DE2215824B2 - Schmuckstück und Informationsträger - Google Patents
Schmuckstück und InformationsträgerInfo
- Publication number
- DE2215824B2 DE2215824B2 DE2215824A DE2215824A DE2215824B2 DE 2215824 B2 DE2215824 B2 DE 2215824B2 DE 2215824 A DE2215824 A DE 2215824A DE 2215824 A DE2215824 A DE 2215824A DE 2215824 B2 DE2215824 B2 DE 2215824B2
- Authority
- DE
- Germany
- Prior art keywords
- housing
- plate
- plates
- piece
- jewelry
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 239000010437 gem Substances 0.000 title description 2
- 229910001751 gemstone Inorganic materials 0.000 title description 2
- 230000006835 compression Effects 0.000 claims description 13
- 238000007906 compression Methods 0.000 claims description 13
- 210000002105 tongue Anatomy 0.000 claims description 5
- 238000013459 approach Methods 0.000 claims 1
- 238000000926 separation method Methods 0.000 claims 1
- FSCNUJMKSQHQSY-UHFFFAOYSA-N Gein Chemical compound COC1=CC(CC=C)=CC=C1OC1C(O)C(O)C(O)C(COC2C(C(O)C(O)CO2)O)O1 FSCNUJMKSQHQSY-UHFFFAOYSA-N 0.000 description 2
- 206010020751 Hypersensitivity Diseases 0.000 description 2
- 230000007815 allergy Effects 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000005192 partition Methods 0.000 description 2
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000005755 formation reaction Methods 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A44—HABERDASHERY; JEWELLERY
- A44C—PERSONAL ADORNMENTS, e.g. JEWELLERY; COINS
- A44C5/00—Bracelets; Wrist-watch straps; Fastenings for bracelets or wrist-watch straps
- A44C5/0007—Bracelets specially adapted for other functions or with means for attaching other articles
- A44C5/0015—Bracelets specially adapted for other functions or with means for attaching other articles providing information, e.g. bracelets with calendars
Landscapes
- Purses, Travelling Bags, Baskets, Or Suitcases (AREA)
- Buckles (AREA)
- Clamps And Clips (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US13092771A | 1971-04-05 | 1971-04-05 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2215824A1 DE2215824A1 (de) | 1972-10-26 |
| DE2215824B2 true DE2215824B2 (de) | 1974-03-28 |
| DE2215824C3 DE2215824C3 (ref) | 1974-11-07 |
Family
ID=22447024
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2215824A Granted DE2215824B2 (de) | 1971-04-05 | 1972-03-30 | Schmuckstück und Informationsträger |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3769726A (ref) |
| CH (1) | CH548748A (ref) |
| DE (1) | DE2215824B2 (ref) |
| GB (1) | GB1382654A (ref) |
| IT (1) | IT951152B (ref) |
Families Citing this family (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3864856A (en) * | 1972-09-05 | 1975-02-11 | Hi Tor Inventions Corp | Emergency data band |
| EP0021063B1 (de) * | 1979-06-23 | 1984-08-15 | RODI & WIENENBERGER Aktiengesellschaft | Verstellbarer Faltverschluss für Uhrarmbänder |
| US4396298A (en) * | 1981-08-03 | 1983-08-02 | Textron, Inc. | Case for electronic watch module |
| FR2636215A1 (fr) * | 1988-09-12 | 1990-03-16 | Rodel Robin | Porte-cartes |
| EP0425608B1 (de) * | 1989-04-25 | 1994-08-31 | SKIDATA COMPUTER GESELLSCHAFT m.b.H. | Datenträger |
| US5259540A (en) * | 1989-04-25 | 1993-11-09 | Skidata Computer Gesellschaft M.B.H. | Data carrier |
| WO2001057829A1 (en) * | 2000-02-07 | 2001-08-09 | Helio Zapata | Retractable watch band calendar |
| US6186552B1 (en) * | 2000-04-12 | 2001-02-13 | Avis Y. Seabrook | Changeable memorandum wristband |
| US6829851B2 (en) * | 2001-10-31 | 2004-12-14 | Hewlett-Packard Development Company L.P. | Foldable label display system |
| GB2418343A (en) * | 2004-09-28 | 2006-03-29 | Hilton Armand | Wristwatch strap with information pouch |
| US7607243B2 (en) | 2006-05-03 | 2009-10-27 | Nike, Inc. | Athletic or other performance sensing systems |
| US8088043B2 (en) * | 2007-09-07 | 2012-01-03 | Nike, Inc. | Wearable device assembly having athletic functionality |
| EP2700434A3 (en) | 2008-04-02 | 2014-07-02 | Nike International Ltd. | Wearable device assembly having athletic functionality |
| US20110072700A1 (en) * | 2009-09-30 | 2011-03-31 | Dominick Theresa | Color Coded Marking System for all formats of USB Flash Drives and SD Memory Cards |
| US11094224B2 (en) * | 2018-03-30 | 2021-08-17 | David Stapleton | Separable identification assembly |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US301920A (en) * | 1884-07-15 | Lewis w | ||
| US919983A (en) * | 1907-10-18 | 1909-04-27 | John Walsh | Identification device. |
| US1044704A (en) * | 1911-04-18 | 1912-11-19 | John H Stoddard | Label-holder. |
| US1063209A (en) * | 1911-11-14 | 1913-06-03 | H C Perley | Locket. |
-
1971
- 1971-04-05 US US00130927A patent/US3769726A/en not_active Expired - Lifetime
-
1972
- 1972-03-28 GB GB1452572A patent/GB1382654A/en not_active Expired
- 1972-03-30 DE DE2215824A patent/DE2215824B2/de active Granted
- 1972-04-01 IT IT22781/72A patent/IT951152B/it active
- 1972-04-04 CH CH488372A patent/CH548748A/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE2215824C3 (ref) | 1974-11-07 |
| GB1382654A (en) | 1975-02-05 |
| IT951152B (it) | 1973-06-30 |
| US3769726A (en) | 1973-11-06 |
| CH548748A (de) | 1974-05-15 |
| DE2215824A1 (de) | 1972-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69314896T2 (de) | Schnalle für Uhrarmband | |
| DE69418965T2 (de) | Uhrarmbandverschluss | |
| DE2215824B2 (de) | Schmuckstück und Informationsträger | |
| DE2803426A1 (de) | Halteklammer-anordnung | |
| DE602004011530T2 (de) | Vorrichtung zur befestigung eines endes eines bandes auf einem gegenstand | |
| DE2458684A1 (de) | Anschlussglied fuer uhrarmbaender | |
| EP0021063B1 (de) | Verstellbarer Faltverschluss für Uhrarmbänder | |
| DE68922233T2 (de) | Einheit mit verstellbarem Riemen für einen Papierumschlag. | |
| DE8331210U1 (de) | Kanten- oder Eckbeschlag | |
| DE3600794A1 (de) | Tasche mit loesbarer vortasche | |
| DE1557412B1 (de) | Verschlussschnalle fuer Sicherheitsgurte | |
| EP0208168A1 (de) | Armbandverschluss | |
| EP0126980A1 (de) | Vorrichtung zur geordneten Ablage und Aufbewahrung von flächig ausgebildeten Gegenstanden | |
| DE2411369A1 (de) | Schnappverschluss fuer schmucksachen | |
| DE2526862A1 (de) | Schliesse fuer schmuckketten | |
| DE1632742C3 (de) | Verschluß fur ein Armband od dgl | |
| DE2935245A1 (de) | Schliesse fuer ein uhrenarmband | |
| DE8803354U1 (de) | Angebotsmappe | |
| CH317488A (de) | Registraturhilfsmittel an Hängeregistraturen mit seitlicher Sicht | |
| DE3520122A1 (de) | Armbandverschluss | |
| DE679168C (de) | Reissverschluss | |
| DE19901479C2 (de) | Halterung für blattförmige Aufzeichnungsträger | |
| DE2402144A1 (de) | Verschluss fuer metall-uhrarmbaender | |
| DE179508C (ref) | ||
| DE1632741C3 (de) | Gliederband veränderbarer Lange |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) |