DE2321518C2 - Sulfamylbenzoesäuren und deren Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Mittel - Google Patents
Sulfamylbenzoesäuren und deren Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische MittelInfo
- Publication number
- DE2321518C2 DE2321518C2 DE2321518A DE2321518A DE2321518C2 DE 2321518 C2 DE2321518 C2 DE 2321518C2 DE 2321518 A DE2321518 A DE 2321518A DE 2321518 A DE2321518 A DE 2321518A DE 2321518 C2 DE2321518 C2 DE 2321518C2
- Authority
- DE
- Germany
- Prior art keywords
- benzoic acid
- benzoyl
- amino
- benzyl
- nitro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001875 compounds Chemical class 0.000 title claims description 107
- 238000000034 method Methods 0.000 title claims description 92
- 238000002360 preparation method Methods 0.000 title claims description 7
- 239000008194 pharmaceutical composition Substances 0.000 title description 2
- KDNIOKSLVIGAAN-UHFFFAOYSA-N 2-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=CC=C1C(O)=O KDNIOKSLVIGAAN-UHFFFAOYSA-N 0.000 title 1
- -1 trifluoromethylphenyl Chemical group 0.000 claims description 67
- 239000005711 Benzoic acid Substances 0.000 claims description 46
- 239000002253 acid Substances 0.000 claims description 30
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 18
- 239000012954 diazonium Substances 0.000 claims description 18
- 229910052760 oxygen Inorganic materials 0.000 claims description 18
- 239000001301 oxygen Substances 0.000 claims description 18
- 150000002148 esters Chemical class 0.000 claims description 17
- 150000003839 salts Chemical class 0.000 claims description 14
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 claims description 12
- 150000001989 diazonium salts Chemical class 0.000 claims description 10
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims description 9
- 229910052717 sulfur Inorganic materials 0.000 claims description 9
- 239000011593 sulfur Substances 0.000 claims description 9
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000007513 acids Chemical class 0.000 claims description 5
- 235000019445 benzyl alcohol Nutrition 0.000 claims description 4
- LTYRAPJYLUPLCI-UHFFFAOYSA-N glycolonitrile Chemical compound OCC#N LTYRAPJYLUPLCI-UHFFFAOYSA-N 0.000 claims description 4
- 150000001336 alkenes Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 229910021529 ammonia Inorganic materials 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 2
- 125000004076 pyridyl group Chemical group 0.000 claims description 2
- 125000001544 thienyl group Chemical group 0.000 claims description 2
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims 5
- 229910052736 halogen Inorganic materials 0.000 claims 2
- 150000002367 halogens Chemical group 0.000 claims 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 claims 1
- 125000003342 alkenyl group Chemical group 0.000 claims 1
- 125000005059 halophenyl group Chemical group 0.000 claims 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 claims 1
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 126
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 105
- 239000000243 solution Substances 0.000 description 66
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 50
- 239000000203 mixture Substances 0.000 description 45
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 40
- 238000001914 filtration Methods 0.000 description 35
- 238000003756 stirring Methods 0.000 description 35
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 33
- 238000001816 cooling Methods 0.000 description 29
- 239000000463 material Substances 0.000 description 26
- 238000001035 drying Methods 0.000 description 22
- 238000002844 melting Methods 0.000 description 19
- 230000008018 melting Effects 0.000 description 19
- IKUZQNIVXMTVMF-UHFFFAOYSA-N 3-amino-4-benzoyl-5-ethoxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=CC=C1 IKUZQNIVXMTVMF-UHFFFAOYSA-N 0.000 description 18
- RTXCMPYKVCYFHJ-UHFFFAOYSA-N 4-benzoyl-3-butoxy-5-nitrobenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 RTXCMPYKVCYFHJ-UHFFFAOYSA-N 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- 239000002244 precipitate Substances 0.000 description 16
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 15
- 238000001953 recrystallisation Methods 0.000 description 15
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 14
- 238000006243 chemical reaction Methods 0.000 description 13
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 13
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 12
- LPXPTNMVRIOKMN-UHFFFAOYSA-M sodium nitrite Chemical compound [Na+].[O-]N=O LPXPTNMVRIOKMN-UHFFFAOYSA-M 0.000 description 12
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 11
- PEWLKQYRNICSSA-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-phenylmethoxybenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C([N+]([O-])=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=C1 PEWLKQYRNICSSA-UHFFFAOYSA-N 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 10
- 238000002329 infrared spectrum Methods 0.000 description 9
- VSCGDYFHRXWWQY-UHFFFAOYSA-N 4-benzoyl-3-[(2-benzoyl-3-benzylsulfanyl-5-carboxyphenyl)diazenyl]-5-benzylsulfanylbenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(N=NC=2C(=C(SCC=3C=CC=CC=3)C=C(C=2)C(O)=O)C(=O)C=2C=CC=CC=2)=CC(C(=O)O)=CC=1SCC1=CC=CC=C1 VSCGDYFHRXWWQY-UHFFFAOYSA-N 0.000 description 8
- IJGRMHOSHXDMSA-UHFFFAOYSA-O diazynium Chemical compound [NH+]#N IJGRMHOSHXDMSA-UHFFFAOYSA-O 0.000 description 8
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 7
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 7
- 239000003610 charcoal Substances 0.000 description 7
- 238000010438 heat treatment Methods 0.000 description 7
- 229910052757 nitrogen Inorganic materials 0.000 description 7
- 239000011734 sodium Substances 0.000 description 7
- 229910052708 sodium Inorganic materials 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 6
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 6
- 235000010288 sodium nitrite Nutrition 0.000 description 6
- 239000007858 starting material Substances 0.000 description 6
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 5
- ORDXMNKCZLGACE-UHFFFAOYSA-N 3-amino-4-benzoyl-5-butoxybenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=CC=C1 ORDXMNKCZLGACE-UHFFFAOYSA-N 0.000 description 5
- JABRUGVTUOKGAS-UHFFFAOYSA-N 4-benzoyl-3-butoxy-5-chlorosulfonylbenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 JABRUGVTUOKGAS-UHFFFAOYSA-N 0.000 description 5
- CBFXZEPHYUGUCK-UHFFFAOYSA-N 4-benzoyl-3-butoxy-5-sulfamoylbenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1C(=O)C1=CC=CC=C1 CBFXZEPHYUGUCK-UHFFFAOYSA-N 0.000 description 5
- NSNGJWSQAQNSCX-UHFFFAOYSA-N 4-benzoyl-3-ethoxy-5-nitrobenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 NSNGJWSQAQNSCX-UHFFFAOYSA-N 0.000 description 5
- JFVTWPPQHQIYAS-UHFFFAOYSA-N 4-benzyl-3-benzylsulfanyl-5-sulfamoylbenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1SCC1=CC=CC=C1 JFVTWPPQHQIYAS-UHFFFAOYSA-N 0.000 description 5
- KDNVOPZCGGURTN-UHFFFAOYSA-N 4-benzyl-3-sulfamoyl-5-sulfanylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC(S)=C1CC1=CC=CC=C1 KDNVOPZCGGURTN-UHFFFAOYSA-N 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 230000018044 dehydration Effects 0.000 description 5
- 238000006297 dehydration reaction Methods 0.000 description 5
- 230000001882 diuretic effect Effects 0.000 description 5
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 5
- 159000000000 sodium salts Chemical class 0.000 description 5
- YKQXJSFODOCRGV-UHFFFAOYSA-N 3-amino-4-benzoyl-5-nitrobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 YKQXJSFODOCRGV-UHFFFAOYSA-N 0.000 description 4
- LIBJXVGMXJONMR-UHFFFAOYSA-N 4-benzoyl-3-[(2-benzoyl-3-butylsulfanyl-5-carboxyphenyl)diazenyl]-5-butylsulfanylbenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(SCCCC)=CC(C(O)=O)=CC=1N=NC1=CC(C(O)=O)=CC(SCCCC)=C1C(=O)C1=CC=CC=C1 LIBJXVGMXJONMR-UHFFFAOYSA-N 0.000 description 4
- KWDJBPCFBYNLSC-UHFFFAOYSA-N 4-benzoyl-3-[(2-benzoyl-5-carboxy-3-propylsulfanylphenyl)diazenyl]-5-propylsulfanylbenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(SCCC)=CC(C(O)=O)=CC=1N=NC1=CC(C(O)=O)=CC(SCCC)=C1C(=O)C1=CC=CC=C1 KWDJBPCFBYNLSC-UHFFFAOYSA-N 0.000 description 4
- ACEOOJALSZIIKW-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-(2-phenylethenyl)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C([N+]([O-])=O)=CC(C(=O)O)=CC=1C=CC1=CC=CC=C1 ACEOOJALSZIIKW-UHFFFAOYSA-N 0.000 description 4
- YNAPYFFFOJICHH-UHFFFAOYSA-N 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoic acid Chemical compound CCCCSC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 YNAPYFFFOJICHH-UHFFFAOYSA-N 0.000 description 4
- 150000001412 amines Chemical class 0.000 description 4
- MAEIEVLCKWDQJH-UHFFFAOYSA-N bumetanide Chemical compound CCCCNC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1OC1=CC=CC=C1 MAEIEVLCKWDQJH-UHFFFAOYSA-N 0.000 description 4
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical compound CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 description 4
- ORTQZVOHEJQUHG-UHFFFAOYSA-L copper(II) chloride Chemical compound Cl[Cu]Cl ORTQZVOHEJQUHG-UHFFFAOYSA-L 0.000 description 4
- 239000002934 diuretic Substances 0.000 description 4
- 239000000706 filtrate Substances 0.000 description 4
- 125000002510 isobutoxy group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])O* 0.000 description 4
- 125000004708 n-butylthio group Chemical group C(CCC)S* 0.000 description 4
- 125000003506 n-propoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 4
- 230000000894 saliuretic effect Effects 0.000 description 4
- 235000017557 sodium bicarbonate Nutrition 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- 238000001665 trituration Methods 0.000 description 4
- CYNYIHKIEHGYOZ-UHFFFAOYSA-N 1-bromopropane Chemical compound CCCBr CYNYIHKIEHGYOZ-UHFFFAOYSA-N 0.000 description 3
- MFAWZJRHDSMQBG-UHFFFAOYSA-N 3-amino-4-(4-methylbenzoyl)-5-phenylmethoxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(N)C=C(C(O)=O)C=C1OCC1=CC=CC=C1 MFAWZJRHDSMQBG-UHFFFAOYSA-N 0.000 description 3
- VNBHLVARXWVQET-UHFFFAOYSA-N 3-amino-4-benzoyl-5-(2-phenylethyl)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(N)=CC(C(O)=O)=CC=1CCC1=CC=CC=C1 VNBHLVARXWVQET-UHFFFAOYSA-N 0.000 description 3
- PULKLHXUJDGQIH-UHFFFAOYSA-N 3-amino-4-benzoyl-5-(pyridin-2-ylmethoxy)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(N)=CC(C(O)=O)=CC=1OCC1=CC=CC=N1 PULKLHXUJDGQIH-UHFFFAOYSA-N 0.000 description 3
- BLEUGILADQRDDK-UHFFFAOYSA-N 3-amino-4-benzoyl-5-benzylbenzenecarbothioic s-acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(N)=CC(C(O)=S)=CC=1CC1=CC=CC=C1 BLEUGILADQRDDK-UHFFFAOYSA-N 0.000 description 3
- MRSKOHLOCRBGLO-UHFFFAOYSA-N 3-amino-4-benzoyl-5-butylbenzenecarbothioic s-acid Chemical compound CCCCC1=CC(C(O)=S)=CC(N)=C1C(=O)C1=CC=CC=C1 MRSKOHLOCRBGLO-UHFFFAOYSA-N 0.000 description 3
- JVXKBGINSQNTGC-UHFFFAOYSA-N 3-amino-5-butoxy-4-(4-chlorobenzoyl)benzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=C(Cl)C=C1 JVXKBGINSQNTGC-UHFFFAOYSA-N 0.000 description 3
- NYEGZHZHHMCZRL-UHFFFAOYSA-N 3-butoxy-4-(4-chlorobenzoyl)-5-nitrobenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=C(Cl)C=C1 NYEGZHZHHMCZRL-UHFFFAOYSA-N 0.000 description 3
- JHIAQSUWNCYJBC-UHFFFAOYSA-N 3-butoxy-4-(4-methylbenzoyl)-5-nitrobenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=C(C)C=C1 JHIAQSUWNCYJBC-UHFFFAOYSA-N 0.000 description 3
- YXFOFBNAXLAIAJ-UHFFFAOYSA-N 3-chlorosulfonyl-4-(4-methylbenzoyl)-5-phenylmethoxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)C(C(=CC(=C1)C(O)=O)S(Cl)(=O)=O)=C1OCC1=CC=CC=C1 YXFOFBNAXLAIAJ-UHFFFAOYSA-N 0.000 description 3
- HOMKIOOWHJSHGE-UHFFFAOYSA-N 3-hydroxy-4-(4-methylbenzoyl)-5-nitrobenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(O)C=C(C(O)=O)C=C1[N+]([O-])=O HOMKIOOWHJSHGE-UHFFFAOYSA-N 0.000 description 3
- WZSVCHYXJHIBGW-UHFFFAOYSA-N 4-(4-chlorobenzoyl)-3-hydroxy-5-nitrobenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC(O)=C1C(=O)C1=CC=C(Cl)C=C1 WZSVCHYXJHIBGW-UHFFFAOYSA-N 0.000 description 3
- JPWGEZLTDXXLMZ-UHFFFAOYSA-N 4-(4-chlorobenzoyl)-3-nitro-5-phenylmethoxybenzoic acid Chemical compound C=1C=C(Cl)C=CC=1C(=O)C=1C([N+]([O-])=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=C1 JPWGEZLTDXXLMZ-UHFFFAOYSA-N 0.000 description 3
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 3
- ADRCCORHGSBRSI-UHFFFAOYSA-N 4-benzoyl-3-(2-methylpropoxy)-5-nitrobenzoic acid Chemical compound CC(C)COC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 ADRCCORHGSBRSI-UHFFFAOYSA-N 0.000 description 3
- HIERMPNXNFMCLY-UHFFFAOYSA-N 4-benzoyl-3-[(4-chlorophenyl)methoxy]-5-nitrobenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C([N+]([O-])=O)=CC(C(=O)O)=CC=1OCC1=CC=C(Cl)C=C1 HIERMPNXNFMCLY-UHFFFAOYSA-N 0.000 description 3
- HFQLPTOCDBFBBY-UHFFFAOYSA-N 4-benzoyl-3-benzylsulfanyl-5-chlorosulfonylbenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1SCC1=CC=CC=C1 HFQLPTOCDBFBBY-UHFFFAOYSA-N 0.000 description 3
- TYLJGWIWSAXYOY-UHFFFAOYSA-N 4-benzoyl-3-butylsulfanyl-5-chlorosulfonylbenzoic acid Chemical compound CCCCSC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 TYLJGWIWSAXYOY-UHFFFAOYSA-N 0.000 description 3
- NYVKEDIBARTCPF-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-(2-phenylethyl)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1CCC1=CC=CC=C1 NYVKEDIBARTCPF-UHFFFAOYSA-N 0.000 description 3
- LCLNTIUASQPOAD-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-(3-methylbutyl)benzenecarbothioic s-acid Chemical compound CC(C)CCC1=CC(C(O)=S)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 LCLNTIUASQPOAD-UHFFFAOYSA-N 0.000 description 3
- RFJOQFOBDXUQTR-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-ethoxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 RFJOQFOBDXUQTR-UHFFFAOYSA-N 0.000 description 3
- FULZBBCJLHJFTR-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 FULZBBCJLHJFTR-UHFFFAOYSA-N 0.000 description 3
- UNODCNAEYQMBCA-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-pentoxybenzoic acid Chemical compound CCCCCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 UNODCNAEYQMBCA-UHFFFAOYSA-N 0.000 description 3
- BQAIQKHTGBNPFQ-UHFFFAOYSA-N 4-benzoyl-3-hydroxy-5-nitrobenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC(O)=C1C(=O)C1=CC=CC=C1 BQAIQKHTGBNPFQ-UHFFFAOYSA-N 0.000 description 3
- FDFLDCJHSKWFBE-UHFFFAOYSA-N 4-benzoyl-3-hydroxy-5-sulfamoylbenzoic acid Chemical compound NS(=O)(=O)C1=CC(C(O)=O)=CC(O)=C1C(=O)C1=CC=CC=C1 FDFLDCJHSKWFBE-UHFFFAOYSA-N 0.000 description 3
- RWNGYUBMWCJLIN-UHFFFAOYSA-N 4-benzoyl-3-methylsulfanyl-5-nitrobenzoic acid Chemical compound CSC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 RWNGYUBMWCJLIN-UHFFFAOYSA-N 0.000 description 3
- IOIJFZSOYTWZNH-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-(pyridin-2-ylmethoxy)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C([N+]([O-])=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=N1 IOIJFZSOYTWZNH-UHFFFAOYSA-N 0.000 description 3
- JCRMIEDCEJMBHD-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-pentoxybenzoic acid Chemical compound CCCCCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 JCRMIEDCEJMBHD-UHFFFAOYSA-N 0.000 description 3
- YGCBGKZYDDPQOP-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-propoxybenzoic acid Chemical compound CCCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 YGCBGKZYDDPQOP-UHFFFAOYSA-N 0.000 description 3
- NSJPYJYMLVCFTO-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-thiocyanatobenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC(SC#N)=C1C(=O)C1=CC=CC=C1 NSJPYJYMLVCFTO-UHFFFAOYSA-N 0.000 description 3
- OKBDPLNOGQGNDG-UHFFFAOYSA-N 4-benzyl-3-[(4-chlorophenyl)methoxy]-5-chlorosulfonylbenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1OCC1=CC=C(Cl)C=C1 OKBDPLNOGQGNDG-UHFFFAOYSA-N 0.000 description 3
- QIOPAHVULTWHSF-UHFFFAOYSA-N 4-benzyl-3-benzylsulfanyl-5-chlorosulfonylbenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1SCC1=CC=CC=C1 QIOPAHVULTWHSF-UHFFFAOYSA-N 0.000 description 3
- QXJUPAXKXCXBOY-UHFFFAOYSA-N 4-benzyl-3-butylsulfanyl-5-chlorosulfonylbenzoic acid Chemical compound CCCCSC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1CC1=CC=CC=C1 QXJUPAXKXCXBOY-UHFFFAOYSA-N 0.000 description 3
- WRZFAYAHAFFDCH-UHFFFAOYSA-N 4-benzyl-3-ethylsulfanyl-5-sulfamoylbenzoic acid Chemical compound CCSC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 WRZFAYAHAFFDCH-UHFFFAOYSA-N 0.000 description 3
- DAMSJFLKRNIRCX-UHFFFAOYSA-N 4-benzyl-3-propylsulfanyl-5-sulfamoylbenzoic acid Chemical compound CCCSC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 DAMSJFLKRNIRCX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 3
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 3
- 125000005336 allyloxy group Chemical group 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 239000003814 drug Substances 0.000 description 3
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 3
- OOWFADBAORAQLR-UHFFFAOYSA-N ethyl 3-hydroxy-4-(4-methylbenzoyl)-5-nitrobenzoate Chemical compound [O-][N+](=O)C1=CC(C(=O)OCC)=CC(O)=C1C(=O)C1=CC=C(C)C=C1 OOWFADBAORAQLR-UHFFFAOYSA-N 0.000 description 3
- OLPLZNJNOUWVFN-UHFFFAOYSA-N ethyl 4-(4-chlorobenzoyl)-3-hydroxy-5-nitrobenzoate Chemical compound [O-][N+](=O)C1=CC(C(=O)OCC)=CC(O)=C1C(=O)C1=CC=C(Cl)C=C1 OLPLZNJNOUWVFN-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 230000029142 excretion Effects 0.000 description 3
- 125000005843 halogen group Chemical group 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- 125000001298 n-hexoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 3
- 125000003935 n-pentoxy group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])O* 0.000 description 3
- 125000004706 n-propylthio group Chemical group C(CC)S* 0.000 description 3
- 239000012299 nitrogen atmosphere Substances 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 230000020477 pH reduction Effects 0.000 description 3
- 239000008177 pharmaceutical agent Substances 0.000 description 3
- 238000006722 reduction reaction Methods 0.000 description 3
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 3
- YZWKKMVJZFACSU-UHFFFAOYSA-N 1-bromopentane Chemical compound CCCCCBr YZWKKMVJZFACSU-UHFFFAOYSA-N 0.000 description 2
- MEZOBCCBMVMKDE-UHFFFAOYSA-N 2-benzoyl-5-carboxy-3-nitrobenzenediazonium;chloride Chemical compound [Cl-].[O-][N+](=O)C1=CC(C(=O)O)=CC([N+]#N)=C1C(=O)C1=CC=CC=C1 MEZOBCCBMVMKDE-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- HCDMJFOHIXMBOV-UHFFFAOYSA-N 3-(2,6-difluoro-3,5-dimethoxyphenyl)-1-ethyl-8-(morpholin-4-ylmethyl)-4,7-dihydropyrrolo[4,5]pyrido[1,2-d]pyrimidin-2-one Chemical compound C=1C2=C3N(CC)C(=O)N(C=4C(=C(OC)C=C(OC)C=4F)F)CC3=CN=C2NC=1CN1CCOCC1 HCDMJFOHIXMBOV-UHFFFAOYSA-N 0.000 description 2
- NPFBUWYHFRHDMQ-UHFFFAOYSA-N 3-amino-4,5-dibenzylbenzenecarbothioic s-acid Chemical compound C=1C=CC=CC=1CC=1C(N)=CC(C(O)=S)=CC=1CC1=CC=CC=C1 NPFBUWYHFRHDMQ-UHFFFAOYSA-N 0.000 description 2
- USCHKKDLSDEPDZ-UHFFFAOYSA-N 3-amino-4-(4-chlorobenzoyl)-5-phenylmethoxybenzoic acid Chemical compound C=1C=C(Cl)C=CC=1C(=O)C=1C(N)=CC(C(O)=O)=CC=1OCC1=CC=CC=C1 USCHKKDLSDEPDZ-UHFFFAOYSA-N 0.000 description 2
- ISTBSCYWGDCYGS-UHFFFAOYSA-N 3-amino-4-benzoyl-5-[(4-chlorophenyl)methoxy]benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(N)=CC(C(O)=O)=CC=1OCC1=CC=C(Cl)C=C1 ISTBSCYWGDCYGS-UHFFFAOYSA-N 0.000 description 2
- UTFCCWJYIAYOSL-UHFFFAOYSA-N 3-amino-4-benzoyl-5-hexoxybenzoic acid Chemical compound CCCCCCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=CC=C1 UTFCCWJYIAYOSL-UHFFFAOYSA-N 0.000 description 2
- VICVVETUVJLYRE-UHFFFAOYSA-N 3-amino-4-benzoyl-5-methylbenzenecarbothioic s-acid Chemical compound CC1=CC(C(O)=S)=CC(N)=C1C(=O)C1=CC=CC=C1 VICVVETUVJLYRE-UHFFFAOYSA-N 0.000 description 2
- OWYJBPRGZNKGRB-UHFFFAOYSA-N 3-amino-4-benzoyl-5-pentoxybenzoic acid Chemical compound CCCCCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=CC=C1 OWYJBPRGZNKGRB-UHFFFAOYSA-N 0.000 description 2
- GRCMYZLNWKUSOD-UHFFFAOYSA-N 3-amino-4-benzoyl-5-phenylmethoxybenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(N)=CC(C(O)=O)=CC=1OCC1=CC=CC=C1 GRCMYZLNWKUSOD-UHFFFAOYSA-N 0.000 description 2
- NCROKCQZZJAYBM-UHFFFAOYSA-N 3-amino-4-benzoyl-5-prop-2-enylsulfanylbenzoic acid Chemical compound NC1=CC(C(O)=O)=CC(SCC=C)=C1C(=O)C1=CC=CC=C1 NCROKCQZZJAYBM-UHFFFAOYSA-N 0.000 description 2
- OGLMVAZCEYCTBZ-UHFFFAOYSA-N 3-amino-4-benzoyl-5-prop-2-ynoxybenzoic acid Chemical compound NC1=CC(C(O)=O)=CC(OCC#C)=C1C(=O)C1=CC=CC=C1 OGLMVAZCEYCTBZ-UHFFFAOYSA-N 0.000 description 2
- YTEFVJYHVJVQAB-UHFFFAOYSA-N 3-amino-4-benzoyl-5-propoxybenzoic acid Chemical compound CCCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=CC=C1 YTEFVJYHVJVQAB-UHFFFAOYSA-N 0.000 description 2
- VFSYYYCYHOBPSC-UHFFFAOYSA-N 3-amino-4-benzoyl-5-propylbenzenecarbothioic s-acid Chemical compound CCCC1=CC(C(O)=S)=CC(N)=C1C(=O)C1=CC=CC=C1 VFSYYYCYHOBPSC-UHFFFAOYSA-N 0.000 description 2
- YDRVGFGKJUNKIP-UHFFFAOYSA-N 3-amino-4-benzyl-5-[(4-chlorophenyl)methoxy]benzoic acid Chemical compound C=1C=CC=CC=1CC=1C(N)=CC(C(O)=O)=CC=1OCC1=CC=C(Cl)C=C1 YDRVGFGKJUNKIP-UHFFFAOYSA-N 0.000 description 2
- DPXOIMYYPRSQMD-UHFFFAOYSA-N 3-amino-4-benzyl-5-butylbenzenecarbothioic s-acid Chemical compound CCCCC1=CC(C(O)=S)=CC(N)=C1CC1=CC=CC=C1 DPXOIMYYPRSQMD-UHFFFAOYSA-N 0.000 description 2
- MLKZHTGMFAFESG-UHFFFAOYSA-N 3-amino-4-benzyl-5-ethoxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(N)=C1CC1=CC=CC=C1 MLKZHTGMFAFESG-UHFFFAOYSA-N 0.000 description 2
- YUWRFJZVYXDKHD-UHFFFAOYSA-N 3-amino-4-benzyl-5-methylbenzenecarbothioic s-acid Chemical compound CC1=CC(C(O)=S)=CC(N)=C1CC1=CC=CC=C1 YUWRFJZVYXDKHD-UHFFFAOYSA-N 0.000 description 2
- HWZAWPDYGBUIBE-UHFFFAOYSA-N 3-amino-4-benzyl-5-propoxybenzoic acid Chemical compound CCCOC1=CC(C(O)=O)=CC(N)=C1CC1=CC=CC=C1 HWZAWPDYGBUIBE-UHFFFAOYSA-N 0.000 description 2
- XDNHTCYIKNVQFR-UHFFFAOYSA-N 3-amino-4-benzyl-5-sulfamoylbenzoic acid Chemical compound NC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 XDNHTCYIKNVQFR-UHFFFAOYSA-N 0.000 description 2
- CDJNJDOJDQMGEZ-UHFFFAOYSA-N 3-amino-5-butoxy-4-(4-methylbenzoyl)benzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(N)=C1C(=O)C1=CC=C(C)C=C1 CDJNJDOJDQMGEZ-UHFFFAOYSA-N 0.000 description 2
- ZVRKLRPRDTWXAB-UHFFFAOYSA-N 3-butoxy-5-chlorosulfonyl-4-(4-methylbenzoyl)benzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=C(C)C=C1 ZVRKLRPRDTWXAB-UHFFFAOYSA-N 0.000 description 2
- PCANOLRNUSLKET-UHFFFAOYSA-N 4-(4-chlorobenzoyl)-3-chlorosulfonyl-5-phenylmethoxybenzoic acid Chemical compound C=1C=C(Cl)C=CC=1C(=O)C=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=C1 PCANOLRNUSLKET-UHFFFAOYSA-N 0.000 description 2
- YIUODVCDZANPJT-UHFFFAOYSA-N 4-(4-methylbenzoyl)-3-nitro-5-phenylmethoxybenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)C(C(=CC(=C1)C(O)=O)[N+]([O-])=O)=C1OCC1=CC=CC=C1 YIUODVCDZANPJT-UHFFFAOYSA-N 0.000 description 2
- IGASQMNUJARXST-UHFFFAOYSA-N 4-benzoyl-3-[[2-benzoyl-5-carboxy-3-(3-methylbutylsulfanyl)phenyl]diazenyl]-5-(3-methylbutylsulfanyl)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(SCCC(C)C)=CC(C(O)=O)=CC=1N=NC1=CC(C(O)=O)=CC(SCCC(C)C)=C1C(=O)C1=CC=CC=C1 IGASQMNUJARXST-UHFFFAOYSA-N 0.000 description 2
- DONQBDDCFFNRKL-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-(2-methylpropoxy)benzoic acid Chemical compound CC(C)COC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 DONQBDDCFFNRKL-UHFFFAOYSA-N 0.000 description 2
- HEOWQADEEUIIPK-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-(pyridin-2-ylmethoxy)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=N1 HEOWQADEEUIIPK-UHFFFAOYSA-N 0.000 description 2
- VZRPFJQFXSCSDC-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-prop-2-ynoxybenzoic acid Chemical compound ClS(=O)(=O)C1=CC(C(=O)O)=CC(OCC#C)=C1C(=O)C1=CC=CC=C1 VZRPFJQFXSCSDC-UHFFFAOYSA-N 0.000 description 2
- ZDZQLMUCULZRKI-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-propoxybenzoic acid Chemical compound CCCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 ZDZQLMUCULZRKI-UHFFFAOYSA-N 0.000 description 2
- BCSKNEYUSGFQQD-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-propylbenzenecarbothioic s-acid Chemical compound CCCC1=CC(C(O)=S)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 BCSKNEYUSGFQQD-UHFFFAOYSA-N 0.000 description 2
- PGCDZDMZGWYZMD-UHFFFAOYSA-N 4-benzoyl-3-hexoxy-5-nitrobenzoic acid Chemical compound CCCCCCOC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 PGCDZDMZGWYZMD-UHFFFAOYSA-N 0.000 description 2
- IQQVMTJYKCHLLE-UHFFFAOYSA-N 4-benzoyl-3-nitro-5-prop-2-ynoxybenzoic acid Chemical compound [O-][N+](=O)C1=CC(C(=O)O)=CC(OCC#C)=C1C(=O)C1=CC=CC=C1 IQQVMTJYKCHLLE-UHFFFAOYSA-N 0.000 description 2
- HAMFYDGMDONLMO-UHFFFAOYSA-N 4-benzoyl-3-phenylmethoxy-5-sulfamoylbenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1OCC1=CC=CC=C1 HAMFYDGMDONLMO-UHFFFAOYSA-N 0.000 description 2
- CQYYESGBQPQEOP-UHFFFAOYSA-N 4-benzyl-3-butoxy-5-sulfamoylbenzoic acid Chemical compound CCCCOC1=CC(C(O)=O)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 CQYYESGBQPQEOP-UHFFFAOYSA-N 0.000 description 2
- UFBHBAICZRHFGT-UHFFFAOYSA-N 4-benzyl-3-chlorosulfonyl-5-ethoxybenzoic acid Chemical compound CCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1CC1=CC=CC=C1 UFBHBAICZRHFGT-UHFFFAOYSA-N 0.000 description 2
- KHNGEFNAZXROLI-UHFFFAOYSA-N 4-benzyl-3-chlorosulfonyl-5-phenylmethoxybenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=C1 KHNGEFNAZXROLI-UHFFFAOYSA-N 0.000 description 2
- YVQUGCKTDWXADU-UHFFFAOYSA-N 4-benzyl-3-chlorosulfonyl-5-propoxybenzoic acid Chemical compound CCCOC1=CC(C(O)=O)=CC(S(Cl)(=O)=O)=C1CC1=CC=CC=C1 YVQUGCKTDWXADU-UHFFFAOYSA-N 0.000 description 2
- WGDSJANRFVENBV-UHFFFAOYSA-N 4-benzyl-3-phenylmethoxy-5-sulfamoylbenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1OCC1=CC=CC=C1 WGDSJANRFVENBV-UHFFFAOYSA-N 0.000 description 2
- NMUISIINDFJKPE-UHFFFAOYSA-N 4-benzyl-3-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC(C(O)=O)=CC=C1CC1=CC=CC=C1 NMUISIINDFJKPE-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- 206010020772 Hypertension Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- YTPLMLYBLZKORZ-UHFFFAOYSA-N Thiophene Chemical compound C=1C=CSC=1 YTPLMLYBLZKORZ-UHFFFAOYSA-N 0.000 description 2
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 239000011149 active material Substances 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 229910052783 alkali metal Inorganic materials 0.000 description 2
- 230000029936 alkylation Effects 0.000 description 2
- 238000005804 alkylation reaction Methods 0.000 description 2
- 208000026935 allergic disease Diseases 0.000 description 2
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- DMLAVOWQYNRWNQ-UHFFFAOYSA-N azobenzene Chemical compound C1=CC=CC=C1N=NC1=CC=CC=C1 DMLAVOWQYNRWNQ-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229960004064 bumetanide Drugs 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- BQVVSSAWECGTRN-UHFFFAOYSA-L copper;dithiocyanate Chemical compound [Cu+2].[S-]C#N.[S-]C#N BQVVSSAWECGTRN-UHFFFAOYSA-L 0.000 description 2
- 229960003280 cupric chloride Drugs 0.000 description 2
- 235000005911 diet Nutrition 0.000 description 2
- 230000000378 dietary effect Effects 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 230000002497 edematous effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003792 electrolyte Substances 0.000 description 2
- ZOOODBUHSVUZEM-UHFFFAOYSA-N ethoxymethanedithioic acid Chemical compound CCOC(S)=S ZOOODBUHSVUZEM-UHFFFAOYSA-N 0.000 description 2
- HYCCLAUBZWWXTL-UHFFFAOYSA-N ethyl 2,6-dioxo-3,7-dihydropurine-8-carboxylate Chemical compound N1C(=O)NC(=O)C2=C1N=C(C(=O)OCC)N2 HYCCLAUBZWWXTL-UHFFFAOYSA-N 0.000 description 2
- NXZXQPXXFLRERO-UHFFFAOYSA-N ethyl 4-benzoyl-3-hydroxy-5-nitrobenzoate Chemical compound [O-][N+](=O)C1=CC(C(=O)OCC)=CC(O)=C1C(=O)C1=CC=CC=C1 NXZXQPXXFLRERO-UHFFFAOYSA-N 0.000 description 2
- MDGIQKBCSXGLSJ-UHFFFAOYSA-N ethyl 4-benzyl-3-benzylsulfanyl-5-sulfamoylbenzoate Chemical compound C=1C=CC=CC=1CC=1C(S(N)(=O)=O)=CC(C(=O)OCC)=CC=1SCC1=CC=CC=C1 MDGIQKBCSXGLSJ-UHFFFAOYSA-N 0.000 description 2
- ZEWYOJXIXPXDCO-UHFFFAOYSA-N ethyl 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoate Chemical compound CCCCSC1=CC(C(=O)OCC)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 ZEWYOJXIXPXDCO-UHFFFAOYSA-N 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- 238000002955 isolation Methods 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- WMFOQBRAJBCJND-UHFFFAOYSA-M lithium hydroxide Inorganic materials [Li+].[OH-] WMFOQBRAJBCJND-UHFFFAOYSA-M 0.000 description 2
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 2
- 238000007911 parenteral administration Methods 0.000 description 2
- JCBJVAJGLKENNC-UHFFFAOYSA-M potassium ethyl xanthate Chemical compound [K+].CCOC([S-])=S JCBJVAJGLKENNC-UHFFFAOYSA-M 0.000 description 2
- 229910001414 potassium ion Inorganic materials 0.000 description 2
- ZNNZYHKDIALBAK-UHFFFAOYSA-M potassium thiocyanate Chemical compound [K+].[S-]C#N ZNNZYHKDIALBAK-UHFFFAOYSA-M 0.000 description 2
- 229940116357 potassium thiocyanate Drugs 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- FWPIDFUJEMBDLS-UHFFFAOYSA-L tin(II) chloride dihydrate Chemical compound O.O.Cl[Sn]Cl FWPIDFUJEMBDLS-UHFFFAOYSA-L 0.000 description 2
- 210000002700 urine Anatomy 0.000 description 2
- TXUICONDJPYNPY-UHFFFAOYSA-N (1,10,13-trimethyl-3-oxo-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) heptanoate Chemical compound C1CC2CC(=O)C=C(C)C2(C)C2C1C1CCC(OC(=O)CCCCCC)C1(C)CC2 TXUICONDJPYNPY-UHFFFAOYSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- AVMHMVJVHYGDOO-NSCUHMNNSA-N (e)-1-bromobut-2-ene Chemical compound C\C=C\CBr AVMHMVJVHYGDOO-NSCUHMNNSA-N 0.000 description 1
- WBYWAXJHAXSJNI-VOTSOKGWSA-M .beta-Phenylacrylic acid Natural products [O-]C(=O)\C=C\C1=CC=CC=C1 WBYWAXJHAXSJNI-VOTSOKGWSA-M 0.000 description 1
- CSNIZNHTOVFARY-UHFFFAOYSA-N 1,2-benzothiazole Chemical class C1=CC=C2C=NSC2=C1 CSNIZNHTOVFARY-UHFFFAOYSA-N 0.000 description 1
- BTNAZHHYONIOIV-UHFFFAOYSA-N 1,2-benzothiazole 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)N=CC2=C1 BTNAZHHYONIOIV-UHFFFAOYSA-N 0.000 description 1
- FVONCKXELOJWPR-UHFFFAOYSA-N 1-(2-chloroethylsulfanyl)butane Chemical compound CCCCSCCCl FVONCKXELOJWPR-UHFFFAOYSA-N 0.000 description 1
- VGISFWWEOGVMED-UHFFFAOYSA-N 1-(chloromethyl)-3-methoxybenzene Chemical compound COC1=CC=CC(CCl)=C1 VGISFWWEOGVMED-UHFFFAOYSA-N 0.000 description 1
- HLVFKOKELQSXIQ-UHFFFAOYSA-N 1-bromo-2-methylpropane Chemical compound CC(C)CBr HLVFKOKELQSXIQ-UHFFFAOYSA-N 0.000 description 1
- MNDIARAMWBIKFW-UHFFFAOYSA-N 1-bromohexane Chemical compound CCCCCCBr MNDIARAMWBIKFW-UHFFFAOYSA-N 0.000 description 1
- JQZAEUFPPSRDOP-UHFFFAOYSA-N 1-chloro-4-(chloromethyl)benzene Chemical compound ClCC1=CC=C(Cl)C=C1 JQZAEUFPPSRDOP-UHFFFAOYSA-N 0.000 description 1
- BDKLKNJTMLIAFE-UHFFFAOYSA-N 2-(3-fluorophenyl)-1,3-oxazole-4-carbaldehyde Chemical compound FC1=CC=CC(C=2OC=C(C=O)N=2)=C1 BDKLKNJTMLIAFE-UHFFFAOYSA-N 0.000 description 1
- YWECCEXWKFHHQJ-UHFFFAOYSA-N 2-(4-chlorobenzoyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1C(=O)C1=CC=C(Cl)C=C1 YWECCEXWKFHHQJ-UHFFFAOYSA-N 0.000 description 1
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 1
- ZFFTZDQKIXPDAF-UHFFFAOYSA-N 2-Furanmethanethiol Chemical compound SCC1=CC=CO1 ZFFTZDQKIXPDAF-UHFFFAOYSA-N 0.000 description 1
- ZRWICZHXYMHBDP-UHFFFAOYSA-N 2-chlorosulfonylbenzoic acid Chemical compound OC(=O)C1=CC=CC=C1S(Cl)(=O)=O ZRWICZHXYMHBDP-UHFFFAOYSA-N 0.000 description 1
- IIVWHGMLFGNMOW-UHFFFAOYSA-N 2-methylpropane Chemical compound C[C](C)C IIVWHGMLFGNMOW-UHFFFAOYSA-N 0.000 description 1
- KRTGJZMJJVEKRX-UHFFFAOYSA-N 2-phenylethan-1-yl Chemical compound [CH2]CC1=CC=CC=C1 KRTGJZMJJVEKRX-UHFFFAOYSA-N 0.000 description 1
- WMPPDTMATNBGJN-UHFFFAOYSA-N 2-phenylethylbromide Chemical compound BrCCC1=CC=CC=C1 WMPPDTMATNBGJN-UHFFFAOYSA-N 0.000 description 1
- KBWHYRUAHXHHFO-UHFFFAOYSA-N 3-(bromomethyl)thiophene Chemical compound BrCC=1C=CSC=1 KBWHYRUAHXHHFO-UHFFFAOYSA-N 0.000 description 1
- DQGCJXNKPVJGDC-UHFFFAOYSA-N 3-amino-4-(4-chlorobenzoyl)-5-nitrobenzoic acid Chemical compound NC1=CC(C(O)=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=C(Cl)C=C1 DQGCJXNKPVJGDC-UHFFFAOYSA-N 0.000 description 1
- KVOLOOPXKCMXHU-UHFFFAOYSA-N 3-amino-4-(4-methylbenzoyl)-5-nitrobenzoic acid Chemical compound C1=CC(C)=CC=C1C(=O)C1=C(N)C=C(C(O)=O)C=C1[N+]([O-])=O KVOLOOPXKCMXHU-UHFFFAOYSA-N 0.000 description 1
- DNEPIQXBZVVMFX-UHFFFAOYSA-N 3-amino-4-benzoyl-5-(3-methylbutyl)benzenecarbothioic s-acid Chemical compound CC(C)CCC1=CC(C(O)=S)=CC(N)=C1C(=O)C1=CC=CC=C1 DNEPIQXBZVVMFX-UHFFFAOYSA-N 0.000 description 1
- CCSKFWLTBOORAR-UHFFFAOYSA-N 3-amino-4-benzyl-5-phenylmethoxybenzoic acid Chemical compound C=1C=CC=CC=1CC=1C(N)=CC(C(O)=O)=CC=1OCC1=CC=CC=C1 CCSKFWLTBOORAR-UHFFFAOYSA-N 0.000 description 1
- MITOQHGFQYAQRS-UHFFFAOYSA-N 3-amino-4-benzyl-5-propylbenzenecarbothioic s-acid Chemical compound CCCC1=CC(C(O)=S)=CC(N)=C1CC1=CC=CC=C1 MITOQHGFQYAQRS-UHFFFAOYSA-N 0.000 description 1
- JPVKCHIPRSQDKL-UHFFFAOYSA-N 3-aminobenzenesulfonamide Chemical compound NC1=CC=CC(S(N)(=O)=O)=C1 JPVKCHIPRSQDKL-UHFFFAOYSA-N 0.000 description 1
- HERILFFCDZRBMN-UHFFFAOYSA-N 3-prop-2-ynoxybenzoic acid Chemical compound OC(=O)C1=CC=CC(OCC#C)=C1 HERILFFCDZRBMN-UHFFFAOYSA-N 0.000 description 1
- NAETXYOXMDYNLE-UHFFFAOYSA-N 3-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC=CC(C(O)=O)=C1 NAETXYOXMDYNLE-UHFFFAOYSA-N 0.000 description 1
- AQBBZYVPKBIILN-UHFFFAOYSA-N 4-(chloromethyl)-2-methyl-1,3-thiazole Chemical compound CC1=NC(CCl)=CS1 AQBBZYVPKBIILN-UHFFFAOYSA-N 0.000 description 1
- WZIYCIBURCPKAR-UHFFFAOYSA-N 4-(chloromethyl)pyridine Chemical compound ClCC1=CC=NC=C1 WZIYCIBURCPKAR-UHFFFAOYSA-N 0.000 description 1
- QPXVRWCAXUFGOH-UHFFFAOYSA-N 4-amino-1,1-dioxo-3-phenyl-1,2-benzothiazole-6-carboxylic acid Chemical compound NC1=CC(C(O)=O)=CC(S(N=2)(=O)=O)=C1C=2C1=CC=CC=C1 QPXVRWCAXUFGOH-UHFFFAOYSA-N 0.000 description 1
- BXJXFVMLZMBSEE-UHFFFAOYSA-N 4-benzoyl-3-but-2-enoxy-5-sulfamoylbenzoic acid Chemical compound C(C1=CC=CC=C1)(=O)C1=C(C=C(C(=O)O)C=C1S(N)(=O)=O)OCC=CC BXJXFVMLZMBSEE-UHFFFAOYSA-N 0.000 description 1
- HTDADKJLXAGYOA-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-methylbenzenecarbothioic s-acid Chemical compound CC1=CC(C(O)=S)=CC(S(Cl)(=O)=O)=C1C(=O)C1=CC=CC=C1 HTDADKJLXAGYOA-UHFFFAOYSA-N 0.000 description 1
- QQYOUXNWEVSCHY-UHFFFAOYSA-N 4-benzoyl-3-chlorosulfonyl-5-phenylmethoxybenzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(S(Cl)(=O)=O)=CC(C(=O)O)=CC=1OCC1=CC=CC=C1 QQYOUXNWEVSCHY-UHFFFAOYSA-N 0.000 description 1
- QYUPPINXPFCSIM-UHFFFAOYSA-N 4-benzoyl-3-sulfamoyl-5-(thiophen-3-ylmethoxy)benzoic acid Chemical compound C=1C=CC=CC=1C(=O)C=1C(S(=O)(=O)N)=CC(C(O)=O)=CC=1OCC=1C=CSC=1 QYUPPINXPFCSIM-UHFFFAOYSA-N 0.000 description 1
- PSEKQDISHVOBRX-UHFFFAOYSA-N 4-benzoyl-3-sulfamoylbenzoic acid Chemical class NS(=O)(=O)C1=CC(C(O)=O)=CC=C1C(=O)C1=CC=CC=C1 PSEKQDISHVOBRX-UHFFFAOYSA-N 0.000 description 1
- IRJLYGMTHUGDHR-UHFFFAOYSA-N 4-benzyl-3-chlorosulfonyl-5-methylbenzenecarbothioic s-acid Chemical compound CC1=CC(C(O)=S)=CC(S(Cl)(=O)=O)=C1CC1=CC=CC=C1 IRJLYGMTHUGDHR-UHFFFAOYSA-N 0.000 description 1
- GWWRSUVJNHPWMV-UHFFFAOYSA-N 4-benzyl-3-chlorosulfonyl-5-propylbenzenecarbothioic s-acid Chemical compound CCCC1=CC(C(O)=S)=CC(S(Cl)(=O)=O)=C1CC1=CC=CC=C1 GWWRSUVJNHPWMV-UHFFFAOYSA-N 0.000 description 1
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- 206010048962 Brain oedema Diseases 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- QZEMZWPRHOSQRP-UHFFFAOYSA-N C1(=CC=CC=C1)CCC1=C(C=CC=C1)N=NC1=CC=CC=C1 Chemical compound C1(=CC=CC=C1)CCC1=C(C=CC=C1)N=NC1=CC=CC=C1 QZEMZWPRHOSQRP-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-SREVYHEPSA-N Cinnamic acid Chemical compound OC(=O)\C=C/C1=CC=CC=C1 WBYWAXJHAXSJNI-SREVYHEPSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical class [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 1
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 1
- 238000007192 Meerwein reaction reaction Methods 0.000 description 1
- IHAIQUNWCVTVMQ-UHFFFAOYSA-N N#[N+]C1=C(C(C2=CC=CC=C2)=O)C([N+]([O-])=O)=CC(C([O-])=O)=C1 Chemical compound N#[N+]C1=C(C(C2=CC=CC=C2)=O)C([N+]([O-])=O)=CC(C([O-])=O)=C1 IHAIQUNWCVTVMQ-UHFFFAOYSA-N 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 208000004880 Polyuria Diseases 0.000 description 1
- NPYPAHLBTDXSSS-UHFFFAOYSA-N Potassium ion Chemical compound [K+] NPYPAHLBTDXSSS-UHFFFAOYSA-N 0.000 description 1
- 206010037423 Pulmonary oedema Diseases 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- 229920002472 Starch Polymers 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 230000002159 abnormal effect Effects 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000002009 alkene group Chemical group 0.000 description 1
- 230000002152 alkylating effect Effects 0.000 description 1
- 230000009435 amidation Effects 0.000 description 1
- 238000007112 amidation reaction Methods 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 238000007098 aminolysis reaction Methods 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 238000010171 animal model Methods 0.000 description 1
- 125000005279 aryl sulfonyloxy group Chemical group 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- UENWRTRMUIOCKN-UHFFFAOYSA-N benzyl thiol Chemical compound SCC1=CC=CC=C1 UENWRTRMUIOCKN-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 208000006752 brain edema Diseases 0.000 description 1
- 125000001246 bromo group Chemical group Br* 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000002775 capsule Substances 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229930016911 cinnamic acid Natural products 0.000 description 1
- 235000013985 cinnamic acid Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 150000004683 dihydrates Chemical class 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 229940030606 diuretics Drugs 0.000 description 1
- 229940079593 drug Drugs 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 239000012259 ether extract Substances 0.000 description 1
- PUSKHXMZPOMNTQ-UHFFFAOYSA-N ethyl 2,1,3-benzoselenadiazole-5-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=[Se]=NC2=C1 PUSKHXMZPOMNTQ-UHFFFAOYSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000000284 extract Substances 0.000 description 1
- 239000003925 fat Substances 0.000 description 1
- 125000001153 fluoro group Chemical group F* 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 229960003883 furosemide Drugs 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 210000002216 heart Anatomy 0.000 description 1
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 230000009610 hypersensitivity Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 210000003734 kidney Anatomy 0.000 description 1
- 239000008101 lactose Substances 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- ZPLJFKAOGIWKGC-UHFFFAOYSA-M lithium;nitrite;hydrate Chemical compound [Li+].O.[O-]N=O ZPLJFKAOGIWKGC-UHFFFAOYSA-M 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 231100000053 low toxicity Toxicity 0.000 description 1
- 235000019359 magnesium stearate Nutrition 0.000 description 1
- 230000014759 maintenance of location Effects 0.000 description 1
- UKVIEHSSVKSQBA-UHFFFAOYSA-N methane;palladium Chemical compound C.[Pd] UKVIEHSSVKSQBA-UHFFFAOYSA-N 0.000 description 1
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 1
- UERWBBOZQWHNJC-UHFFFAOYSA-N methyl 4-benzyl-3-butylsulfanyl-5-sulfamoylbenzoate Chemical compound CCCCSC1=CC(C(=O)OC)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 UERWBBOZQWHNJC-UHFFFAOYSA-N 0.000 description 1
- WBYWAXJHAXSJNI-UHFFFAOYSA-N methyl p-hydroxycinnamate Natural products OC(=O)C=CC1=CC=CC=C1 WBYWAXJHAXSJNI-UHFFFAOYSA-N 0.000 description 1
- 150000004682 monohydrates Chemical class 0.000 description 1
- 125000006606 n-butoxy group Chemical group 0.000 description 1
- 125000004712 n-pentylthio group Chemical group C(CCCC)S* 0.000 description 1
- PVWOIHVRPOBWPI-UHFFFAOYSA-N n-propyl iodide Chemical compound CCCI PVWOIHVRPOBWPI-UHFFFAOYSA-N 0.000 description 1
- YCWSUKQGVSGXJO-NTUHNPAUSA-N nifuroxazide Chemical group C1=CC(O)=CC=C1C(=O)N\N=C\C1=CC=C([N+]([O-])=O)O1 YCWSUKQGVSGXJO-NTUHNPAUSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 230000001575 pathological effect Effects 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 230000004962 physiological condition Effects 0.000 description 1
- 239000006187 pill Substances 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- DITHIFQMPPCBCU-UHFFFAOYSA-N propa-1,2-diene Chemical compound [CH]=C=C DITHIFQMPPCBCU-UHFFFAOYSA-N 0.000 description 1
- YORCIIVHUBAYBQ-UHFFFAOYSA-N propargyl bromide Chemical compound BrCC#C YORCIIVHUBAYBQ-UHFFFAOYSA-N 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 208000005333 pulmonary edema Diseases 0.000 description 1
- 230000002685 pulmonary effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 230000002441 reversible effect Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000012047 saturated solution Substances 0.000 description 1
- IFVPGFXWENMXJK-UHFFFAOYSA-M sodium 4-benzoyl-3-butoxy-5-nitrobenzoate Chemical compound [Na+].CCCCOC1=CC(C([O-])=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 IFVPGFXWENMXJK-UHFFFAOYSA-M 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 229940087562 sodium acetate trihydrate Drugs 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- DHGQRZGJIURQFE-UHFFFAOYSA-M sodium;4-benzoyl-3-(2-methylpropoxy)-5-nitrobenzoate Chemical compound [Na+].CC(C)COC1=CC(C([O-])=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 DHGQRZGJIURQFE-UHFFFAOYSA-M 0.000 description 1
- OFACFKJBPHGQFC-UHFFFAOYSA-M sodium;4-benzoyl-3-ethoxy-5-nitrobenzoate Chemical compound [Na+].CCOC1=CC(C([O-])=O)=CC([N+]([O-])=O)=C1C(=O)C1=CC=CC=C1 OFACFKJBPHGQFC-UHFFFAOYSA-M 0.000 description 1
- HXQWBFMBHOMMCL-UHFFFAOYSA-M sodium;4-benzoyl-3-phenylmethoxy-5-sulfamoylbenzoate Chemical compound [Na+].C=1C=CC=CC=1C(=O)C=1C(S(=O)(=O)N)=CC(C([O-])=O)=CC=1OCC1=CC=CC=C1 HXQWBFMBHOMMCL-UHFFFAOYSA-M 0.000 description 1
- DNOLFHZDLGPWPX-UHFFFAOYSA-M sodium;4-benzyl-3-propylsulfanyl-5-sulfamoylbenzoate Chemical compound [Na+].CCCSC1=CC(C([O-])=O)=CC(S(N)(=O)=O)=C1CC1=CC=CC=C1 DNOLFHZDLGPWPX-UHFFFAOYSA-M 0.000 description 1
- 239000001119 stannous chloride Substances 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000008107 starch Substances 0.000 description 1
- 235000019698 starch Nutrition 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- 229930192474 thiophene Natural products 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/61—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by doubly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/78—Halides of sulfonic acids
- C07C309/86—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/89—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/22—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms
- C07C311/29—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/66—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfo, esterified sulfo or halosulfonyl groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/26—Radicals substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1995972A GB1406882A (en) | 1972-04-28 | 1972-04-28 | Benzoic acid derivatives and benzisptjoaup'e 1.1 dopxode derovatoves |
| GB5304372 | 1972-11-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2321518A1 DE2321518A1 (de) | 1973-11-15 |
| DE2321518C2 true DE2321518C2 (de) | 1986-07-31 |
Family
ID=26254338
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2321518A Expired DE2321518C2 (de) | 1972-04-28 | 1973-04-27 | Sulfamylbenzoesäuren und deren Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Mittel |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3897476A (enExample) |
| JP (1) | JPS57313B2 (enExample) |
| AR (1) | AR204908A1 (enExample) |
| AT (1) | AT326629B (enExample) |
| CA (1) | CA1004677A (enExample) |
| CH (2) | CH587805A5 (enExample) |
| DD (1) | DD109619A5 (enExample) |
| DE (1) | DE2321518C2 (enExample) |
| FR (1) | FR2183725B1 (enExample) |
| GB (1) | GB1406882A (enExample) |
| HU (1) | HU166256B (enExample) |
| IE (1) | IE37490B1 (enExample) |
| LU (1) | LU67514A1 (enExample) |
| NL (1) | NL7305844A (enExample) |
| PH (1) | PH9438A (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3229453A1 (de) * | 1981-09-01 | 1983-03-10 | SPOFA spojené podniky pro zdravotnickou výrobu, 13000 Praha | Substituierte n-anilino-4-chlor-3-sulfamoylbenzamide, ihre herstellung und pharmazeutische mittel |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3770801A (en) * | 1971-04-16 | 1973-11-06 | Rohm & Haas | Esters of sulfo-benzoic and phthalic acid |
| US3972886A (en) * | 1972-07-13 | 1976-08-03 | Leo Pharmaceutical Products Ltd. | Certain 4-phenoxy-3-heteroarylmethyl or ethyl sulfamyl benzoic acid derivatives |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| DE3216843C2 (de) * | 1982-05-05 | 1986-10-23 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | 3-Thiomethyl-pyridin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US4868188A (en) * | 1982-11-03 | 1989-09-19 | Hoechst-Roussel Pharmaceuticals, Inc. | 4-(Benzisothiazol-3-yl)phenoxyacetic acid 1',1'-dioxides as diuretics |
| DE59205384D1 (de) * | 1991-07-17 | 1996-03-28 | Ciba Geigy Ag | Nematizide Mittel |
| DE19532311A1 (de) * | 1995-09-01 | 1997-03-06 | Basf Ag | Benzoylderivate |
| EP1647549A1 (en) * | 2004-10-14 | 2006-04-19 | Laboratoire Theramex | Indazoles, benzisoxazoles and benzisothiazoles as estrogenic agents |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3493584A (en) * | 1966-02-21 | 1970-02-03 | Smithkline Corp | 4-substituted amino-5-sulfamoylbenzoic acid derivatives and preparation |
| GB1249490A (en) * | 1968-12-24 | 1971-10-13 | Leo Pharm Prod Ltd | New sulphamyl-benzoic acid derivatives |
| US3758522A (en) * | 1970-06-18 | 1973-09-11 | Leo Pharm Prod Ltd | Certain sulfamylbenzoic acids, esters thereof, and pharmaceutically acceptable salts thereof |
| BE768706A (fr) * | 1970-06-18 | 1971-12-20 | Leo Pharm Prod Ltd | Nouveaux acides sulfamoylbenzoiques |
| CA919668A (en) * | 1970-06-20 | 1973-01-23 | Murakami Masuo | Morphinan derivatives |
| GB1327482A (en) * | 1970-06-30 | 1973-08-22 | Leo Pharm Prod Ltd | 1,2-benzisothiazole-1,1-dioxide derivatives |
-
1972
- 1972-04-28 GB GB1995972A patent/GB1406882A/en not_active Expired
-
1973
- 1973-01-01 AR AR247693A patent/AR204908A1/es active
- 1973-04-03 IE IE519/73A patent/IE37490B1/xx unknown
- 1973-04-10 US US349826A patent/US3897476A/en not_active Expired - Lifetime
- 1973-04-17 PH PH14520*UA patent/PH9438A/en unknown
- 1973-04-24 AT AT360373A patent/AT326629B/de not_active IP Right Cessation
- 1973-04-26 NL NL7305844A patent/NL7305844A/xx not_active Application Discontinuation
- 1973-04-26 FR FR7315218A patent/FR2183725B1/fr not_active Expired
- 1973-04-26 JP JP4680373A patent/JPS57313B2/ja not_active Expired
- 1973-04-27 CH CH608573A patent/CH587805A5/xx not_active IP Right Cessation
- 1973-04-27 DE DE2321518A patent/DE2321518C2/de not_active Expired
- 1973-04-27 CH CH396176A patent/CH587806A5/xx not_active IP Right Cessation
- 1973-04-27 DD DD170479A patent/DD109619A5/xx unknown
- 1973-04-27 CA CA169,718A patent/CA1004677A/en not_active Expired
- 1973-04-27 LU LU67514A patent/LU67514A1/xx unknown
- 1973-04-27 HU HULE696A patent/HU166256B/hu unknown
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3229453A1 (de) * | 1981-09-01 | 1983-03-10 | SPOFA spojené podniky pro zdravotnickou výrobu, 13000 Praha | Substituierte n-anilino-4-chlor-3-sulfamoylbenzamide, ihre herstellung und pharmazeutische mittel |
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4954352A (enExample) | 1974-05-27 |
| CH587805A5 (enExample) | 1977-05-13 |
| JPS57313B2 (enExample) | 1982-01-06 |
| PH9438A (en) | 1975-11-26 |
| GB1406882A (en) | 1975-09-17 |
| CH587806A5 (enExample) | 1977-05-13 |
| AT326629B (de) | 1975-12-29 |
| FR2183725A1 (enExample) | 1973-12-21 |
| DE2321518A1 (de) | 1973-11-15 |
| IE37490B1 (en) | 1977-08-03 |
| AR204908A1 (es) | 1976-03-19 |
| NL7305844A (enExample) | 1973-10-30 |
| IE37490L (en) | 1973-10-28 |
| DD109619A5 (enExample) | 1974-11-12 |
| CA1004677A (en) | 1977-02-01 |
| HU166256B (enExample) | 1975-02-28 |
| LU67514A1 (enExample) | 1973-07-13 |
| ATA360373A (de) | 1975-03-15 |
| FR2183725B1 (enExample) | 1976-12-31 |
| US3897476A (en) | 1975-07-29 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2451417C3 (de) | Ester der 6,-Dimethyl-4-hydroxymethyl- l-phthalazon-7-carbonsäure, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2419970A1 (de) | Tertiaere cyclische amine und verfahren zu ihrer herstellung | |
| DE2055496A1 (de) | Entzündungshemmende Pyndonver bindungen | |
| CH623580A5 (enExample) | ||
| DE2634903C2 (de) | Tetrahydrothieno-[3,2-c]-pyridin-Derivate und sie enthaltende Arzneimittel | |
| DE2321518C2 (de) | Sulfamylbenzoesäuren und deren Derivate, Verfahren zu deren Herstellung und diese Verbindungen enthaltende pharmazeutische Mittel | |
| DE1923306A1 (de) | Heterocyclische Verbindungen,Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2537070C2 (enExample) | ||
| DE2453977A1 (de) | Neue ferrocen verbindungen und verfahren zu deren herstellung sowie pharmazeutische zusammensetzungen | |
| CH504416A (de) | Verfahren zur Herstellung von aromatischen Sulfamoylverbindungen | |
| DE2442696A1 (de) | Phenylbenzoesaeurederivate und verfahren zu ihrer herstellung | |
| EP0003144A2 (de) | 4-Pyridon-3-carbonsäurederivate, diese enthaltende pharmazeutische Präparate und deren Herstellung sowie deren Verwendung | |
| DE1667893A1 (de) | Neue Anthelminthica | |
| CH621126A5 (enExample) | ||
| DE2021105A1 (de) | Neue Sulfamylanthranilsaeuren | |
| DE1919381B2 (de) | Heterocyclische Verbindungen und Verfahren zu deren Herstellung | |
| DE3883164T2 (de) | Rhodanin-Derivate, Verfahren zu ihrer Herstellung, ihre Anwendung und pharmazeutische Zusammensetzungen, die sie enthalten. | |
| DE2550959C3 (de) | Tetrazolyl-imidazole und Tetrazolyl--benzimidazole, Verfahren zu deren Herstellung und diese enthaltende Arzneimittel | |
| DE2106038C3 (de) | 2-Imidazolin-2-ylamino-benzo [b] thiophene und diese enthaltende pharmazeutische Präparate | |
| DE3152942T1 (de) | Heterocyclisch substituierte amidinoharnstoffe und ihre therapeutische anwendung | |
| DE3017977A1 (de) | Neue substituierte 2(3h)-benzothiazolone | |
| DE1445579A1 (de) | Neue Aminopyrazole | |
| DE2132609A1 (de) | Neue Substituierte 6-Carboxy-1,2-benzisothiazol-1,1-dioxyde | |
| DE2335507C2 (de) | Sulfamylbenzoesäurederivate, Verfahren zu deren Herstellung und sie enthaltendes pharmazeutisches Mittel | |
| DE1445438C (enExample) |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8128 | New person/name/address of the agent |
Representative=s name: KINZEBACH, W., DIPL.-CHEM. DR.PHIL. RIEDL, P., DIP |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |