DE2207098C2 - Verfahren zur Herstellung von 2,5-Dimethyl-furan-3-carbon-säureestern - Google Patents
Verfahren zur Herstellung von 2,5-Dimethyl-furan-3-carbon-säureesternInfo
- Publication number
- DE2207098C2 DE2207098C2 DE2207098A DE2207098A DE2207098C2 DE 2207098 C2 DE2207098 C2 DE 2207098C2 DE 2207098 A DE2207098 A DE 2207098A DE 2207098 A DE2207098 A DE 2207098A DE 2207098 C2 DE2207098 C2 DE 2207098C2
- Authority
- DE
- Germany
- Prior art keywords
- carboxylic acid
- parts
- furan
- dimethyl
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 13
- 238000002360 preparation method Methods 0.000 title claims description 3
- CNTHHNPBADVTRY-UHFFFAOYSA-N 2,5-dimethylfuran-3-carboxylic acid Chemical class CC1=CC(C(O)=O)=C(C)O1 CNTHHNPBADVTRY-UHFFFAOYSA-N 0.000 title description 7
- 125000001589 carboacyl group Chemical group 0.000 claims description 2
- 125000005907 alkyl ester group Chemical group 0.000 claims 1
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000003054 catalyst Substances 0.000 description 9
- 238000007363 ring formation reaction Methods 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 8
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- 238000006000 Knoevenagel condensation reaction Methods 0.000 description 4
- 238000009833 condensation Methods 0.000 description 4
- 230000005494 condensation Effects 0.000 description 4
- DNYLSCDHFCSDRM-UHFFFAOYSA-N ethyl 2,5-dimethylfuran-3-carboxylate Chemical compound CCOC(=O)C=1C=C(C)OC=1C DNYLSCDHFCSDRM-UHFFFAOYSA-N 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- VTUMIXJWXJGPJW-UHFFFAOYSA-N 2,5-dimethyl-3h-furan-2-carboxylic acid Chemical compound CC1=CCC(C)(C(O)=O)O1 VTUMIXJWXJGPJW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 239000007859 condensation product Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- LBLYYCQCTBFVLH-UHFFFAOYSA-N 2-Methylbenzenesulfonic acid Chemical compound CC1=CC=CC=C1S(O)(=O)=O LBLYYCQCTBFVLH-UHFFFAOYSA-N 0.000 description 2
- IHCCAYCGZOLTEU-UHFFFAOYSA-N 3-furoic acid Chemical class OC(=O)C=1C=COC=1 IHCCAYCGZOLTEU-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- LCTONWCANYUPML-UHFFFAOYSA-N Pyruvic acid Chemical compound CC(=O)C(O)=O LCTONWCANYUPML-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 238000010533 azeotropic distillation Methods 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000003197 catalytic effect Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- 125000004494 ethyl ester group Chemical group 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 238000007127 saponification reaction Methods 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- FXPPNKAYSGWCQG-UHFFFAOYSA-N 2-acetoxypropanal Chemical compound O=CC(C)OC(C)=O FXPPNKAYSGWCQG-UHFFFAOYSA-N 0.000 description 1
- KPRGOTLNGIBVFL-GINZOMEDSA-N 7-ketodehydroepiandrosterone Chemical group C1[C@@H](O)CC[C@]2(C)[C@H]3CC[C@](C)(C(CC4)=O)[C@@H]4[C@@H]3C(=O)C=C21 KPRGOTLNGIBVFL-GINZOMEDSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- JVUFLUNFHLZHIJ-UHFFFAOYSA-N CC1(OC(=CC1)C)C(=O)OCC Chemical compound CC1(OC(=CC1)C)C(=O)OCC JVUFLUNFHLZHIJ-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- QNAYBMKLOCPYGJ-REOHCLBHSA-N L-alanine Chemical compound C[C@H](N)C(O)=O QNAYBMKLOCPYGJ-REOHCLBHSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 235000004279 alanine Nutrition 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000004063 butyryl group Chemical group O=C([*])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- 235000019441 ethanol Nutrition 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- JDPRRECMRPCSIF-UHFFFAOYSA-N ethyl 3-oxobutanoate;sodium Chemical compound [Na].CCOC(=O)CC(C)=O JDPRRECMRPCSIF-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000000855 fungicidal effect Effects 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- -1 isobutyryl Chemical group 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- RAIYODFGMLZUDF-UHFFFAOYSA-N piperidin-1-ium;acetate Chemical compound CC([O-])=O.C1CC[NH2+]CC1 RAIYODFGMLZUDF-UHFFFAOYSA-N 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229940107700 pyruvic acid Drugs 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006798 ring closing metathesis reaction Methods 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000012258 stirred mixture Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/56—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D307/68—Carbon atoms having three bonds to hetero atoms with at the most one bond to halogen
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Furan Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (15)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE795524D BE795524A (fr) | 1972-02-16 | Procede de preparation d'esters de l'acide dimethyl-2,5-furanne-carboxylique-3 | |
| DE2207098A DE2207098C2 (de) | 1972-02-16 | 1972-02-16 | Verfahren zur Herstellung von 2,5-Dimethyl-furan-3-carbon-säureestern |
| IL41439A IL41439A (en) | 1972-02-16 | 1973-01-31 | The preparation of 2,5-dimethylfuran-3-carboxylic acid esters |
| US328480A US3919261A (en) | 1972-02-16 | 1973-01-31 | Preparation of 2,5-dimethylfuran-3-carboxylic esters |
| IT48012/73A IT977158B (it) | 1972-02-16 | 1973-02-01 | Procedimento per la produzione di esteri di acido 2 5 dimetil furan 3 carbossilico |
| JP48012495A JPS5749551B2 (enExample) | 1972-02-16 | 1973-02-01 | |
| NLAANVRAGE7301666,A NL176457C (nl) | 1972-02-16 | 1973-02-06 | Werkwijze ter bereiding van een 2,5-dimethylfurancarbonzuurderivaat. |
| FR7304820A FR2172141B1 (enExample) | 1972-02-16 | 1973-02-12 | |
| CH202373A CH574951A5 (enExample) | 1972-02-16 | 1973-02-13 | |
| SU1884212A SU485595A3 (ru) | 1972-02-16 | 1973-02-14 | Способ получени алкиловых эфиров 2,5-диметилфуран-3-карбоновой кислоты |
| HUBA2871A HU165489B (enExample) | 1972-02-16 | 1973-02-14 | |
| SE7302087A SE377122B (enExample) | 1972-02-16 | 1973-02-14 | |
| CS7300001104A CS180612B2 (en) | 1972-02-16 | 1973-02-15 | Mode of production of alkylesters 2,5-dimethyl-furane-3-carboxyl acid |
| GB742873A GB1411173A (en) | 1972-02-16 | 1973-02-15 | Preparation of 2,5-dimethylfuran-3-carboxylic esters |
| DK81073AA DK130976B (da) | 1972-02-16 | 1973-02-15 | Fremgangsmåde til fremstilling af 2,5-dimethyl-furan-3-carboxylsyreestere. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2207098A DE2207098C2 (de) | 1972-02-16 | 1972-02-16 | Verfahren zur Herstellung von 2,5-Dimethyl-furan-3-carbon-säureestern |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2207098A1 DE2207098A1 (de) | 1973-08-23 |
| DE2207098C2 true DE2207098C2 (de) | 1983-03-24 |
Family
ID=5836028
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2207098A Expired DE2207098C2 (de) | 1972-02-16 | 1972-02-16 | Verfahren zur Herstellung von 2,5-Dimethyl-furan-3-carbon-säureestern |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3919261A (enExample) |
| JP (1) | JPS5749551B2 (enExample) |
| BE (1) | BE795524A (enExample) |
| CH (1) | CH574951A5 (enExample) |
| CS (1) | CS180612B2 (enExample) |
| DE (1) | DE2207098C2 (enExample) |
| DK (1) | DK130976B (enExample) |
| FR (1) | FR2172141B1 (enExample) |
| GB (1) | GB1411173A (enExample) |
| HU (1) | HU165489B (enExample) |
| IL (1) | IL41439A (enExample) |
| IT (1) | IT977158B (enExample) |
| NL (1) | NL176457C (enExample) |
| SE (1) | SE377122B (enExample) |
| SU (1) | SU485595A3 (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5751394B2 (enExample) * | 1974-04-30 | 1982-11-01 | ||
| US4198341A (en) * | 1977-09-08 | 1980-04-15 | Dynamit Nobel Aktiengesellschaft | 2,5,5-Trimethyl-3-carbalkoxy-4(β,β-dihalovinyl)-4,5-dihydrofurans |
| DE2826013A1 (de) * | 1978-06-14 | 1980-01-03 | Basf Ag | Verfahren zur herstellung von 2,5-dimethylfuran-3-carbonsaeurealkylestern |
| DE3227388A1 (de) * | 1982-07-22 | 1984-01-26 | Basf Ag, 6700 Ludwigshafen | Verfahren zur herstellung von (alpha)-substituierten ss-dicarbonyl-, ss-cyancarbonyl- und ss-dicyanverbindungen |
| CN101486696B (zh) * | 2009-02-27 | 2011-05-25 | 西南大学 | 2,5-二甲基呋喃-3,4-二甲酸的制备方法 |
| US8324409B2 (en) | 2010-04-23 | 2012-12-04 | The Board Of Trustees Of The University Of Illinois | Efficient method for preparing 2,5-dimethylfuran |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA932334A (en) * | 1969-02-13 | 1973-08-21 | Uniroyal Ltd. | Furan-3-carboxamide derivatives and method of preparing same |
-
0
- BE BE795524D patent/BE795524A/xx not_active IP Right Cessation
-
1972
- 1972-02-16 DE DE2207098A patent/DE2207098C2/de not_active Expired
-
1973
- 1973-01-31 US US328480A patent/US3919261A/en not_active Expired - Lifetime
- 1973-01-31 IL IL41439A patent/IL41439A/en unknown
- 1973-02-01 IT IT48012/73A patent/IT977158B/it active
- 1973-02-01 JP JP48012495A patent/JPS5749551B2/ja not_active Expired
- 1973-02-06 NL NLAANVRAGE7301666,A patent/NL176457C/xx not_active IP Right Cessation
- 1973-02-12 FR FR7304820A patent/FR2172141B1/fr not_active Expired
- 1973-02-13 CH CH202373A patent/CH574951A5/xx not_active IP Right Cessation
- 1973-02-14 SE SE7302087A patent/SE377122B/xx unknown
- 1973-02-14 SU SU1884212A patent/SU485595A3/ru active
- 1973-02-14 HU HUBA2871A patent/HU165489B/hu unknown
- 1973-02-15 DK DK81073AA patent/DK130976B/da unknown
- 1973-02-15 CS CS7300001104A patent/CS180612B2/cs unknown
- 1973-02-15 GB GB742873A patent/GB1411173A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK130976B (da) | 1975-05-12 |
| NL7301666A (enExample) | 1973-08-20 |
| JPS5749551B2 (enExample) | 1982-10-22 |
| FR2172141A1 (enExample) | 1973-09-28 |
| DK130976C (enExample) | 1975-10-13 |
| NL176457C (nl) | 1985-04-16 |
| NL176457B (nl) | 1984-11-16 |
| JPS4891054A (enExample) | 1973-11-27 |
| IL41439A0 (en) | 1973-03-30 |
| DE2207098A1 (de) | 1973-08-23 |
| BE795524A (fr) | 1973-08-16 |
| HU165489B (enExample) | 1974-09-28 |
| IL41439A (en) | 1976-03-31 |
| GB1411173A (en) | 1975-10-22 |
| FR2172141B1 (enExample) | 1978-05-26 |
| US3919261A (en) | 1975-11-11 |
| CS180612B2 (en) | 1978-01-31 |
| SU485595A3 (ru) | 1975-09-25 |
| SE377122B (enExample) | 1975-06-23 |
| CH574951A5 (enExample) | 1976-04-30 |
| IT977158B (it) | 1974-09-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3006277C2 (enExample) | ||
| DE2743920C2 (de) | Verfahren zur Herstellung von dl-α-Tocopherol | |
| DE2207098C2 (de) | Verfahren zur Herstellung von 2,5-Dimethyl-furan-3-carbon-säureestern | |
| DE1289046B (de) | Verfahren zur Herstellung von trans-Chrysanthemummonocarbonsaeure bzw. deren funktionellen Derivaten | |
| DE2318001C3 (de) | Dienische Sulfone | |
| DE2060443C3 (de) | Verfahren zur Herstellung von alpha -Alkylacylessigsäureestern | |
| DE1001261C2 (de) | Verfahren zur Herstellung von basischen Estern endocyclisch substituierter Mandelsaeuren und ihren Salzen | |
| DE1793693C3 (enExample) | ||
| DE1301313B (de) | Verfahren zur Herstellung von Pyrryl-(2)-essigsaeureestern | |
| DE69016647T2 (de) | Verfahren zur herstellung von alpha-beta-ungesättigten ketonen. | |
| EP0302331B1 (de) | Ester von Arylbisperfluoralkylcarbinolen, Verfahren zur Herstellung dieser Verbindungen und der zugrundeliegenden Arylbisperfluoralkylcarbinole | |
| EP0003107B1 (de) | Verfahren zur Herstellung von Furancarbonsäureanilid | |
| DE1291334B (de) | Verfahren zur Herstellung von 2, 3, 4-Trialkoxy-5-(2'-carboxyaethyl)-7, 8, 9-trihydro-benzocycloheptenen | |
| EP0573999A1 (de) | Verfahren zur Herstellung von Tetronsäurealkylestern | |
| EP0034746B1 (de) | 5-Sulfamoyl-orthanilsäuren, Verfahren zu ihrer Herstellung, diese enthaltende Heilmittel und die Verbindungen zur Verwendung als Heilmittel | |
| DE3225605C2 (enExample) | ||
| DE2361144C3 (de) | SuIfon-Alkohole und deren Ester und Verfahren zu ihrer Herstellung | |
| DE1900202A1 (de) | Neue Dioxanderivate | |
| DE1543880C3 (de) | Verfahren zur Herstellung von Benzo- oder Naphtho-dioxolen bzw. -oxathiolen | |
| AT228804B (de) | Verfahren zur Herstellung von Thionothiolphosphorsäureestern | |
| DE1618310C3 (enExample) | ||
| DE1568253C (de) | N substituierte 1,2 Diphenyl 2 acyloxy 3 amino methyl butene | |
| AT230361B (de) | Verfahren zur Herstellung von substituierten Triphenylmethanverbindungen | |
| DE2264663C3 (de) | Ungesättigte Sulfoxyde und Verfahren zu ihrer Herstellung | |
| AT225185B (de) | Verfahren zur Herstellung von neuen substituierten Triphenylcarbinolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition |