DE2317175A1 - Nicht staeubende formstabile farbstoffgranulate und verfahren zu deren herstellung - Google Patents
Nicht staeubende formstabile farbstoffgranulate und verfahren zu deren herstellungInfo
- Publication number
- DE2317175A1 DE2317175A1 DE2317175A DE2317175A DE2317175A1 DE 2317175 A1 DE2317175 A1 DE 2317175A1 DE 2317175 A DE2317175 A DE 2317175A DE 2317175 A DE2317175 A DE 2317175A DE 2317175 A1 DE2317175 A1 DE 2317175A1
- Authority
- DE
- Germany
- Prior art keywords
- dye
- weight
- percent
- granules
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000008187 granular material Substances 0.000 title claims description 47
- 238000010410 dusting Methods 0.000 title claims description 9
- 238000000034 method Methods 0.000 title claims description 7
- 238000004519 manufacturing process Methods 0.000 title claims description 6
- 239000000975 dye Substances 0.000 claims description 76
- 239000000203 mixture Substances 0.000 claims description 20
- 239000002270 dispersing agent Substances 0.000 claims description 12
- 239000000080 wetting agent Substances 0.000 claims description 12
- 239000000654 additive Substances 0.000 claims description 11
- 229920001353 Dextrin Polymers 0.000 claims description 10
- 239000004375 Dextrin Substances 0.000 claims description 10
- 239000011230 binding agent Substances 0.000 claims description 10
- 235000019425 dextrin Nutrition 0.000 claims description 10
- 125000002091 cationic group Chemical group 0.000 claims description 6
- 239000000945 filler Substances 0.000 claims description 6
- 229920001732 Lignosulfonate Polymers 0.000 claims description 5
- 239000003795 chemical substances by application Substances 0.000 claims description 5
- 235000019329 dioctyl sodium sulphosuccinate Nutrition 0.000 claims description 5
- YHAIUSTWZPMYGG-UHFFFAOYSA-L disodium;2,2-dioctyl-3-sulfobutanedioate Chemical compound [Na+].[Na+].CCCCCCCCC(C([O-])=O)(C(C([O-])=O)S(O)(=O)=O)CCCCCCCC YHAIUSTWZPMYGG-UHFFFAOYSA-L 0.000 claims description 5
- YRIUSKIDOIARQF-UHFFFAOYSA-N dodecyl benzenesulfonate Chemical compound CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 YRIUSKIDOIARQF-UHFFFAOYSA-N 0.000 claims description 5
- 229940071161 dodecylbenzenesulfonate Drugs 0.000 claims description 5
- 150000003871 sulfonates Chemical class 0.000 claims description 5
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 4
- 125000000129 anionic group Chemical group 0.000 claims description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 claims description 3
- 239000007859 condensation product Substances 0.000 claims description 3
- 150000003839 salts Chemical class 0.000 claims description 3
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 claims description 2
- 229910000013 Ammonium bicarbonate Inorganic materials 0.000 claims description 2
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims description 2
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 2
- 150000008055 alkyl aryl sulfonates Chemical class 0.000 claims description 2
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 claims description 2
- 150000008052 alkyl sulfonates Chemical class 0.000 claims description 2
- 235000012538 ammonium bicarbonate Nutrition 0.000 claims description 2
- 239000001099 ammonium carbonate Substances 0.000 claims description 2
- 239000004202 carbamide Substances 0.000 claims description 2
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 2
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims description 2
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims description 2
- 239000001913 cellulose Substances 0.000 claims description 2
- 229920002678 cellulose Polymers 0.000 claims description 2
- 235000010980 cellulose Nutrition 0.000 claims description 2
- 239000007884 disintegrant Substances 0.000 claims description 2
- 229920000159 gelatin Polymers 0.000 claims description 2
- 235000019322 gelatine Nutrition 0.000 claims description 2
- 235000011187 glycerol Nutrition 0.000 claims description 2
- 239000003906 humectant Substances 0.000 claims description 2
- OPUAWDUYWRUIIL-UHFFFAOYSA-L methanedisulfonate Chemical compound [O-]S(=O)(=O)CS([O-])(=O)=O OPUAWDUYWRUIIL-UHFFFAOYSA-L 0.000 claims description 2
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 claims description 2
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 2
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 2
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 2
- 229920001592 potato starch Polymers 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 229940116560 sodium bicarbonate / tartaric acid Drugs 0.000 claims description 2
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 2
- 239000002562 thickening agent Substances 0.000 claims description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims 2
- 229920002261 Corn starch Polymers 0.000 claims 1
- 108010010803 Gelatin Proteins 0.000 claims 1
- 150000008051 alkyl sulfates Chemical class 0.000 claims 1
- 239000008120 corn starch Substances 0.000 claims 1
- 239000006185 dispersion Substances 0.000 claims 1
- 239000008273 gelatin Substances 0.000 claims 1
- 235000011852 gelatine desserts Nutrition 0.000 claims 1
- 238000000227 grinding Methods 0.000 claims 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 claims 1
- 239000000377 silicon dioxide Substances 0.000 claims 1
- 235000012239 silicon dioxide Nutrition 0.000 claims 1
- 239000013589 supplement Substances 0.000 claims 1
- 239000000843 powder Substances 0.000 description 24
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 18
- -1 polyazo Polymers 0.000 description 10
- 238000005469 granulation Methods 0.000 description 8
- 230000003179 granulation Effects 0.000 description 8
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 7
- 229910052938 sodium sulfate Inorganic materials 0.000 description 7
- 235000011152 sodium sulphate Nutrition 0.000 description 7
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 6
- 235000014113 dietary fatty acids Nutrition 0.000 description 6
- 239000000194 fatty acid Substances 0.000 description 6
- 229930195729 fatty acid Natural products 0.000 description 6
- 150000004665 fatty acids Chemical class 0.000 description 6
- 238000002156 mixing Methods 0.000 description 6
- 229920000151 polyglycol Polymers 0.000 description 6
- 239000010695 polyglycol Substances 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 150000002170 ethers Chemical class 0.000 description 5
- 229920003023 plastic Polymers 0.000 description 5
- 239000004033 plastic Substances 0.000 description 5
- 229920000768 polyamine Polymers 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 238000001035 drying Methods 0.000 description 4
- 239000000428 dust Substances 0.000 description 4
- 238000004898 kneading Methods 0.000 description 4
- 239000011734 sodium Substances 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- 235000002639 sodium chloride Nutrition 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- GKQHIYSTBXDYNQ-UHFFFAOYSA-M 1-dodecylpyridin-1-ium;chloride Chemical compound [Cl-].CCCCCCCCCCCC[N+]1=CC=CC=C1 GKQHIYSTBXDYNQ-UHFFFAOYSA-M 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- 238000005299 abrasion Methods 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 239000000987 azo dye Substances 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 3
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- BCHZICNRHXRCHY-UHFFFAOYSA-N 2h-oxazine Chemical compound N1OC=CC=C1 BCHZICNRHXRCHY-UHFFFAOYSA-N 0.000 description 2
- DLFVBJFMPXGRIB-UHFFFAOYSA-N Acetamide Chemical compound CC(N)=O DLFVBJFMPXGRIB-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 239000004927 clay Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical compound C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 2
- POULHZVOKOAJMA-UHFFFAOYSA-N dodecanoic acid Chemical compound CCCCCCCCCCCC(O)=O POULHZVOKOAJMA-UHFFFAOYSA-N 0.000 description 2
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N epsilon-caprolactam Chemical compound O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 description 2
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 150000004010 onium ions Chemical class 0.000 description 2
- 229920001281 polyalkylene Polymers 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000985 reactive dye Substances 0.000 description 2
- 239000001044 red dye Substances 0.000 description 2
- 238000005096 rolling process Methods 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- WRIDQFICGBMAFQ-UHFFFAOYSA-N (E)-8-Octadecenoic acid Natural products CCCCCCCCCC=CCCCCCCC(O)=O WRIDQFICGBMAFQ-UHFFFAOYSA-N 0.000 description 1
- OTPDWCMLUKMQNO-UHFFFAOYSA-N 1,2,3,4-tetrahydropyrimidine Chemical class C1NCC=CN1 OTPDWCMLUKMQNO-UHFFFAOYSA-N 0.000 description 1
- CUQRGPRDCOJLCF-UHFFFAOYSA-M 1-(octadecoxymethylidene)-2h-pyridin-1-ium;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCCOC=[N+]1CC=CC=C1 CUQRGPRDCOJLCF-UHFFFAOYSA-M 0.000 description 1
- VUQPJRPDRDVQMN-UHFFFAOYSA-N 1-chlorooctadecane Chemical compound CCCCCCCCCCCCCCCCCCCl VUQPJRPDRDVQMN-UHFFFAOYSA-N 0.000 description 1
- LDMOEFOXLIZJOW-UHFFFAOYSA-N 1-dodecanesulfonic acid Chemical compound CCCCCCCCCCCCS(O)(=O)=O LDMOEFOXLIZJOW-UHFFFAOYSA-N 0.000 description 1
- QAQSNXHKHKONNS-UHFFFAOYSA-N 1-ethyl-2-hydroxy-4-methyl-6-oxopyridine-3-carboxamide Chemical compound CCN1C(O)=C(C(N)=O)C(C)=CC1=O QAQSNXHKHKONNS-UHFFFAOYSA-N 0.000 description 1
- LWEAHXKXKDCSIE-UHFFFAOYSA-N 2,3-di(propan-2-yl)naphthalene-1-sulfonic acid Chemical compound C1=CC=C2C(S(O)(=O)=O)=C(C(C)C)C(C(C)C)=CC2=C1 LWEAHXKXKDCSIE-UHFFFAOYSA-N 0.000 description 1
- ICPUMOMIMAIRLA-UHFFFAOYSA-N 2-methylpropyl naphthalene-1-sulfonate Chemical compound C1=CC=C2C(S(=O)(=O)OCC(C)C)=CC=CC2=C1 ICPUMOMIMAIRLA-UHFFFAOYSA-N 0.000 description 1
- LQJBNNIYVWPHFW-UHFFFAOYSA-N 20:1omega9c fatty acid Natural products CCCCCCCCCCC=CCCCCCCCC(O)=O LQJBNNIYVWPHFW-UHFFFAOYSA-N 0.000 description 1
- CBZWWXKESAEZKC-UHFFFAOYSA-M 2H-pyridin-1-ium-1-ylidenemethyl octadecanoate chloride Chemical compound [Cl-].C(CCCCCCCCCCCCCCCCC)(=O)OC=[N+]1CC=CC=C1 CBZWWXKESAEZKC-UHFFFAOYSA-M 0.000 description 1
- AGIJRRREJXSQJR-UHFFFAOYSA-N 2h-thiazine Chemical compound N1SC=CC=C1 AGIJRRREJXSQJR-UHFFFAOYSA-N 0.000 description 1
