfpolymerisat" |
| IT1199981B (it) * | 1982-03-24 | 1989-01-05 | Montedison Spa | Mescole a base di polimeri vinil-aromatici |
| DE3378125D1 (en) | 1982-09-10 | 1988-11-03 | Bayer Ag | Flame-retardant polymer mixtures |
| JPS60501111A (ja) * | 1983-04-18 | 1985-07-18 | アモコ、コ−ポレ−ション | 改良ポリカルボナ−トブレンド |
| CA1231485A (en) * | 1983-07-13 | 1988-01-12 | Ulrich R. Grigo | Molding compositions containing polycarbonate and a certain abs resin |
| DE3344101A1 (de) * | 1983-12-07 | 1985-06-13 | Bayer Ag, 5090 Leverkusen | Verwendung von halogenfreien polycarbonaten auf basis von bis-(3,5-dimethyl-4-hydroxyphenyl)-methan in kombination mit polymerisaten als flammschutzmittel |
| DE3635825A1 (de) * | 1986-10-22 | 1988-04-28 | Bayer Ag | Thermoplastische mischungen aus aromatischen polycarbonaten und polystyrolen und ihre verwendung als substrate fuer optische datenspeicher |
| DE3641990A1 (de) * | 1986-12-09 | 1988-06-16 | Bayer Ag | Thermoplastische formmassen auf basis spezieller pfropfpolymerisate |
| DE3719239A1 (de) * | 1987-06-06 | 1988-12-15 | Roehm Gmbh | Vertraegliche polycarbonat-polymethacrylat-mischungen |
| JP2853806B2 (ja) * | 1987-10-22 | 1999-02-03 | ダイセル化学工業 株式会社 | ポリカーボネート系樹脂組成物 |
| DE4014308C2 (de) * | 1990-05-04 | 1994-01-27 | Bayer Ag | Polycarbonat/ABS-Formmassen mit hoher Schlagzähigkeit |
| BR0114145A (pt) | 2000-09-26 | 2003-07-29 | Bayer Akietiengesellschaft | Composição na base de copolicarbonatos |
| CN104003057A (zh) * | 2014-06-12 | 2014-08-27 | 东莞市金富实业有限公司 | 一种可激光印刷的抗菌塑料瓶盖及其制造工艺 |
| JPWO2024038853A1 (enExample) * | 2022-08-18 | 2024-02-22 |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1174012B (de) * | 1959-12-18 | 1964-07-16 | Fuji Spinning Co Ltd | Verfahren zur Herstellung von leicht faerbbaren Fasern oder aehnlich geformten Gegenstaenden aus kristallinem Polypropylen |
| US3801673A (en) * | 1972-01-03 | 1974-04-02 | Gen Electric | Process for preparing polycarbonate alloys |
| DE2252974C2 (de) * | 1972-10-28 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen und Formkörper aus Polycarbonat und Styrol-Maleinsäureanhydrid-Copolymerisat |
| JPS5846269B2 (ja) * | 1972-12-06 | 1983-10-15 | バイエル・アクチエンゲゼルシヤフト | 成形用組成物 |
| US3891719A (en) * | 1972-12-06 | 1975-06-24 | Bayer Ag | Thermoplastic moulding compositions of a polycarbonate and a graft copolymer of styrene and acrylonitrile on an acrylic acid ester polymer |
| DE2322435C2 (de) * | 1973-05-04 | 1982-06-03 | Bayer Ag, 5090 Leverkusen | Thermoplastische Formmassen |
-
1973
- 1973-06-09 DE DE2329585A patent/DE2329585C2/de not_active Expired
- 1973-12-04 CA CA187,280A patent/CA1031481A/en not_active Expired
- 1973-12-04 JP JP13496173A patent/JPS5615669B2/ja not_active Expired
- 1973-12-04 SU SU7301975619A patent/SU584797A3/ru active
- 1973-12-05 SE SE7316430A patent/SE7316430L/xx unknown
- 1973-12-05 DK DK658973A patent/DK658973A/da unknown
- 1973-12-05 BE BE138519A patent/BE808228A/xx not_active IP Right Cessation
- 1973-12-05 IT IT54075/73A patent/IT1000186B/it active
- 1973-12-05 DD DD175123A patent/DD112466A5/xx unknown
- 1973-12-05 NO NO4645/73A patent/NO464573L/no unknown
- 1973-12-05 BR BR9567/73A patent/BR7309567D0/pt unknown
- 1973-12-05 ES ES421175A patent/ES421175A1/es not_active Expired
- 1973-12-06 AT AT1023573A patent/AT337992B/de not_active IP Right Cessation
- 1973-12-06 CH CH1711973A patent/CH590896A5/xx not_active IP Right Cessation
- 1973-12-06 GB GB5649273A patent/GB1452141A/en not_active Expired
- 1973-12-06 FR FR7343619A patent/FR2234349B1/fr not_active Expired
- 1973-12-06 NL NLAANVRAGE7316734,A patent/NL177224C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| FR2234349A1 (enExample) | 1975-01-17 |
| DK658973A (enExample) | 1975-02-03 |
| NL7316734A (enExample) | 1974-12-11 |
| NO464573L (enExample) | 1975-01-06 |
| BR7309567D0 (pt) | 1974-12-31 |
| ATA1023573A (de) | 1976-11-15 |
| SE7316430L (enExample) | 1974-12-10 |
| CH590896A5 (enExample) | 1977-08-31 |
| ES421175A1 (es) | 1976-07-01 |
| GB1452141A (en) | 1976-10-13 |
| SU584797A3 (ru) | 1977-12-15 |
| BE808228A (fr) | 1974-06-05 |
| AT337992B (de) | 1977-07-25 |
| FR2234349B1 (enExample) | 1977-06-10 |
| JPS5615669B2 (enExample) | 1981-04-11 |
| JPS5017462A (enExample) | 1975-02-24 |
| DE2329585A1 (de) | 1975-01-02 |
| IT1000186B (it) | 1976-03-30 |
| DD112466A5 (enExample) | 1975-04-12 |
| NL177224C (nl) | 1985-08-16 |
| NL177224B (nl) | 1985-03-18 |
| CA1031481A (en) | 1978-05-16 |
| AU6316873A (en) | 1975-06-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2329585C2 (de) | Polycarbonat-Formmassen | |
| DE2653143C2 (de) | Thermoplastische Formmassen | |
| DE2329646A1 (de) | Transparente formmassen | |
| DE3210284A1 (de) | Polycarbonatabmischungen | |
| DE4221293A1 (de) | Formmasse mit matter Oberfläche | |
| DE69920200T2 (de) | Kompatibilisierte abs-polycarbonat-formmasse | |
| DE2264104B2 (de) | Thermoplastische Polycarbonat-Formmassen | |
| DE69929521T2 (de) | Thermoplastische formmassen mit verbesserter plattierbarkeit | |
| DE3105364A1 (de) | Polyamid-formmassen | |
| DE4132497A1 (de) | Mehrschaliges pfropfcopolymerisat | |
| DE3325702C2 (enExample) | ||
| EP0312929A2 (de) | Thermoplastische Formmasse, Verfahren zu ihrer Herstellung und deren Verwendung | |
| DE3782567T2 (de) | Mischungen auf basis von polycarbonaten mit verbesserten physikalischen und chemischen eigenschaften. | |
| DE4142910A1 (de) | Schlagzaehmodifier und diesen enthaltende formmasse | |
| DE2717165A1 (de) | Thermoplastische formmassen aus polycarbonaten und abs-polymerisaten | |
| EP4565632A1 (de) | Thermoplastische abs-formmassen mit einer guten eigenschaftskombination von verarbeitbarkeit und oberflächenqualität | |
| DE2402177A1 (de) | Polycarbonat-polyvinylchlorid-formmassen | |
| EP0096301A2 (de) | Einphasige Polymermischungen | |
| DE3118861A1 (de) | "thermoplastische formmassen aus aromatischem polycarbonat und pfropfpolymerisat" | |
| EP0725091B1 (de) | Formmassen mit verbesserter Tieftemperaturzähigkeit | |
| EP0174503A1 (de) | Acrylnitrilfreie Blends aus Polycarbonat, Methylmethacrylat, Pfropfkautschuk und einem Terpolymerisatharz | |
| DE3430688A1 (de) | Acrylnitrilfreie polycarbonat blends | |
| EP0161452A1 (de) | Thermoplastische Formmassen | |
| DE3326562A1 (de) | Polycarbonat-gemische mit verbesserter schlagzaehigkeit | |
| DE3150341A1 (de) | Thermoplastische harzmassen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8126 | Change of the secondary classification |
Free format text: C08L 21/00 C08L 25/04 C08L 33/00 C08L 51/04 |
|
| Q176 | The application caused the suspense of an application |
Ref document number: 2329646 Country of ref document: DE |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8380 | Miscellaneous part iii |
Free format text: ES ERFOLGT NEUDRUCK DER UNVOLLSTAENDIG GEDRUCKTEN PATENTSCHRIFT. |
|
| 8339 | Ceased/non-payment of the annual fee |