IE37490B1 - Novel benzoic acid derivatives and benzisothiazole 1,1 dioxide derivatives - Google Patents
Novel benzoic acid derivatives and benzisothiazole 1,1 dioxide derivativesInfo
- Publication number
- IE37490B1 IE37490B1 IE519/73A IE51973A IE37490B1 IE 37490 B1 IE37490 B1 IE 37490B1 IE 519/73 A IE519/73 A IE 519/73A IE 51973 A IE51973 A IE 51973A IE 37490 B1 IE37490 B1 IE 37490B1
- Authority
- IE
- Ireland
- Prior art keywords
- derivatives
- benzisothiazole
- benzoic acid
- dioxide
- stands
- Prior art date
Links
- BTNAZHHYONIOIV-UHFFFAOYSA-N 1,2-benzothiazole 1,1-dioxide Chemical class C1=CC=C2S(=O)(=O)N=CC2=C1 BTNAZHHYONIOIV-UHFFFAOYSA-N 0.000 title 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 title 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 abstract 1
- 239000005864 Sulphur Substances 0.000 abstract 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical class [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 125000003342 alkenyl group Chemical group 0.000 abstract 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- HZVOZRGWRWCICA-UHFFFAOYSA-N methanediyl Chemical compound [CH2] HZVOZRGWRWCICA-UHFFFAOYSA-N 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 239000001301 oxygen Substances 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/30—Oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C205/00—Compounds containing nitro groups bound to a carbon skeleton
- C07C205/49—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
- C07C205/57—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton
- C07C205/61—Compounds containing nitro groups bound to a carbon skeleton the carbon skeleton being further substituted by carboxyl groups having nitro groups and carboxyl groups bound to carbon atoms of six-membered aromatic rings of the carbon skeleton the carbon skeleton being further substituted by doubly-bound oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/78—Halides of sulfonic acids
- C07C309/86—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton
- C07C309/89—Halides of sulfonic acids having halosulfonyl groups bound to carbon atoms of six-membered aromatic rings of a carbon skeleton containing carboxyl groups bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/22—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms
- C07C311/29—Sulfonamides, the carbon skeleton of the acid part being further substituted by singly-bound oxygen atoms having the sulfur atom of at least one of the sulfonamide groups bound to a carbon atom of a six-membered aromatic ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/64—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton
- C07C323/66—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and sulfur atoms, not being part of thio groups, bound to the same carbon skeleton containing sulfur atoms of sulfo, esterified sulfo or halosulfonyl groups, bound to the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/28—Radicals substituted by singly-bound oxygen or sulphur atoms
- C07D213/32—Sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D275/00—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings
- C07D275/04—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems
- C07D275/06—Heterocyclic compounds containing 1,2-thiazole or hydrogenated 1,2-thiazole rings condensed with carbocyclic rings or ring systems with hetero atoms directly attached to the ring sulfur atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D277/00—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings
- C07D277/02—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings
- C07D277/20—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D277/22—Heterocyclic compounds containing 1,3-thiazole or hydrogenated 1,3-thiazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D277/26—Radicals substituted by sulfur atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Heterocyclic Compounds Containing Sulfur Atoms (AREA)
- Thiazole And Isothizaole Compounds (AREA)
- Furan Compounds (AREA)
- Pyridine Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB1995972A GB1406882A (en) | 1972-04-28 | 1972-04-28 | Benzoic acid derivatives and benzisptjoaup'e 1.1 dopxode derovatoves |
| GB5304372 | 1972-11-16 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| IE37490L IE37490L (en) | 1973-10-28 |
| IE37490B1 true IE37490B1 (en) | 1977-08-03 |
Family
ID=26254338
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| IE519/73A IE37490B1 (en) | 1972-04-28 | 1973-04-03 | Novel benzoic acid derivatives and benzisothiazole 1,1 dioxide derivatives |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3897476A (enExample) |
| JP (1) | JPS57313B2 (enExample) |
| AR (1) | AR204908A1 (enExample) |
| AT (1) | AT326629B (enExample) |
| CA (1) | CA1004677A (enExample) |
| CH (2) | CH587806A5 (enExample) |
| DD (1) | DD109619A5 (enExample) |
| DE (1) | DE2321518C2 (enExample) |
| FR (1) | FR2183725B1 (enExample) |
| GB (1) | GB1406882A (enExample) |
| HU (1) | HU166256B (enExample) |
| IE (1) | IE37490B1 (enExample) |
| LU (1) | LU67514A1 (enExample) |
| NL (1) | NL7305844A (enExample) |
| PH (1) | PH9438A (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3770801A (en) * | 1971-04-16 | 1973-11-06 | Rohm & Haas | Esters of sulfo-benzoic and phthalic acid |
| US3972886A (en) * | 1972-07-13 | 1976-08-03 | Leo Pharmaceutical Products Ltd. | Certain 4-phenoxy-3-heteroarylmethyl or ethyl sulfamyl benzoic acid derivatives |
| DE2737195A1 (de) * | 1977-08-18 | 1979-03-01 | Hoechst Ag | Benzolsulfonamidderivate und verfahren zu ihrer herstellung |
| CS220569B1 (en) * | 1981-09-01 | 1983-04-29 | Otilie Uhlova | Substituted n-aniline-4-chloro-3-sulphamoylbenzamides and method of preparing same |
| DE3216843C2 (de) * | 1982-05-05 | 1986-10-23 | Ludwig Heumann & Co GmbH, 8500 Nürnberg | 3-Thiomethyl-pyridin-Derivate, Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende Arzneimittel |
| US4868188A (en) * | 1982-11-03 | 1989-09-19 | Hoechst-Roussel Pharmaceuticals, Inc. | 4-(Benzisothiazol-3-yl)phenoxyacetic acid 1',1'-dioxides as diuretics |
| ES2084324T3 (es) * | 1991-07-17 | 1996-05-01 | Ciba Geigy Ag | Agentes nematicidas. |
| DE19532311A1 (de) * | 1995-09-01 | 1997-03-06 | Basf Ag | Benzoylderivate |
| EP1647549A1 (en) * | 2004-10-14 | 2006-04-19 | Laboratoire Theramex | Indazoles, benzisoxazoles and benzisothiazoles as estrogenic agents |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3493584A (en) * | 1966-02-21 | 1970-02-03 | Smithkline Corp | 4-substituted amino-5-sulfamoylbenzoic acid derivatives and preparation |
| GB1249490A (en) * | 1968-12-24 | 1971-10-13 | Leo Pharm Prod Ltd | New sulphamyl-benzoic acid derivatives |
| BE768706A (fr) * | 1970-06-18 | 1971-12-20 | Leo Pharm Prod Ltd | Nouveaux acides sulfamoylbenzoiques |
| US3758522A (en) * | 1970-06-18 | 1973-09-11 | Leo Pharm Prod Ltd | Certain sulfamylbenzoic acids, esters thereof, and pharmaceutically acceptable salts thereof |
| CA919668A (en) * | 1970-06-20 | 1973-01-23 | Murakami Masuo | Morphinan derivatives |
| GB1327482A (en) * | 1970-06-30 | 1973-08-22 | Leo Pharm Prod Ltd | 1,2-benzisothiazole-1,1-dioxide derivatives |
-
1972
- 1972-04-28 GB GB1995972A patent/GB1406882A/en not_active Expired
-
1973
- 1973-01-01 AR AR247693A patent/AR204908A1/es active
- 1973-04-03 IE IE519/73A patent/IE37490B1/xx unknown
- 1973-04-10 US US349826A patent/US3897476A/en not_active Expired - Lifetime
- 1973-04-17 PH PH14520*UA patent/PH9438A/en unknown
- 1973-04-24 AT AT360373A patent/AT326629B/de not_active IP Right Cessation
- 1973-04-26 JP JP4680373A patent/JPS57313B2/ja not_active Expired
- 1973-04-26 NL NL7305844A patent/NL7305844A/xx not_active Application Discontinuation
- 1973-04-26 FR FR7315218A patent/FR2183725B1/fr not_active Expired
- 1973-04-27 DD DD170479A patent/DD109619A5/xx unknown
- 1973-04-27 CH CH396176A patent/CH587806A5/xx not_active IP Right Cessation
- 1973-04-27 LU LU67514A patent/LU67514A1/xx unknown
- 1973-04-27 CA CA169,718A patent/CA1004677A/en not_active Expired
- 1973-04-27 HU HULE696A patent/HU166256B/hu unknown
- 1973-04-27 DE DE2321518A patent/DE2321518C2/de not_active Expired
- 1973-04-27 CH CH608573A patent/CH587805A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| AT326629B (de) | 1975-12-29 |
| AR204908A1 (es) | 1976-03-19 |
| DE2321518A1 (de) | 1973-11-15 |
| CH587805A5 (enExample) | 1977-05-13 |
| NL7305844A (enExample) | 1973-10-30 |
| LU67514A1 (enExample) | 1973-07-13 |
| HU166256B (enExample) | 1975-02-28 |
| US3897476A (en) | 1975-07-29 |
| FR2183725B1 (enExample) | 1976-12-31 |
| DE2321518C2 (de) | 1986-07-31 |
| JPS57313B2 (enExample) | 1982-01-06 |
| GB1406882A (en) | 1975-09-17 |
| CH587806A5 (enExample) | 1977-05-13 |
| JPS4954352A (enExample) | 1974-05-27 |
| FR2183725A1 (enExample) | 1973-12-21 |
| CA1004677A (en) | 1977-02-01 |
| DD109619A5 (enExample) | 1974-11-12 |
| ATA360373A (de) | 1975-03-15 |
| IE37490L (en) | 1973-10-28 |
| PH9438A (en) | 1975-11-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| PT66271A (en) | Process for the preparation of a parasiticidal composition containing 4,5-dichloroimidazole-2-carboxilic acid derivatives and salts thereof | |
| IE41383L (en) | Piperidinylimidazolinone derivatives | |
| IE37490B1 (en) | Novel benzoic acid derivatives and benzisothiazole 1,1 dioxide derivatives | |
| IE39602L (en) | Alkoxyalkyl-1,4-dihydropyridines | |
| IE41440L (en) | Thiatetracyclines | |
| IE38979L (en) | Tetrazolyl - quinoxalinecarboxamide derivatives | |
| SE7807054L (sv) | Nya amidinopenicillansyraderivat, salter och estrar derav samt farmaceutiska kompositioner innehallande desamma | |
| IE37989B1 (en) | New 2-alkylamino-dihydropyridines their production and their medicinal use | |
| GB1381320A (en) | Benzoxazole derivatives | |
| IE37573L (en) | Thiocarbamic acid derivatives | |
| IE36598L (en) | Phthalazone derivatives | |
| JPS5228310A (en) | Endless tape cartridge | |
| CA989834A (en) | 3,4-dihydro-6,7-substituted-2,3-lower alkyl-4-oxo-1(2h)-quinazolecarboxylic acid derivatives useful as analgesic and tranquilizer agents | |
| JPS5297934A (en) | N#-arylsulfonyl-l-argininamides and their salts acceptable as medicine s | |
| DK411981A (da) | Beta-lactamer fremgangsmaade til fremstilling deraf og deres anvendelse som antibiotika | |
| IE38561B1 (en) | 1,4-dithiino 2,3-cpyrrole derivatives | |
| CA1017341A (en) | 1,7-dialkyl-1,2-dihydro-4-hydroxy-1,8-naphthyridine-3-carboxylic acid alkyl esters | |
| IE35052L (en) | Indenopyridines. | |
| IE38268B1 (en) | 4-ethers of 3-amino-5-sulfamoyl benzoic acids process for their mnufacture and pharmaceutical preparations containing them | |
| JPS52118464A (en) | Alpha-substituted aminoalkanyloxyindole derivatives and method of preparing the same | |
| ES416789A1 (es) | Metodo para producir nuevos derivados del acido sulfamil- benzoico. | |
| ES461718A1 (es) | Procedimiento para la obtencion de composiciones herbicidas | |
| HU178753B (en) | Herbicide compositions containing carbamicid acid ester derivatives as active materials and process for preparing the active materials | |
| JPS5268149A (en) | Preparation of novel 16-hydroxymethylprostadienoic acid derivatives | |
| IL50467A0 (en) | New derivatives of 3-(3,5-dichlorophenyl)-ureidoacetic acid processes for the preparation thereof and fungicidal compositions containing the same |