DE2306964A1 - Mechanischer fugenverschluss - Google Patents
Mechanischer fugenverschlussInfo
- Publication number
- DE2306964A1 DE2306964A1 DE2306964A DE2306964A DE2306964A1 DE 2306964 A1 DE2306964 A1 DE 2306964A1 DE 2306964 A DE2306964 A DE 2306964A DE 2306964 A DE2306964 A DE 2306964A DE 2306964 A1 DE2306964 A1 DE 2306964A1
- Authority
- DE
- Germany
- Prior art keywords
- joint
- strips
- substructure
- closure according
- sealing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000007789 sealing Methods 0.000 claims description 46
- 239000003566 sealing material Substances 0.000 claims description 43
- 230000008961 swelling Effects 0.000 claims description 25
- 239000004567 concrete Substances 0.000 claims description 11
- 239000012790 adhesive layer Substances 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 239000004033 plastic Substances 0.000 claims description 8
- 239000011324 bead Substances 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- 239000006260 foam Substances 0.000 claims description 4
- 229920001821 foam rubber Polymers 0.000 claims description 4
- 230000000149 penetrating effect Effects 0.000 claims description 2
- 239000002023 wood Substances 0.000 claims description 2
- 206010061258 Joint lock Diseases 0.000 claims 1
- 238000005266 casting Methods 0.000 claims 1
- 239000013013 elastic material Substances 0.000 claims 1
- 230000002459 sustained effect Effects 0.000 claims 1
- 238000010276 construction Methods 0.000 description 8
- 239000011888 foil Substances 0.000 description 4
- 229910010272 inorganic material Inorganic materials 0.000 description 4
- 239000011147 inorganic material Substances 0.000 description 4
- CBENFWSGALASAD-UHFFFAOYSA-N Ozone Chemical compound [O-][O+]=O CBENFWSGALASAD-UHFFFAOYSA-N 0.000 description 3
- 239000004568 cement Substances 0.000 description 3
- 238000005253 cladding Methods 0.000 description 3
- 239000010410 layer Substances 0.000 description 3
- 238000004382 potting Methods 0.000 description 3
- 230000005855 radiation Effects 0.000 description 3
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- 239000010425 asbestos Substances 0.000 description 2
- 239000010426 asphalt Substances 0.000 description 2
- 229940125810 compound 20 Drugs 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000004744 fabric Substances 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 2
- 230000002045 lasting effect Effects 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000012986 modification Methods 0.000 description 2
- 230000004048 modification Effects 0.000 description 2
- 230000002787 reinforcement Effects 0.000 description 2
- 229910052895 riebeckite Inorganic materials 0.000 description 2
- 239000000565 sealant Substances 0.000 description 2
- 238000003466 welding Methods 0.000 description 2
- 229910001369 Brass Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- 235000013351 cheese Nutrition 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003292 glue Substances 0.000 description 1
- 210000003128 head Anatomy 0.000 description 1
- 239000012774 insulation material Substances 0.000 description 1
- 210000001331 nose Anatomy 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000009281 ultraviolet germicidal irradiation Methods 0.000 description 1
- 238000004078 waterproofing Methods 0.000 description 1
Classifications
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04D—ROOF COVERINGS; SKY-LIGHTS; GUTTERS; ROOF-WORKING TOOLS
- E04D1/00—Roof covering by making use of tiles, slates, shingles, or other small roofing elements
- E04D1/36—Devices for sealing the spaces or joints between roof-covering elements
- E04D1/365—Sealing strips between lateral sides of roof-covering elements
-
- E—FIXED CONSTRUCTIONS
- E04—BUILDING
- E04D—ROOF COVERINGS; SKY-LIGHTS; GUTTERS; ROOF-WORKING TOOLS
- E04D3/00—Roof covering by making use of flat or curved slabs or stiff sheets
- E04D3/38—Devices for sealing spaces or joints between roof-covering elements
Landscapes
- Engineering & Computer Science (AREA)
- Architecture (AREA)
- Civil Engineering (AREA)
- Structural Engineering (AREA)
- Roof Covering Using Slabs Or Stiff Sheets (AREA)
- Building Environments (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2306964A DE2306964A1 (de) | 1973-02-13 | 1973-02-13 | Mechanischer fugenverschluss |
| NL7401668A NL7401668A (enExample) | 1973-02-13 | 1974-02-07 | |
| CH178274A CH577090A5 (enExample) | 1973-02-13 | 1974-02-08 | |
| AT102774A AT333480B (de) | 1973-02-13 | 1974-02-08 | Verschluss fur fugen zwischen auf einem dach bzw. auf einer unterkonstruktion verlegten tafeln |
| US05/441,623 US3943678A (en) | 1973-02-13 | 1974-02-11 | Gap-sealing structure |
| FR7404550A FR2217491B1 (enExample) | 1973-02-13 | 1974-02-11 | |
| IT20407/74A IT1007331B (it) | 1973-02-13 | 1974-02-11 | Chiusura meccanica per fessure di giunzioni |
| BE140817A BE810915A (fr) | 1973-02-13 | 1974-02-12 | Dispositif mecanique pour l'obturation de joints pour des revetements |
| SE7401909A SE399731B (sv) | 1973-02-13 | 1974-02-13 | Mekanisk fogforslutning |
| GB657774A GB1466115A (en) | 1973-02-13 | 1974-02-13 | Joints between roofing panels |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2306964A DE2306964A1 (de) | 1973-02-13 | 1973-02-13 | Mechanischer fugenverschluss |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2306964A1 true DE2306964A1 (de) | 1974-08-22 |
Family
ID=5871738
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2306964A Pending DE2306964A1 (de) | 1973-02-13 | 1973-02-13 | Mechanischer fugenverschluss |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3943678A (enExample) |
| AT (1) | AT333480B (enExample) |
| BE (1) | BE810915A (enExample) |
| CH (1) | CH577090A5 (enExample) |
| DE (1) | DE2306964A1 (enExample) |
| FR (1) | FR2217491B1 (enExample) |
| GB (1) | GB1466115A (enExample) |
| IT (1) | IT1007331B (enExample) |
| NL (1) | NL7401668A (enExample) |
| SE (1) | SE399731B (enExample) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4557093A (en) * | 1984-02-10 | 1985-12-10 | Epsm Inc. | Insulated building block |
| US4557094A (en) * | 1984-02-10 | 1985-12-10 | Epsm Inc. | Insulated block building |
| GB2167100A (en) * | 1984-11-19 | 1986-05-21 | John Wilkinson | Roof |
| US5651225A (en) * | 1995-10-31 | 1997-07-29 | Leeks; Allan T. | Device and method for joining and supporting pieces of sheet material |
| US6805953B2 (en) * | 2000-02-09 | 2004-10-19 | Nitto Denko Corporation | Waterstop sealing material |
| ES2300506T3 (es) * | 2001-12-03 | 2008-06-16 | Vkr Holding A/S | Un elemento para la provision de una transicion sellada con respecto a componentes de construccion. |
| US8065851B2 (en) * | 2006-08-25 | 2011-11-29 | Huber Engineered Woods Llc | Self-spacing wood composite panels |
Family Cites Families (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE484436C (de) * | 1929-10-19 | Zimmermann Fa G | Deckschienenbefestigung fuer Glasdacheindeckungen | |
| DE235182C (enExample) * | ||||
| DE398802C (de) * | 1915-09-21 | 1924-07-21 | Robertson Co H H | Verglasung fuer Daecher und Fenster |
| GB121354A (en) * | 1917-12-15 | 1918-12-16 | John Horatio Lovell | Improvements in or relating to Puttyless Glazing. |
| US1513810A (en) * | 1923-06-19 | 1924-11-04 | Harold B Hawes | Skylight |
| GB284169A (en) * | 1927-09-23 | 1928-01-26 | Paul Liese | Improvements in glass roofs, walls and floors |
| FR657748A (fr) * | 1928-07-05 | 1929-05-27 | Chevron pour vitrage sans mastic | |
| US2102902A (en) * | 1937-01-28 | 1937-12-21 | Julius J Ohlis | Skylight construction |
| US2145469A (en) * | 1937-08-18 | 1939-01-31 | Merle C Scanland | Ornamental wall panel and means for securing the same |
| US2842073A (en) * | 1954-09-29 | 1958-07-08 | Sanford K Huston | Skylight |
| US3028938A (en) * | 1959-03-12 | 1962-04-10 | Schorr Wallace | Locked joint and reinforcing construction for fragile sheet material |
| FR1261638A (fr) * | 1960-07-01 | 1961-05-19 | Dispositif pour la fixation et l'assemblage de panneaux ondulés ou plans | |
| DK100445C (da) * | 1960-09-08 | 1964-11-30 | Georg Aagaard | Tagkonstruktion. |
| US3263385A (en) * | 1962-08-29 | 1966-08-02 | Olin Mathieson | Building structure with anchored panels |
| US3320707A (en) * | 1965-03-10 | 1967-05-23 | Edward T Berg | Metal covered roof with deformable sealing pads |
| US3350828A (en) * | 1965-04-12 | 1967-11-07 | Lockheed Aircraft Corp | Abutting wall panels and sealing structure therefor |
| US3339329A (en) * | 1965-05-18 | 1967-09-05 | Edward T Berg | Arrangement for securing panels to the surface of a roof or wall |
| US3552704A (en) * | 1968-10-14 | 1971-01-05 | American Air Filter Co | Clamping device for simultaneously securing two panels to a support |
| FR2038478A5 (enExample) * | 1969-03-17 | 1971-01-08 | Mullen William |
-
1973
- 1973-02-13 DE DE2306964A patent/DE2306964A1/de active Pending
-
1974
- 1974-02-07 NL NL7401668A patent/NL7401668A/xx not_active Application Discontinuation
- 1974-02-08 AT AT102774A patent/AT333480B/de active
- 1974-02-08 CH CH178274A patent/CH577090A5/xx not_active IP Right Cessation
- 1974-02-11 IT IT20407/74A patent/IT1007331B/it active
- 1974-02-11 FR FR7404550A patent/FR2217491B1/fr not_active Expired
- 1974-02-11 US US05/441,623 patent/US3943678A/en not_active Expired - Lifetime
- 1974-02-12 BE BE140817A patent/BE810915A/xx unknown
- 1974-02-13 GB GB657774A patent/GB1466115A/en not_active Expired
- 1974-02-13 SE SE7401909A patent/SE399731B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATA102774A (de) | 1976-03-15 |
| GB1466115A (en) | 1977-03-02 |
| FR2217491A1 (enExample) | 1974-09-06 |
| AT333480B (de) | 1976-11-25 |
| US3943678A (en) | 1976-03-16 |
| BE810915A (fr) | 1974-05-29 |
| IT1007331B (it) | 1976-10-30 |
| FR2217491B1 (enExample) | 1978-09-08 |
| NL7401668A (enExample) | 1974-08-15 |
| CH577090A5 (enExample) | 1976-06-30 |
| SE399731B (sv) | 1978-02-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2407980A1 (de) | Plattenfoermiges bauelement | |
| DE2520199B2 (de) | Flachdachbelag | |
| DE69503182T3 (de) | Dachunterkonstruktion für mit Dacheindeckungsplatten gedeckte Dächer und Verfahren zur Herstellung der Dachunterkonstruktion | |
| DE2306964A1 (de) | Mechanischer fugenverschluss | |
| DE3509514C2 (de) | Unterdachelement | |
| DE19704112C2 (de) | Wärmedämmende Fassadenverkleidung | |
| DE2905777A1 (de) | Vorgefertigtes dachkonstruktionselement | |
| DE2736992B2 (de) | Flachdachbelag | |
| DE4309649A1 (de) | Dämmkonstruktion für Steildächer | |
| DE10055354B4 (de) | Plattenelement | |
| DE3909157A1 (de) | Dacheindeckung mit metallprofilbohlen | |
| DE19728980C2 (de) | Dachkonstruktion als Grundkonstruktion eine Dacheindeckung tragend sowie Trag- und Dämmelement | |
| DE4419135C2 (de) | Flachdacheindeckung aus Kunststoffplatten | |
| EP0008671A1 (de) | Plattenförmiges Dämmelement für hinterlüftete Längssparren-Steildächer | |
| DE2507090A1 (de) | Plattenfoermiges bauelement | |
| AT16626U1 (de) | Ankerelement für Herstellung einer Formfassade, Formfassade und Verfahren zur Herstellung der Formfassade | |
| EP0890683B1 (de) | Dachkonstruktion | |
| DE2532100C2 (de) | Warmdach | |
| DE2306963A1 (de) | Mechanischer fugenverschluss | |
| DE1509164A1 (de) | Wand-,Decken oder Fussbodenkonstruktion mit Oberflaechenbekleidung | |
| DE2306962A1 (de) | Mechanischer fugenverschluss | |
| DE8500260U1 (de) | Dachelement mit hoher luftschalldaemmung | |
| DE2250314A1 (de) | Metalldachkonstruktion | |
| AT352965B (de) | Selbsttragendes verbundpaneel | |
| DE3003690A1 (de) | Vorgefertigtes daemmelement fuer daecher von bauwerken |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHW | Rejection |