DE2201456C3 - Verfahren zur Herstellung von Aldehyden und Diolen - Google Patents
Verfahren zur Herstellung von Aldehyden und DiolenInfo
- Publication number
- DE2201456C3 DE2201456C3 DE2201456A DE2201456A DE2201456C3 DE 2201456 C3 DE2201456 C3 DE 2201456C3 DE 2201456 A DE2201456 A DE 2201456A DE 2201456 A DE2201456 A DE 2201456A DE 2201456 C3 DE2201456 C3 DE 2201456C3
- Authority
- DE
- Germany
- Prior art keywords
- hydrogen peroxide
- reaction
- diols
- tert
- aldehydes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title claims description 22
- 150000001299 aldehydes Chemical class 0.000 title claims description 9
- 150000002009 diols Chemical class 0.000 title claims description 5
- 238000004519 manufacturing process Methods 0.000 title claims description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 claims description 64
- 150000001336 alkenes Chemical class 0.000 claims description 23
- 239000003054 catalyst Substances 0.000 claims description 18
- 150000001875 compounds Chemical class 0.000 claims description 11
- -1 alkyl radical Chemical class 0.000 description 31
- 238000006243 chemical reaction Methods 0.000 description 17
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 description 12
- 239000002904 solvent Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 8
- LPIQUOYDBNQMRZ-UHFFFAOYSA-N cyclopentenylidene Natural products C1CC=CC1 LPIQUOYDBNQMRZ-UHFFFAOYSA-N 0.000 description 7
- 229910052750 molybdenum Inorganic materials 0.000 description 7
- 239000011733 molybdenum Substances 0.000 description 7
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 5
- 239000002253 acid Substances 0.000 description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 5
- 229910052794 bromium Inorganic materials 0.000 description 5
- 229910052801 chlorine Inorganic materials 0.000 description 5
- 239000000460 chlorine Chemical group 0.000 description 5
- 229910052731 fluorine Inorganic materials 0.000 description 5
- 239000011737 fluorine Substances 0.000 description 5
- 125000001153 fluoro group Chemical group F* 0.000 description 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 150000000180 1,2-diols Chemical class 0.000 description 4
- 125000004432 carbon atom Chemical group C* 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- HGCIXCUEYOPUTN-UHFFFAOYSA-N cyclohexene Chemical compound C1CCC=CC1 HGCIXCUEYOPUTN-UHFFFAOYSA-N 0.000 description 4
- 150000002148 esters Chemical class 0.000 description 4
- 239000007800 oxidant agent Substances 0.000 description 4
- RGSFGYAAUTVSQA-UHFFFAOYSA-N pentamethylene Natural products C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 4
- POILWHVDKZOXJZ-ARJAWSKDSA-M (z)-4-oxopent-2-en-2-olate Chemical compound C\C([O-])=C\C(C)=O POILWHVDKZOXJZ-ARJAWSKDSA-M 0.000 description 3
- YEVQZPWSVWZAOB-UHFFFAOYSA-N 2-(bromomethyl)-1-iodo-4-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=C(I)C(CBr)=C1 YEVQZPWSVWZAOB-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 150000001242 acetic acid derivatives Chemical class 0.000 description 3
- 150000007513 acids Chemical class 0.000 description 3
- VONWDASPFIQPDY-UHFFFAOYSA-N dimethyl methylphosphonate Chemical compound COP(C)(=O)OC VONWDASPFIQPDY-UHFFFAOYSA-N 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 235000011007 phosphoric acid Nutrition 0.000 description 3
- 150000003016 phosphoric acids Chemical class 0.000 description 3
- CAWFCZIEFIQKRV-UHFFFAOYSA-N 1,1'-(E)-ethene-1,2-diylbis(4-methoxybenzene) Natural products C1=CC(OC)=CC=C1C=CC1=CC=C(OC)C=C1 CAWFCZIEFIQKRV-UHFFFAOYSA-N 0.000 description 2
- FSWCCQWDVGZMRD-UHFFFAOYSA-N 4-methylcyclohexene Chemical compound CC1CCC=CC1 FSWCCQWDVGZMRD-UHFFFAOYSA-N 0.000 description 2
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- DKPFZGUDAPQIHT-UHFFFAOYSA-N Butyl acetate Natural products CCCCOC(C)=O DKPFZGUDAPQIHT-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 239000005977 Ethylene Substances 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 2
- 125000002837 carbocyclic group Chemical group 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- UCIYGNATMHQYCT-UHFFFAOYSA-N cyclodecene Chemical compound C1CCCCC=CCCC1 UCIYGNATMHQYCT-UHFFFAOYSA-N 0.000 description 2
- PQANGXXSEABURG-UHFFFAOYSA-N cyclohex-2-en-1-ol Chemical compound OC1CCCC=C1 PQANGXXSEABURG-UHFFFAOYSA-N 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- GNTDGMZSJNCJKK-UHFFFAOYSA-N divanadium pentaoxide Chemical compound O=[V](=O)O[V](=O)=O GNTDGMZSJNCJKK-UHFFFAOYSA-N 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- FUZZWVXGSFPDMH-UHFFFAOYSA-N hexanoic acid Chemical compound CCCCCC(O)=O FUZZWVXGSFPDMH-UHFFFAOYSA-N 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- 125000005609 naphthenate group Chemical group 0.000 description 2
- 150000002978 peroxides Chemical class 0.000 description 2
- 150000003009 phosphonic acids Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 229910052720 vanadium Inorganic materials 0.000 description 2
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 2
- BSVZXPLUMFUWHW-OWOJBTEDSA-N (e)-hex-3-enedinitrile Chemical compound N#CC\C=C\CC#N BSVZXPLUMFUWHW-OWOJBTEDSA-N 0.000 description 1
- FSJSYDFBTIVUFD-SUKNRPLKSA-N (z)-4-hydroxypent-3-en-2-one;oxovanadium Chemical compound [V]=O.C\C(O)=C\C(C)=O.C\C(O)=C\C(C)=O FSJSYDFBTIVUFD-SUKNRPLKSA-N 0.000 description 1
- NLOLSXYRJFEOTA-UHFFFAOYSA-N 1,1,1,4,4,4-hexafluorobut-2-ene Chemical group FC(F)(F)C=CC(F)(F)F NLOLSXYRJFEOTA-UHFFFAOYSA-N 0.000 description 1
- PRJNEUBECVAVAG-UHFFFAOYSA-N 1,3-bis(ethenyl)benzene Chemical compound C=CC1=CC=CC(C=C)=C1 PRJNEUBECVAVAG-UHFFFAOYSA-N 0.000 description 1
- WEERVPDNCOGWJF-UHFFFAOYSA-N 1,4-bis(ethenyl)benzene Chemical compound C=CC1=CC=C(C=C)C=C1 WEERVPDNCOGWJF-UHFFFAOYSA-N 0.000 description 1
- KTZVZZJJVJQZHV-UHFFFAOYSA-N 1-chloro-4-ethenylbenzene Chemical group ClC1=CC=C(C=C)C=C1 KTZVZZJJVJQZHV-UHFFFAOYSA-N 0.000 description 1
- OEVVKKAVYQFQNV-UHFFFAOYSA-N 1-ethenyl-2,4-dimethylbenzene Chemical group CC1=CC=C(C=C)C(C)=C1 OEVVKKAVYQFQNV-UHFFFAOYSA-N 0.000 description 1
- JWVTWJNGILGLAT-UHFFFAOYSA-N 1-ethenyl-4-fluorobenzene Chemical group FC1=CC=C(C=C)C=C1 JWVTWJNGILGLAT-UHFFFAOYSA-N 0.000 description 1
- LIKMAJRDDDTEIG-UHFFFAOYSA-N 1-hexene Chemical compound CCCCC=C LIKMAJRDDDTEIG-UHFFFAOYSA-N 0.000 description 1
- 125000004201 2,4-dichlorophenyl group Chemical group [H]C1=C([H])C(*)=C(Cl)C([H])=C1Cl 0.000 description 1
- ZFBUBYLVRDQACY-UHFFFAOYSA-N 3-Phenyl-1-cycloheptene Chemical compound C1=CCCCCC1C1=CC=CC=C1 ZFBUBYLVRDQACY-UHFFFAOYSA-N 0.000 description 1
- OYTBFGDMOREDSZ-UHFFFAOYSA-N 3-fluorocyclohexene Chemical compound FC1CCCC=C1 OYTBFGDMOREDSZ-UHFFFAOYSA-N 0.000 description 1
- OPNSNMMOWIYFLI-UHFFFAOYSA-N 3-fluorocyclopentene Chemical compound FC1CCC=C1 OPNSNMMOWIYFLI-UHFFFAOYSA-N 0.000 description 1
- MWSJZNDJYPNARD-UHFFFAOYSA-N 3-methyldodec-1-ene Chemical compound CCCCCCCCCC(C)C=C MWSJZNDJYPNARD-UHFFFAOYSA-N 0.000 description 1
- IXCFDFOLHPYMRD-UHFFFAOYSA-N 4,5-dichlorocyclohexene Chemical compound ClC1CC=CCC1Cl IXCFDFOLHPYMRD-UHFFFAOYSA-N 0.000 description 1
- WCYLOAZMPHBTCL-UHFFFAOYSA-N 4,6-dichlorocycloheptene Chemical compound ClC1CC=CCC(C1)Cl WCYLOAZMPHBTCL-UHFFFAOYSA-N 0.000 description 1
- YVTVGBJCMXKLCB-UHFFFAOYSA-N 4-[(2-methylpropan-2-yl)oxy]cyclopentene Chemical compound CC(C)(C)OC1CC=CC1 YVTVGBJCMXKLCB-UHFFFAOYSA-N 0.000 description 1
- NCDVDTXDSDVLPL-UHFFFAOYSA-N 4-chlorocyclohexene Chemical compound ClC1CCC=CC1 NCDVDTXDSDVLPL-UHFFFAOYSA-N 0.000 description 1
- 125000004801 4-cyanophenyl group Chemical group [H]C1=C([H])C(C#N)=C([H])C([H])=C1* 0.000 description 1
- OCKRQDBWYBJGDX-UHFFFAOYSA-N 4-ethoxycyclohexene Chemical compound CCOC1CCC=CC1 OCKRQDBWYBJGDX-UHFFFAOYSA-N 0.000 description 1
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 description 1
- QGFLPMBESZASTD-UHFFFAOYSA-N 4-propan-2-yloxycyclohexene Chemical compound CC(C)OC1CCC=CC1 QGFLPMBESZASTD-UHFFFAOYSA-N 0.000 description 1
- RGZRERBANQLHRL-UHFFFAOYSA-N 4-tert-butyl-1-[2-(4-tert-butyl-2-chlorophenyl)ethenyl]-2-chlorobenzene Chemical group ClC1=CC(C(C)(C)C)=CC=C1C=CC1=CC=C(C(C)(C)C)C=C1Cl RGZRERBANQLHRL-UHFFFAOYSA-N 0.000 description 1
- GMJLNPMQAPKCFR-UHFFFAOYSA-N 5-phenylcycloheptene Chemical compound C1CC=CCCC1C1=CC=CC=C1 GMJLNPMQAPKCFR-UHFFFAOYSA-N 0.000 description 1
- OSDWBNJEKMUWAV-UHFFFAOYSA-N Allyl chloride Chemical group ClCC=C OSDWBNJEKMUWAV-UHFFFAOYSA-N 0.000 description 1
- WTNYDLAFEPHCFW-UHFFFAOYSA-N C(CC1)CCC=CCCCCC1C1=CC=CC=C1 Chemical compound C(CC1)CCC=CCCCCC1C1=CC=CC=C1 WTNYDLAFEPHCFW-UHFFFAOYSA-N 0.000 description 1
- QKXPKVWRIIEXID-UHFFFAOYSA-N CC(C)CCCCC(C)CCC(C)C=C Chemical compound CC(C)CCCCC(C)CCC(C)C=C QKXPKVWRIIEXID-UHFFFAOYSA-N 0.000 description 1
- KHMOSTOJEIONMJ-UHFFFAOYSA-N CCCOC(C1CCCC=CCCCC1)=O Chemical compound CCCOC(C1CCCC=CCCCC1)=O KHMOSTOJEIONMJ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- YYLLIJHXUHJATK-UHFFFAOYSA-N Cyclohexyl acetate Chemical compound CC(=O)OC1CCCCC1 YYLLIJHXUHJATK-UHFFFAOYSA-N 0.000 description 1
- UCNVFOCBFJOQAL-UHFFFAOYSA-N DDE Chemical group C=1C=C(Cl)C=CC=1C(=C(Cl)Cl)C1=CC=C(Cl)C=C1 UCNVFOCBFJOQAL-UHFFFAOYSA-N 0.000 description 1
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 description 1
- SXRSQZLOMIGNAQ-UHFFFAOYSA-N Glutaraldehyde Chemical compound O=CCCCC=O SXRSQZLOMIGNAQ-UHFFFAOYSA-N 0.000 description 1
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 1
- IVTHXIVYHHBDNH-UHFFFAOYSA-N OC(CC=CCCCCCCC1)C1Cl Chemical compound OC(CC=CCCCCCCC1)C1Cl IVTHXIVYHHBDNH-UHFFFAOYSA-N 0.000 description 1
- 229910021536 Zeolite Inorganic materials 0.000 description 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 1
- HZPMQTGECAAKST-UHFFFAOYSA-K [V+3].CC([O-])=O.CC([O-])=O.CC([O-])=O Chemical compound [V+3].CC([O-])=O.CC([O-])=O.CC([O-])=O HZPMQTGECAAKST-UHFFFAOYSA-K 0.000 description 1
- JJKOMVAGGBIZNW-UHFFFAOYSA-K [W+3].CC([O-])=O.CC([O-])=O.CC([O-])=O Chemical compound [W+3].CC([O-])=O.CC([O-])=O.CC([O-])=O JJKOMVAGGBIZNW-UHFFFAOYSA-K 0.000 description 1
- UCYXRZPFJJBQDL-UHFFFAOYSA-N acetic acid;molybdenum Chemical compound [Mo].[Mo].CC(O)=O.CC(O)=O.CC(O)=O.CC(O)=O UCYXRZPFJJBQDL-UHFFFAOYSA-N 0.000 description 1
- 125000005595 acetylacetonate group Chemical group 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- WYYQVWLEPYFFLP-UHFFFAOYSA-K chromium(3+);triacetate Chemical compound [Cr+3].CC([O-])=O.CC([O-])=O.CC([O-])=O WYYQVWLEPYFFLP-UHFFFAOYSA-K 0.000 description 1
- 239000012084 conversion product Substances 0.000 description 1
- 230000007797 corrosion Effects 0.000 description 1
- 238000005260 corrosion Methods 0.000 description 1
- MLFPQCBUOCQCHT-UHFFFAOYSA-N cyclohept-4-en-1-ol Chemical compound OC1CCC=CCC1 MLFPQCBUOCQCHT-UHFFFAOYSA-N 0.000 description 1
- HWDJEYOUABWZCM-UHFFFAOYSA-N cyclohept-4-ene-1,2-diol Chemical compound OC1CCC=CCC1O HWDJEYOUABWZCM-UHFFFAOYSA-N 0.000 description 1
- ZXIJMRYMVAMXQP-UHFFFAOYSA-N cycloheptene Chemical compound C1CCC=CCC1 ZXIJMRYMVAMXQP-UHFFFAOYSA-N 0.000 description 1
- XPCJYQUUKUVAMI-UHFFFAOYSA-N cyclohex-2-ene-1-carbaldehyde Chemical compound O=CC1CCCC=C1 XPCJYQUUKUVAMI-UHFFFAOYSA-N 0.000 description 1
- FPQOEJPNPFCPNQ-UHFFFAOYSA-N cyclohex-4-ene-1,3-diol Chemical compound OC1CC=CC(O)C1 FPQOEJPNPFCPNQ-UHFFFAOYSA-N 0.000 description 1
- URYYVOIYTNXXBN-UPHRSURJSA-N cyclooctene Chemical compound C1CCC\C=C/CC1 URYYVOIYTNXXBN-UPHRSURJSA-N 0.000 description 1
- 239000004913 cyclooctene Substances 0.000 description 1
- JCHHHZHRUTYDLD-UHFFFAOYSA-N cyclopent-3-ene-1-carbonitrile Chemical compound N#CC1CC=CC1 JCHHHZHRUTYDLD-UHFFFAOYSA-N 0.000 description 1
- 125000002433 cyclopentenyl group Chemical group C1(=CCCC1)* 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- WMWXXXSCZVGQAR-UHFFFAOYSA-N dialuminum;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3] WMWXXXSCZVGQAR-UHFFFAOYSA-N 0.000 description 1
- HNPSIPDUKPIQMN-UHFFFAOYSA-N dioxosilane;oxo(oxoalumanyloxy)alumane Chemical compound O=[Si]=O.O=[Al]O[Al]=O HNPSIPDUKPIQMN-UHFFFAOYSA-N 0.000 description 1
- 238000004090 dissolution Methods 0.000 description 1
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000004880 explosion Methods 0.000 description 1
- 239000012527 feed solution Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 239000007792 gaseous phase Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000007210 heterogeneous catalysis Methods 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- JYJVVHFRSFVEJM-UHFFFAOYSA-N iodosobenzene Chemical compound O=IC1=CC=CC=C1 JYJVVHFRSFVEJM-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- ACKFDYCQCBEDNU-UHFFFAOYSA-J lead(2+);tetraacetate Chemical compound [Pb+2].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O ACKFDYCQCBEDNU-UHFFFAOYSA-J 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- IIUSKJYCNFLTOO-UHFFFAOYSA-N methyl cyclododec-2-ene-1-carboxylate Chemical compound COC(=O)C1CCCCCCCCCC=C1 IIUSKJYCNFLTOO-UHFFFAOYSA-N 0.000 description 1
- 150000004702 methyl esters Chemical class 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 239000005078 molybdenum compound Substances 0.000 description 1
- 150000002752 molybdenum compounds Chemical class 0.000 description 1
- WKEZHBQACHILEC-UHFFFAOYSA-N molybdenum(3+) Chemical compound [Mo+3] WKEZHBQACHILEC-UHFFFAOYSA-N 0.000 description 1
- HUOURESLNDTPFO-UHFFFAOYSA-K molybdenum(3+) triacetate Chemical compound [Mo+3].CC([O-])=O.CC([O-])=O.CC([O-])=O HUOURESLNDTPFO-UHFFFAOYSA-K 0.000 description 1
