DE2324789A1 - Vorrichtung zum herstellen von schneebaellen - Google Patents
Vorrichtung zum herstellen von schneebaellenInfo
- Publication number
- DE2324789A1 DE2324789A1 DE2324789A DE2324789A DE2324789A1 DE 2324789 A1 DE2324789 A1 DE 2324789A1 DE 2324789 A DE2324789 A DE 2324789A DE 2324789 A DE2324789 A DE 2324789A DE 2324789 A1 DE2324789 A1 DE 2324789A1
- Authority
- DE
- Germany
- Prior art keywords
- hemispherical
- cups
- hemispherical cup
- cup
- snowballs
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 235000015511 Liquidambar orientalis Nutrition 0.000 title 1
- 241000893513 Liquidambar orientalis Species 0.000 title 1
- 235000019013 Viburnum opulus Nutrition 0.000 claims description 40
- 244000071378 Viburnum opulus Species 0.000 claims description 40
- 239000004033 plastic Substances 0.000 description 4
- 101100327917 Caenorhabditis elegans chup-1 gene Proteins 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 238000000465 moulding Methods 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 238000007493 shaping process Methods 0.000 description 2
- 229920001169 thermoplastic Polymers 0.000 description 2
- 239000004416 thermosoftening plastic Substances 0.000 description 2
- 238000009825 accumulation Methods 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- LYKJEJVAXSGWAJ-UHFFFAOYSA-N compactone Natural products CC1(C)CCCC2(C)C1CC(=O)C3(O)CC(C)(CCC23)C=C LYKJEJVAXSGWAJ-UHFFFAOYSA-N 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 239000012858 resilient material Substances 0.000 description 1
- 238000007790 scraping Methods 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63H—TOYS, e.g. TOPS, DOLLS, HOOPS OR BUILDING BLOCKS
- A63H33/00—Other toys
- A63H33/001—Toy-moulding appliances; Toy moulding
Landscapes
- Footwear And Its Accessory, Manufacturing Method And Apparatuses (AREA)
- Cleaning Of Streets, Tracks, Or Beaches (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US00254079A US3836308A (en) | 1972-05-17 | 1972-05-17 | Snowball forming device |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2324789A1 true DE2324789A1 (de) | 1973-11-29 |
Family
ID=22962848
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2324789A Pending DE2324789A1 (de) | 1972-05-17 | 1973-05-16 | Vorrichtung zum herstellen von schneebaellen |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US3836308A (enExample) |
| JP (1) | JPS4926031A (enExample) |
| DE (1) | DE2324789A1 (enExample) |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3995826A (en) * | 1975-04-21 | 1976-12-07 | Saunders Archery Company | Pellet mold |
| US4163639A (en) * | 1977-12-19 | 1979-08-07 | Stern Robert G | Snowball maker |
| GB2056900B (en) * | 1979-08-17 | 1982-12-08 | Delta Mouldings Ltd | Mould assembly |
| US4859167A (en) * | 1988-05-04 | 1989-08-22 | Maerz Ralph R | Snowball maker |
| US5080572A (en) * | 1989-05-02 | 1992-01-14 | Sagebrush Industries | Snow ball making device |
| USD342002S (en) | 1990-11-06 | 1993-12-07 | Sagebrush Industries, Inc. | Tool for making snowballs |
| US5711892A (en) * | 1996-07-02 | 1998-01-27 | Ramirez; Luis Fernando | Ice sculpture mold |
| US7128556B2 (en) * | 2003-08-04 | 2006-10-31 | Wessells Philip G | Object forming and launching apparatus and method |
| JP3771929B1 (ja) * | 2004-10-20 | 2006-05-10 | 利栄 水沢 | お握り製造用具 |
| US20060201941A1 (en) * | 2005-03-11 | 2006-09-14 | Hung-Ming Lee | Sphere container |
| USD567602S1 (en) | 2006-02-09 | 2008-04-29 | Andrew Lee Choy | Snowball former and launcher |
| USD577390S1 (en) * | 2006-08-10 | 2008-09-23 | Collier Michael E | Basketball hand-held noisemaker |
| USD565125S1 (en) * | 2006-09-15 | 2008-03-25 | Michael Elyard Collier | Football hand-held noisemaker |
| US8641401B2 (en) * | 2008-04-07 | 2014-02-04 | Randall L. Leininger | Combination scoop and mold press for dough fishing bait |
| USD609708S1 (en) * | 2008-06-13 | 2010-02-09 | Pawel A. Woloszyn | Computer case |
| USD609240S1 (en) * | 2008-09-08 | 2010-02-02 | Pawel A. Woloszyn | Computer case |
| USD653256S1 (en) * | 2008-09-08 | 2012-01-31 | Pawel A. Woloszyn | Computer case |
| USD654079S1 (en) * | 2008-09-08 | 2012-02-14 | Pawel A. Woloszyn | Computer case |
| USD653257S1 (en) * | 2008-09-08 | 2012-01-31 | Pawel A. Woloszyn | Computer case |
| USD609709S1 (en) * | 2008-09-08 | 2010-02-09 | Pawel A. Woloszyn | Computer case |
| USD609239S1 (en) * | 2008-09-08 | 2010-02-02 | Pawel A. Woloszyn | Computer case |
| USD627358S1 (en) * | 2009-10-28 | 2010-11-16 | Pawel A. Woloszyn | Computer case |
| US20120308694A1 (en) * | 2011-06-03 | 2012-12-06 | Price William D | Apparatus and methodology for even defrosting of frozen food products |
| US9186824B2 (en) * | 2012-03-13 | 2015-11-17 | Anthony Klaves | Snowman making device |
| USD741676S1 (en) * | 2013-12-18 | 2015-10-27 | Shantou Top Toys Co., Ltd | Snowball clamp |
| GB2548430B (en) * | 2016-03-17 | 2018-03-07 | Mileto Giuseppe | Snowman making apparatus |
| US10874953B2 (en) * | 2018-11-20 | 2020-12-29 | Daniel Fabrizi | Snowball forming apparatus, and method of use |
| USD959515S1 (en) * | 2021-05-12 | 2022-08-02 | Naiwen Xiao | Bath bomb mold |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US436818A (en) * | 1890-09-23 | Mold for making pop-corn balls | ||
| US211859A (en) * | 1879-02-04 | Improvement in egg-boilers | ||
| US466617A (en) * | 1892-01-05 | Cake-baking pan | ||
| US19819A (en) * | 1858-03-30 | Improvement in lightning-conductors | ||
| CA461137A (en) * | 1949-11-15 | Pittsburgh Corning Corporation | Mould and use of the same in the cellulation of glass | |
| US52790A (en) * | 1866-02-20 | Improved mold for casting heads upon screws, tacks | ||
| DE129114C (enExample) * | ||||
| US2226844A (en) * | 1940-06-03 | 1940-12-31 | Howard L Snode | Egg cooker |
| US3159699A (en) * | 1961-01-06 | 1964-12-01 | Procter & Gamble | Skirted die |
| US3059273A (en) * | 1961-03-17 | 1962-10-23 | Harry H Nolan | Snowball forming and ejecting device |
| US3059279A (en) * | 1961-04-20 | 1962-10-23 | Joseph A Rossi | Multisectional interlocked snow mold |
| US3289246A (en) * | 1964-09-10 | 1966-12-06 | Neil S Deye | Amusement device |
| US3717431A (en) * | 1971-08-23 | 1973-02-20 | H Matsuda | Snow bricker |
-
1972
- 1972-05-17 US US00254079A patent/US3836308A/en not_active Expired - Lifetime
-
1973
- 1973-04-19 JP JP48043759A patent/JPS4926031A/ja active Pending
- 1973-05-16 DE DE2324789A patent/DE2324789A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3836308A (en) | 1974-09-17 |
| JPS4926031A (enExample) | 1974-03-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2324789A1 (de) | Vorrichtung zum herstellen von schneebaellen | |
| DE867582C (de) | Praeservativ | |
| DE3936149C1 (en) | Disposable tooth-brush with removable head - has handle as tapering paper tube for head insertion | |
| DE2746168A1 (de) | Tennisschlaeger | |
| DE69803347T2 (de) | Spielzeug für Hunde | |
| DE561388C (de) | Fussballspiel mit pneumatischem Antrieb fuer die Baelle | |
| DE102006054640B4 (de) | Tischtennisschläger | |
| DE1927468B2 (de) | Handgriff eines tennisschlaegers | |
| DE450019C (de) | Aus tanzenden Kugeln bestehendes Kinderspielzeug | |
| DE3214028A1 (de) | Topologisches solitaerspielzeug | |
| DE29512494U1 (de) | Sportgerät zum Trainieren des menschlichen Körpers | |
| DE3214500A1 (de) | Halter fuer wisch- oder poliertuecher | |
| DE439139C (de) | Spielzeug mit an einem elastischen Band befestigtem Wurfkoerper | |
| DE8137136U1 (de) | Handgerechtes puzzlespielgeraet | |
| DE2533620A1 (de) | Gymnastik- und spielgeraet | |
| DE1943593A1 (de) | Abc-Kinderski | |
| DE2120355C3 (de) | Flacher Formkörper fur Blind Schaltbilder aus Kunststoff | |
| DE3024293A1 (de) | Werkstoff | |
| EP0173722A1 (de) | Vorrichtung zum trainieren des skilaufens | |
| DE1733929U (de) | Ziehvorrichtung. | |
| DE7141232U (de) | Rollkugel-SchwingspieL | |
| DE7740236U1 (de) | Spielzeug-ziehvorrichtung | |
| DE7723726U1 (de) | Spielzeug, insbesondere spielfigur | |
| DE29610868U1 (de) | Spielfahrzeug | |
| DE8124365U1 (de) | Tischtennisschläger |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |