DE2201432C2 - Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende Herbizide - Google Patents
Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende HerbizideInfo
- Publication number
- DE2201432C2 DE2201432C2 DE2201432A DE2201432A DE2201432C2 DE 2201432 C2 DE2201432 C2 DE 2201432C2 DE 2201432 A DE2201432 A DE 2201432A DE 2201432 A DE2201432 A DE 2201432A DE 2201432 C2 DE2201432 C2 DE 2201432C2
- Authority
- DE
- Germany
- Prior art keywords
- glycolic acid
- weight
- anllld
- parts
- sec
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004009 herbicide Substances 0.000 title description 4
- 239000004480 active ingredient Substances 0.000 description 35
- 150000001875 compounds Chemical class 0.000 description 15
- 235000010469 Glycine max Nutrition 0.000 description 13
- 244000062793 Sorghum vulgare Species 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 13
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 12
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 12
- 239000000243 solution Substances 0.000 description 12
- 230000002363 herbicidal effect Effects 0.000 description 11
- -1 η-butyl Chemical group 0.000 description 11
- 241000335053 Beta vulgaris Species 0.000 description 10
- 241000196324 Embryophyta Species 0.000 description 9
- 240000008042 Zea mays Species 0.000 description 9
- 235000019713 millet Nutrition 0.000 description 9
- 244000292693 Poa annua Species 0.000 description 8
- IAQRGUVFOMOMEM-UHFFFAOYSA-N butene Natural products CC=CC IAQRGUVFOMOMEM-UHFFFAOYSA-N 0.000 description 8
- 244000058871 Echinochloa crus-galli Species 0.000 description 7
- 241000219146 Gossypium Species 0.000 description 7
- 244000038559 crop plants Species 0.000 description 7
- 239000000203 mixture Substances 0.000 description 7
- VXNZUUAINFGPBY-UHFFFAOYSA-N 1-Butene Chemical compound CCC=C VXNZUUAINFGPBY-UHFFFAOYSA-N 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- 235000021533 Beta vulgaris Nutrition 0.000 description 6
- 244000299507 Gossypium hirsutum Species 0.000 description 6
- 235000009432 Gossypium hirsutum Nutrition 0.000 description 6
- 235000011999 Panicum crusgalli Nutrition 0.000 description 6
- 235000007244 Zea mays Nutrition 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 5
- 244000100545 Lolium multiflorum Species 0.000 description 5
- 244000042664 Matricaria chamomilla Species 0.000 description 5
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 5
- 239000013543 active substance Substances 0.000 description 5
- 241000743985 Alopecurus Species 0.000 description 4
- 240000001592 Amaranthus caudatus Species 0.000 description 4
- 235000016068 Berberis vulgaris Nutrition 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- 244000152970 Digitaria sanguinalis Species 0.000 description 4
- 235000010823 Digitaria sanguinalis Nutrition 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 241000287828 Gallus gallus Species 0.000 description 4
- 244000068988 Glycine max Species 0.000 description 4
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 4
- 241001355178 Setaria faberi Species 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 4
- 241001233037 catfish Species 0.000 description 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 3
- 240000002791 Brassica napus Species 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 235000014716 Eleusine indica Nutrition 0.000 description 3
- 244000025670 Eleusine indica Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 235000010582 Pisum sativum Nutrition 0.000 description 3
- 240000004713 Pisum sativum Species 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- 235000005775 Setaria Nutrition 0.000 description 3
- 241000232088 Setaria <nematode> Species 0.000 description 3
- 241000862632 Soja Species 0.000 description 3
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 3
- 244000300264 Spinacia oleracea Species 0.000 description 3
- 235000009337 Spinacia oleracea Nutrition 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 241000209140 Triticum Species 0.000 description 3
- 235000021307 Triticum Nutrition 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 239000004359 castor oil Substances 0.000 description 3
- 235000019438 castor oil Nutrition 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000000839 emulsion Substances 0.000 description 3
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 3
- 210000001699 lower leg Anatomy 0.000 description 3
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000002689 soil Substances 0.000 description 3
- 241000894007 species Species 0.000 description 3
- 239000007921 spray Substances 0.000 description 3
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 241001621841 Alopecurus myosuroides Species 0.000 description 2
- 241000219318 Amaranthus Species 0.000 description 2
- 235000007320 Avena fatua Nutrition 0.000 description 2
- 235000011293 Brassica napus Nutrition 0.000 description 2
- 244000025254 Cannabis sativa Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 235000007866 Chamaemelum nobile Nutrition 0.000 description 2
- 241000219312 Chenopodium Species 0.000 description 2
- 240000006122 Chenopodium album Species 0.000 description 2
- 235000009438 Gossypium Nutrition 0.000 description 2
- 241000208818 Helianthus Species 0.000 description 2
- 241000520028 Lamium Species 0.000 description 2
- 241000209082 Lolium Species 0.000 description 2
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 2
- 240000007594 Oryza sativa Species 0.000 description 2
- 241000209048 Poa Species 0.000 description 2
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 244000152045 Themeda triandra Species 0.000 description 2
- 241000219793 Trifolium Species 0.000 description 2
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- YUDRVAHLXDBKSR-UHFFFAOYSA-N [CH]1CCCCC1 Chemical compound [CH]1CCCCC1 YUDRVAHLXDBKSR-UHFFFAOYSA-N 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- 239000008280 blood Substances 0.000 description 2
- 210000004369 blood Anatomy 0.000 description 2
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 description 2
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 239000008187 granular material Substances 0.000 description 2
- 150000002430 hydrocarbons Chemical class 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 125000004435 hydrogen atom Chemical class [H]* 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 235000009973 maize Nutrition 0.000 description 2
- 125000006261 methyl amino sulfonyl group Chemical group [H]N(C([H])([H])[H])S(*)(=O)=O 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- 239000002994 raw material Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 2
- NFAOATPOYUWEHM-UHFFFAOYSA-N 2-(6-methylheptyl)phenol Chemical compound CC(C)CCCCCC1=CC=CC=C1O NFAOATPOYUWEHM-UHFFFAOYSA-N 0.000 description 1
- WBIQQQGBSDOWNP-UHFFFAOYSA-N 2-dodecylbenzenesulfonic acid Chemical compound CCCCCCCCCCCCC1=CC=CC=C1S(O)(=O)=O WBIQQQGBSDOWNP-UHFFFAOYSA-N 0.000 description 1
- PJFNNMFXEVADGK-UHFFFAOYSA-N 2-hydroxy-n-phenylacetamide Chemical compound OCC(=O)NC1=CC=CC=C1 PJFNNMFXEVADGK-UHFFFAOYSA-N 0.000 description 1
- 235000005255 Allium cepa Nutrition 0.000 description 1
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000209764 Avena fatua Species 0.000 description 1
- 244000075850 Avena orientalis Species 0.000 description 1
- 241000219198 Brassica Species 0.000 description 1
- 235000003351 Brassica cretica Nutrition 0.000 description 1
- 240000007124 Brassica oleracea Species 0.000 description 1
- 235000000540 Brassica rapa subsp rapa Nutrition 0.000 description 1
- 235000003343 Brassica rupestris Nutrition 0.000 description 1
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- 241001148727 Bromus tectorum Species 0.000 description 1
- 241000282836 Camelus dromedarius Species 0.000 description 1
- 235000009344 Chenopodium album Nutrition 0.000 description 1
- 235000011498 Chenopodium album var missouriense Nutrition 0.000 description 1
- 235000013328 Chenopodium album var. album Nutrition 0.000 description 1
- 235000014052 Chenopodium album var. microphyllum Nutrition 0.000 description 1
- 235000014050 Chenopodium album var. stevensii Nutrition 0.000 description 1
- 235000013012 Chenopodium album var. striatum Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 101100102516 Clonostachys rogersoniana vern gene Proteins 0.000 description 1
- 240000008067 Cucumis sativus Species 0.000 description 1
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 244000000626 Daucus carota Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 241000209219 Hordeum Species 0.000 description 1
- 240000005979 Hordeum vulgare Species 0.000 description 1
- 235000007340 Hordeum vulgare Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 241000208822 Lactuca Species 0.000 description 1
- 235000003228 Lactuca sativa Nutrition 0.000 description 1
- 240000008415 Lactuca sativa Species 0.000 description 1
- 241000208202 Linaceae Species 0.000 description 1
- 241000208204 Linum Species 0.000 description 1
- 235000004431 Linum usitatissimum Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000209094 Oryza Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 241001520808 Panicum virgatum Species 0.000 description 1
- 239000005662 Paraffin oil Substances 0.000 description 1
- 244000062780 Petroselinum sativum Species 0.000 description 1
- 241000219833 Phaseolus Species 0.000 description 1
- 235000010627 Phaseolus vulgaris Nutrition 0.000 description 1
- 244000046052 Phaseolus vulgaris Species 0.000 description 1
- 240000006597 Poa trivialis Species 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 244000061456 Solanum tuberosum Species 0.000 description 1
- 235000005373 Uvularia sessilifolia Nutrition 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- FOCAUTSVDIKZOP-UHFFFAOYSA-N chloroacetic acid Chemical compound OC(=O)CCl FOCAUTSVDIKZOP-UHFFFAOYSA-N 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- XNMQEEKYCVKGBD-UHFFFAOYSA-N dimethylacetylene Natural products CC#CC XNMQEEKYCVKGBD-UHFFFAOYSA-N 0.000 description 1
- 238000009826 distribution Methods 0.000 description 1
- 229940060296 dodecylbenzenesulfonic acid Drugs 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000000428 dust Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 238000000227 grinding Methods 0.000 description 1
- 125000000623 heterocyclic group Chemical group 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 235000010460 mustard Nutrition 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 230000003472 neutralizing effect Effects 0.000 description 1
- ZQPPMHVWECSIRJ-KTKRTIGZSA-N oleic acid group Chemical group C(CCCCCCC\C=C/CCCCCCCC)(=O)O ZQPPMHVWECSIRJ-KTKRTIGZSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 235000011197 perejil Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-L sulfite Chemical compound [O-]S([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-L 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C307/00—Amides of sulfuric acids, i.e. compounds having singly-bound oxygen atoms of sulfate groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C307/02—Monoamides of sulfuric acids or esters thereof, e.g. sulfamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (30)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| BE794013D BE794013A (fr) | 1972-01-13 | Anilides d'acide o-(aminosulfonyl)-glycolique substitues | |
| DE2201432A DE2201432C2 (de) | 1972-01-13 | 1972-01-13 | Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende Herbizide |
| PL1972159930A PL78984B1 (enExample) | 1972-01-13 | 1972-12-29 | |
| IL41216A IL41216A (en) | 1972-01-13 | 1973-01-01 | Anilides 0-) Aminosulfonyl (- Transformed glycols and herbicidal preparations containing them |
| TR17278A TR17278A (tr) | 1972-01-13 | 1973-01-04 | Suebstituee o/aminosulfonil/-glikolik asit anilidleri |
| US321548A US3870740A (en) | 1972-01-13 | 1973-01-05 | Substituted O-(aminosulfonyl)-glycolic anilides |
| AU50800/73A AU472352B2 (en) | 1972-01-13 | 1973-01-05 | Substituted o-[aminosulfonyl] glycolic anilides |
| CH15073A CH575712A5 (enExample) | 1972-01-13 | 1973-01-08 | |
| JP499473A JPS5635162B2 (enExample) | 1972-01-13 | 1973-01-09 | |
| IT47600/73A IT976809B (it) | 1972-01-13 | 1973-01-10 | Anilidi dell acido o ammino solfonil glicolico sostituite |
| SU731870088A SU708977A3 (ru) | 1972-01-13 | 1973-01-11 | Гербицидное средство |
| NL7300422A NL7300422A (enExample) | 1972-01-13 | 1973-01-11 | |
| HUBA2850A HU165488B (enExample) | 1972-01-13 | 1973-01-11 | |
| DD168205A DD104171A5 (enExample) | 1972-01-13 | 1973-01-11 | |
| AR246098A AR195814A1 (es) | 1972-01-13 | 1973-01-12 | Anilidas sustituidas del acido 0-<aminosulfonil>-glicolico utiles como herbicidas |
| DK17873A DK134042C (da) | 1972-01-13 | 1973-01-12 | Herbicid |
| GB171173A GB1407114A (en) | 1972-01-13 | 1973-01-12 | Substituted o- aminosulphonyl -glycoil anilides |
| BG022437A BG22788A3 (bg) | 1972-01-13 | 1973-01-12 | Хербицидно средство |
| OA54808A OA04316A (fr) | 1972-01-13 | 1973-01-12 | Anilides d'acides o-( aminosulfonyl ) -glycolique substitués. |
| CA161,100A CA1001642A (en) | 1972-01-13 | 1973-01-12 | Substituted 0- (aminosulfonyl)-glycolic anilides |
| BR73274A BR7300274D0 (pt) | 1972-01-13 | 1973-01-12 | Processo para fabricar uma aperfeicoada composicao herbicida e processo para simultaneamente combater ervas daninhas e mildio e respectivamente efetuar uma fito-regulacao |
| BR73284A BR7300284D0 (pt) | 1972-01-13 | 1973-01-12 | Composicoes herbicidas e processo para preparacao de novas o-(amino-sulfonil) anilidas de acido glicolico nelas aplicaveis |
| FR7301025A FR2168009B1 (enExample) | 1972-01-13 | 1973-01-12 | |
| ZA730264A ZA73264B (en) | 1972-01-13 | 1973-01-12 | Substituted o-(aminosulfonyl)-glycolic anilides |
| AT25773A AT322276B (de) | 1972-01-13 | 1973-01-12 | Herbizid |
| CS73289A CS192459B2 (en) | 1972-01-13 | 1973-01-12 | Herbicide means and method of production of active substances |
| US05/502,741 US3954827A (en) | 1972-01-13 | 1974-09-03 | Substituted o-[aminosulfonyl]-glycolic anilides |
| US502742A US3919282A (en) | 1972-01-13 | 1974-09-03 | Substituted O-(aminosulfonyl)-glycolic anilides |
| US502746A US3925439A (en) | 1972-01-13 | 1974-09-03 | Substituted O-(aminosulfonyl)-glycolic anilides |
| US502740A US3929454A (en) | 1972-01-13 | 1974-09-03 | Substituted O-{8 aminosulfonyl{9 -glycolic anilides herbicides |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2201432A DE2201432C2 (de) | 1972-01-13 | 1972-01-13 | Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende Herbizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2201432A1 DE2201432A1 (de) | 1973-07-19 |
| DE2201432C2 true DE2201432C2 (de) | 1983-11-03 |
Family
ID=5832870
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE2201432A Expired DE2201432C2 (de) | 1972-01-13 | 1972-01-13 | Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende Herbizide |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3870740A (enExample) |
| JP (1) | JPS5635162B2 (enExample) |
| AR (1) | AR195814A1 (enExample) |
| AT (1) | AT322276B (enExample) |
| AU (1) | AU472352B2 (enExample) |
| BE (1) | BE794013A (enExample) |
| BG (1) | BG22788A3 (enExample) |
| BR (2) | BR7300274D0 (enExample) |
| CA (1) | CA1001642A (enExample) |
| CH (1) | CH575712A5 (enExample) |
| CS (1) | CS192459B2 (enExample) |
| DD (1) | DD104171A5 (enExample) |
| DE (1) | DE2201432C2 (enExample) |
| DK (1) | DK134042C (enExample) |
| FR (1) | FR2168009B1 (enExample) |
| GB (1) | GB1407114A (enExample) |
| HU (1) | HU165488B (enExample) |
| IL (1) | IL41216A (enExample) |
| IT (1) | IT976809B (enExample) |
| NL (1) | NL7300422A (enExample) |
| OA (1) | OA04316A (enExample) |
| PL (1) | PL78984B1 (enExample) |
| SU (1) | SU708977A3 (enExample) |
| TR (1) | TR17278A (enExample) |
| ZA (1) | ZA73264B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2417764A1 (de) * | 1974-04-11 | 1975-10-30 | Basf Ag | O-aminosulfonyl-glykolsaeureanilide |
| DE2431582A1 (de) * | 1974-07-01 | 1976-01-22 | Basf Ag | O-aminosulfonyl-glykolsaeureamide |
| DE2453908A1 (de) * | 1974-11-14 | 1976-05-26 | Basf Ag | Herbizide mischungen |
| US4209317A (en) * | 1974-11-18 | 1980-06-24 | Basf Aktiengesellschaft | Herbicidal compositions |
| US4140519A (en) * | 1974-11-18 | 1979-02-20 | Basf Aktiengesellschaft | Herbicidal compositions |
| DE2458972A1 (de) * | 1974-12-13 | 1976-06-16 | Basf Ag | Substituierte o-alkylsulfonylglykolsaeureanilide |
| US4264520A (en) * | 1974-12-13 | 1981-04-28 | Basf Aktiengesellschaft | Substituted O-alkylsulfonylglycolic acid anilides |
| DE2852274A1 (de) * | 1978-12-02 | 1980-06-19 | Basf Ag | Verfahren zur herstellung von sulfamidsaeurehalogeniden |
| JPS5592366A (en) * | 1978-12-28 | 1980-07-12 | Hokko Chem Ind Co Ltd | O-sulfamoylglycolic acid amide derivative |
| DE2904490A1 (de) * | 1979-02-07 | 1980-08-21 | Bayer Ag | Verfahren zur herstellung von alpha -hydroxycarbonsaeureamiden |
| DE3038598A1 (de) * | 1980-10-13 | 1982-05-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von (alpha)-hydroxy-carbonsaeureamiden, neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE19504225A1 (de) * | 1995-02-09 | 1996-08-14 | Hoechst Ag | Verfahren zur Herstellung von O-Acyloxycarbonsäureaniliden |
| DE19933936A1 (de) | 1999-07-20 | 2001-01-25 | Bayer Ag | Substituierte Heteroaryloxyacetanilide |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3536721A (en) * | 1963-09-13 | 1970-10-27 | Stauffer Chemical Co | Substituted-sulfonyl glycolamide compositions |
-
0
- BE BE794013D patent/BE794013A/xx not_active IP Right Cessation
-
1972
- 1972-01-13 DE DE2201432A patent/DE2201432C2/de not_active Expired
- 1972-12-29 PL PL1972159930A patent/PL78984B1/pl unknown
-
1973
- 1973-01-01 IL IL41216A patent/IL41216A/en unknown
- 1973-01-04 TR TR17278A patent/TR17278A/xx unknown
- 1973-01-05 AU AU50800/73A patent/AU472352B2/en not_active Expired
- 1973-01-05 US US321548A patent/US3870740A/en not_active Expired - Lifetime
- 1973-01-08 CH CH15073A patent/CH575712A5/xx not_active IP Right Cessation
- 1973-01-09 JP JP499473A patent/JPS5635162B2/ja not_active Expired
- 1973-01-10 IT IT47600/73A patent/IT976809B/it active
- 1973-01-11 DD DD168205A patent/DD104171A5/xx unknown
- 1973-01-11 HU HUBA2850A patent/HU165488B/hu unknown
- 1973-01-11 NL NL7300422A patent/NL7300422A/xx not_active Application Discontinuation
- 1973-01-11 SU SU731870088A patent/SU708977A3/ru active
- 1973-01-12 AR AR246098A patent/AR195814A1/es active
- 1973-01-12 AT AT25773A patent/AT322276B/de active
- 1973-01-12 GB GB171173A patent/GB1407114A/en not_active Expired
- 1973-01-12 BR BR73274A patent/BR7300274D0/pt unknown
- 1973-01-12 DK DK17873A patent/DK134042C/da active
- 1973-01-12 ZA ZA730264A patent/ZA73264B/xx unknown
- 1973-01-12 BG BG022437A patent/BG22788A3/xx unknown
- 1973-01-12 CA CA161,100A patent/CA1001642A/en not_active Expired
- 1973-01-12 CS CS73289A patent/CS192459B2/cs unknown
- 1973-01-12 FR FR7301025A patent/FR2168009B1/fr not_active Expired
- 1973-01-12 BR BR73284A patent/BR7300284D0/pt unknown
- 1973-01-12 OA OA54808A patent/OA04316A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| NICHTS-ERMITTELT |
Also Published As
| Publication number | Publication date |
|---|---|
| CH575712A5 (enExample) | 1976-05-31 |
| DE2201432A1 (de) | 1973-07-19 |
| GB1407114A (en) | 1975-09-24 |
| BR7300274D0 (pt) | 1973-09-25 |
| CA1001642A (en) | 1976-12-14 |
| PL78984B1 (enExample) | 1975-06-30 |
| US3870740A (en) | 1975-03-11 |
| DK134042B (da) | 1976-09-06 |
| FR2168009A1 (enExample) | 1973-08-24 |
| DD104171A5 (enExample) | 1974-03-05 |
| HU165488B (enExample) | 1974-09-28 |
| AU5080073A (en) | 1974-07-11 |
| AU472352B2 (en) | 1976-05-20 |
| NL7300422A (enExample) | 1973-07-17 |
| IT976809B (it) | 1974-09-10 |
| AR195814A1 (es) | 1973-11-09 |
| DK134042C (da) | 1977-02-07 |
| BE794013A (fr) | 1973-07-12 |
| BG22788A3 (bg) | 1977-04-20 |
| CS192459B2 (en) | 1979-08-31 |
| TR17278A (tr) | 1975-03-24 |
| ZA73264B (en) | 1973-11-28 |
| OA04316A (fr) | 1980-01-15 |
| FR2168009B1 (enExample) | 1976-08-27 |
| AT322276B (de) | 1975-05-12 |
| IL41216A (en) | 1976-02-29 |
| IL41216A0 (en) | 1973-03-30 |
| SU708977A3 (ru) | 1980-01-05 |
| JPS4880727A (enExample) | 1973-10-29 |
| JPS5635162B2 (enExample) | 1981-08-15 |
| BR7300284D0 (pt) | 1973-09-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2201432C2 (de) | Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende Herbizide | |
| DE69835653T2 (de) | Phthalsaeurediamidderivate, insektizide für landbau und gartenbau, und deren verwendung | |
| EP0240659A2 (de) | N-substituierte 3,4,5,6-Tetrahydrophthalimide und deren Vorprodukte | |
| DE1905598A1 (de) | Verwendung von Harnstoffen als selektive Herbizide | |
| DE2720427A1 (de) | M-phenoxybenzamide, verfahren zu ihrer herstellung und herbizide mittel | |
| JPS6021965B2 (ja) | 殺菌剤 | |
| DE2160380A1 (de) | Substituierte sulfonylglykolsaeureanilide | |
| EP0007089B1 (de) | Acylanilide mit herbicider und fungicider Wirkung, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| EP0775124A1 (de) | Herbizide saccharincarbonsäure-derivate und verfahren zu ihrer herstellung | |
| DE1137259B (de) | Selektive Bekaempfung von Fingerhirse | |
| US3165549A (en) | Carbanil-hydroxamic acid esters | |
| EP0072348B1 (de) | Neue Phenoxyphenyl-aminosäure-Derivate, ihre Herstellung, sie enthaltende Mittel sowie ihre Verwendung | |
| EP0003297B1 (de) | Neue Phenoxy-alkyl-oxazoline, deren Herstellung, sie enthaltende herbizide Mittel und deren Verwendung | |
| DE1567142C3 (de) | Oximcarbamate und ihre Verwendung als Insekticide, Akaricide und Nematicide | |
| DE1932827C3 (de) | Cycloaliphatische Imidazolidin-2-on-1-carbonsäure-amide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| DE1944525C3 (de) | Anilinoalkanohydroxamsäureverbindungen, Verfahren zu ihrer Herstellung und ihre Verwendung als herbicide Mittel | |
| DE2114774C3 (de) | m-(Halogenalkenyloxy)-phenyIharnstoffe, Verfahren zu ihrer Herstellung und sie enthaltende herbizide Mittel | |
| DE1906050C3 (de) | S-Alkyi-dnethyl-hexahydro-lHazepin)-1 -carbothiolate | |
| DE2035145B2 (de) | Decahydrochinoline und octahydroindole | |
| EP0016731B1 (de) | Meta-Cyanoalkoxy-Phenylharnstoffe mit herbizider Wirkung, deren Herstellung und sie enthaltende Mittel | |
| DE2803662A1 (de) | Chloracetanilide, verfahren zur herstellung dieser verbindungen sowie diese enthaltende herbizide mittel | |
| CH656614A5 (de) | Aryloxysubstituierte aliphatische saeuren und saeurederivate und diese enthaltende herbizide zusammensetzungen. | |
| DE1643798C (de) | 3,4-DibromphenylharnstofTe bzw. -thioharnstoffe und diese als Wirkstoff enthaltende total- oder selektiv-herbizide Mittel | |
| DD264372A5 (de) | Verfahren zur verzoegerung des pflanzenwachstums | |
| DE3035145A1 (de) | Neue kohlensaeure-derivate, verfahren zu ihrer herstellung und diese enthaltende pestizide mittel |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OD | Request for examination | ||
| 8125 | Change of the main classification |
Ipc: C07C143/86 |
|
| 8126 | Change of the secondary classification |
Ipc: A01N 41/02 |
|
| D2 | Grant after examination | ||
| 8364 | No opposition during term of opposition | ||
| 8330 | Complete renunciation |