DE2238207A1 - Peroxido-bleichmittel - Google Patents
Peroxido-bleichmittelInfo
- Publication number
- DE2238207A1 DE2238207A1 DE2238207A DE2238207A DE2238207A1 DE 2238207 A1 DE2238207 A1 DE 2238207A1 DE 2238207 A DE2238207 A DE 2238207A DE 2238207 A DE2238207 A DE 2238207A DE 2238207 A1 DE2238207 A1 DE 2238207A1
- Authority
- DE
- Germany
- Prior art keywords
- methyl
- nitrate
- activator
- bleaching
- bleach
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007844 bleaching agent Substances 0.000 title claims description 70
- 239000000203 mixture Substances 0.000 claims description 122
- 239000012190 activator Substances 0.000 claims description 91
- 150000001875 compounds Chemical class 0.000 claims description 52
- -1 anionic radical Chemical class 0.000 claims description 43
- 150000002576 ketones Chemical class 0.000 claims description 42
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 37
- 150000001299 aldehydes Chemical class 0.000 claims description 35
- 229910002651 NO3 Inorganic materials 0.000 claims description 33
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 claims description 28
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 claims description 27
- 239000000872 buffer Substances 0.000 claims description 23
- 238000007254 oxidation reaction Methods 0.000 claims description 23
- 230000003647 oxidation Effects 0.000 claims description 22
- 239000007864 aqueous solution Substances 0.000 claims description 19
- 125000004432 carbon atom Chemical group C* 0.000 claims description 18
- 125000000864 peroxy group Chemical group O(O*)* 0.000 claims description 17
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 claims description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 claims description 15
- MKQRTTJKPCAWRP-UHFFFAOYSA-N nitrooxymethyl nitrate Chemical compound [O-][N+](=O)OCO[N+]([O-])=O MKQRTTJKPCAWRP-UHFFFAOYSA-N 0.000 claims description 14
- 150000003839 salts Chemical class 0.000 claims description 14
- 125000000217 alkyl group Chemical group 0.000 claims description 12
- 239000003795 chemical substances by application Substances 0.000 claims description 9
- QPOWUYJWCJRLEE-UHFFFAOYSA-N dipyridin-2-ylmethanone Chemical compound C=1C=CC=NC=1C(=O)C1=CC=CC=N1 QPOWUYJWCJRLEE-UHFFFAOYSA-N 0.000 claims description 9
- 150000004967 organic peroxy acids Chemical class 0.000 claims description 8
- QQXLDOJGLXJCSE-KNVOCYPGSA-N tropinone Chemical compound C1C(=O)C[C@H]2CC[C@@H]1N2C QQXLDOJGLXJCSE-KNVOCYPGSA-N 0.000 claims description 8
- 150000004965 peroxy acids Chemical class 0.000 claims description 7
- MCJGNVYPOGVAJF-UHFFFAOYSA-N quinolin-8-ol Chemical compound C1=CN=C2C(O)=CC=CC2=C1 MCJGNVYPOGVAJF-UHFFFAOYSA-N 0.000 claims description 7
- 229920002554 vinyl polymer Polymers 0.000 claims description 7
- 239000002888 zwitterionic surfactant Substances 0.000 claims description 7
- AZFMFGIMDGBJRR-UHFFFAOYSA-N 1-(1-oxidopyridin-1-ium-3-yl)ethanone Chemical compound CC(=O)C1=CC=C[N+]([O-])=C1 AZFMFGIMDGBJRR-UHFFFAOYSA-N 0.000 claims description 6
- SWGILLQQUULMJB-UHFFFAOYSA-N 1-quinoxalin-2-ylethanone Chemical compound C1=CC=CC2=NC(C(=O)C)=CN=C21 SWGILLQQUULMJB-UHFFFAOYSA-N 0.000 claims description 6
- AJKVQEKCUACUMD-UHFFFAOYSA-N 2-Acetylpyridine Chemical compound CC(=O)C1=CC=CC=N1 AJKVQEKCUACUMD-UHFFFAOYSA-N 0.000 claims description 6
- 239000005725 8-Hydroxyquinoline Substances 0.000 claims description 6
- 239000003945 anionic surfactant Substances 0.000 claims description 6
- 229960003540 oxyquinoline Drugs 0.000 claims description 6
- YQYGPGKTNQNXMH-UHFFFAOYSA-N 4-nitroacetophenone Chemical compound CC(=O)C1=CC=C([N+]([O-])=O)C=C1 YQYGPGKTNQNXMH-UHFFFAOYSA-N 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 5
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 5
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 5
- XFMQGQAAHOGFQS-UHFFFAOYSA-N 1,1-dioxothian-4-one Chemical compound O=C1CCS(=O)(=O)CC1 XFMQGQAAHOGFQS-UHFFFAOYSA-N 0.000 claims description 4
- XXKIXPWTFVBBJF-UHFFFAOYSA-N 1-(3-methylquinoxalin-2-yl)ethanone Chemical compound C1=CC=C2N=C(C)C(C(=O)C)=NC2=C1 XXKIXPWTFVBBJF-UHFFFAOYSA-N 0.000 claims description 4
- ARKIFHPFTHVKDT-UHFFFAOYSA-N 1-(3-nitrophenyl)ethanone Chemical compound CC(=O)C1=CC=CC([N+]([O-])=O)=C1 ARKIFHPFTHVKDT-UHFFFAOYSA-N 0.000 claims description 4
- QQXLDOJGLXJCSE-UHFFFAOYSA-N N-methylnortropinone Natural products C1C(=O)CC2CCC1N2C QQXLDOJGLXJCSE-UHFFFAOYSA-N 0.000 claims description 4
- 125000002947 alkylene group Chemical group 0.000 claims description 4
- XLSMFKSTNGKWQX-UHFFFAOYSA-N hydroxyacetone Chemical compound CC(=O)CO XLSMFKSTNGKWQX-UHFFFAOYSA-N 0.000 claims description 4
- FJKUOCCQEBLPNX-UHFFFAOYSA-N 8-hydroxyquinoline N-oxide Chemical compound C1=C[N+]([O-])=C2C(O)=CC=CC2=C1 FJKUOCCQEBLPNX-UHFFFAOYSA-N 0.000 claims description 3
- 125000000732 arylene group Chemical group 0.000 claims description 3
- 150000004820 halides Chemical class 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000005342 perphosphate group Chemical group 0.000 claims description 3
- KCXFHTAICRTXLI-UHFFFAOYSA-N propane-1-sulfonic acid Chemical compound CCCS(O)(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-N 0.000 claims description 3
- LVQFKRXRTXCQCZ-UHFFFAOYSA-N 1-(2-acetylphenyl)ethanone Chemical compound CC(=O)C1=CC=CC=C1C(C)=O LVQFKRXRTXCQCZ-UHFFFAOYSA-N 0.000 claims description 2
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 2
- RHOZMEYZKYWKNU-UHFFFAOYSA-N O[N+]([O-])=O.CCCC(C)=O Chemical compound O[N+]([O-])=O.CCCC(C)=O RHOZMEYZKYWKNU-UHFFFAOYSA-N 0.000 claims description 2
- LUBGFMZTGFXIIN-UHFFFAOYSA-N ethyl 4-oxopiperidine-1-carboxylate Chemical compound CCOC(=O)N1CCC(=O)CC1 LUBGFMZTGFXIIN-UHFFFAOYSA-N 0.000 claims description 2
- ZHGLYCLLMKLQBE-UHFFFAOYSA-M sodium 4-oxocyclohexane-1-carboxylate Chemical compound O=C1CCC(CC1)C(=O)[O-].[Na+] ZHGLYCLLMKLQBE-UHFFFAOYSA-M 0.000 claims description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims 3
- BYKYYIJJGLIHLH-UHFFFAOYSA-N 3-chloro-2-oxobutanoic acid Chemical compound CC(Cl)C(=O)C(O)=O BYKYYIJJGLIHLH-UHFFFAOYSA-N 0.000 claims 2
- KMEUSKGEUADGET-UHFFFAOYSA-N 1-hydroxy-2,2,6,6-tetramethylpiperidin-4-one Chemical group CC1(C)CC(=O)CC(C)(C)N1O KMEUSKGEUADGET-UHFFFAOYSA-N 0.000 claims 1
- RBSFFHQWOUNEJJ-UHFFFAOYSA-N 1-hydroxypiperidin-4-one Chemical compound ON1CCC(=O)CC1 RBSFFHQWOUNEJJ-UHFFFAOYSA-N 0.000 claims 1
- 235000008331 Pinus X rigitaeda Nutrition 0.000 claims 1
- 235000011613 Pinus brutia Nutrition 0.000 claims 1
- 241000018646 Pinus brutia Species 0.000 claims 1
- 101000650578 Salmonella phage P22 Regulatory protein C3 Proteins 0.000 claims 1
- 101001040920 Triticum aestivum Alpha-amylase inhibitor 0.28 Proteins 0.000 claims 1
- OVRJVKCZJCNSOW-UHFFFAOYSA-N thian-4-one Chemical compound O=C1CCSCC1 OVRJVKCZJCNSOW-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 90
- 238000004061 bleaching Methods 0.000 description 54
- 239000000975 dye Substances 0.000 description 42
- 239000004744 fabric Substances 0.000 description 39
- 238000000034 method Methods 0.000 description 32
- 239000004753 textile Substances 0.000 description 30
- 150000002978 peroxides Chemical class 0.000 description 25
- 238000012360 testing method Methods 0.000 description 25
- 238000012546 transfer Methods 0.000 description 25
- 238000005406 washing Methods 0.000 description 25
- 230000007704 transition Effects 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000003599 detergent Substances 0.000 description 18
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical compound Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 description 18
- 239000002253 acid Substances 0.000 description 16
- 230000008569 process Effects 0.000 description 16
- 238000001994 activation Methods 0.000 description 15
- FAPWRFPIFSIZLT-UHFFFAOYSA-M sodium chloride Inorganic materials [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 15
- 229920000742 Cotton Polymers 0.000 description 14
- 229910052757 nitrogen Inorganic materials 0.000 description 14
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 13
- 239000011734 sodium Substances 0.000 description 13
- 229910052708 sodium Inorganic materials 0.000 description 13
- 230000002265 prevention Effects 0.000 description 12
- 230000004913 activation Effects 0.000 description 10
- 239000004094 surface-active agent Substances 0.000 description 10
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- 150000001805 chlorine compounds Chemical class 0.000 description 9
- 239000007850 fluorescent dye Substances 0.000 description 9
- 238000009472 formulation Methods 0.000 description 9
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- SXLLDUPXUVRMEE-UHFFFAOYSA-N nonanediperoxoic acid Chemical compound OOC(=O)CCCCCCCC(=O)OO SXLLDUPXUVRMEE-UHFFFAOYSA-N 0.000 description 8
- 239000011780 sodium chloride Substances 0.000 description 8
- 239000000126 substance Substances 0.000 description 8
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 7
- 230000009467 reduction Effects 0.000 description 7
- ZTQSAGDEMFDKMZ-UHFFFAOYSA-N Butyraldehyde Chemical compound CCCC=O ZTQSAGDEMFDKMZ-UHFFFAOYSA-N 0.000 description 6
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 6
- 239000004677 Nylon Substances 0.000 description 6
- 125000001931 aliphatic group Chemical group 0.000 description 6
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 6
- 239000012928 buffer substance Substances 0.000 description 6
- 238000004042 decolorization Methods 0.000 description 6
- 239000004615 ingredient Substances 0.000 description 6
- 239000007788 liquid Substances 0.000 description 6
- 229920001778 nylon Polymers 0.000 description 6
- 239000000047 product Substances 0.000 description 6
- 125000003118 aryl group Chemical group 0.000 description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 5
- KXEMXOYVVPLGSD-UHFFFAOYSA-N benzene-1,3-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=CC(C(=O)OO)=C1 KXEMXOYVVPLGSD-UHFFFAOYSA-N 0.000 description 5
- 239000007859 condensation product Substances 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000000463 material Substances 0.000 description 5
- CWKLZLBVOJRSOM-UHFFFAOYSA-N methyl pyruvate Chemical compound COC(=O)C(C)=O CWKLZLBVOJRSOM-UHFFFAOYSA-N 0.000 description 5
- 239000001301 oxygen Substances 0.000 description 5
- 229910052760 oxygen Inorganic materials 0.000 description 5
- 239000003973 paint Substances 0.000 description 5
- 239000002304 perfume Substances 0.000 description 5
- 229910052717 sulfur Inorganic materials 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 4
- 239000012425 OXONE® Substances 0.000 description 4
- 229910019142 PO4 Inorganic materials 0.000 description 4
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 4
- 238000002835 absorbance Methods 0.000 description 4
- 125000000129 anionic group Chemical group 0.000 description 4
- 150000008365 aromatic ketones Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- 239000000460 chlorine Substances 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- 239000000982 direct dye Substances 0.000 description 4
- 150000002191 fatty alcohols Chemical class 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- HJKYXKSLRZKNSI-UHFFFAOYSA-I pentapotassium;hydrogen sulfate;oxido sulfate;sulfuric acid Chemical compound [K+].[K+].[K+].[K+].[K+].OS([O-])(=O)=O.[O-]S([O-])(=O)=O.OS(=O)(=O)O[O-].OS(=O)(=O)O[O-] HJKYXKSLRZKNSI-UHFFFAOYSA-I 0.000 description 4
- 235000021317 phosphate Nutrition 0.000 description 4
- 229920000728 polyester Polymers 0.000 description 4
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 4
- 235000019832 sodium triphosphate Nutrition 0.000 description 4
- 238000012549 training Methods 0.000 description 4
- SKBBQSLSGRSQAJ-UHFFFAOYSA-N 1-(4-acetylphenyl)ethanone Chemical compound CC(=O)C1=CC=C(C(C)=O)C=C1 SKBBQSLSGRSQAJ-UHFFFAOYSA-N 0.000 description 3
- KFDVPJUYSDEJTH-UHFFFAOYSA-N 4-ethenylpyridine Chemical compound C=CC1=CC=NC=C1 KFDVPJUYSDEJTH-UHFFFAOYSA-N 0.000 description 3
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 3
- 244000025254 Cannabis sativa Species 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 3
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical class [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 244000269722 Thea sinensis Species 0.000 description 3
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 3
- 238000010521 absorption reaction Methods 0.000 description 3
- IKHGUXGNUITLKF-XPULMUKRSA-N acetaldehyde Chemical compound [14CH]([14CH3])=O IKHGUXGNUITLKF-XPULMUKRSA-N 0.000 description 3
- 239000001045 blue dye Substances 0.000 description 3
- 150000001649 bromium compounds Chemical class 0.000 description 3
- 239000006172 buffering agent Substances 0.000 description 3
- RNFNDJAIBTYOQL-UHFFFAOYSA-N chloral hydrate Chemical compound OC(O)C(Cl)(Cl)Cl RNFNDJAIBTYOQL-UHFFFAOYSA-N 0.000 description 3
- 229960002327 chloral hydrate Drugs 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 239000012459 cleaning agent Substances 0.000 description 3
- 150000003997 cyclic ketones Chemical class 0.000 description 3
- CGZZMOTZOONQIA-UHFFFAOYSA-N cycloheptanone Chemical compound O=C1CCCCCC1 CGZZMOTZOONQIA-UHFFFAOYSA-N 0.000 description 3
- DCZFGQYXRKMVFG-UHFFFAOYSA-N cyclohexane-1,4-dione Chemical compound O=C1CCC(=O)CC1 DCZFGQYXRKMVFG-UHFFFAOYSA-N 0.000 description 3
- 235000019674 grape juice Nutrition 0.000 description 3
- 235000013882 gravy Nutrition 0.000 description 3
- 125000000623 heterocyclic group Chemical group 0.000 description 3
- 239000000178 monomer Substances 0.000 description 3
- 239000002736 nonionic surfactant Substances 0.000 description 3
- QNGNSVIICDLXHT-UHFFFAOYSA-N para-ethylbenzaldehyde Natural products CCC1=CC=C(C=O)C=C1 QNGNSVIICDLXHT-UHFFFAOYSA-N 0.000 description 3
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 3
- 239000011591 potassium Substances 0.000 description 3
- 229910052700 potassium Inorganic materials 0.000 description 3
- KCXFHTAICRTXLI-UHFFFAOYSA-M propane-1-sulfonate Chemical compound CCCS([O-])(=O)=O KCXFHTAICRTXLI-UHFFFAOYSA-M 0.000 description 3
- JRZIYJSQQILHNO-UHFFFAOYSA-M sodium;1-hydroxycyclohexane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)C1(O)CCCCC1 JRZIYJSQQILHNO-UHFFFAOYSA-M 0.000 description 3
- 238000003756 stirring Methods 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- PEKPGBKEIWFPAS-UHFFFAOYSA-J tetrapotassium;[oxido(oxidooxy)phosphoryl] phosphate Chemical compound [K+].[K+].[K+].[K+].[O-]OP([O-])(=O)OP([O-])([O-])=O PEKPGBKEIWFPAS-UHFFFAOYSA-J 0.000 description 3
- GUHDDRZAZNIQJB-UHFFFAOYSA-N 1-(1-oxidopyridin-1-ium-4-yl)ethanone Chemical compound CC(=O)C1=CC=[N+]([O-])C=C1 GUHDDRZAZNIQJB-UHFFFAOYSA-N 0.000 description 2
- PGYZAKRTYUHXRA-UHFFFAOYSA-N 2,10-dinitro-12h-[1,4]benzothiazino[3,2-b]phenothiazin-3-one Chemical compound S1C2=CC(=O)C([N+]([O-])=O)=CC2=NC2=C1C=C1SC3=CC=C([N+](=O)[O-])C=C3NC1=C2 PGYZAKRTYUHXRA-UHFFFAOYSA-N 0.000 description 2
- OJVAMHKKJGICOG-UHFFFAOYSA-N 2,5-hexanedione Chemical compound CC(=O)CCC(C)=O OJVAMHKKJGICOG-UHFFFAOYSA-N 0.000 description 2
- RYTWPAUCABOYJP-UHFFFAOYSA-N 2-(3-oxocyclohexyl)acetic acid Chemical compound OC(=O)CC1CCCC(=O)C1 RYTWPAUCABOYJP-UHFFFAOYSA-N 0.000 description 2
- WEGYGNROSJDEIW-UHFFFAOYSA-N 3-Acetylpyridine Chemical compound CC(=O)C1=CC=CN=C1 WEGYGNROSJDEIW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- ROWKJAVDOGWPAT-UHFFFAOYSA-N Acetoin Chemical compound CC(O)C(C)=O ROWKJAVDOGWPAT-UHFFFAOYSA-N 0.000 description 2
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- 244000060011 Cocos nucifera Species 0.000 description 2
- 235000013162 Cocos nucifera Nutrition 0.000 description 2
- TWRXJAOTZQYOKJ-UHFFFAOYSA-L Magnesium chloride Chemical compound [Mg+2].[Cl-].[Cl-] TWRXJAOTZQYOKJ-UHFFFAOYSA-L 0.000 description 2
- WHNWPMSKXPGLAX-UHFFFAOYSA-N N-Vinyl-2-pyrrolidone Chemical compound C=CN1CCCC1=O WHNWPMSKXPGLAX-UHFFFAOYSA-N 0.000 description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 2
- 229920000388 Polyphosphate Polymers 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 2
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 2
- 229920002253 Tannate Polymers 0.000 description 2
- 125000002015 acyclic group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- RRDBXTBGGXLZHD-UHFFFAOYSA-N benzene-1,4-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(C(=O)OO)C=C1 RRDBXTBGGXLZHD-UHFFFAOYSA-N 0.000 description 2
- 229960003237 betaine Drugs 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- BNIILDVGGAEEIG-UHFFFAOYSA-L disodium hydrogen phosphate Chemical compound [Na+].[Na+].OP([O-])([O-])=O BNIILDVGGAEEIG-UHFFFAOYSA-L 0.000 description 2
- 239000000986 disperse dye Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 229940083124 ganglion-blocking antiadrenergic secondary and tertiary amines Drugs 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- CATSNJVOTSVZJV-UHFFFAOYSA-N heptan-2-one Chemical compound CCCCCC(C)=O CATSNJVOTSVZJV-UHFFFAOYSA-N 0.000 description 2
- 230000002209 hydrophobic effect Effects 0.000 description 2
- 150000002500 ions Chemical class 0.000 description 2
- 230000031700 light absorption Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 150000004702 methyl esters Chemical class 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 239000001205 polyphosphate Substances 0.000 description 2
- 235000011176 polyphosphates Nutrition 0.000 description 2
- 239000000985 reactive dye Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 229910000029 sodium carbonate Inorganic materials 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000011550 stock solution Substances 0.000 description 2
- 239000000271 synthetic detergent Substances 0.000 description 2
- ILJSQTXMGCGYMG-UHFFFAOYSA-N triacetic acid Chemical compound CC(=O)CC(=O)CC(O)=O ILJSQTXMGCGYMG-UHFFFAOYSA-N 0.000 description 2
- HGBOYTHUEUWSSQ-UHFFFAOYSA-N valeric aldehyde Natural products CCCCC=O HGBOYTHUEUWSSQ-UHFFFAOYSA-N 0.000 description 2
- 239000000984 vat dye Substances 0.000 description 2
- LABTWGUMFABVFG-ONEGZZNKSA-N (3E)-pent-3-en-2-one Chemical compound C\C=C\C(C)=O LABTWGUMFABVFG-ONEGZZNKSA-N 0.000 description 1
- IEPILIZNCKDPAY-UHFFFAOYSA-N 1-(1-methylpyridin-1-ium-4-yl)ethanone;nitrate Chemical compound [O-][N+]([O-])=O.CC(=O)C1=CC=[N+](C)C=C1 IEPILIZNCKDPAY-UHFFFAOYSA-N 0.000 description 1
- VHZYBRINFLDXLR-UHFFFAOYSA-N 1-(1-oxidopyridin-1-ium-2-yl)ethanone Chemical compound CC(=O)C1=CC=CC=[N+]1[O-] VHZYBRINFLDXLR-UHFFFAOYSA-N 0.000 description 1
- BUZYGTVTZYSBCU-UHFFFAOYSA-N 1-(4-chlorophenyl)ethanone Chemical compound CC(=O)C1=CC=C(Cl)C=C1 BUZYGTVTZYSBCU-UHFFFAOYSA-N 0.000 description 1
- VXLKYQQBEPCMJE-UHFFFAOYSA-N 1-(4-methoxy-3-nitrophenyl)ethanone Chemical compound COC1=CC=C(C(C)=O)C=C1[N+]([O-])=O VXLKYQQBEPCMJE-UHFFFAOYSA-N 0.000 description 1
- OVLQUHIORJZHTK-UHFFFAOYSA-M 1-[4-(4-methylmorpholin-4-ium-4-yl)phenyl]ethanone methyl sulfate Chemical compound S(=O)(=O)(OC)[O-].C[N+]1(CCOCC1)C1=CC=C(C=C1)C(C)=O OVLQUHIORJZHTK-UHFFFAOYSA-M 0.000 description 1
- PJQNRRLQLXLNSN-UHFFFAOYSA-N 1-[4-(4-methylmorpholin-4-ium-4-yl)phenyl]ethanone;nitrate Chemical compound [O-][N+]([O-])=O.C1=CC(C(=O)C)=CC=C1[N+]1(C)CCOCC1 PJQNRRLQLXLNSN-UHFFFAOYSA-N 0.000 description 1
- SJZKULRDWHPHGG-UHFFFAOYSA-N 1-benzylpiperidin-4-one Chemical compound C1CC(=O)CCN1CC1=CC=CC=C1 SJZKULRDWHPHGG-UHFFFAOYSA-N 0.000 description 1
- SIDULKZCBGMXJL-UHFFFAOYSA-N 1-dimethylphosphoryldodecane Chemical compound CCCCCCCCCCCCP(C)(C)=O SIDULKZCBGMXJL-UHFFFAOYSA-N 0.000 description 1
- QKGPEEBIQDMBGA-UHFFFAOYSA-N 1-methyl-1-oxidopiperidin-1-ium-4-one Chemical compound C[N+]1([O-])CCC(=O)CC1 QKGPEEBIQDMBGA-UHFFFAOYSA-N 0.000 description 1
- CJPDBKNETSCHCH-UHFFFAOYSA-N 1-methylsulfinyldodecane Chemical compound CCCCCCCCCCCCS(C)=O CJPDBKNETSCHCH-UHFFFAOYSA-N 0.000 description 1
- PYFVRMNFLPOIHE-UHFFFAOYSA-N 1-phenylethanone;sodium Chemical compound [Na].CC(=O)C1=CC=CC=C1 PYFVRMNFLPOIHE-UHFFFAOYSA-N 0.000 description 1
- WMQUKDQWMMOHSA-UHFFFAOYSA-N 1-pyridin-4-ylethanone Chemical compound CC(=O)C1=CC=NC=C1 WMQUKDQWMMOHSA-UHFFFAOYSA-N 0.000 description 1
- BEZVGIHGZPLGBL-UHFFFAOYSA-N 2,6-diacetylpyridine Chemical compound CC(=O)C1=CC=CC(C(C)=O)=N1 BEZVGIHGZPLGBL-UHFFFAOYSA-N 0.000 description 1
- ZUYKJZQOPXDNOK-UHFFFAOYSA-N 2-(ethylamino)-2-thiophen-2-ylcyclohexan-1-one;hydrochloride Chemical class Cl.C=1C=CSC=1C1(NCC)CCCCC1=O ZUYKJZQOPXDNOK-UHFFFAOYSA-N 0.000 description 1
- GLVYLTSKTCWWJR-UHFFFAOYSA-N 2-carbonoperoxoylbenzoic acid Chemical compound OOC(=O)C1=CC=CC=C1C(O)=O GLVYLTSKTCWWJR-UHFFFAOYSA-N 0.000 description 1
- UZDXATQPJOOHQJ-UHFFFAOYSA-N 2-ethylbenzonitrile Chemical compound CCC1=CC=CC=C1C#N UZDXATQPJOOHQJ-UHFFFAOYSA-N 0.000 description 1
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- JWNUJJTXNQNZSI-UHFFFAOYSA-N 3-[hexadecyl(dimethyl)azaniumyl]butanoate Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)C(C)CC([O-])=O JWNUJJTXNQNZSI-UHFFFAOYSA-N 0.000 description 1
- NHQDETIJWKXCTC-UHFFFAOYSA-N 3-chloroperbenzoic acid Chemical compound OOC(=O)C1=CC=CC(Cl)=C1 NHQDETIJWKXCTC-UHFFFAOYSA-N 0.000 description 1
- ZUGHSJIRMAZPBK-UHFFFAOYSA-N 4-chlorobenzene-1,2-dicarboperoxoic acid Chemical compound OOC(=O)C1=CC=C(Cl)C=C1C(=O)OO ZUGHSJIRMAZPBK-UHFFFAOYSA-N 0.000 description 1
- OKSDJGWHKXFVME-UHFFFAOYSA-N 4-ethylcyclohexan-1-one Chemical compound CCC1CCC(=O)CC1 OKSDJGWHKXFVME-UHFFFAOYSA-N 0.000 description 1
- ZJAFQAPHWPSKRZ-UHFFFAOYSA-N 4-nitrobenzenecarboperoxoic acid Chemical compound OOC(=O)C1=CC=C([N+]([O-])=O)C=C1 ZJAFQAPHWPSKRZ-UHFFFAOYSA-N 0.000 description 1
- JSHPTIGHEWEXRW-UHFFFAOYSA-N 5-hydroxypentan-2-one Chemical compound CC(=O)CCCO JSHPTIGHEWEXRW-UHFFFAOYSA-N 0.000 description 1
- 238000006220 Baeyer-Villiger oxidation reaction Methods 0.000 description 1
- 239000004342 Benzoyl peroxide Substances 0.000 description 1
- OMPJBNCRMGITSC-UHFFFAOYSA-N Benzoylperoxide Chemical compound C=1C=CC=CC=1C(=O)OOC(=O)C1=CC=CC=C1 OMPJBNCRMGITSC-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- SGHZXLIDFTYFHQ-UHFFFAOYSA-L Brilliant Blue Chemical compound [Na+].[Na+].C=1C=C(C(=C2C=CC(C=C2)=[N+](CC)CC=2C=C(C=CC=2)S([O-])(=O)=O)C=2C(=CC=CC=2)S([O-])(=O)=O)C=CC=1N(CC)CC1=CC=CC(S([O-])(=O)=O)=C1 SGHZXLIDFTYFHQ-UHFFFAOYSA-L 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- 229910014033 C-OH Inorganic materials 0.000 description 1
- 101100352919 Caenorhabditis elegans ppm-2 gene Proteins 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241001630921 Chlorida Species 0.000 description 1
- 229910014570 C—OH Inorganic materials 0.000 description 1
- 229920004934 Dacron® Polymers 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- GMEONFUTDYJSNV-UHFFFAOYSA-N Ethyl levulinate Chemical compound CCOC(=O)CCC(C)=O GMEONFUTDYJSNV-UHFFFAOYSA-N 0.000 description 1
- PIICEJLVQHRZGT-UHFFFAOYSA-N Ethylenediamine Chemical compound NCCN PIICEJLVQHRZGT-UHFFFAOYSA-N 0.000 description 1
- CWYNVVGOOAEACU-UHFFFAOYSA-N Fe2+ Chemical compound [Fe+2] CWYNVVGOOAEACU-UHFFFAOYSA-N 0.000 description 1
- DOJXGHGHTWFZHK-UHFFFAOYSA-N Hexachloroacetone Chemical compound ClC(Cl)(Cl)C(=O)C(Cl)(Cl)Cl DOJXGHGHTWFZHK-UHFFFAOYSA-N 0.000 description 1
- IMQLKJBTEOYOSI-GPIVLXJGSA-N Inositol-hexakisphosphate Chemical class OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O IMQLKJBTEOYOSI-GPIVLXJGSA-N 0.000 description 1
- OWYWGLHRNBIFJP-UHFFFAOYSA-N Ipazine Chemical compound CCN(CC)C1=NC(Cl)=NC(NC(C)C)=N1 OWYWGLHRNBIFJP-UHFFFAOYSA-N 0.000 description 1
- 150000001204 N-oxides Chemical class 0.000 description 1
- IGFHQQFPSIBGKE-UHFFFAOYSA-N Nonylphenol Natural products CCCCCCCCCC1=CC=C(O)C=C1 IGFHQQFPSIBGKE-UHFFFAOYSA-N 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Chemical compound CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 238000005602 Reppe reaction Methods 0.000 description 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 description 1
- DWAQJAXMDSEUJJ-UHFFFAOYSA-M Sodium bisulfite Chemical compound [Na+].OS([O-])=O DWAQJAXMDSEUJJ-UHFFFAOYSA-M 0.000 description 1
- 239000005708 Sodium hypochlorite Substances 0.000 description 1
- NYPJQJCKSVNISI-UHFFFAOYSA-O [O-][N+]([O-])=O.O=C1CC[NH2+]CC1 Chemical compound [O-][N+]([O-])=O.O=C1CC[NH2+]CC1 NYPJQJCKSVNISI-UHFFFAOYSA-O 0.000 description 1
- 150000008062 acetophenones Chemical class 0.000 description 1
- FFOZKDPTWPZDIA-UHFFFAOYSA-N acetyloxy-hexadecyl-dimethylazanium Chemical compound CCCCCCCCCCCCCCCC[N+](C)(C)OC(C)=O FFOZKDPTWPZDIA-UHFFFAOYSA-N 0.000 description 1
- 239000000980 acid dye Substances 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000003213 activating effect Effects 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910000288 alkali metal carbonate Inorganic materials 0.000 description 1
- 150000008041 alkali metal carbonates Chemical class 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 150000001449 anionic compounds Chemical class 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- 125000000656 azaniumyl group Chemical group [H][N+]([H])([H])[*] 0.000 description 1
- 229940077388 benzenesulfonate Drugs 0.000 description 1
- SRSXLGNVWSONIS-UHFFFAOYSA-M benzenesulfonate Chemical compound [O-]S(=O)(=O)C1=CC=CC=C1 SRSXLGNVWSONIS-UHFFFAOYSA-M 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 235000019400 benzoyl peroxide Nutrition 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- 235000019471 brown gravy Nutrition 0.000 description 1
- 230000003139 buffering effect Effects 0.000 description 1
- 239000001110 calcium chloride Substances 0.000 description 1
- 229910001628 calcium chloride Inorganic materials 0.000 description 1
- ZFXVRMSLJDYJCH-UHFFFAOYSA-N calcium magnesium Chemical compound [Mg].[Ca] ZFXVRMSLJDYJCH-UHFFFAOYSA-N 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- 125000002837 carbocyclic group Chemical group 0.000 description 1
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 description 1
- 150000001734 carboxylic acid salts Chemical class 0.000 description 1
- 150000001768 cations Chemical class 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 210000001072 colon Anatomy 0.000 description 1
- 239000013065 commercial product Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007334 copolymerization reaction Methods 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- YKFKEYKJGVSEIX-UHFFFAOYSA-N cyclohexanone, 4-(1,1-dimethylethyl)- Chemical compound CC(C)(C)C1CCC(=O)CC1 YKFKEYKJGVSEIX-UHFFFAOYSA-N 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- SWXVUIWOUIDPGS-UHFFFAOYSA-N diacetone alcohol Natural products CC(=O)CC(C)(C)O SWXVUIWOUIDPGS-UHFFFAOYSA-N 0.000 description 1
- DBKKFIIYQGGHJO-UHFFFAOYSA-N diethyl 2-oxopropanedioate Chemical compound CCOC(=O)C(=O)C(=O)OCC DBKKFIIYQGGHJO-UHFFFAOYSA-N 0.000 description 1
- GVGUFUZHNYFZLC-UHFFFAOYSA-N dodecyl benzenesulfonate;sodium Chemical compound [Na].CCCCCCCCCCCCOS(=O)(=O)C1=CC=CC=C1 GVGUFUZHNYFZLC-UHFFFAOYSA-N 0.000 description 1
- SYELZBGXAIXKHU-UHFFFAOYSA-N dodecyldimethylamine N-oxide Chemical compound CCCCCCCCCCCC[N+](C)(C)[O-] SYELZBGXAIXKHU-UHFFFAOYSA-N 0.000 description 1
- 239000012154 double-distilled water Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 125000005677 ethinylene group Chemical group [*:2]C#C[*:1] 0.000 description 1
- 238000013213 extrapolation Methods 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000011389 fruit/vegetable juice Nutrition 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 239000003673 groundwater Substances 0.000 description 1
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 229940095970 imodium Drugs 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 230000002452 interceptive effect Effects 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- BAUYGSIQEAFULO-UHFFFAOYSA-L iron(2+) sulfate (anhydrous) Chemical compound [Fe+2].[O-]S([O-])(=O)=O BAUYGSIQEAFULO-UHFFFAOYSA-L 0.000 description 1
- 229910000359 iron(II) sulfate Inorganic materials 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- RDOIQAHITMMDAJ-UHFFFAOYSA-N loperamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(C(=O)N(C)C)CCN(CC1)CCC1(O)C1=CC=C(Cl)C=C1 RDOIQAHITMMDAJ-UHFFFAOYSA-N 0.000 description 1
- 229910001629 magnesium chloride Inorganic materials 0.000 description 1
- FPYJFEHAWHCUMM-UHFFFAOYSA-N maleic anhydride Chemical compound O=C1OC(=O)C=C1 FPYJFEHAWHCUMM-UHFFFAOYSA-N 0.000 description 1
- BLYKGTCYDJZLFB-UHFFFAOYSA-N methyl 4-oxocyclohexane-1-carboxylate Chemical compound COC(=O)C1CCC(=O)CC1 BLYKGTCYDJZLFB-UHFFFAOYSA-N 0.000 description 1
- YLHXLHGIAMFFBU-UHFFFAOYSA-N methyl phenylglyoxalate Chemical compound COC(=O)C(=O)C1=CC=CC=C1 YLHXLHGIAMFFBU-UHFFFAOYSA-N 0.000 description 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 description 1
- 229910000403 monosodium phosphate Inorganic materials 0.000 description 1
- 235000019799 monosodium phosphate Nutrition 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- MGFYIUFZLHCRTH-UHFFFAOYSA-N nitrilotriacetic acid Chemical compound OC(=O)CN(CC(O)=O)CC(O)=O MGFYIUFZLHCRTH-UHFFFAOYSA-N 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical compound CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical class [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- PNJWIWWMYCMZRO-UHFFFAOYSA-N pent‐4‐en‐2‐one Natural products CC(=O)CC=C PNJWIWWMYCMZRO-UHFFFAOYSA-N 0.000 description 1
- BOIYPCUFUWWDPK-UHFFFAOYSA-N phenacyl(triphenyl)phosphanium nitrate Chemical compound [O-][N+]([O-])=O.C=1C=CC=CC=1C(=O)C[P+](C=1C=CC=CC=1)(C=1C=CC=CC=1)C1=CC=CC=C1 BOIYPCUFUWWDPK-UHFFFAOYSA-N 0.000 description 1
- QCCDLTOVEPVEJK-UHFFFAOYSA-N phenylacetone Chemical compound CC(=O)CC1=CC=CC=C1 QCCDLTOVEPVEJK-UHFFFAOYSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 125000001476 phosphono group Chemical group [H]OP(*)(=O)O[H] 0.000 description 1
- 235000002949 phytic acid Nutrition 0.000 description 1
- 239000005020 polyethylene terephthalate Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- BITYAPCSNKJESK-UHFFFAOYSA-N potassiosodium Chemical compound [Na].[K] BITYAPCSNKJESK-UHFFFAOYSA-N 0.000 description 1
- 239000001103 potassium chloride Substances 0.000 description 1
- WCUXLLCKKVVCTQ-UHFFFAOYSA-M potassium chloride Inorganic materials [Cl-].[K+] WCUXLLCKKVVCTQ-UHFFFAOYSA-M 0.000 description 1
- USHAGKDGDHPEEY-UHFFFAOYSA-L potassium persulfate Chemical compound [K+].[K+].[O-]S(=O)(=O)OOS([O-])(=O)=O USHAGKDGDHPEEY-UHFFFAOYSA-L 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001737 promoting effect Effects 0.000 description 1
- 229950008352 promoxolane Drugs 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical compound [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- 150000003856 quaternary ammonium compounds Chemical class 0.000 description 1
- 150000003242 quaternary ammonium salts Chemical class 0.000 description 1
- 150000004023 quaternary phosphonium compounds Chemical class 0.000 description 1
- 150000003254 radicals Chemical class 0.000 description 1
- 235000020095 red wine Nutrition 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000002356 single layer Substances 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- AJPJDKMHJJGVTQ-UHFFFAOYSA-M sodium dihydrogen phosphate Chemical compound [Na+].OP(O)([O-])=O AJPJDKMHJJGVTQ-UHFFFAOYSA-M 0.000 description 1
- 229940080264 sodium dodecylbenzenesulfonate Drugs 0.000 description 1
- 235000010267 sodium hydrogen sulphite Nutrition 0.000 description 1
- SUKJFIGYRHOWBL-UHFFFAOYSA-N sodium hypochlorite Chemical compound [Na+].Cl[O-] SUKJFIGYRHOWBL-UHFFFAOYSA-N 0.000 description 1
- CHQMHPLRPQMAMX-UHFFFAOYSA-L sodium persulfate Chemical compound [Na+].[Na+].[O-]S(=O)(=O)OOS([O-])(=O)=O CHQMHPLRPQMAMX-UHFFFAOYSA-L 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 229910052979 sodium sulfide Inorganic materials 0.000 description 1
- GRVFOGOEDUUMBP-UHFFFAOYSA-N sodium sulfide (anhydrous) Chemical compound [Na+].[Na+].[S-2] GRVFOGOEDUUMBP-UHFFFAOYSA-N 0.000 description 1
- HWCHICTXVOMIIF-UHFFFAOYSA-M sodium;3-(dodecylamino)propanoate Chemical group [Na+].CCCCCCCCCCCCNCCC([O-])=O HWCHICTXVOMIIF-UHFFFAOYSA-M 0.000 description 1
- DIORMHZUUKOISG-UHFFFAOYSA-N sulfoformic acid Chemical compound OC(=O)S(O)(=O)=O DIORMHZUUKOISG-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 229920001864 tannin Polymers 0.000 description 1
- 239000001648 tannin Substances 0.000 description 1
- 235000018553 tannin Nutrition 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 235000013616 tea Nutrition 0.000 description 1
- 150000004026 tertiary sulfonium compounds Chemical class 0.000 description 1
- HREJWSNWXTUMSH-UHFFFAOYSA-N trimethyl(2-oxopropyl)azanium;nitrate Chemical compound [O-][N+]([O-])=O.CC(=O)C[N+](C)(C)C HREJWSNWXTUMSH-UHFFFAOYSA-N 0.000 description 1
- VTPALXBJRVITSQ-UHFFFAOYSA-N trimethyl-(4-oxocyclohexyl)azanium;nitrate Chemical compound [O-][N+]([O-])=O.C[N+](C)(C)C1CCC(=O)CC1 VTPALXBJRVITSQ-UHFFFAOYSA-N 0.000 description 1
- UNXRWKVEANCORM-UHFFFAOYSA-I triphosphate(5-) Chemical compound [O-]P([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O UNXRWKVEANCORM-UHFFFAOYSA-I 0.000 description 1
- PFMBRNMAXCVTIV-UHFFFAOYSA-K trisodium hydrogen carbonate Chemical compound [Na+].[Na+].[Na+].OC([O-])=O.OC([O-])=O.OC([O-])=O PFMBRNMAXCVTIV-UHFFFAOYSA-K 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 235000014101 wine Nutrition 0.000 description 1
- 210000002268 wool Anatomy 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
- C11D3/3917—Nitrogen-containing compounds
- C11D3/392—Heterocyclic compounds, e.g. cyclic imides or lactames
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D3/00—Other compounding ingredients of detergent compositions covered in group C11D1/00
- C11D3/39—Organic or inorganic per-compounds
- C11D3/3902—Organic or inorganic per-compounds combined with specific additives
- C11D3/3905—Bleach activators or bleach catalysts
- C11D3/3907—Organic compounds
-
- D—TEXTILES; PAPER
- D06—TREATMENT OF TEXTILES OR THE LIKE; LAUNDERING; FLEXIBLE MATERIALS NOT OTHERWISE PROVIDED FOR
- D06L—DRY-CLEANING, WASHING OR BLEACHING FIBRES, FILAMENTS, THREADS, YARNS, FABRICS, FEATHERS OR MADE-UP FIBROUS GOODS; BLEACHING LEATHER OR FURS
- D06L4/00—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs
- D06L4/10—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen
- D06L4/12—Bleaching fibres, filaments, threads, yarns, fabrics, feathers or made-up fibrous goods; Bleaching leather or furs using agents which develop oxygen combined with specific additives
Landscapes
- Chemical & Material Sciences (AREA)
- Engineering & Computer Science (AREA)
- Inorganic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Textile Engineering (AREA)
- Detergent Compositions (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US16949171A | 1971-08-05 | 1971-08-05 | |
| US23049172A | 1972-02-29 | 1972-02-29 | |
| US23051872A | 1972-02-29 | 1972-02-29 | |
| GB3587872A GB1368400A (en) | 1971-08-05 | 1972-08-01 | Bleaching process and compositions therefor |
| US00293262A US3822114A (en) | 1971-08-05 | 1972-09-28 | Bleaching process and compositions therefor |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2238207A1 true DE2238207A1 (de) | 1973-02-15 |
Family
ID=27516329
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2238207A Pending DE2238207A1 (de) | 1971-08-05 | 1972-08-03 | Peroxido-bleichmittel |
Country Status (9)
Families Citing this family (59)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4006092A (en) * | 1971-08-05 | 1977-02-01 | The Procter & Gamble Company | Laundering aid |
| US4005029A (en) * | 1973-08-01 | 1977-01-25 | The Procter & Gamble Company | Laundering adjunct |
| CA1075405A (en) * | 1977-03-28 | 1980-04-15 | John F. Goodman | Photoactivated bleach-compositions and process |
| US4001131A (en) * | 1975-06-03 | 1977-01-04 | The Procter & Gamble Company | Activation of organic peracids by di-ketones |
| GB1568358A (en) * | 1975-11-18 | 1980-05-29 | Interox Chemicals Ltd | Aromatic peroxyacids and their use in bleaching processes |
| US4120651A (en) * | 1977-10-03 | 1978-10-17 | Fmc Corporation | Disulfones as peroxygen activators |
| ZA804929B (en) * | 1979-08-16 | 1982-03-31 | Unilever Ltd | Bleach composition |
| ZA804930B (en) * | 1979-08-16 | 1982-03-31 | Unilever Ltd | Bleach composition |
| US4367156A (en) * | 1980-07-02 | 1983-01-04 | The Procter & Gamble Company | Bleaching process and compositions |
| US4283301A (en) * | 1980-07-02 | 1981-08-11 | The Procter & Gamble Company | Bleaching process and compositions |
| DE3263812D1 (en) | 1981-02-16 | 1985-07-04 | Unilever Nv | Washing composition |
| US4443352A (en) * | 1982-03-04 | 1984-04-17 | Colgate-Palmolive Company | Silicate-free bleaching and laundering composition |
| AU568809B2 (en) * | 1982-06-03 | 1988-01-14 | Interox Chemicals Ltd. | Peroxyacid sanitizer compositions |
| US4547305A (en) * | 1982-07-22 | 1985-10-15 | Lever Brothers Company | Low temperature bleaching detergent compositions comprising peracids and persalt activator |
| GB8307036D0 (en) * | 1983-03-15 | 1983-04-20 | Interox Chemicals Ltd | Peroxygen compounds |
| US4671891A (en) * | 1983-09-16 | 1987-06-09 | The Procter & Gamble Company | Bleaching compositions |
| US4483778A (en) * | 1983-12-22 | 1984-11-20 | The Procter & Gamble Company | Peroxygen bleach activators and bleaching compositions |
| US4539130A (en) * | 1983-12-22 | 1985-09-03 | The Procter & Gamble Company | Peroxygen bleach activators and bleaching compositions |
| US4486327A (en) * | 1983-12-22 | 1984-12-04 | The Procter & Gamble Company | Bodies containing stabilized bleach activators |
| US4613332A (en) * | 1984-07-11 | 1986-09-23 | The Clorox Company | Controlled generation hypochlorite compositions and method |
| US4613463A (en) * | 1984-11-01 | 1986-09-23 | The Upjohn Company | Process and intermediates for the preparation of 17 alphahydroxyprogesterones and corticoids from an enol steroid |
| US4814110A (en) * | 1984-12-14 | 1989-03-21 | The Clorox Company | Method for esterifying dihydroxybenzenes |
| US4900468A (en) * | 1985-06-17 | 1990-02-13 | The Clorox Company | Stabilized liquid hydrogen peroxide bleach compositions |
| US5180514A (en) * | 1985-06-17 | 1993-01-19 | The Clorox Company | Stabilizing system for liquid hydrogen peroxide compositions |
| EP0232530A3 (en) * | 1986-01-21 | 1988-08-31 | Pennwalt Corporation | Improved textile detergent |
| DE3938526A1 (de) * | 1989-11-21 | 1991-05-23 | Basf Ag | Verwendung von heterocyclischen verbindungen als bleichaktivatoren oder optische aufheller in wasch- und reinigungsmitteln |
| AU653782B2 (en) * | 1991-02-12 | 1994-10-13 | Curators Of The University Of Missouri, The | Bleaching of lignocellulosic material with activated oxygen |
| ZA932278B (en) * | 1992-04-17 | 1994-09-30 | Colgate Palmolive Co | Peroxygen bleach composition |
| EP0681625A4 (en) * | 1993-02-01 | 1997-03-12 | Solvay Interox | IMPROVED PROCESS AND COMPOSITION FOR DELIGNIFICATION OF A LIGNOCELLULOSIC MATERIAL. |
| US5403549A (en) * | 1993-11-04 | 1995-04-04 | Cyclo3 pss Medical Systems, Inc. | Method for sterilization using a fluid chemical biocide |
| US5437686A (en) * | 1994-05-18 | 1995-08-01 | Colgate-Palmolive Co. | Peroxygen bleach composition activated by bi and tricyclic diketones |
| DE4439039A1 (de) * | 1994-11-02 | 1996-05-09 | Hoechst Ag | Granulierte Bleichaktivatoren und ihre Herstellung |
| GB9525773D0 (en) * | 1995-12-16 | 1996-02-14 | Unilever Plc | Detergent composition |
| WO1997024429A1 (en) * | 1995-12-28 | 1997-07-10 | Colgate-Palmolive Company | Peroxygen bleach composition activated by piperidone derivatives |
| US5709815A (en) * | 1995-12-28 | 1998-01-20 | Colgate Palmolive Company | Peroxygen bleach composition activated by oxo-piperidinium salts |
| BR9708553A (pt) * | 1996-04-10 | 1999-09-28 | Unilever Nv | Processo para limpeza de um substrato e uso de umsistema ativador de oxigenio molecular |
| US5755993A (en) * | 1996-12-23 | 1998-05-26 | Colgate-Palmolive Co. | Peroxygen bleach composition activated by piperidone derivatives |
| WO1998059108A2 (de) * | 1997-06-20 | 1998-12-30 | Blume, Hildegard | Oxidations- und bleichsystem mit enzymatisch hergestellten oxidationsmitteln |
| EP0913462A1 (en) * | 1997-10-31 | 1999-05-06 | The Procter & Gamble Company | Liquid aqueous bleaching compositions packaged in a UV-resistant container |
| EP0913515A1 (en) * | 1997-10-31 | 1999-05-06 | The Procter & Gamble Company | Process of bleaching fabrics |
| EP0915150A1 (en) * | 1997-10-31 | 1999-05-12 | The Procter & Gamble Company | Processes of soaking fabrics with a liquid aqueous persulfate salt-containing composition |
| US6117833A (en) * | 1998-12-16 | 2000-09-12 | Lever Brothers Company | Bleaching compositions and method for bleaching substrates directly with air |
| US6140298A (en) * | 1998-12-16 | 2000-10-31 | Lever Brothers Company, Division Of Conopco, Inc. | Bleaching compositions based on air, uncomplexed transition metal ions and aromatic aldehydes |
| JP2003508586A (ja) * | 1999-08-27 | 2003-03-04 | ザ、プロクター、エンド、ギャンブル、カンパニー | 迅速に作用する処方成分、それらの成分を使用する組成物および洗濯方法 |
| DE10054693A1 (de) * | 2000-11-03 | 2002-05-08 | Clariant Gmbh | Reinigungsmittel für Zahnprothesen |
| DE10057045A1 (de) | 2000-11-17 | 2002-05-23 | Clariant Gmbh | Teilchenförmige Bleichaktivatoren auf der Basis von Acetonitrilen |
| DE10058645A1 (de) | 2000-11-25 | 2002-05-29 | Clariant Gmbh | Verwendung von cyclischen Zuckerketonen als Katalysatoren für Persauerstoffverbindungen |
| US7407924B2 (en) | 2000-12-05 | 2008-08-05 | Miz Co., Ltd. | Surfactant-free detergent composition comprising an anti-soil redeposition agent |
| DE10134364A1 (de) * | 2001-07-14 | 2003-01-23 | Clariant Gmbh | Verfahren zur Herstellung von Bleichaktivator-Granulaten |
| DE10136805A1 (de) | 2001-07-25 | 2003-02-13 | Clariant Gmbh | Verfahren zur Herstellung von Bleichaktivator-Granulaten |
| EP1288283A1 (en) * | 2001-09-04 | 2003-03-05 | Unilever Plc | Antimicrobial compositions |
| DE10161766A1 (de) * | 2001-12-15 | 2003-06-26 | Clariant Gmbh | Bleichaktivator-Co-Granulate |
| US7557076B2 (en) * | 2002-06-06 | 2009-07-07 | The Procter & Gamble Company | Organic catalyst with enhanced enzyme compatibility |
| US7169744B2 (en) * | 2002-06-06 | 2007-01-30 | Procter & Gamble Company | Organic catalyst with enhanced solubility |
| DE10334046A1 (de) * | 2003-07-25 | 2005-02-10 | Clariant Gmbh | Verfahren zur Herstellung von granulierten Acyloxybenzolsulfonaten oder Acyloxybenzolcarbonsäuren und deren Salze |
| US20050113246A1 (en) * | 2003-11-06 | 2005-05-26 | The Procter & Gamble Company | Process of producing an organic catalyst |
| AR051659A1 (es) * | 2005-06-17 | 2007-01-31 | Procter & Gamble | Una composicion que comprende un catalizador organico con compatibilidada enzimatica mejorada |
| GB0615487D0 (en) * | 2006-08-04 | 2006-09-13 | Reckitt Benckiser Nv | Detergent composition |
| DE102006036889A1 (de) * | 2006-08-04 | 2008-02-07 | Clariant International Limited | Verwendung von Aminoacetonen und deren Salzen als Bleichkraftverstärker für Persauerstoffverbindungen |
-
1972
- 1972-08-01 GB GB3587872A patent/GB1368400A/en not_active Expired
- 1972-08-03 DE DE2238207A patent/DE2238207A1/de active Pending
- 1972-08-04 FR FR7228368A patent/FR2148302B1/fr not_active Expired
- 1972-08-04 NL NL7210754A patent/NL7210754A/xx not_active Application Discontinuation
- 1972-08-04 CH CH1157872A patent/CH574497A5/xx not_active IP Right Cessation
- 1972-08-04 CA CA148,764A patent/CA991364A/en not_active Expired
- 1972-08-07 SE SE7210264A patent/SE385718B/xx unknown
- 1972-08-07 AU AU45357/72A patent/AU4535772A/en not_active Expired
- 1972-09-28 US US00293262A patent/US3822114A/en not_active Expired - Lifetime
-
1973
- 1973-02-27 CA CA164,705A patent/CA993755A/en not_active Expired
- 1973-02-27 CA CA164,704A patent/CA993754A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CH574497A5 (US20100268047A1-20101021-C00003.png) | 1976-04-15 |
| US3822114A (en) | 1974-07-02 |
| CA993754A (en) | 1976-07-27 |
| FR2148302A1 (US20100268047A1-20101021-C00003.png) | 1973-03-11 |
| NL7210754A (US20100268047A1-20101021-C00003.png) | 1973-02-07 |
| FR2148302B1 (US20100268047A1-20101021-C00003.png) | 1975-03-07 |
| SE385718B (sv) | 1976-07-19 |
| CA993755A (en) | 1976-07-27 |
| GB1368400A (en) | 1974-09-25 |
| CA991364A (en) | 1976-06-22 |
| AU4535772A (en) | 1974-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2238207A1 (de) | Peroxido-bleichmittel | |
| DE69014384T2 (de) | Bleichaktivierung. | |
| DE69434227T3 (de) | Durchsichtige, isotrope, wässrige Bleichmittelzusammensetzung | |
| DE2703876C2 (US20100268047A1-20101021-C00003.png) | ||
| DE1444024A1 (de) | Bleich- und Reinigungsmittel | |
| CH622569A5 (US20100268047A1-20101021-C00003.png) | ||
| DE943105C (de) | Verfahren zum Bleichen von anderen organischen Materialien als Celluose | |
| DE2207979A1 (de) | Trockene chlorfreie Bleichmittel | |
| EP0869171A2 (de) | Bleichaktive Metall-Komplexe | |
| DE2207988A1 (de) | Zusammensetzung mit bleichender und gewebe weichmachender wirkung | |
| DE2420647B2 (de) | Bleichmittel | |
| DE3540933C2 (US20100268047A1-20101021-C00003.png) | ||
| EP0210952A1 (de) | Wässrige, alkalische, silikathaltige Zusammensetzung zum Bleichen von cellulosehaltigen Fasermaterialien in Gegenwart von Perverbindungen | |
| DE2531870C3 (de) | Bleichmittel auf der Basis eines Wasserstoffperoxyd-Addukts | |
| EP0882814B1 (de) | System und Verfahren zur elektrochemischen Spaltung von Verbindungen | |
| DE1617161A1 (de) | Verstaerkungsmittel fuer synthetische Detergentien | |
| DE2530539B2 (de) | Addukt aus Natriumsulfat, Wasserstoffperoxyd und Natriumchlorid und dessen Verwendung | |
| DE2023792A1 (de) | Bleichmittelmischung | |
| DE1962125A1 (de) | Wasch-,Bleich- und Reinigungsmittel | |
| DE1802576A1 (de) | Bleich- und Waschmittel | |
| DE1695219A1 (de) | Aktivatoren fuer Perverbindungen | |
| JPS6023148B2 (ja) | 天然産油脂の漂白方法 | |
| AT394386B (de) | Bleichende koernige waschmittelzusammensetzung | |
| EP0210132A1 (de) | Wässrige, alkalische, silikathaltige Zusammensetzung zum Bleichen von cellulosehaltigen Fasermaterialien in Gegenwart von Perverbindungen | |
| DE1083221B (de) | Verfahren zum Bleichen von natuerlichen oder synthetischen Fasern und Textilien sowie Zellstoff und Holzschliff mit waessrigen peroxydhaltigen Behandlungsbaedern |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHJ | Non-payment of the annual fee |