- UVBOWHBSXHFLSU-UHFFFAOYSA-K molybdenum(3+) tribenzoate Chemical compound [Mo+3].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 UVBOWHBSXHFLSU-UHFFFAOYSA-K 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- PXHVJJICTQNCMI-UHFFFAOYSA-N nickel Substances [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 1
- LDPWMGUFXYRDRG-UHFFFAOYSA-I niobium(5+) pentaacetate Chemical compound [Nb+5].CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O.CC([O-])=O LDPWMGUFXYRDRG-UHFFFAOYSA-I 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 239000012457 nonaqueous media Substances 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000006384 oligomerization reaction Methods 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 150000002902 organometallic compounds Chemical class 0.000 description 1
- 239000012285 osmium tetroxide Substances 0.000 description 1
- 229910000489 osmium tetroxide Inorganic materials 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000000913 palmityl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002958 pentadecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- YWAKXRMUMFPDSH-UHFFFAOYSA-N pentene Chemical compound CCCC=C YWAKXRMUMFPDSH-UHFFFAOYSA-N 0.000 description 1
- QMMOXUPEWRXHJS-UHFFFAOYSA-N pentene-2 Natural products CCC=CC QMMOXUPEWRXHJS-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- KHIWWQKSHDUIBK-UHFFFAOYSA-N periodic acid Chemical compound OI(=O)(=O)=O KHIWWQKSHDUIBK-UHFFFAOYSA-N 0.000 description 1
- 125000000843 phenylene group Chemical group C1(=C(C=CC=C1)*)* 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000004344 phenylpropyl group Chemical group 0.000 description 1
- 150000003008 phosphonic acid esters Chemical class 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229910001927 ruthenium tetroxide Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011550 stock solution Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- PJANXHGTPQOBST-UHFFFAOYSA-N trans-Stilbene Natural products C=1C=CC=CC=1C=CC1=CC=CC=C1 PJANXHGTPQOBST-UHFFFAOYSA-N 0.000 description 1
- IAQRGUVFOMOMEM-ONEGZZNKSA-N trans-but-2-ene Chemical compound C\C=C\C IAQRGUVFOMOMEM-ONEGZZNKSA-N 0.000 description 1
- PJANXHGTPQOBST-VAWYXSNFSA-N trans-stilbene Chemical group C=1C=CC=CC=1/C=C/C1=CC=CC=C1 PJANXHGTPQOBST-VAWYXSNFSA-N 0.000 description 1
- DQWPFSLDHJDLRL-UHFFFAOYSA-N triethyl phosphate Chemical compound CCOP(=O)(OCC)OCC DQWPFSLDHJDLRL-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 125000002948 undecyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- BLSRSXLJVJVBIK-UHFFFAOYSA-N vanadium(2+) Chemical compound [V+2] BLSRSXLJVJVBIK-UHFFFAOYSA-N 0.000 description 1
- FZVZKKLCQTZRTJ-UHFFFAOYSA-L vanadium(2+);diacetate Chemical compound [V+2].CC([O-])=O.CC([O-])=O FZVZKKLCQTZRTJ-UHFFFAOYSA-L 0.000 description 1
- MHZBDMUSONZIIF-UHFFFAOYSA-L vanadium(2+);dibenzoate Chemical compound [V+2].[O-]C(=O)C1=CC=CC=C1.[O-]C(=O)C1=CC=CC=C1 MHZBDMUSONZIIF-UHFFFAOYSA-L 0.000 description 1
- 125000005287 vanadyl group Chemical group 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000010457 zeolite Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/28—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of CHx-moieties
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/03—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by addition of hydroxy groups to unsaturated carbon-to-carbon bonds, e.g. with the aid of H2O2
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C35/00—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a ring other than a six-membered aromatic ring
- C07C35/02—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a ring other than a six-membered aromatic ring monocyclic
- C07C35/06—Compounds having at least one hydroxy or O-metal group bound to a carbon atom of a ring other than a six-membered aromatic ring monocyclic containing a five-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07B—GENERAL METHODS OF ORGANIC CHEMISTRY; APPARATUS THEREFOR
- C07B2200/00—Indexing scheme relating to specific properties of organic compounds
- C07B2200/09—Geometrical isomers
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/06—Systems containing only non-condensed rings with a five-membered ring
- C07C2601/08—Systems containing only non-condensed rings with a five-membered ring the ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2201456A DE2201456C3 (de) | 1972-01-13 | 1972-01-13 | Verfahren zur Herstellung von Aldehyden und Diolen |
| JP48005363A JPS5130043B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1972-01-13 | 1973-01-10 | |
| NL7300418A NL7300418A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1972-01-13 | 1973-01-11 | |
| BE793899D BE793899A (fr) | 1972-01-13 | 1973-01-11 | Procede de preparation d'aldehydes et de diols |
| AT22473A AT324292B (de) | 1972-01-13 | 1973-01-11 | Verfahren zur gleichzeitigen herstellung von aldehyden und diolen |
| CH37473A CH576407A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1972-01-13 | 1973-01-11 | |
| IT47613/73A IT976822B (it) | 1972-01-13 | 1973-01-11 | Procedimento per produrre aldeidi e dioli |
| FR7301183A FR2168082B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1972-01-13 | 1973-01-12 | |
| GB179373A GB1403854A (en) | 1972-01-13 | 1973-01-12 | Process for the production of aldehydes and diols |
| US06/009,019 US4293717A (en) | 1972-01-13 | 1979-02-05 | Process for preparing aldehydes and diols |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2201456A DE2201456C3 (de) | 1972-01-13 | 1972-01-13 | Verfahren zur Herstellung von Aldehyden und Diolen |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2201456A1 DE2201456A1 (de) | 1973-07-19 |
| DE2201456B2 DE2201456B2 (de) | 1980-03-27 |
| DE2201456C3 true DE2201456C3 (de) | 1980-11-27 |
Family
ID=5832889
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2201456A Expired DE2201456C3 (de) | 1972-01-13 | 1972-01-13 | Verfahren zur Herstellung von Aldehyden und Diolen |
Country Status (10)
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS55136267U (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1979-03-22 | 1980-09-27 | ||
| IT1187738B (it) * | 1985-09-09 | 1987-12-23 | Interox Sa | Procedimento per la produzione di composti aldeidici o chetonici e aldeidi e chetoni ottenuti mediante questo procedimento |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2808429A (en) * | 1954-08-12 | 1957-10-01 | Allied Chem & Dye Corp | Synthesis of carbonyl compounds |
| NL266182A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1960-07-01 | |||
| DE2252674C3 (de) * | 1972-10-27 | 1981-02-05 | Bayer Ag, 5090 Leverkusen | Verfahren zur Herstellung von Aldehyden aus Olefinen |
-
1972
- 1972-01-13 DE DE2201456A patent/DE2201456C3/de not_active Expired
-
1973
- 1973-01-10 JP JP48005363A patent/JPS5130043B2/ja not_active Expired
- 1973-01-11 CH CH37473A patent/CH576407A5/xx not_active IP Right Cessation
- 1973-01-11 IT IT47613/73A patent/IT976822B/it active
- 1973-01-11 BE BE793899D patent/BE793899A/xx not_active IP Right Cessation
- 1973-01-11 AT AT22473A patent/AT324292B/de not_active IP Right Cessation
- 1973-01-11 NL NL7300418A patent/NL7300418A/xx not_active Application Discontinuation
- 1973-01-12 FR FR7301183A patent/FR2168082B1/fr not_active Expired
- 1973-01-12 GB GB179373A patent/GB1403854A/en not_active Expired
-
1979
- 1979-02-05 US US06/009,019 patent/US4293717A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| BE793899A (fr) | 1973-07-11 |
| US4293717A (en) | 1981-10-06 |
| DE2201456A1 (de) | 1973-07-19 |
| FR2168082B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-02-10 |
| DE2201456B2 (de) | 1980-03-27 |
| GB1403854A (en) | 1975-08-28 |
| IT976822B (it) | 1974-09-10 |
| CH576407A5 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1976-06-15 |
| JPS5130043B2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1976-08-30 |
| JPS48103503A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1973-12-25 |
| NL7300418A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1973-07-17 |
| FR2168082A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1973-08-24 |
| AT324292B (de) | 1975-08-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE851496C (de) | Verfahren zur Herstellung symmetrischer oder unsymmetrischer aliphatischer, ditertiaerer Peroxyde | |
| DE3338340A1 (de) | Hydroformylierungsverfahren | |
| DE2600541C3 (de) | Verfahren zur Herstellung von Phenylbrenztraubensäure oder Arylbrenztraubensäuren | |
| DE2526381B2 (de) | Verfahren zur Herstellung von Glykolsäure oder deren Gemische mit Diglykolsäure | |
| DE2446830C3 (de) | Verfahren zur Epoxydation von Olefinen | |
| DE2252674C3 (de) | Verfahren zur Herstellung von Aldehyden aus Olefinen | |
| DE2824856A1 (de) | Verfahren zur herstellung von 2-aryl-c tief 3 - bis c tief 6 -alkancarbonsaeureestern | |
| DE2928002A1 (de) | Verfahren zur herstellung von isobuttersaeure | |
| DE2605041C3 (de) | Verfahren zur Epoxydation von Olefinen | |
| DE2201456C3 (de) | Verfahren zur Herstellung von Aldehyden und Diolen | |
| DE2616934A1 (de) | Verfahren zur epoxidierung von olefinen | |
| DE2803757C3 (de) | Verfahren zur Epoxidation von Olefinen in Anwesenheit eines Katalysators auf Arsenbasis | |
| DE2443142C2 (de) | Verfahren zur Herstellung von Cyclopropancarbonsäurenitril | |
| DE2949847C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| EP0079432B1 (de) | Verfahren zur Herstellung von Methacrylsäure aus Isobutyraldehyd | |
| EP0090977B2 (de) | Verfahren zur Herstellung von Kohlensäureestern | |
| DE2201455C3 (de) | Verfahren zur Herstellung von Aldehyden | |
| EP0074009B1 (de) | Verfahren zur Herstellung von Tetramethyloxiran | |
| EP0196088B1 (de) | Verfahren zur Herstellung von Verbindungen mit mehrfach durch Chlor substituiertem Alkylrest | |
| DE1518997C3 (de) | Verfahren zur Herstellung von Epoxiden | |
| DE933337C (de) | Verfahren zur Herstellung von Alkoholen | |
| DE2428559C3 (de) | Verfahren zur Epoxydation von olefinischen Verbindungen | |
| EP0564979B1 (de) | Verfahren zur Herstellung von Dixylylpropan | |
| DE1668251C3 (de) | Verfahren zur Herstellung Allylalkohol aus Propylen | |
| DE2128978A1 (de) | Verfahren zur Herstellung von Olefinoxyden |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |