DE2264268C2 - Verbesserte Polycarbonat-Formmasse - Google Patents
Verbesserte Polycarbonat-FormmasseInfo
- Publication number
- DE2264268C2 DE2264268C2 DE19722264268 DE2264268A DE2264268C2 DE 2264268 C2 DE2264268 C2 DE 2264268C2 DE 19722264268 DE19722264268 DE 19722264268 DE 2264268 A DE2264268 A DE 2264268A DE 2264268 C2 DE2264268 C2 DE 2264268C2
- Authority
- DE
- Germany
- Prior art keywords
- polycarbonate
- acrylic copolymer
- molding compound
- methyl methacrylate
- aromatic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 229920000515 polycarbonate Polymers 0.000 title claims description 40
- 239000004417 polycarbonate Substances 0.000 title claims description 40
- 238000000465 moulding Methods 0.000 title claims description 15
- 150000001875 compounds Chemical class 0.000 title claims description 6
- 229920006243 acrylic copolymer Polymers 0.000 claims description 18
- 125000003118 aryl group Chemical group 0.000 claims description 14
- VVQNEPGJFQJSBK-UHFFFAOYSA-N Methyl methacrylate Chemical group COC(=O)C(C)=C VVQNEPGJFQJSBK-UHFFFAOYSA-N 0.000 claims description 9
- 125000005250 alkyl acrylate group Chemical group 0.000 claims description 5
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 3
- 239000002243 precursor Substances 0.000 claims description 3
- 239000000203 mixture Substances 0.000 description 15
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 10
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 7
- 238000006243 chemical reaction Methods 0.000 description 7
- 229920001577 copolymer Polymers 0.000 description 7
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 5
- 239000000370 acceptor Substances 0.000 description 5
- 150000002989 phenols Chemical class 0.000 description 5
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- -1 carbonyl halide Chemical class 0.000 description 4
- 230000005540 biological transmission Effects 0.000 description 3
- 238000002845 discoloration Methods 0.000 description 3
- 239000000155 melt Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 229920000728 polyester Polymers 0.000 description 3
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 2
- 229920000178 Acrylic resin Polymers 0.000 description 2
- 239000004925 Acrylic resin Substances 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 150000001491 aromatic compounds Chemical class 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- 239000004305 biphenyl Substances 0.000 description 2
- 125000006267 biphenyl group Chemical group 0.000 description 2
- PXKLMJQFEQBVLD-UHFFFAOYSA-N bisphenol F Chemical compound C1=CC(O)=CC=C1CC1=CC=C(O)C=C1 PXKLMJQFEQBVLD-UHFFFAOYSA-N 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- WCYWZMWISLQXQU-UHFFFAOYSA-N methyl Chemical compound [CH3] WCYWZMWISLQXQU-UHFFFAOYSA-N 0.000 description 2
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- SYNPRNNJJLRHTI-UHFFFAOYSA-N 2-(hydroxymethyl)butane-1,4-diol Chemical compound OCCC(CO)CO SYNPRNNJJLRHTI-UHFFFAOYSA-N 0.000 description 1
- YMTYZTXUZLQUSF-UHFFFAOYSA-N 3,3'-Dimethylbisphenol A Chemical compound C1=C(O)C(C)=CC(C(C)(C)C=2C=C(C)C(O)=CC=2)=C1 YMTYZTXUZLQUSF-UHFFFAOYSA-N 0.000 description 1
- MLDIQALUMKMHCC-UHFFFAOYSA-N 4,4-Bis(4-hydroxyphenyl)heptane Chemical compound C=1C=C(O)C=CC=1C(CCC)(CCC)C1=CC=C(O)C=C1 MLDIQALUMKMHCC-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 1
- 230000000996 additive effect Effects 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 229940106691 bisphenol a Drugs 0.000 description 1
- CQEYYJKEWSMYFG-UHFFFAOYSA-N butyl acrylate Chemical compound CCCCOC(=O)C=C CQEYYJKEWSMYFG-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- MOIPGXQKZSZOQX-UHFFFAOYSA-N carbonyl bromide Chemical compound BrC(Br)=O MOIPGXQKZSZOQX-UHFFFAOYSA-N 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 239000003054 catalyst Substances 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 238000006731 degradation reaction Methods 0.000 description 1
- 150000004675 formic acid derivatives Chemical class 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- IQRVNLYKJBNWHE-UHFFFAOYSA-N heptan-2-yl prop-2-enoate Chemical compound CCCCCC(C)OC(=O)C=C IQRVNLYKJBNWHE-UHFFFAOYSA-N 0.000 description 1
- ZMCFZBPGZDNOLJ-UHFFFAOYSA-N hexyl prop-2-enoate;methyl 2-methylprop-2-enoate Chemical compound COC(=O)C(C)=C.CCCCCCOC(=O)C=C ZMCFZBPGZDNOLJ-UHFFFAOYSA-N 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- PBOSTUDLECTMNL-UHFFFAOYSA-N lauryl acrylate Chemical compound CCCCCCCCCCCCOC(=O)C=C PBOSTUDLECTMNL-UHFFFAOYSA-N 0.000 description 1
- USUBUUXHLGKOHN-UHFFFAOYSA-N methyl 2-methylidenehexanoate Chemical compound CCCCC(=C)C(=O)OC USUBUUXHLGKOHN-UHFFFAOYSA-N 0.000 description 1
- MWCRSWMJQSTWMA-UHFFFAOYSA-N methyl 2-methylprop-2-enoate;octyl prop-2-enoate Chemical compound COC(=O)C(C)=C.CCCCCCCCOC(=O)C=C MWCRSWMJQSTWMA-UHFFFAOYSA-N 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 125000001971 neopentyl group Chemical group [H]C([*])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940065472 octyl acrylate Drugs 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 230000006641 stabilisation Effects 0.000 description 1
- 238000011105 stabilization Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08L—COMPOSITIONS OF MACROMOLECULAR COMPOUNDS
- C08L69/00—Compositions of polycarbonates; Compositions of derivatives of polycarbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Polyesters Or Polycarbonates (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US21511472A | 1972-01-03 | 1972-01-03 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2264268A1 DE2264268A1 (de) | 1973-07-12 |
| DE2264268C2 true DE2264268C2 (de) | 1982-11-04 |
Family
ID=22801713
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722264268 Expired DE2264268C2 (de) | 1972-01-03 | 1972-12-30 | Verbesserte Polycarbonat-Formmasse |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS5628937B2 (enExample) |
| AU (1) | AU462964B2 (enExample) |
| DE (1) | DE2264268C2 (enExample) |
| FR (1) | FR2167650B1 (enExample) |
| GB (1) | GB1394481A (enExample) |
| IT (1) | IT977995B (enExample) |
| NL (1) | NL7300034A (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS50141648A (enExample) * | 1974-05-02 | 1975-11-14 | ||
| US4260693A (en) * | 1979-08-27 | 1981-04-07 | General Electric Company | Polycarbonate compositions |
| US4263416A (en) * | 1979-08-27 | 1981-04-21 | General Electric Company | Polycarbonate compositions |
| US4263415A (en) * | 1979-08-27 | 1981-04-21 | General Electric Company | Polycarbonate compositions |
| US4245058A (en) * | 1979-08-27 | 1981-01-13 | General Electric Company | Polycarbonate compositions |
| US4299928A (en) * | 1980-03-14 | 1981-11-10 | Mobay Chemical Corporation | Impact modified polycarbonates |
| US4251647A (en) * | 1980-03-20 | 1981-02-17 | General Electric Company | Ternary polycarbonate compositions |
| DE3576965D1 (de) * | 1984-09-15 | 1990-05-10 | Huels Chemische Werke Ag | Formmassen auf basis von thermoplasten. |
| JPS62131056A (ja) * | 1985-12-04 | 1987-06-13 | Idemitsu Petrochem Co Ltd | ポリカ−ボネ−ト樹脂組成物 |
| DE3632946A1 (de) * | 1986-09-27 | 1988-03-31 | Roehm Gmbh | Vertraegliche mischungen aus polycarbonat und methylmethacrylat-copolymeren |
| US4828921A (en) * | 1986-10-17 | 1989-05-09 | Mobay Corporation | Polycarbonate molding compositions |
| CA1315033C (en) * | 1986-10-17 | 1993-03-23 | Mark W. Witman | Polycarbonate molding compositions |
| US5270385A (en) * | 1987-02-13 | 1993-12-14 | Bayer Aktiengesellschaft | Antistatic, thermoplastic moulding compounds based on aromatic polycarbonates and aromatic vinyl polymers |
| DE3709562A1 (de) * | 1987-03-24 | 1988-10-06 | Roehm Gmbh | Vertraegliche mischungen von polycarbonat- und methylmethacrylat-copolymeren |
| DE3719239A1 (de) * | 1987-06-06 | 1988-12-15 | Roehm Gmbh | Vertraegliche polycarbonat-polymethacrylat-mischungen |
| CA1339699C (en) * | 1988-02-08 | 1998-03-03 | Rohm And Haas Company | Thermoplastic polymer compositions containing meltrheology modifiers |
| DE3928661A1 (de) * | 1989-08-30 | 1991-03-07 | Bayer Ag | Polycarbonatformmassen, ihre herstellung und verwendung |
| US5292809A (en) * | 1992-06-01 | 1994-03-08 | Enichem S.P.A. | Blends of polycarbonate containing fluorinated-bisphenol A and polymethyl methacrylate |
| US5280070A (en) * | 1992-06-01 | 1994-01-18 | Enichem S.P.A. | Polycarbonate-polymethyl methacrylate blends |
| US5274044A (en) * | 1992-07-28 | 1993-12-28 | General Electric Company | Graft copolymers containing (thioaromatic) alkyl acrylate rubber substrates |
| US6359069B1 (en) | 2000-08-10 | 2002-03-19 | Bayer Corporation | Transparent composition containing polycarbonate and a copolymer of methylmethacrylate |
| JP4843592B2 (ja) * | 2007-10-22 | 2011-12-21 | 出光興産株式会社 | ポリカーボネート樹脂組成物及び導光板 |
| EP2657294A1 (de) * | 2012-04-27 | 2013-10-30 | Bayer MaterialScience AG | Verarbeitungsstabile PC/ABS-Zusammensetzungen |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1182807A (en) * | 1967-08-03 | 1970-03-04 | Ici Ltd | Thermoplastic Polymeric Compositions |
-
1972
- 1972-12-29 AU AU50625/72A patent/AU462964B2/en not_active Expired
- 1972-12-30 DE DE19722264268 patent/DE2264268C2/de not_active Expired
-
1973
- 1973-01-02 NL NL7300034A patent/NL7300034A/xx not_active Application Discontinuation
- 1973-01-03 GB GB30073A patent/GB1394481A/en not_active Expired
- 1973-01-03 FR FR7300165A patent/FR2167650B1/fr not_active Expired
- 1973-01-03 IT IT1901173A patent/IT977995B/it active
- 1973-01-04 JP JP473A patent/JPS5628937B2/ja not_active Expired
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| FR2167650A1 (enExample) | 1973-08-24 |
| IT977995B (it) | 1974-09-20 |
| AU462964B2 (en) | 1975-06-25 |
| AU5062572A (en) | 1974-07-04 |
| FR2167650B1 (enExample) | 1979-02-09 |
| DE2264268A1 (de) | 1973-07-12 |
| JPS4880650A (enExample) | 1973-10-29 |
| JPS5628937B2 (enExample) | 1981-07-04 |
| NL7300034A (enExample) | 1973-07-05 |
| GB1394481A (en) | 1975-05-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2264268C2 (de) | Verbesserte Polycarbonat-Formmasse | |
| EP0087038B1 (de) | Verwendung von farbhellen Polyphenylensulfiden in Mischungen mit thermoplastischen Polycarbonaten und/oder thermoplastischen Polyestern | |
| DE2938464A1 (de) | Thermoplastische polycarbonate, ihre herstellung und ihre verwendung als formkoerper und folien | |
| DE2931172A1 (de) | Verwendung von alkali- und erdalkalisalzen alkylsubstituierter aromatischer sulfonsaeuren, phosphonsaeuren und sauerer phosphonsaeureester als interne antistatika fuer polycarbonat, insbesondere fuer polycarbonatfolien | |
| DE3002762A1 (de) | Verfahren zur herstellung von heterocyclisch-aromatischen oligocarbonaten mit diphenolcarbonat-endgruppen und ihre verwendung zur herstellung von thermoplastischen, hochmolekularen heterocyclisch-aromatischen copolycarbonaten | |
| EP0001096A2 (de) | Polycarbonatgemische mit verbesserter Flammwidrigkeit | |
| DE2148598B2 (de) | Flammfeste thermoplastische Formmassen und Formkörper mit hoher Schlagzähigkeit | |
| DE3222522A1 (de) | Stabilisatorkombinationen, ihre verwendung zur stabilisierung von thermoplastischen polycarbonaten sowie stabilisierte thermoplastische polycarbonate | |
| DE3226810A1 (de) | Aromatische polycarbonat-zubereitung mit verbesserter hydrolytischer stabilitaet | |
| DE69032397T2 (de) | Stabilisierte aromatische polykarbonatzusammensetzung und herstellung | |
| DE2620255C2 (de) | Thermoplastische Formmassen und Formkörper aus Polycarbonaten mit verbesserter Entformbarkeit beim Spritzgießen | |
| DE2211199C3 (de) | Wärmeformbeständige Massen auf der Basis von Styrol-Polymerisaten | |
| DE3143252A1 (de) | Verfahren zur herstellung von polycarbonaten mit verbessertem alterungsverhalten | |
| DE2751218A1 (de) | Plastizierte polycarbonatzusammensetzung | |
| DE2658849A1 (de) | Stabilisierte polycarbonatzusammensetzung | |
| DE60118394T2 (de) | Transparente Zusammensetzung enthaltend ein Polycarbonat und ein Methylmethacrylat-Copolymer | |
| EP0066772A2 (de) | Polycarbonat-Silicat-Zusammensetzungen | |
| DE2601961A1 (de) | Flammverzoegernde polymermasse | |
| EP0472064A2 (de) | Ternäre Mischungen | |
| DE4236142A1 (de) | Gegen gamma-strahlung bestaendige polycarbonat-zusammensetzungen | |
| EP0102573A1 (de) | Polycarbonate mit konjugierte Doppelbindungen enthaltenden Endgruppen, gegebenenfalls im Gemisch mit bekannten aromatischen Polycarbonaten, ihre Herstellung und ihre Verwendung | |
| DE3884434T2 (de) | Harzmischung aus einem aromatischen Polycarbonat und einem aromatischen Polyester. | |
| DE2364399A1 (de) | Stabilisierte form- und pressmassen | |
| DE3021726A1 (de) | Stabilisierte thermoplastische formmassen | |
| DE3209672A1 (de) | Flammhemmende polycarbonatmasse |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8363 | Opposition against the patent | ||
| 8330 | Complete disclaimer |