- QSBYPNXLFMSGKH-UHFFFAOYSA-N 9-Heptadecensaeure Natural products CCCCCCCC=CCCCCCCCC(O)=O QSBYPNXLFMSGKH-UHFFFAOYSA-N 0.000 description 1
- GJCOSYZMQJWQCA-UHFFFAOYSA-N 9H-xanthene Chemical compound C1=CC=C2CC3=CC=CC=C3OC2=C1 GJCOSYZMQJWQCA-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- RAXXELZNTBOGNW-UHFFFAOYSA-O Imidazolium Chemical compound C1=C[NH+]=CN1 RAXXELZNTBOGNW-UHFFFAOYSA-O 0.000 description 1
- 239000005639 Lauric acid Substances 0.000 description 1
- 239000004117 Lignosulphonate Substances 0.000 description 1
- 206010028347 Muscle twitching Diseases 0.000 description 1
- YBMJSMXDOXMIEI-UHFFFAOYSA-N N(=NC1=NNC=C1)C1=NNC=C1.C1=CC=CC=C1 Chemical compound N(=NC1=NNC=C1)C1=NNC=C1.C1=CC=CC=C1 YBMJSMXDOXMIEI-UHFFFAOYSA-N 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- JCXJVPUVTGWSNB-UHFFFAOYSA-N Nitrogen dioxide Chemical compound O=[N]=O JCXJVPUVTGWSNB-UHFFFAOYSA-N 0.000 description 1
- 239000005642 Oleic acid Substances 0.000 description 1
- ZQPPMHVWECSIRJ-UHFFFAOYSA-N Oleic acid Natural products CCCCCCCCC=CCCCCCCCC(O)=O ZQPPMHVWECSIRJ-UHFFFAOYSA-N 0.000 description 1
- 235000021314 Palmitic acid Nutrition 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- KYQCOXFCLRTKLS-UHFFFAOYSA-N Pyrazine Chemical group C1=CN=CC=N1 KYQCOXFCLRTKLS-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-N Pyrazole Chemical compound C=1C=NNC=1 WTKZEGDFNFYCGP-UHFFFAOYSA-N 0.000 description 1
- WTKZEGDFNFYCGP-UHFFFAOYSA-O Pyrazolium Chemical compound C1=CN[NH+]=C1 WTKZEGDFNFYCGP-UHFFFAOYSA-O 0.000 description 1
- 239000004115 Sodium Silicate Substances 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- AZFNGPAYDKGCRB-XCPIVNJJSA-M [(1s,2s)-2-amino-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;chlororuthenium(1+);1-methyl-4-propan-2-ylbenzene Chemical compound [Ru+]Cl.CC(C)C1=CC=C(C)C=C1.C1=CC(C)=CC=C1S(=O)(=O)[N-][C@@H](C=1C=CC=CC=1)[C@@H](N)C1=CC=CC=C1 AZFNGPAYDKGCRB-XCPIVNJJSA-M 0.000 description 1
- 235000010443 alginic acid Nutrition 0.000 description 1
- 229920000615 alginic acid Polymers 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 150000001350 alkyl halides Chemical class 0.000 description 1
- 125000005037 alkyl phenyl group Chemical group 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O ammonium group Chemical group [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- PYKYMHQGRFAEBM-UHFFFAOYSA-N anthraquinone Natural products CCC(=O)c1c(O)c2C(=O)C3C(C=CC=C3O)C(=O)c2cc1CC(=O)OC PYKYMHQGRFAEBM-UHFFFAOYSA-N 0.000 description 1
- 150000004056 anthraquinones Chemical class 0.000 description 1
- 125000003118 aryl group Chemical group 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 210000000941 bile Anatomy 0.000 description 1
- 239000001045 blue dye Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003240 coconut oil Substances 0.000 description 1
- 235000019864 coconut oil Nutrition 0.000 description 1
- 238000004040 coloring Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 239000002274 desiccant Substances 0.000 description 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 description 1
- PPSZHCXTGRHULJ-UHFFFAOYSA-N dioxazine Chemical compound O1ON=CC=C1 PPSZHCXTGRHULJ-UHFFFAOYSA-N 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- SSILHZFTFWOUJR-UHFFFAOYSA-M hexadecane-1-sulfonate Chemical compound CCCCCCCCCCCCCCCCS([O-])(=O)=O SSILHZFTFWOUJR-UHFFFAOYSA-M 0.000 description 1
- DEQLTFPCJRGSHW-UHFFFAOYSA-N hexadecylbenzene Chemical compound CCCCCCCCCCCCCCCCC1=CC=CC=C1 DEQLTFPCJRGSHW-UHFFFAOYSA-N 0.000 description 1
- ZCQWOFVYLHDMMC-UHFFFAOYSA-O hydron;1,3-oxazole Chemical compound C1=COC=[NH+]1 ZCQWOFVYLHDMMC-UHFFFAOYSA-O 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-O hydron;pyrimidine Chemical compound C1=CN=C[NH+]=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-O 0.000 description 1
- LPAGFVYQRIESJQ-UHFFFAOYSA-N indoline Chemical compound C1=CC=C2NCCC2=C1 LPAGFVYQRIESJQ-UHFFFAOYSA-N 0.000 description 1
- QXJSBBXBKPUZAA-UHFFFAOYSA-N isooleic acid Natural products CCCCCCCC=CCCCCCCCCC(O)=O QXJSBBXBKPUZAA-UHFFFAOYSA-N 0.000 description 1
- QDLAGTHXVHQKRE-UHFFFAOYSA-N lichenxanthone Natural products COC1=CC(O)=C2C(=O)C3=C(C)C=C(OC)C=C3OC2=C1 QDLAGTHXVHQKRE-UHFFFAOYSA-N 0.000 description 1
- 235000019357 lignosulphonate Nutrition 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 239000000434 metal complex dye Substances 0.000 description 1
- 229910001507 metal halide Inorganic materials 0.000 description 1
- 150000005309 metal halides Chemical class 0.000 description 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 description 1
- 125000001434 methanylylidene group Chemical group [H]C#[*] 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 125000001421 myristyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RRHLGOOTLYHTEW-UHFFFAOYSA-N n'-[2-(dodecylamino)ethyl]ethane-1,2-diamine Chemical compound CCCCCCCCCCCCNCCNCCN RRHLGOOTLYHTEW-UHFFFAOYSA-N 0.000 description 1
- QWWVKNIOABZQTG-UHFFFAOYSA-N n-(2h-pyridin-1-ium-1-ylidenemethyl)octadecanamide;chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC(=O)NC=[N+]1CC=CC=C1 QWWVKNIOABZQTG-UHFFFAOYSA-N 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- 125000005608 naphthenic acid group Chemical group 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- CACRRXGTWZXOAU-UHFFFAOYSA-N octadecane-1-sulfonic acid Chemical compound CCCCCCCCCCCCCCCCCCS(O)(=O)=O CACRRXGTWZXOAU-UHFFFAOYSA-N 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid Chemical compound CCCCCCCC\C=C/CCCCCCCC(O)=O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 235000021313 oleic acid Nutrition 0.000 description 1
- 125000001117 oleyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])/C([H])=C([H])\C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003346 palm kernel oil Chemical class 0.000 description 1
- 235000019865 palm kernel oil Nutrition 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- IEQIEDJGQAUEQZ-UHFFFAOYSA-N phthalocyanine Chemical compound N1C(N=C2C3=CC=CC=C3C(N=C3C4=CC=CC=C4C(=N4)N3)=N2)=C(C=CC=C2)C2=C1N=C1C2=CC=CC=C2C4=N1 IEQIEDJGQAUEQZ-UHFFFAOYSA-N 0.000 description 1
- 235000010289 potassium nitrite Nutrition 0.000 description 1
- 239000004304 potassium nitrite Substances 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 150000003222 pyridines Chemical class 0.000 description 1
- JUJWROOIHBZHMG-UHFFFAOYSA-O pyridinium Chemical compound C1=CC=[NH+]C=C1 JUJWROOIHBZHMG-UHFFFAOYSA-O 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- FQENQNTWSFEDLI-UHFFFAOYSA-J sodium diphosphate Chemical compound [Na+].[Na+].[Na+].[Na+].[O-]P([O-])(=O)OP([O-])([O-])=O FQENQNTWSFEDLI-UHFFFAOYSA-J 0.000 description 1
- 235000019795 sodium metasilicate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 235000011008 sodium phosphates Nutrition 0.000 description 1
- 229940048086 sodium pyrophosphate Drugs 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 1
- 229910052911 sodium silicate Inorganic materials 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 238000001694 spray drying Methods 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 150000005846 sugar alcohols Polymers 0.000 description 1
- 125000000542 sulfonic acid group Chemical group 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- TUNFSRHWOTWDNC-HKGQFRNVSA-N tetradecanoic acid Chemical compound CCCCCCCCCCCCC[14C](O)=O TUNFSRHWOTWDNC-HKGQFRNVSA-N 0.000 description 1
- 235000019818 tetrasodium diphosphate Nutrition 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- 125000003831 tetrazolyl group Chemical group 0.000 description 1
- 150000004897 thiazines Chemical class 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B67/00—Influencing the physical, e.g. the dyeing or printing properties of dyestuffs without chemical reactions, e.g. by treating with solvents grinding or grinding assistants, coating of pigments or dyes; Process features in the making of dyestuff preparations; Dyestuff preparations of a special physical nature, e.g. tablets, films
- C09B67/0071—Process features in the making of dyestuff preparations; Dehydrating agents; Dispersing agents; Dustfree compositions
- C09B67/0092—Dyes in solid form
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Detergent Compositions (AREA)
- Medicinal Preparation (AREA)
- Glanulating (AREA)
- Cosmetics (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH513672A CH562310A5 (OSRAM) | 1972-04-07 | 1972-04-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2317175A1 true DE2317175A1 (de) | 1973-10-18 |
Family
ID=4288547
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2317175A Pending DE2317175A1 (de) | 1972-04-07 | 1973-04-05 | Nicht staeubende formstabile farbstoffgranulate und verfahren zu deren herstellung |
Country Status (13)
| Country | Link |
|---|---|
| JP (1) | JPS4917819A (OSRAM) |
| AR (1) | AR197497A1 (OSRAM) |
| BE (1) | BE797867A (OSRAM) |
| BR (1) | BR7302492D0 (OSRAM) |
| CA (1) | CA1027710A (OSRAM) |
| CH (1) | CH562310A5 (OSRAM) |
| DD (1) | DD102720A5 (OSRAM) |
| DE (1) | DE2317175A1 (OSRAM) |
| ES (1) | ES413406A1 (OSRAM) |
| FR (1) | FR2179137B1 (OSRAM) |
| GB (1) | GB1425237A (OSRAM) |
| IT (1) | IT980106B (OSRAM) |
| ZA (1) | ZA732103B (OSRAM) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2723221A1 (de) * | 1976-05-25 | 1977-12-01 | Ciba Geigy Ag | Verfahren und anlage zur herstellung von granulaten |
| US4105401A (en) | 1975-04-23 | 1978-08-08 | Ciba-Geigy Corporation | Dye preparation soluble in cold water |
| EP0016642A1 (en) * | 1979-03-21 | 1980-10-01 | EASTMAN KODAK COMPANY (a New Jersey corporation) | Dye and dyebath compositions and process for dyeing |
| DE3910275C1 (OSRAM) * | 1989-03-30 | 1990-10-18 | Bayer Ag, 5090 Leverkusen, De | |
| WO1998017729A1 (en) * | 1996-10-22 | 1998-04-30 | Ciba Specialty Chemicals Holding Inc. | Pigment granulation |
| US6712862B1 (en) | 1997-07-21 | 2004-03-30 | Clariant Finance (Bvi) Limited | Granular compacts, their production and use |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5124760U (OSRAM) * | 1974-08-12 | 1976-02-23 | ||
| DE2656408C2 (de) * | 1976-12-13 | 1983-12-15 | CIBA-GEIGY AG, 4002 Basel | Verfahren zur Herstellung von staubarmen Präparaten und deren Verwendung |
| DE2656407C3 (de) | 1976-12-13 | 1981-10-08 | CIBA-GEIGY AG, 4002 Basel | Verfahren zur Herstellung von staubarmen Farbstoff- und optischen Aufhellerpräparaten und deren Verwendung |
| DE2656406C3 (de) * | 1976-12-13 | 1979-12-20 | Ciba-Geigy Ag, Basel (Schweiz) | Verfahren zur Herstellung von staubarmen Präparaten und deren Verwendung |
| LU76632A1 (OSRAM) * | 1977-01-24 | 1978-09-13 | ||
| US4215990A (en) | 1978-04-14 | 1980-08-05 | Purex Corporation | Peroxygen bleaching and laundering compositions |
| US4541831A (en) * | 1979-06-04 | 1985-09-17 | Ciba-Geigy Corporation | Dustless, water-soluble, solid, dyestuff or optical brightener compositions and a process of production |
| DE3115546A1 (de) * | 1981-04-16 | 1982-11-11 | Bayer Ag, 5090 Leverkusen | Farbstoffeinstellungen, ihre herstellung und verwendung |
| CH668981A5 (de) * | 1985-06-27 | 1989-02-15 | Sandoz Ag | Badstabile zubereitungen von wasserloeslichen metallkomplexfarbstoffen. |
| US4663859A (en) * | 1985-10-04 | 1987-05-12 | Ciba-Geigy Corporation | Method for improving strength of dry dye particles and reducing explosion hazards |
| JPS62117886A (ja) * | 1985-11-19 | 1987-05-29 | 農林水産省蚕糸・昆虫農業技術研究所長 | 繊維の染色法 |
| EP1188798B1 (de) * | 1997-10-01 | 2004-10-20 | Ciba SC Holding AG | Pigmentgranulate |
| EP0906938B1 (de) * | 1997-10-01 | 2002-10-30 | Ciba SC Holding AG | Pigmentgranulierung |
| EP1354006B1 (en) * | 2000-12-29 | 2007-08-08 | Roha Dyechem Private Limited | Manufacturing process of spheroidal food dyes |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1992185A (en) * | 1932-03-30 | 1935-02-26 | Du Pont | Azo dyes |
| US2043178A (en) * | 1932-12-09 | 1936-06-02 | Rit Products Corp | Dye preparation |
| FR926908A (fr) * | 1946-05-14 | 1947-10-15 | C V Handelsonderneming Joco | Procédé de fabrication d'un produit en tablettes ou autres destiné à la teinture des produits textiles |
| FR1170167A (fr) * | 1955-09-02 | 1959-01-12 | Hoechst Ag | Produits colorants sous forme d'agglomérés et leur préparation |
| CH492007A (de) * | 1967-08-11 | 1970-06-15 | Geigy Ag J R | Verfahren zur Herstellung nicht stäubender Textilfarbstoff-Präparate |
| US3583877A (en) * | 1968-04-10 | 1971-06-08 | Tenneco Chem | Method of treating basic dyes |
-
1972
- 1972-04-07 CH CH513672A patent/CH562310A5/xx not_active IP Right Cessation
-
1973
- 1973-03-27 ZA ZA732103A patent/ZA732103B/xx unknown
- 1973-03-30 CA CA167,549A patent/CA1027710A/en not_active Expired
- 1973-04-04 FR FR7312203A patent/FR2179137B1/fr not_active Expired
- 1973-04-04 GB GB1618473A patent/GB1425237A/en not_active Expired
- 1973-04-05 AR AR247406A patent/AR197497A1/es active
- 1973-04-05 IT IT49257/73A patent/IT980106B/it active
- 1973-04-05 DE DE2317175A patent/DE2317175A1/de active Pending
- 1973-04-05 DD DD169966A patent/DD102720A5/xx unknown
- 1973-04-06 BR BR732492A patent/BR7302492D0/pt unknown
- 1973-04-06 ES ES413406A patent/ES413406A1/es not_active Expired
- 1973-04-06 BE BE129721A patent/BE797867A/xx unknown
- 1973-04-07 JP JP48039154A patent/JPS4917819A/ja active Pending
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4105401A (en) | 1975-04-23 | 1978-08-08 | Ciba-Geigy Corporation | Dye preparation soluble in cold water |
| DE2723221A1 (de) * | 1976-05-25 | 1977-12-01 | Ciba Geigy Ag | Verfahren und anlage zur herstellung von granulaten |
| EP0016642A1 (en) * | 1979-03-21 | 1980-10-01 | EASTMAN KODAK COMPANY (a New Jersey corporation) | Dye and dyebath compositions and process for dyeing |
| DE3910275C1 (OSRAM) * | 1989-03-30 | 1990-10-18 | Bayer Ag, 5090 Leverkusen, De | |
| WO1998017729A1 (en) * | 1996-10-22 | 1998-04-30 | Ciba Specialty Chemicals Holding Inc. | Pigment granulation |
| US6712862B1 (en) | 1997-07-21 | 2004-03-30 | Clariant Finance (Bvi) Limited | Granular compacts, their production and use |
| EP1002022B2 (en) † | 1997-07-21 | 2005-05-04 | Clariant Finance (BVI) Limited | Granular compacts, their production and use |
Also Published As
| Publication number | Publication date |
|---|---|
| CA1027710A (en) | 1978-03-14 |
| ES413406A1 (es) | 1976-01-16 |
| BR7302492D0 (pt) | 1974-07-18 |
| GB1425237A (en) | 1976-02-18 |
| AR197497A1 (es) | 1974-04-15 |
| JPS4917819A (OSRAM) | 1974-02-16 |
| ZA732103B (en) | 1974-01-30 |
| DD102720A5 (OSRAM) | 1973-12-20 |
| FR2179137B1 (OSRAM) | 1976-11-12 |
| IT980106B (it) | 1974-09-30 |
| FR2179137A1 (OSRAM) | 1973-11-16 |
| CH562310A5 (OSRAM) | 1975-05-30 |
| BE797867A (fr) | 1973-10-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2317175A1 (de) | Nicht staeubende formstabile farbstoffgranulate und verfahren zu deren herstellung | |
| DE2338505A1 (de) | Feste, nicht staeubende farbstoffschaeume beliebiger form und groesse | |
| DE3246493A1 (de) | Verfahren zur herstellung von wasserdispergierbaren granulaten | |
| CH658667A5 (de) | Verfahren zur herstellung von farbstoffgranulaten. | |
| DE69806015T3 (de) | Kompaktierte granulate, deren herstellung und verwendung | |
| DE2536719C2 (OSRAM) | ||
| EP0095740B1 (de) | Feste Präparate von Metallkomplexfarbstoffen | |
| DE2321220A1 (de) | Nichtstaeubende formstabile farbstoffgranulate beliebiger form und groesse von dispersionsfarbstoffen und verfahren zu deren herstellung | |
| DE2322308A1 (de) | Rieselfaehige, leicht loesliche farbstoffgranulate von anionischen farbstoffen | |
| EP0085376A2 (de) | Wasserdispergierbare bzw. wasserlösliche Granulate, Verfahren zu deren Herstellung und deren Verwendung | |
| EP0026489B1 (de) | Aufbaugranulate wasserlöslicher Farbstoffe, Verfahren zur Herstellung und Verwendung zum Färben | |
| DE3212408C2 (de) | Feste Farbstoffpräparate von anionischen Farbstoffen, ihre Herstellung und Verwendung | |
| EP0155239B2 (de) | Verfahren zur Herstellung von Farbstoffgranulaten | |
| DE2207753A1 (de) | Verfahren zur Herstellung von Farbstoffpräparaten | |
| EP0135963B1 (de) | In wässrigen Medien dispergierbare granulierte Zusammensetzung von in Wasser schwer- oder unlöslichen Wirkstoffen | |
| DE1239672B (de) | Verfahren zur Herstellung von in Wasser ohne Klumpenbildung loeslicher pulverfoermiger Methylcellulose | |
| DE2459895C3 (de) | Zerstäubungsgetrocknete niedrigschmelzende basische Farbstoffe und Verfahren zu ihrer Herstellung | |
| EP0906372B1 (de) | Leukoküpenfarbstoff-präparationen in granulatform | |
| DE2247371C3 (de) | Verfahren zur Herstellung von unlöslichen Schwefel enthaltenden Granulaten | |
| DE2723221B2 (de) | Farbstoffgranulate und Vorrichtung zu deren Herstellung | |
| DE2363376C3 (de) | Formierter, wasserunlöslicher Azofarbstoff und seine Herstellung und Verwendung | |
| EP0004883B1 (de) | Verfahren zur Herstellung rieselfähiger, anorganischer Ammonium- und Alkalisalze | |
| EP0028379A1 (de) | Granulate wasserlöslicher Farbstoffe, Verfahren zur Herstellung und Verwendung zum Färben | |
| DE2826756C2 (de) | Verfahren zur Pelletierung eines feinkörnigen wasserlöslichen Kalisalzes | |
| CH594727A5 (en) | Stable printing ink or concentrate for transfer printing |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |