DE2244264C3 - Verfahren zur Herstellung eines Gemisches aus Crotonsäurenitril, MaIeinsäurenitril und Fumarsäurenitril - Google Patents
Verfahren zur Herstellung eines Gemisches aus Crotonsäurenitril, MaIeinsäurenitril und FumarsäurenitrilInfo
- Publication number
- DE2244264C3 DE2244264C3 DE19722244264 DE2244264A DE2244264C3 DE 2244264 C3 DE2244264 C3 DE 2244264C3 DE 19722244264 DE19722244264 DE 19722244264 DE 2244264 A DE2244264 A DE 2244264A DE 2244264 C3 DE2244264 C3 DE 2244264C3
- Authority
- DE
- Germany
- Prior art keywords
- acid nitrile
- mixture
- oxides
- catalyst
- oxygen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000000203 mixture Substances 0.000 title claims description 13
- -1 maleic acid nitrile Chemical class 0.000 title claims description 12
- 238000000034 method Methods 0.000 title claims description 12
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 title claims description 7
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 title claims description 5
- 239000011976 maleic acid Substances 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title description 4
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Natural products OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 title description 2
- NKKMVIVFRUYPLQ-NSCUHMNNSA-N crotononitrile Chemical compound C\C=C\C#N NKKMVIVFRUYPLQ-NSCUHMNNSA-N 0.000 title description 2
- 239000001530 fumaric acid Substances 0.000 title description 2
- 239000003054 catalyst Substances 0.000 claims description 24
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 15
- 150000002825 nitriles Chemical class 0.000 claims description 9
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 8
- 229910052760 oxygen Inorganic materials 0.000 claims description 8
- 239000001301 oxygen Substances 0.000 claims description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 8
- 229910021529 ammonia Inorganic materials 0.000 claims description 7
- 239000007789 gas Substances 0.000 claims description 7
- 239000002253 acid Substances 0.000 claims description 6
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- 210000001691 amnion Anatomy 0.000 claims description 2
- LDHQCZJRKDOVOX-UHFFFAOYSA-N trans-crotonic acid Natural products CC=CC(O)=O LDHQCZJRKDOVOX-UHFFFAOYSA-N 0.000 claims description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 7
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 6
- 229910052750 molybdenum Inorganic materials 0.000 description 6
- 239000011733 molybdenum Substances 0.000 description 6
- 229910052797 bismuth Inorganic materials 0.000 description 5
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 4
- 229910044991 metal oxide Inorganic materials 0.000 description 4
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical group [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 229910052783 alkali metal Inorganic materials 0.000 description 3
- 229910052785 arsenic Inorganic materials 0.000 description 3
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 229910052698 phosphorus Inorganic materials 0.000 description 3
- 239000011574 phosphorus Substances 0.000 description 3
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 3
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 3
- 229910052714 tellurium Inorganic materials 0.000 description 3
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 3
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 3
- 229910052721 tungsten Inorganic materials 0.000 description 3
- 239000010937 tungsten Substances 0.000 description 3
- 229910052720 vanadium Inorganic materials 0.000 description 3
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 229910000410 antimony oxide Inorganic materials 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 229910052802 copper Inorganic materials 0.000 description 2
- 239000010949 copper Substances 0.000 description 2
- XAEWZDYWZHIUCT-UHFFFAOYSA-N desipramine hydrochloride Chemical compound [H+].[Cl-].C1CC2=CC=CC=C2N(CCCNC)C2=CC=CC=C21 XAEWZDYWZHIUCT-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 239000011572 manganese Substances 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 229910000476 molybdenum oxide Inorganic materials 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 2
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000000243 solution Substances 0.000 description 2
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229910052684 Cerium Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 1
- XCUCRSRQUDMZLU-UHFFFAOYSA-N [As].[Bi] Chemical compound [As].[Bi] XCUCRSRQUDMZLU-UHFFFAOYSA-N 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 1
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- PSJHYNCTLOOHDE-UHFFFAOYSA-N azane buta-1,3-diene Chemical compound N.C=CC=C PSJHYNCTLOOHDE-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- ZMIGMASIKSOYAM-UHFFFAOYSA-N cerium Chemical compound [Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce][Ce] ZMIGMASIKSOYAM-UHFFFAOYSA-N 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- DOBRDRYODQBAMW-UHFFFAOYSA-N copper(i) cyanide Chemical compound [Cu+].N#[C-] DOBRDRYODQBAMW-UHFFFAOYSA-N 0.000 description 1
- MLUCVPSAIODCQM-NSCUHMNNSA-N crotonaldehyde Chemical compound C\C=C\C=O MLUCVPSAIODCQM-NSCUHMNNSA-N 0.000 description 1
- MLUCVPSAIODCQM-UHFFFAOYSA-N crotonaldehyde Natural products CC=CC=O MLUCVPSAIODCQM-UHFFFAOYSA-N 0.000 description 1
- MGNCLNQXLYJVJD-UHFFFAOYSA-N cyanuric chloride Chemical compound ClC1=NC(Cl)=NC(Cl)=N1 MGNCLNQXLYJVJD-UHFFFAOYSA-N 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- 150000001470 diamides Chemical class 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- FBAFATDZDUQKNH-UHFFFAOYSA-M iron chloride Chemical compound [Cl-].[Fe] FBAFATDZDUQKNH-UHFFFAOYSA-M 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- 239000000178 monomer Substances 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 229910000484 niobium oxide Inorganic materials 0.000 description 1
- URLJKFSTXLNXLG-UHFFFAOYSA-N niobium(5+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Nb+5].[Nb+5] URLJKFSTXLNXLG-UHFFFAOYSA-N 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- QVGXLLKOCUKJST-AKLPVKDBSA-N oxygen-19 atom Chemical compound [19O] QVGXLLKOCUKJST-AKLPVKDBSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000009257 reactivity Effects 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 239000010936 titanium Substances 0.000 description 1
- 229910052719 titanium Inorganic materials 0.000 description 1
- JCMLRUNDSXARRW-UHFFFAOYSA-N trioxouranium Chemical compound O=[U](=O)=O JCMLRUNDSXARRW-UHFFFAOYSA-N 0.000 description 1
- JFALSRSLKYAFGM-UHFFFAOYSA-N uranium(0) Chemical compound [U] JFALSRSLKYAFGM-UHFFFAOYSA-N 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 150000003738 xylenes Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/24—Preparation of carboxylic acid nitriles by ammoxidation of hydrocarbons or substituted hydrocarbons
- C07C253/26—Preparation of carboxylic acid nitriles by ammoxidation of hydrocarbons or substituted hydrocarbons containing carbon-to-carbon multiple bonds, e.g. unsaturated aldehydes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7132586A FR2151704A5 (enExample) | 1971-09-09 | 1971-09-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2244264A1 DE2244264A1 (de) | 1973-03-15 |
| DE2244264B2 DE2244264B2 (enExample) | 1974-09-12 |
| DE2244264C3 true DE2244264C3 (de) | 1975-05-15 |
Family
ID=9082718
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722244264 Expired DE2244264C3 (de) | 1971-09-09 | 1972-09-08 | Verfahren zur Herstellung eines Gemisches aus Crotonsäurenitril, MaIeinsäurenitril und Fumarsäurenitril |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5024294B2 (enExample) |
| AT (1) | AT319199B (enExample) |
| BE (1) | BE788611A (enExample) |
| BR (1) | BR7206085D0 (enExample) |
| CH (1) | CH544068A (enExample) |
| DD (1) | DD100245A5 (enExample) |
| DE (1) | DE2244264C3 (enExample) |
| ES (1) | ES406547A1 (enExample) |
| FR (1) | FR2151704A5 (enExample) |
| GB (1) | GB1394207A (enExample) |
| IT (1) | IT967311B (enExample) |
| LU (1) | LU66034A1 (enExample) |
| NL (1) | NL148309B (enExample) |
| SU (1) | SU434648A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4436671A (en) | 1981-02-12 | 1984-03-13 | Takeda Chemical Industries, Limited | Process for producing unsaturated aliphatic dinitriles |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5231597U (enExample) * | 1975-08-25 | 1977-03-05 | ||
| JPS5377738A (en) * | 1976-12-16 | 1978-07-10 | Hiroshi Nakamura | Model aircraft and model aircraft assembling kit |
| DE3008946A1 (de) * | 1980-03-08 | 1981-09-24 | Brown, Boveri & Cie Ag, 6800 Mannheim | Programmierbarer scheibenwischer-intervallschalter |
| US4599430A (en) * | 1981-12-21 | 1986-07-08 | The Standard Oil Company | Nitrogenation of hydrocarbons, including the production of maleimide |
| US4604244A (en) * | 1983-01-03 | 1986-08-05 | The Standard Oil Company | Process for making adiponitrile precursors |
| JPS59147057A (ja) * | 1983-02-14 | 1984-08-23 | Mitsui Petrochem Ind Ltd | 塗装用フツ素樹脂組成物 |
| EP1812157A1 (en) * | 2004-11-22 | 2007-08-01 | DSMIP Assets B.V. | Catalyst for the preparation of fumaronitrile and/or maleonitrile |
-
0
- BE BE788611D patent/BE788611A/xx unknown
-
1971
- 1971-09-09 FR FR7132586A patent/FR2151704A5/fr not_active Expired
-
1972
- 1972-08-23 SU SU1821084A patent/SU434648A3/ru active
- 1972-09-01 NL NL7211947A patent/NL148309B/xx unknown
- 1972-09-04 DD DD16543272A patent/DD100245A5/xx unknown
- 1972-09-04 BR BR608572A patent/BR7206085D0/pt unknown
- 1972-09-08 LU LU66034D patent/LU66034A1/xx unknown
- 1972-09-08 GB GB4192272A patent/GB1394207A/en not_active Expired
- 1972-09-08 DE DE19722244264 patent/DE2244264C3/de not_active Expired
- 1972-09-08 CH CH1325572A patent/CH544068A/fr not_active IP Right Cessation
- 1972-09-08 AT AT772772A patent/AT319199B/de not_active IP Right Cessation
- 1972-09-08 JP JP8966272A patent/JPS5024294B2/ja not_active Expired
- 1972-09-09 ES ES406547A patent/ES406547A1/es not_active Expired
- 1972-09-09 IT IT2901072A patent/IT967311B/it active
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4436671A (en) | 1981-02-12 | 1984-03-13 | Takeda Chemical Industries, Limited | Process for producing unsaturated aliphatic dinitriles |
Also Published As
| Publication number | Publication date |
|---|---|
| LU66034A1 (enExample) | 1973-03-12 |
| AT319199B (de) | 1974-12-10 |
| JPS4834823A (enExample) | 1973-05-22 |
| JPS5024294B2 (enExample) | 1975-08-14 |
| GB1394207A (en) | 1975-05-14 |
| NL7211947A (enExample) | 1973-03-13 |
| DD100245A5 (enExample) | 1973-09-12 |
| DE2244264A1 (de) | 1973-03-15 |
| SU434648A3 (ru) | 1974-06-30 |
| BE788611A (fr) | 1973-03-08 |
| FR2151704A5 (enExample) | 1973-04-20 |
| ES406547A1 (es) | 1975-09-01 |
| CH544068A (fr) | 1973-11-15 |
| NL148309B (nl) | 1976-01-15 |
| BR7206085D0 (pt) | 1973-09-13 |
| DE2244264B2 (enExample) | 1974-09-12 |
| IT967311B (it) | 1974-02-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2530959C2 (de) | Oxydationskatalysator | |
| DE60018531T2 (de) | Oxydkomplex als Katalysator und Verfahren für die Herstellung von Acrylsäure | |
| DE2261907C2 (de) | Verfahren zur Herstellung von Maleinsäureanhydrid | |
| DE60128811T2 (de) | Verfahren für die herstellung von acrylsäure | |
| DE69603810T2 (de) | Verfahren zur Herstellung von Nitrilen | |
| DE2608583C3 (de) | Verfahren zur Herstellung von Methacrylsäure durch katalytisch« Oxidation von Methacrolein | |
| DE19847656B4 (de) | Verwendung eines Ammonoxidationskatalysators bei der Herstellung von Acrylnitril oder Methacrylnitril aus Propan oder Isobutan durch Ammonoxidation | |
| DE2505249A1 (de) | Verfahren zur herstellung von acrylnitril | |
| DE69920437T2 (de) | Katalysator zur herstellung von ungesättigten nitrilen | |
| DE112005000007B4 (de) | Katalysator zur Partialoxidation, Verfahren zur Herstellung desselben und Verwendung des Katalysators | |
| EP0699476B1 (de) | Für die Ammonoxidation geeignete Trägerkatalysatoren | |
| DE102010049824A1 (de) | Verfahren zur Herstellung eines Katalysators zur Herstellung von Methacrylsäure und Verfahren zur Herstellung von Methacrylsäure | |
| DE2244264C3 (de) | Verfahren zur Herstellung eines Gemisches aus Crotonsäurenitril, MaIeinsäurenitril und Fumarsäurenitril | |
| EP0767165B1 (de) | Verfahren zur Herstellung von aromatischen oder heteroaromatischen Nitrilen | |
| DE69818718T2 (de) | Herstellung von Vanadiumantimonatkatalysatoren unter Verwendung von Sn02, nH20 | |
| DE69723795T2 (de) | Erhaltung der Aktivität von Molybdän-Wismuth-Eisen der Cer enthaltenden Oxidationskatalysatoren | |
| EP2021125A1 (de) | Neuer trägerkatalysator für die ammonoxidation | |
| DE2641846A1 (de) | Uranoxid-antimonoxidverbindung sowie herstellung und verwendung derselben als katalysator | |
| DE2321150A1 (de) | Verfahren zur herstellung von methacrylnitril | |
| DE1809795C3 (de) | Verfahren zur Herstellung aromatischer Nitrile | |
| DE2338111C2 (de) | Verfahren zur katalytischen Oxidation von Propylen oder Isobutylen zu Acrolein oder Methacrolein in der Gasphase mit molekularem Sauerstoff | |
| DE2461184C2 (de) | Antimon, Eisen, Wismut und Molybdän, sowie gegebenenfalls Kobalt und Nickel enthaltender Katalysator und seine Verwendung | |
| DE2320231C3 (de) | Katalysator mit einem Gehalt an Wismut, Molybdän und Wolfram und seine Verwendung | |
| DE2161450A1 (enExample) | ||
| DE2338814A1 (de) | Verfahren zur herstellung von acrylsaeurenitril und katalysator zur durchfuehrung des verfahrens |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |