SU434648A3 - Способ получения смеси ненасыщенных алифатических нитрилов - Google Patents
Способ получения смеси ненасыщенных алифатических нитриловInfo
- Publication number
- SU434648A3 SU434648A3 SU1821084A SU1821084A SU434648A3 SU 434648 A3 SU434648 A3 SU 434648A3 SU 1821084 A SU1821084 A SU 1821084A SU 1821084 A SU1821084 A SU 1821084A SU 434648 A3 SU434648 A3 SU 434648A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- ammonolysis
- catalyst
- target product
- mixture
- isolating
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims description 14
- 238000000034 method Methods 0.000 title claims description 11
- 150000002825 nitriles Chemical class 0.000 title description 4
- 239000003054 catalyst Substances 0.000 claims description 18
- 238000005915 ammonolysis reaction Methods 0.000 claims description 11
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 claims description 10
- 239000007789 gas Substances 0.000 claims description 6
- KYPOHTVBFVELTG-UPHRSURJSA-N (z)-but-2-enedinitrile Chemical compound N#C\C=C/C#N KYPOHTVBFVELTG-UPHRSURJSA-N 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 4
- 229910000476 molybdenum oxide Inorganic materials 0.000 claims description 4
- 230000001590 oxidative effect Effects 0.000 claims description 4
- PQQKPALAQIIWST-UHFFFAOYSA-N oxomolybdenum Chemical compound [Mo]=O PQQKPALAQIIWST-UHFFFAOYSA-N 0.000 claims description 4
- 229910001935 vanadium oxide Inorganic materials 0.000 claims description 4
- KYPOHTVBFVELTG-OWOJBTEDSA-N (e)-but-2-enedinitrile Chemical compound N#C\C=C\C#N KYPOHTVBFVELTG-OWOJBTEDSA-N 0.000 claims description 3
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 3
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 claims description 3
- 229910000410 antimony oxide Inorganic materials 0.000 claims description 3
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 3
- 229910052760 oxygen Inorganic materials 0.000 claims description 3
- 239000001301 oxygen Substances 0.000 claims description 3
- -1 unsaturated aliphatic nitriles Chemical class 0.000 claims description 3
- 239000002253 acid Substances 0.000 claims description 2
- 229910021529 ammonia Inorganic materials 0.000 claims description 2
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- MEFBJEMVZONFCJ-UHFFFAOYSA-N molybdate Chemical compound [O-][Mo]([O-])(=O)=O MEFBJEMVZONFCJ-UHFFFAOYSA-N 0.000 claims description 2
- 229920000642 polymer Polymers 0.000 claims description 2
- JKUMLNOQXADSAD-UHFFFAOYSA-N [Bi].[P] Chemical compound [Bi].[P] JKUMLNOQXADSAD-UHFFFAOYSA-N 0.000 claims 1
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 5
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 229910052797 bismuth Inorganic materials 0.000 description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 2
- NKKMVIVFRUYPLQ-NSCUHMNNSA-N crotononitrile Chemical compound C\C=C\C#N NKKMVIVFRUYPLQ-NSCUHMNNSA-N 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910044991 metal oxide Inorganic materials 0.000 description 2
- 150000004706 metal oxides Chemical class 0.000 description 2
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000002244 precipitate Substances 0.000 description 2
- LEONUFNNVUYDNQ-UHFFFAOYSA-N vanadium atom Chemical compound [V] LEONUFNNVUYDNQ-UHFFFAOYSA-N 0.000 description 2
- XTJLXXCARCJVPJ-TWTPFVCWSA-N (2e,4e)-hepta-2,4-diene Chemical compound CC\C=C\C=C\C XTJLXXCARCJVPJ-TWTPFVCWSA-N 0.000 description 1
- PRBHEGAFLDMLAL-GQCTYLIASA-N (4e)-hexa-1,4-diene Chemical compound C\C=C\CC=C PRBHEGAFLDMLAL-GQCTYLIASA-N 0.000 description 1
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 229910021578 Iron(III) chloride Inorganic materials 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 229910052770 Uranium Inorganic materials 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000011114 ammonium hydroxide Nutrition 0.000 description 1
- APUPEJJSWDHEBO-UHFFFAOYSA-P ammonium molybdate Chemical compound [NH4+].[NH4+].[O-][Mo]([O-])(=O)=O APUPEJJSWDHEBO-UHFFFAOYSA-P 0.000 description 1
- 229940010552 ammonium molybdate Drugs 0.000 description 1
- 235000018660 ammonium molybdate Nutrition 0.000 description 1
- 239000011609 ammonium molybdate Substances 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 229910052787 antimony Inorganic materials 0.000 description 1
- FAPDDOBMIUGHIN-UHFFFAOYSA-K antimony trichloride Chemical compound Cl[Sb](Cl)Cl FAPDDOBMIUGHIN-UHFFFAOYSA-K 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- RVEASLJBVZGRIP-UHFFFAOYSA-K dinitrosooxybismuthanyl nitrite Chemical compound [Bi+3].[O-]N=O.[O-]N=O.[O-]N=O RVEASLJBVZGRIP-UHFFFAOYSA-K 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 1
- RBTARNINKXHZNM-UHFFFAOYSA-K iron trichloride Chemical compound Cl[Fe](Cl)Cl RBTARNINKXHZNM-UHFFFAOYSA-K 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000004949 mass spectrometry Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- VLAPMBHFAWRUQP-UHFFFAOYSA-L molybdic acid Chemical compound O[Mo](O)(=O)=O VLAPMBHFAWRUQP-UHFFFAOYSA-L 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- NDLPOXTZKUMGOV-UHFFFAOYSA-N oxo(oxoferriooxy)iron hydrate Chemical compound O.O=[Fe]O[Fe]=O NDLPOXTZKUMGOV-UHFFFAOYSA-N 0.000 description 1
- DHRLEVQXOMLTIM-UHFFFAOYSA-N phosphoric acid;trioxomolybdenum Chemical compound O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.O=[Mo](=O)=O.OP(O)(O)=O DHRLEVQXOMLTIM-UHFFFAOYSA-N 0.000 description 1
- IYDGMDWEHDFVQI-UHFFFAOYSA-N phosphoric acid;trioxotungsten Chemical compound O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.O=[W](=O)=O.OP(O)(O)=O IYDGMDWEHDFVQI-UHFFFAOYSA-N 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 1
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 239000002994 raw material Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- DNYWZCXLKNTFFI-UHFFFAOYSA-N uranium Chemical compound [U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U][U] DNYWZCXLKNTFFI-UHFFFAOYSA-N 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- 239000002912 waste gas Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical compound O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C253/00—Preparation of carboxylic acid nitriles
- C07C253/24—Preparation of carboxylic acid nitriles by ammoxidation of hydrocarbons or substituted hydrocarbons
- C07C253/26—Preparation of carboxylic acid nitriles by ammoxidation of hydrocarbons or substituted hydrocarbons containing carbon-to-carbon multiple bonds, e.g. unsaturated aldehydes
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7132586A FR2151704A5 (enExample) | 1971-09-09 | 1971-09-09 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU434648A3 true SU434648A3 (ru) | 1974-06-30 |
Family
ID=9082718
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU1821084A SU434648A3 (ru) | 1971-09-09 | 1972-08-23 | Способ получения смеси ненасыщенных алифатических нитрилов |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5024294B2 (enExample) |
| AT (1) | AT319199B (enExample) |
| BE (1) | BE788611A (enExample) |
| BR (1) | BR7206085D0 (enExample) |
| CH (1) | CH544068A (enExample) |
| DD (1) | DD100245A5 (enExample) |
| DE (1) | DE2244264C3 (enExample) |
| ES (1) | ES406547A1 (enExample) |
| FR (1) | FR2151704A5 (enExample) |
| GB (1) | GB1394207A (enExample) |
| IT (1) | IT967311B (enExample) |
| LU (1) | LU66034A1 (enExample) |
| NL (1) | NL148309B (enExample) |
| SU (1) | SU434648A3 (enExample) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA010670B1 (ru) * | 2004-11-22 | 2008-10-30 | ДСМ АйПи АССЕТС Б.В. | Катализатор для получения фумаронитрила и/или малеонитрила |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5231597U (enExample) * | 1975-08-25 | 1977-03-05 | ||
| JPS5377738A (en) * | 1976-12-16 | 1978-07-10 | Hiroshi Nakamura | Model aircraft and model aircraft assembling kit |
| DE3008946A1 (de) * | 1980-03-08 | 1981-09-24 | Brown, Boveri & Cie Ag, 6800 Mannheim | Programmierbarer scheibenwischer-intervallschalter |
| JPS57134454A (en) | 1981-02-12 | 1982-08-19 | Takeda Chem Ind Ltd | Preparation of unsaturated aliphatic dinitrile |
| US4599430A (en) * | 1981-12-21 | 1986-07-08 | The Standard Oil Company | Nitrogenation of hydrocarbons, including the production of maleimide |
| US4604244A (en) * | 1983-01-03 | 1986-08-05 | The Standard Oil Company | Process for making adiponitrile precursors |
| JPS59147057A (ja) * | 1983-02-14 | 1984-08-23 | Mitsui Petrochem Ind Ltd | 塗装用フツ素樹脂組成物 |
-
0
- BE BE788611D patent/BE788611A/xx unknown
-
1971
- 1971-09-09 FR FR7132586A patent/FR2151704A5/fr not_active Expired
-
1972
- 1972-08-23 SU SU1821084A patent/SU434648A3/ru active
- 1972-09-01 NL NL7211947A patent/NL148309B/xx unknown
- 1972-09-04 DD DD16543272A patent/DD100245A5/xx unknown
- 1972-09-04 BR BR608572A patent/BR7206085D0/pt unknown
- 1972-09-08 DE DE19722244264 patent/DE2244264C3/de not_active Expired
- 1972-09-08 CH CH1325572A patent/CH544068A/fr not_active IP Right Cessation
- 1972-09-08 AT AT772772A patent/AT319199B/de not_active IP Right Cessation
- 1972-09-08 GB GB4192272A patent/GB1394207A/en not_active Expired
- 1972-09-08 LU LU66034D patent/LU66034A1/xx unknown
- 1972-09-08 JP JP8966272A patent/JPS5024294B2/ja not_active Expired
- 1972-09-09 IT IT2901072A patent/IT967311B/it active
- 1972-09-09 ES ES406547A patent/ES406547A1/es not_active Expired
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EA010670B1 (ru) * | 2004-11-22 | 2008-10-30 | ДСМ АйПи АССЕТС Б.В. | Катализатор для получения фумаронитрила и/или малеонитрила |
Also Published As
| Publication number | Publication date |
|---|---|
| NL148309B (nl) | 1976-01-15 |
| IT967311B (it) | 1974-02-28 |
| GB1394207A (en) | 1975-05-14 |
| FR2151704A5 (enExample) | 1973-04-20 |
| ES406547A1 (es) | 1975-09-01 |
| DE2244264C3 (de) | 1975-05-15 |
| BE788611A (fr) | 1973-03-08 |
| AT319199B (de) | 1974-12-10 |
| JPS4834823A (enExample) | 1973-05-22 |
| DD100245A5 (enExample) | 1973-09-12 |
| LU66034A1 (enExample) | 1973-03-12 |
| DE2244264B2 (enExample) | 1974-09-12 |
| NL7211947A (enExample) | 1973-03-13 |
| BR7206085D0 (pt) | 1973-09-13 |
| CH544068A (fr) | 1973-11-15 |
| DE2244264A1 (de) | 1973-03-15 |
| JPS5024294B2 (enExample) | 1975-08-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US5223469A (en) | Fluidized-bed catalyst for preparing acrylonitrile | |
| US3198750A (en) | Mixed antimony oxide-uranium oxide oxidation catalyst | |
| US3954856A (en) | Method for vapor-phase catalytic oxidation of tert.-butyl alcohol | |
| EP0239070B1 (en) | Process for poduction of composite oxide catalysts | |
| US3087964A (en) | Vapor phase oxidation of acrolein to acrylic acid | |
| US3681421A (en) | Production of unsaturated aliphatic nitriles | |
| SU434648A3 (ru) | Способ получения смеси ненасыщенных алифатических нитрилов | |
| DE2529537C3 (de) | Verfahren zur Herstellung von Metharcrylsäure durch katalytische Gasphasenoxidation von Methacrolein | |
| US3200081A (en) | Mixed antimony oxide-manganese oxide oxidation catalyst | |
| US4620035A (en) | Production of acrylic acid by oxidation of acrolein | |
| EP0235760B1 (en) | Process for producing composite oxide catalyst | |
| SU425383A3 (ru) | СПОСОБ ПОЛУЧЕНИЯ ДИОЛЕФИНОВЫХ УГЛЕВОДОРОДОВ Ci—Сю | |
| JPS5820944B2 (ja) | プロピレンの飾媒酸化によるアクロレインの製法 | |
| US4000176A (en) | Process for simultaneously producing methacrylo-nitrile and butadiene by vapor-phase catalytic oxidation of mixed butenes | |
| US5334743A (en) | Catalytic ammoxidation of saturated hydrocarbons | |
| WO2005056185A1 (ja) | 複合酸化物触媒の製造方法 | |
| SU429579A3 (ru) | Способ получения метакролеина | |
| SU475765A3 (ru) | Способ получени непредельных алифатических динитрилов | |
| DE1964786C3 (de) | Verfahren zur Herstellung von Acrylnitril aus Propan | |
| USRE32484E (en) | Oxidation catalysts | |
| US3461150A (en) | Process for the oxidation of olefin-ammonia mixtures to unsaturated nitriles | |
| US3801621A (en) | Process for preparing unsaturated nitriles by catalytic ammoxidation of saturated aldehydes in the gas phase | |
| US3670017A (en) | Production of unsaturated aliphatic acids | |
| US3630964A (en) | Catalyst for oxidation of aliphatic dienes to furaldehydes | |
| SU547444A1 (ru) | Способ получени акрилонитрила |