DE2243629A1 - Verfahren zur herstellung von alphaoximino-nitrilen - Google Patents
Verfahren zur herstellung von alphaoximino-nitrilenInfo
- Publication number
- DE2243629A1 DE2243629A1 DE2243629A DE2243629A DE2243629A1 DE 2243629 A1 DE2243629 A1 DE 2243629A1 DE 2243629 A DE2243629 A DE 2243629A DE 2243629 A DE2243629 A DE 2243629A DE 2243629 A1 DE2243629 A1 DE 2243629A1
- Authority
- DE
- Germany
- Prior art keywords
- formula
- carbon atoms
- alkyl
- stands
- nitrile
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 238000004519 manufacturing process Methods 0.000 title claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 8
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical class ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 150000003839 salts Chemical class 0.000 claims description 5
- 239000002253 acid Substances 0.000 claims description 4
- 239000003085 diluting agent Substances 0.000 claims description 4
- 239000002904 solvent Substances 0.000 claims description 4
- 125000003342 alkenyl group Chemical group 0.000 claims description 3
- 125000000304 alkynyl group Chemical group 0.000 claims description 3
- 125000004966 cyanoalkyl group Chemical group 0.000 claims description 3
- 125000001188 haloalkyl group Chemical group 0.000 claims description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims description 3
- 125000004971 nitroalkyl group Chemical group 0.000 claims description 3
- -1 Alkyl radicals Chemical class 0.000 description 12
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 8
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 description 8
- 239000007858 starting material Substances 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 4
- 150000002825 nitriles Chemical class 0.000 description 4
- HBCWUUYZERTKBV-UHFFFAOYSA-N 2,2-dimethyl-N-phenylpropanimidoyl cyanide Chemical compound C1(=CC=CC=C1)N=C(C#N)C(C)(C)C HBCWUUYZERTKBV-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000001931 aliphatic group Chemical group 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 150000001875 compounds Chemical class 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N methyl cyanide Natural products CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- AZQWKYJCGOJGHM-UHFFFAOYSA-N 1,4-benzoquinone Chemical compound O=C1C=CC(=O)C=C1 AZQWKYJCGOJGHM-UHFFFAOYSA-N 0.000 description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- LELOWRISYMNNSU-UHFFFAOYSA-N hydrogen cyanide Chemical compound N#C LELOWRISYMNNSU-UHFFFAOYSA-N 0.000 description 2
- 238000002844 melting Methods 0.000 description 2
- 230000008018 melting Effects 0.000 description 2
- 125000002560 nitrile group Chemical group 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- UBBJDRRWKLKSHM-UHFFFAOYSA-N 2,2-dichloro-N-phenylethanimidoyl cyanide Chemical compound C1(=CC=CC=C1)N=C(C#N)C(Cl)Cl UBBJDRRWKLKSHM-UHFFFAOYSA-N 0.000 description 1
- OSEGNECCBMDWRB-UHFFFAOYSA-N 2,2-dimethylbutanenitrile Chemical compound CCC(C)(C)C#N OSEGNECCBMDWRB-UHFFFAOYSA-N 0.000 description 1
- VIOOFTXFRJURJC-UHFFFAOYSA-N 2-hydroxyimino-3,3-dimethylbutanenitrile Chemical compound CC(C)(C)C(=NO)C#N VIOOFTXFRJURJC-UHFFFAOYSA-N 0.000 description 1
- 125000004398 2-methyl-2-butyl group Chemical group CC(C)(CC)* 0.000 description 1
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- DKUJBSPQXDTCRT-UHFFFAOYSA-N N-butyl-2,2-dimethylpropanimidoyl cyanide Chemical compound C(CCC)N=C(C#N)C(C)(C)C DKUJBSPQXDTCRT-UHFFFAOYSA-N 0.000 description 1
- GRYLNZFGIOXLOG-UHFFFAOYSA-N Nitric acid Chemical compound O[N+]([O-])=O GRYLNZFGIOXLOG-UHFFFAOYSA-N 0.000 description 1
- 241000228452 Venturia inaequalis Species 0.000 description 1
- 150000007960 acetonitrile Chemical class 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 150000001264 acyl cyanides Chemical class 0.000 description 1
- 125000005073 adamantyl group Chemical group C12(CC3CC(CC(C1)C3)C2)* 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 150000001450 anions Chemical class 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- BMINJJHPHPYQJR-UHFFFAOYSA-N butan-1-ol;methylsulfinylmethane Chemical compound CS(C)=O.CCCCO BMINJJHPHPYQJR-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- PVXRCPDNJSFYBV-UHFFFAOYSA-N carbamoyl fluoride Chemical class NC(F)=O PVXRCPDNJSFYBV-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 229910052801 chlorine Inorganic materials 0.000 description 1
- 239000000460 chlorine Substances 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- 125000005842 heteroatom Chemical group 0.000 description 1
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 125000002757 morpholinyl group Chemical group 0.000 description 1
- 229910017604 nitric acid Inorganic materials 0.000 description 1
- 238000005580 one pot reaction Methods 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 238000006146 oximation reaction Methods 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- SUSQOBVLVYHIEX-UHFFFAOYSA-N phenylacetonitrile Chemical compound N#CCC1=CC=CC=C1 SUSQOBVLVYHIEX-UHFFFAOYSA-N 0.000 description 1
- 125000003367 polycyclic group Chemical group 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/54—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (13)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2243629A DE2243629A1 (de) | 1972-09-06 | 1972-09-06 | Verfahren zur herstellung von alphaoximino-nitrilen |
| US00392831A US3849469A (en) | 1972-09-06 | 1973-08-29 | Preparation of alpha-oximinonitriles |
| IL43143A IL43143A (en) | 1972-09-06 | 1973-09-03 | Process for the preparation of a-oxamino-nitriles |
| CH1270173A CH589613A5 (enExample) | 1972-09-06 | 1973-09-04 | |
| IT28573/73A IT995282B (it) | 1972-09-06 | 1973-09-04 | Processo per la produzione di alfa ossimino nitrili |
| NL7312218A NL7312218A (enExample) | 1972-09-06 | 1973-09-04 | |
| LU68351A LU68351A1 (enExample) | 1972-09-06 | 1973-09-04 | |
| BE135330A BE804476A (fr) | 1972-09-06 | 1973-09-05 | Procede de production d'alpha-oximino-nitriles |
| DK488573A DK133777C (da) | 1972-09-06 | 1973-09-05 | Fremgangsmade til fremstilling af alfa-oximinonitriler |
| IE1577/73A IE38215B1 (en) | 1972-09-06 | 1973-09-05 | Process for the preparation of oximinonitriles |
| GB4167673A GB1398202A (en) | 1972-09-06 | 1973-09-05 | Process for the preparation of alpha-oximinonitriles |
| JP48099767A JPS4966630A (enExample) | 1972-09-06 | 1973-09-06 | |
| FR7332125A FR2197863B1 (enExample) | 1972-09-06 | 1973-09-06 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2243629A DE2243629A1 (de) | 1972-09-06 | 1972-09-06 | Verfahren zur herstellung von alphaoximino-nitrilen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2243629A1 true DE2243629A1 (de) | 1974-03-14 |
Family
ID=5855561
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2243629A Pending DE2243629A1 (de) | 1972-09-06 | 1972-09-06 | Verfahren zur herstellung von alphaoximino-nitrilen |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3849469A (enExample) |
| JP (1) | JPS4966630A (enExample) |
| BE (1) | BE804476A (enExample) |
| CH (1) | CH589613A5 (enExample) |
| DE (1) | DE2243629A1 (enExample) |
| DK (1) | DK133777C (enExample) |
| FR (1) | FR2197863B1 (enExample) |
| GB (1) | GB1398202A (enExample) |
| IE (1) | IE38215B1 (enExample) |
| IL (1) | IL43143A (enExample) |
| IT (1) | IT995282B (enExample) |
| LU (1) | LU68351A1 (enExample) |
| NL (1) | NL7312218A (enExample) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4277621A (en) * | 1978-10-18 | 1981-07-07 | Ciba-Geigy Corporation | Substituted 11-amino-undeca-4,8-dienal and 11-amino-undecanal derivatives and processes for their preparation |
| US4302402A (en) * | 1980-09-11 | 1981-11-24 | Zoecon Corporation | Process for the preparation of oximinonitriles |
-
1972
- 1972-09-06 DE DE2243629A patent/DE2243629A1/de active Pending
-
1973
- 1973-08-29 US US00392831A patent/US3849469A/en not_active Expired - Lifetime
- 1973-09-03 IL IL43143A patent/IL43143A/en unknown
- 1973-09-04 CH CH1270173A patent/CH589613A5/xx not_active IP Right Cessation
- 1973-09-04 NL NL7312218A patent/NL7312218A/xx unknown
- 1973-09-04 IT IT28573/73A patent/IT995282B/it active
- 1973-09-04 LU LU68351A patent/LU68351A1/xx unknown
- 1973-09-05 GB GB4167673A patent/GB1398202A/en not_active Expired
- 1973-09-05 DK DK488573A patent/DK133777C/da active
- 1973-09-05 BE BE135330A patent/BE804476A/xx unknown
- 1973-09-05 IE IE1577/73A patent/IE38215B1/xx unknown
- 1973-09-06 FR FR7332125A patent/FR2197863B1/fr not_active Expired
- 1973-09-06 JP JP48099767A patent/JPS4966630A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| LU68351A1 (enExample) | 1973-11-12 |
| US3849469A (en) | 1974-11-19 |
| IL43143A (en) | 1976-10-31 |
| JPS4966630A (enExample) | 1974-06-27 |
| FR2197863A1 (enExample) | 1974-03-29 |
| IE38215B1 (en) | 1978-01-18 |
| NL7312218A (enExample) | 1974-03-08 |
| DK133777C (da) | 1976-12-06 |
| IE38215L (en) | 1974-03-06 |
| DK133777B (da) | 1976-07-19 |
| IT995282B (it) | 1975-11-10 |
| IL43143A0 (en) | 1973-11-28 |
| GB1398202A (en) | 1975-06-18 |
| FR2197863B1 (enExample) | 1977-02-25 |
| CH589613A5 (enExample) | 1977-07-15 |
| BE804476A (fr) | 1974-03-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE848503C (de) | Verfahren zur Darstellung von basischen Estern | |
| DE2528211A1 (de) | Verfahren zur herstellung von acylcyaniden | |
| EP0132733B1 (de) | Neue Fluorpivalsäurefluoride und Verfahren zu ihrer Herstellung | |
| DE2243629A1 (de) | Verfahren zur herstellung von alphaoximino-nitrilen | |
| DE2227919A1 (de) | Verfahren zur herstellung von benzimidazol-2-yl-carbaminsaeure-alkylestern | |
| DE2407305A1 (de) | Triphenyl-1,2,3-triazolyl-(1')-methane, verfahren zu ihrer herstellung und ihre verwendung als fungizide | |
| EP0024588B1 (de) | Verfahren zur Herstellung von substituierten Cyclopropyl-carbonsäure-(alpha-cyano-3-phenoxy-benzyl)-estern | |
| DE2603508C2 (de) | Verfahren zur Herstellung von " Isothiocyanaten | |
| DE2640616C3 (de) | Verfahren zur Herstellung von N-Acyl-2-aiylglycinen | |
| DE2005515A1 (de) | P 08.02.69 Niederlande 6902028 Verfahren zur Herstellung von gamma-Cyanobutyraläiminen | |
| EP0257295B1 (de) | (Z)-2-Cyan-2-oximino-acetyl-chloride sowie ein Verfahren zu ihrer Herstellung | |
| DE2828011A1 (de) | Verfahren zur herstellung von mandelsaeureestern | |
| EP0250897B1 (de) | Verfahren zur Herstellung von Hydroxybenzaldoxim-O-ethern | |
| DE2553270A1 (de) | Ektoparasitizide mittel enthaltend diphenylcarbodiimide | |
| DE1670960A1 (de) | Verfahren zur Herstellung von salzartigen heterocyclischen Verbindungen | |
| AT240843B (de) | Verfahren zur Herstellung von basischen Phenylacetonitrilderivaten | |
| DE2221771A1 (de) | Verfahren zur herstellung von alphaimino-nitrilen | |
| DE2137649A1 (de) | Thiazolinon-(2)-carbonsaeureester | |
| DE69700265T2 (de) | Verfahren zur Herstellung von alpha-(tert-Alkyl)cyanoessig Saürestern | |
| AT218010B (de) | Verfahren zur Herstellung von basischen Aralkyl-nitrilen | |
| EP0068373A1 (de) | Schiff-Basen von Aminocycloalkancarbonsäureestern, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Zwischenprodukte | |
| DE2065977B2 (de) | Verfahren zur Herstellung von gegebenenfalls kondensierten 4,5-Bis-trifluormethylimino-oxazolidinen und -imidazolidinen | |
| DE1132912B (de) | Verfahren zur Herstellung eines Trichlorthioacetamid-Derivats | |
| DE1080100B (de) | Verfahren zur Herstellung von Alkylsulfonsaeureamiden | |
| EP0132734A2 (de) | Neopentylisocyanate und ihre Herstellung |