SU708977A3 - Гербицидное средство - Google Patents
Гербицидное средство Download PDFInfo
- Publication number
- SU708977A3 SU708977A3 SU731870088A SU1870088A SU708977A3 SU 708977 A3 SU708977 A3 SU 708977A3 SU 731870088 A SU731870088 A SU 731870088A SU 1870088 A SU1870088 A SU 1870088A SU 708977 A3 SU708977 A3 SU 708977A3
- Authority
- SU
- USSR - Soviet Union
- Prior art keywords
- glycolic acid
- experiment
- dose
- agent
- active substance
- Prior art date
Links
- 239000013543 active substance Substances 0.000 claims description 13
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical class OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 claims description 11
- 239000004009 herbicide Substances 0.000 claims description 8
- 230000002363 herbicidal effect Effects 0.000 claims description 4
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 claims description 2
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 claims description 2
- 125000000480 butynyl group Chemical group [*]C#CC([H])([H])C([H])([H])[H] 0.000 claims description 2
- 239000000969 carrier Substances 0.000 claims description 2
- 239000007788 liquid Substances 0.000 claims description 2
- 239000007787 solid Substances 0.000 claims description 2
- 239000004094 surface-active agent Substances 0.000 claims description 2
- 230000002708 enhancing effect Effects 0.000 claims 1
- 150000001875 compounds Chemical class 0.000 abstract description 6
- 238000000034 method Methods 0.000 abstract description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 abstract 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 abstract 1
- 150000003931 anilides Chemical class 0.000 abstract 1
- 238000002474 experimental method Methods 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 9
- -1 alkylsulfonyl glycolic acids Chemical class 0.000 description 6
- 239000002253 acid Substances 0.000 description 4
- 238000011156 evaluation Methods 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000003306 harvesting Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 240000008042 Zea mays Species 0.000 description 2
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 2
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 2
- 239000004480 active ingredient Substances 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 235000005822 corn Nutrition 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- 208000004998 Abdominal Pain Diseases 0.000 description 1
- 240000001592 Amaranthus caudatus Species 0.000 description 1
- 235000009328 Amaranthus caudatus Nutrition 0.000 description 1
- 235000016068 Berberis vulgaris Nutrition 0.000 description 1
- 241000335053 Beta vulgaris Species 0.000 description 1
- 208000002881 Colic Diseases 0.000 description 1
- 229940126062 Compound A Drugs 0.000 description 1
- 244000060234 Gmelina philippensis Species 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 1
- 244000062793 Sorghum vulgare Species 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 125000004369 butenyl group Chemical group C(=CCC)* 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 229940125904 compound 1 Drugs 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 235000019713 millet Nutrition 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- QAHVHSLSRLSVGS-UHFFFAOYSA-N sulfamoyl chloride Chemical class NS(Cl)(=O)=O QAHVHSLSRLSVGS-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C307/00—Amides of sulfuric acids, i.e. compounds having singly-bound oxygen atoms of sulfate groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C307/02—Monoamides of sulfuric acids or esters thereof, e.g. sulfamic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2201432A DE2201432C2 (de) | 1972-01-13 | 1972-01-13 | Substituierte 0-[Aminosulfonyl]-glykolsäureanilide und diese enthaltende Herbizide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| SU708977A3 true SU708977A3 (ru) | 1980-01-05 |
Family
ID=5832870
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| SU731870088A SU708977A3 (ru) | 1972-01-13 | 1973-01-11 | Гербицидное средство |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US3870740A (enExample) |
| JP (1) | JPS5635162B2 (enExample) |
| AR (1) | AR195814A1 (enExample) |
| AT (1) | AT322276B (enExample) |
| AU (1) | AU472352B2 (enExample) |
| BE (1) | BE794013A (enExample) |
| BG (1) | BG22788A3 (enExample) |
| BR (2) | BR7300274D0 (enExample) |
| CA (1) | CA1001642A (enExample) |
| CH (1) | CH575712A5 (enExample) |
| CS (1) | CS192459B2 (enExample) |
| DD (1) | DD104171A5 (enExample) |
| DE (1) | DE2201432C2 (enExample) |
| DK (1) | DK134042C (enExample) |
| FR (1) | FR2168009B1 (enExample) |
| GB (1) | GB1407114A (enExample) |
| HU (1) | HU165488B (enExample) |
| IL (1) | IL41216A (enExample) |
| IT (1) | IT976809B (enExample) |
| NL (1) | NL7300422A (enExample) |
| OA (1) | OA04316A (enExample) |
| PL (1) | PL78984B1 (enExample) |
| SU (1) | SU708977A3 (enExample) |
| TR (1) | TR17278A (enExample) |
| ZA (1) | ZA73264B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2417764A1 (de) * | 1974-04-11 | 1975-10-30 | Basf Ag | O-aminosulfonyl-glykolsaeureanilide |
| DE2431582A1 (de) * | 1974-07-01 | 1976-01-22 | Basf Ag | O-aminosulfonyl-glykolsaeureamide |
| DE2453908A1 (de) * | 1974-11-14 | 1976-05-26 | Basf Ag | Herbizide mischungen |
| US4209317A (en) * | 1974-11-18 | 1980-06-24 | Basf Aktiengesellschaft | Herbicidal compositions |
| US4140519A (en) * | 1974-11-18 | 1979-02-20 | Basf Aktiengesellschaft | Herbicidal compositions |
| US4264520A (en) * | 1974-12-13 | 1981-04-28 | Basf Aktiengesellschaft | Substituted O-alkylsulfonylglycolic acid anilides |
| DE2458972A1 (de) * | 1974-12-13 | 1976-06-16 | Basf Ag | Substituierte o-alkylsulfonylglykolsaeureanilide |
| DE2852274A1 (de) * | 1978-12-02 | 1980-06-19 | Basf Ag | Verfahren zur herstellung von sulfamidsaeurehalogeniden |
| JPS5592366A (en) * | 1978-12-28 | 1980-07-12 | Hokko Chem Ind Co Ltd | O-sulfamoylglycolic acid amide derivative |
| DE2904490A1 (de) * | 1979-02-07 | 1980-08-21 | Bayer Ag | Verfahren zur herstellung von alpha -hydroxycarbonsaeureamiden |
| DE3038598A1 (de) * | 1980-10-13 | 1982-05-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von (alpha)-hydroxy-carbonsaeureamiden, neue zwischenprodukte hierfuer und verfahren zu deren herstellung |
| DE19504225A1 (de) * | 1995-02-09 | 1996-08-14 | Hoechst Ag | Verfahren zur Herstellung von O-Acyloxycarbonsäureaniliden |
| DE19933936A1 (de) | 1999-07-20 | 2001-01-25 | Bayer Ag | Substituierte Heteroaryloxyacetanilide |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3536721A (en) * | 1963-09-13 | 1970-10-27 | Stauffer Chemical Co | Substituted-sulfonyl glycolamide compositions |
-
0
- BE BE794013D patent/BE794013A/xx not_active IP Right Cessation
-
1972
- 1972-01-13 DE DE2201432A patent/DE2201432C2/de not_active Expired
- 1972-12-29 PL PL1972159930A patent/PL78984B1/pl unknown
-
1973
- 1973-01-01 IL IL41216A patent/IL41216A/en unknown
- 1973-01-04 TR TR17278A patent/TR17278A/xx unknown
- 1973-01-05 AU AU50800/73A patent/AU472352B2/en not_active Expired
- 1973-01-05 US US321548A patent/US3870740A/en not_active Expired - Lifetime
- 1973-01-08 CH CH15073A patent/CH575712A5/xx not_active IP Right Cessation
- 1973-01-09 JP JP499473A patent/JPS5635162B2/ja not_active Expired
- 1973-01-10 IT IT47600/73A patent/IT976809B/it active
- 1973-01-11 DD DD168205A patent/DD104171A5/xx unknown
- 1973-01-11 SU SU731870088A patent/SU708977A3/ru active
- 1973-01-11 HU HUBA2850A patent/HU165488B/hu unknown
- 1973-01-11 NL NL7300422A patent/NL7300422A/xx not_active Application Discontinuation
- 1973-01-12 CA CA161,100A patent/CA1001642A/en not_active Expired
- 1973-01-12 ZA ZA730264A patent/ZA73264B/xx unknown
- 1973-01-12 AT AT25773A patent/AT322276B/de active
- 1973-01-12 OA OA54808A patent/OA04316A/xx unknown
- 1973-01-12 GB GB171173A patent/GB1407114A/en not_active Expired
- 1973-01-12 BR BR73274A patent/BR7300274D0/pt unknown
- 1973-01-12 FR FR7301025A patent/FR2168009B1/fr not_active Expired
- 1973-01-12 BG BG022437A patent/BG22788A3/xx unknown
- 1973-01-12 DK DK17873A patent/DK134042C/da active
- 1973-01-12 BR BR73284A patent/BR7300284D0/pt unknown
- 1973-01-12 AR AR246098A patent/AR195814A1/es active
- 1973-01-12 CS CS73289A patent/CS192459B2/cs unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NL7300422A (enExample) | 1973-07-17 |
| BE794013A (fr) | 1973-07-12 |
| AT322276B (de) | 1975-05-12 |
| ZA73264B (en) | 1973-11-28 |
| AR195814A1 (es) | 1973-11-09 |
| BG22788A3 (bg) | 1977-04-20 |
| CA1001642A (en) | 1976-12-14 |
| OA04316A (fr) | 1980-01-15 |
| CH575712A5 (enExample) | 1976-05-31 |
| PL78984B1 (enExample) | 1975-06-30 |
| JPS4880727A (enExample) | 1973-10-29 |
| AU5080073A (en) | 1974-07-11 |
| IL41216A (en) | 1976-02-29 |
| IL41216A0 (en) | 1973-03-30 |
| DK134042C (da) | 1977-02-07 |
| TR17278A (tr) | 1975-03-24 |
| CS192459B2 (en) | 1979-08-31 |
| FR2168009B1 (enExample) | 1976-08-27 |
| AU472352B2 (en) | 1976-05-20 |
| DE2201432A1 (de) | 1973-07-19 |
| BR7300284D0 (pt) | 1973-09-25 |
| DD104171A5 (enExample) | 1974-03-05 |
| FR2168009A1 (enExample) | 1973-08-24 |
| BR7300274D0 (pt) | 1973-09-25 |
| US3870740A (en) | 1975-03-11 |
| DK134042B (da) | 1976-09-06 |
| IT976809B (it) | 1974-09-10 |
| DE2201432C2 (de) | 1983-11-03 |
| HU165488B (enExample) | 1974-09-28 |
| JPS5635162B2 (enExample) | 1981-08-15 |
| GB1407114A (en) | 1975-09-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SU710499A3 (ru) | Гербицидное средство | |
| SU708977A3 (ru) | Гербицидное средство | |
| US3884671A (en) | Herbicidal n-haloacyl (2-alkylated) oxazolidines | |
| SU670194A3 (ru) | Гербицидна композици | |
| US2863754A (en) | Method of weed control | |
| SU651645A3 (ru) | Гербицидна композици | |
| SU667099A3 (ru) | Гербицидное средство | |
| SU563893A3 (ru) | Гербицидный состав | |
| US4018801A (en) | Substituted oxirane compounds | |
| SU579847A3 (ru) | Гербицидное средство | |
| SU629851A3 (ru) | Способ борьбы с нежелательным ростом растений | |
| SU577933A3 (ru) | Гербицидное средство | |
| SU596149A3 (ru) | Гербицидна композици | |
| US2893855A (en) | N-1-napthylchlorophthalamic herbicides | |
| US3707366A (en) | Pre-emergent chemical method of combating unwanted vegetation | |
| SU670196A3 (ru) | Гербицидный состав | |
| US3881908A (en) | Herbicidal N-haloacyl (2-spirocycloaliphatic) oxazolidines | |
| SU580801A3 (ru) | Гербицидное средство | |
| SU651644A3 (ru) | Гербицидное средство | |
| SU843696A3 (ru) | Гербицидный состав | |
| SU579845A3 (ru) | Гербицидное средство | |
| SU648049A3 (ru) | Гербицидное средство | |
| SU605520A3 (ru) | Гербицидное средство | |
| US3532686A (en) | Alkyleneiminourea compounds | |
| US3877925A (en) | Pre-emergent chemical control of weeds with N-benzyl-N-isopropylthiobenzamides |