DE2262790A1 - Verfahren zur getterung von halogenlampen - Google Patents
Verfahren zur getterung von halogenlampenInfo
- Publication number
- DE2262790A1 DE2262790A1 DE19722262790 DE2262790A DE2262790A1 DE 2262790 A1 DE2262790 A1 DE 2262790A1 DE 19722262790 DE19722262790 DE 19722262790 DE 2262790 A DE2262790 A DE 2262790A DE 2262790 A1 DE2262790 A1 DE 2262790A1
- Authority
- DE
- Germany
- Prior art keywords
- lamp
- halogen
- aluminum
- gas
- compound
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 229910052736 halogen Inorganic materials 0.000 title claims abstract description 29
- 150000002367 halogens Chemical class 0.000 title claims abstract description 29
- -1 aluminium halide Chemical class 0.000 title claims abstract description 11
- 229910052782 aluminium Inorganic materials 0.000 title claims description 15
- 239000004411 aluminium Substances 0.000 title 1
- 239000007789 gas Substances 0.000 claims abstract description 30
- 239000012535 impurity Substances 0.000 claims abstract description 9
- 239000002904 solvent Substances 0.000 claims abstract description 6
- 230000009931 harmful effect Effects 0.000 claims abstract description 3
- 238000000034 method Methods 0.000 claims description 15
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 9
- 239000000463 material Substances 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 8
- 238000004519 manufacturing process Methods 0.000 claims description 7
- 150000001875 compounds Chemical class 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 230000000996 additive effect Effects 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims 3
- 229910052794 bromium Inorganic materials 0.000 claims 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims 2
- 229910052801 chlorine Inorganic materials 0.000 claims 2
- 239000000460 chlorine Substances 0.000 claims 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical compound II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 claims 1
- 229910052731 fluorine Inorganic materials 0.000 claims 1
- 239000011737 fluorine Substances 0.000 claims 1
- 239000007788 liquid Substances 0.000 claims 1
- 239000005078 molybdenum compound Substances 0.000 claims 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 abstract description 3
- 125000005843 halogen group Chemical group 0.000 abstract 2
- 125000004429 atom Chemical group 0.000 abstract 1
- 230000001629 suppression Effects 0.000 abstract 1
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 8
- 229910052721 tungsten Inorganic materials 0.000 description 8
- 239000010937 tungsten Substances 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- PHSPJQZRQAJPPF-UHFFFAOYSA-N N-alpha-Methylhistamine Chemical compound CNCCC1=CN=CN1 PHSPJQZRQAJPPF-UHFFFAOYSA-N 0.000 description 5
- PQLAYKMGZDUDLQ-UHFFFAOYSA-K aluminium bromide Chemical compound Br[Al](Br)Br PQLAYKMGZDUDLQ-UHFFFAOYSA-K 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052698 phosphorus Inorganic materials 0.000 description 4
- 239000011574 phosphorus Substances 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- 229910002092 carbon dioxide Inorganic materials 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 238000005247 gettering Methods 0.000 description 3
- PUGUQINMNYINPK-UHFFFAOYSA-N tert-butyl 4-(2-chloroacetyl)piperazine-1-carboxylate Chemical compound CC(C)(C)OC(=O)N1CCN(C(=O)CCl)CC1 PUGUQINMNYINPK-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 229910002090 carbon oxide Inorganic materials 0.000 description 2
- 230000004907 flux Effects 0.000 description 2
- 150000002366 halogen compounds Chemical class 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 150000002894 organic compounds Chemical class 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 229910001930 tungsten oxide Inorganic materials 0.000 description 2
- 229910001868 water Inorganic materials 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- YUWBVKYVJWNVLE-UHFFFAOYSA-N [N].[P] Chemical compound [N].[P] YUWBVKYVJWNVLE-UHFFFAOYSA-N 0.000 description 1
- 239000013543 active substance Substances 0.000 description 1
- 230000000274 adsorptive effect Effects 0.000 description 1
- 239000003708 ampul Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- UBAZGMLMVVQSCD-UHFFFAOYSA-N carbon dioxide;molecular oxygen Chemical compound O=O.O=C=O UBAZGMLMVVQSCD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000011109 contamination Methods 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 125000004122 cyclic group Chemical class 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 239000001257 hydrogen Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 230000001795 light effect Effects 0.000 description 1
- VUZPPFZMUPKLLV-UHFFFAOYSA-N methane;hydrate Chemical compound C.O VUZPPFZMUPKLLV-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910017464 nitrogen compound Inorganic materials 0.000 description 1
- 239000012454 non-polar solvent Substances 0.000 description 1
- QGLKJKCYBOYXKC-UHFFFAOYSA-N nonaoxidotritungsten Chemical compound O=[W]1(=O)O[W](=O)(=O)O[W](=O)(=O)O1 QGLKJKCYBOYXKC-UHFFFAOYSA-N 0.000 description 1
- VVRQVWSVLMGPRN-UHFFFAOYSA-N oxotungsten Chemical class [W]=O VVRQVWSVLMGPRN-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- IPNPIHIZVLFAFP-UHFFFAOYSA-N phosphorus tribromide Chemical compound BrP(Br)Br IPNPIHIZVLFAFP-UHFFFAOYSA-N 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 238000010079 rubber tapping Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/52—Means for obtaining or maintaining the desired pressure within the vessel
- H01K1/54—Means for absorbing or absorbing gas, or for preventing or removing efflorescence, e.g. by gettering
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01K—ELECTRIC INCANDESCENT LAMPS
- H01K1/00—Details
- H01K1/52—Means for obtaining or maintaining the desired pressure within the vessel
- H01K1/54—Means for absorbing or absorbing gas, or for preventing or removing efflorescence, e.g. by gettering
- H01K1/56—Means for absorbing or absorbing gas, or for preventing or removing efflorescence, e.g. by gettering characterised by the material of the getter
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HUEE001989 HU162781B (cs) | 1971-12-22 | 1971-12-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2262790A1 true DE2262790A1 (de) | 1973-07-05 |
Family
ID=10995415
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722262790 Pending DE2262790A1 (de) | 1971-12-22 | 1972-12-21 | Verfahren zur getterung von halogenlampen |
Country Status (4)
| Country | Link |
|---|---|
| AT (1) | AT326216B (cs) |
| DE (1) | DE2262790A1 (cs) |
| HU (1) | HU162781B (cs) |
| NL (1) | NL7217309A (cs) |
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2309527A1 (fr) * | 1975-04-30 | 1976-11-26 | Degussa | Preparation de solutions anhydres d'acide perpropionique dans du benzene a partir d'acide propionique |
| DE2701051A1 (de) * | 1976-01-12 | 1977-07-21 | Ici Ltd | Gluehlampe und verfahren zum schutz ihrer innenflaechen |
| DE2803122A1 (de) * | 1978-01-25 | 1979-07-26 | Original Hanau Quarzlampen | Halogen-gluehlampe und verfahren zu ihrer herstellung |
-
1971
- 1971-12-22 HU HUEE001989 patent/HU162781B/hu unknown
-
1972
- 1972-07-10 AT AT588672A patent/AT326216B/de not_active IP Right Cessation
- 1972-12-19 NL NL7217309A patent/NL7217309A/xx unknown
- 1972-12-21 DE DE19722262790 patent/DE2262790A1/de active Pending
Cited By (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2309527A1 (fr) * | 1975-04-30 | 1976-11-26 | Degussa | Preparation de solutions anhydres d'acide perpropionique dans du benzene a partir d'acide propionique |
| DE2701051A1 (de) * | 1976-01-12 | 1977-07-21 | Ici Ltd | Gluehlampe und verfahren zum schutz ihrer innenflaechen |
| DE2803122A1 (de) * | 1978-01-25 | 1979-07-26 | Original Hanau Quarzlampen | Halogen-gluehlampe und verfahren zu ihrer herstellung |
Also Published As
| Publication number | Publication date |
|---|---|
| NL7217309A (cs) | 1973-06-26 |
| ATA588672A (de) | 1975-02-15 |
| AT326216B (de) | 1975-11-25 |
| HU162781B (cs) | 1973-04-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1764979A1 (de) | Quecksilber-Metallhalogenid-Dampflampe mit Regeneration | |
| DE2402422C3 (de) | Elektrische Entladungslampe und Verfahren zu deren Herstellung | |
| DE2262790A1 (de) | Verfahren zur getterung von halogenlampen | |
| DE2725297A1 (de) | Hochdruckquecksilberdampfentladungslampe | |
| DE1932843A1 (de) | Elektrische Umwandlungsvorrichtung mit sphaeroidischen Leuchtstoffen | |
| DE2402760C3 (de) | Hochdruck-Entladungslampe | |
| DE2643749A1 (de) | Elektrische gluehlampe mit einem wolfram-brom-zyklus | |
| DE2245519C2 (de) | Mehrkammer-Chemilumineszenz-Lichtquelle | |
| DE2431250C3 (de) | Halogenglühlampe und Verfahren zur Herstellung derselben | |
| DE977219C (de) | Edelgas enthaltende gasgefuellte Gluehlampe und Verfahren zu deren Herstellung | |
| DE2303967A1 (de) | Elektrische gluehlampe mit wolframbrom-zyklus | |
| DE2546417C3 (de) | Quecksilberdampf-Entladungslampe mit Metallhalogenidzusätzen | |
| DE2431250B2 (de) | Halogengluehlampe und verfahren zur herstellung derselben | |
| DE1589146C (de) | Glühlampe | |
| DE1597715C3 (de) | Verbrennungsblitzlampe | |
| DE2720132A1 (de) | Gasbindervorrichtung. verfahren zur herstellung einer farbbildroehre unter verwendung dieser gasbindervorrichtung und durch dieses verfahren hergestellte farbbildroehre | |
| DE2140087C2 (cs) | ||
| DE2452029B2 (de) | Wolframhalogen-Glühlampe | |
| DE174290C (cs) | ||
| DE1036396B (de) | Verfahren zur Herstellung einer Kathode, die aus einem poroesen gesinterten hochschmelzenden Metallkoerper besteht, der mit Erdalkalimetallverbindungen impraegniert ist | |
| AT128310B (de) | Verfahren zur Darstellung von Alkali- und Erdalkalimetallen. | |
| DE376566C (de) | Elektrische Gluehlampe | |
| DE2362932A1 (de) | Quecksilberdampf-hochdruckentladungslampe mit metallhalogeniden | |
| DE464662C (de) | Sauerstofffreie Kohlenwasserstoffverbindung als Einbringstoff fuer gasgefuellte elektrische Gluehlampen | |
| DE2617337C3 (de) | Hochdruck-Natriumdampf -Entladungslampe und Verfahren zu ihrer Herstellung |