DE2200249A1 - Elektrostatographischer Entwickler,sowie dessen Verwendung - Google Patents
Elektrostatographischer Entwickler,sowie dessen VerwendungInfo
- Publication number
- DE2200249A1 DE2200249A1 DE19722200249 DE2200249A DE2200249A1 DE 2200249 A1 DE2200249 A1 DE 2200249A1 DE 19722200249 DE19722200249 DE 19722200249 DE 2200249 A DE2200249 A DE 2200249A DE 2200249 A1 DE2200249 A1 DE 2200249A1
- Authority
- DE
- Germany
- Prior art keywords
- crystalline phase
- glass
- electrostatographic developer
- image
- electrostatographic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000011521 glass Substances 0.000 claims description 43
- 239000000203 mixture Substances 0.000 claims description 35
- 239000002241 glass-ceramic Substances 0.000 claims description 20
- 239000011159 matrix material Substances 0.000 claims description 13
- 238000000034 method Methods 0.000 claims description 10
- 229910010413 TiO 2 Inorganic materials 0.000 claims description 8
- 229910052793 cadmium Inorganic materials 0.000 claims description 8
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 claims description 8
- 229910044991 metal oxide Inorganic materials 0.000 claims description 7
- 150000004706 metal oxides Chemical class 0.000 claims description 7
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 claims description 6
- 229910052788 barium Inorganic materials 0.000 claims description 5
- NKZSPGSOXYXWQA-UHFFFAOYSA-N dioxido(oxo)titanium;lead(2+) Chemical compound [Pb+2].[O-][Ti]([O-])=O NKZSPGSOXYXWQA-UHFFFAOYSA-N 0.000 claims description 5
- 238000007496 glass forming Methods 0.000 claims description 5
- 230000008569 process Effects 0.000 claims description 5
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 claims description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 claims description 4
- JRPBQTZRNDNNOP-UHFFFAOYSA-N barium titanate Chemical compound [Ba+2].[Ba+2].[O-][Ti]([O-])([O-])[O-] JRPBQTZRNDNNOP-UHFFFAOYSA-N 0.000 claims description 4
- 229910002113 barium titanate Inorganic materials 0.000 claims description 4
- 229910052791 calcium Inorganic materials 0.000 claims description 4
- 239000011575 calcium Substances 0.000 claims description 4
- 229910052732 germanium Inorganic materials 0.000 claims description 4
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 4
- 229910052735 hafnium Inorganic materials 0.000 claims description 4
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 claims description 4
- 238000004519 manufacturing process Methods 0.000 claims description 4
- 229910052719 titanium Inorganic materials 0.000 claims description 4
- 239000010936 titanium Substances 0.000 claims description 4
- 229910052726 zirconium Inorganic materials 0.000 claims description 4
- 229910004298 SiO 2 Inorganic materials 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 229910021523 barium zirconate Inorganic materials 0.000 claims description 3
- DQBAOWPVHRWLJC-UHFFFAOYSA-N barium(2+);dioxido(oxo)zirconium Chemical group [Ba+2].[O-][Zr]([O-])=O DQBAOWPVHRWLJC-UHFFFAOYSA-N 0.000 claims description 3
- 229910052712 strontium Inorganic materials 0.000 claims description 3
- CIOAGBVUUVVLOB-UHFFFAOYSA-N strontium atom Chemical compound [Sr] CIOAGBVUUVVLOB-UHFFFAOYSA-N 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- 239000007787 solid Substances 0.000 claims 1
- 239000000463 material Substances 0.000 description 12
- 239000002245 particle Substances 0.000 description 12
- 229920005989 resin Polymers 0.000 description 8
- 239000011347 resin Substances 0.000 description 8
- 239000006229 carbon black Substances 0.000 description 7
- 239000011248 coating agent Substances 0.000 description 7
- 238000000576 coating method Methods 0.000 description 7
- 229920001577 copolymer Polymers 0.000 description 7
- 229920002037 poly(vinyl butyral) polymer Polymers 0.000 description 7
- BUGBHKTXTAQXES-UHFFFAOYSA-N Selenium Chemical compound [Se] BUGBHKTXTAQXES-UHFFFAOYSA-N 0.000 description 6
- 229910052711 selenium Inorganic materials 0.000 description 6
- 239000011669 selenium Substances 0.000 description 6
- 239000000969 carrier Substances 0.000 description 5
- 230000015556 catabolic process Effects 0.000 description 5
- 238000002425 crystallisation Methods 0.000 description 5
- 230000008025 crystallization Effects 0.000 description 5
- 238000006731 degradation reaction Methods 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 239000000919 ceramic Substances 0.000 description 4
- 239000011324 bead Substances 0.000 description 3
- 239000012876 carrier material Substances 0.000 description 3
- 230000000694 effects Effects 0.000 description 3
- HTUMBQDCCIXGCV-UHFFFAOYSA-N lead oxide Chemical compound [O-2].[Pb+2] HTUMBQDCCIXGCV-UHFFFAOYSA-N 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 230000000717 retained effect Effects 0.000 description 3
- 101100016398 Danio rerio hars gene Proteins 0.000 description 2
- 229910052454 barium strontium titanate Inorganic materials 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 239000011162 core material Substances 0.000 description 2
- 239000011222 crystalline ceramic Substances 0.000 description 2
- 229910002106 crystalline ceramic Inorganic materials 0.000 description 2
- 239000012467 final product Substances 0.000 description 2
- 239000006104 solid solution Substances 0.000 description 2
- 239000000758 substrate Substances 0.000 description 2
- KPAPHODVWOVUJL-UHFFFAOYSA-N 1-benzofuran;1h-indene Chemical compound C1=CC=C2CC=CC2=C1.C1=CC=C2OC=CC2=C1 KPAPHODVWOVUJL-UHFFFAOYSA-N 0.000 description 1
- DJOYTAUERRJRAT-UHFFFAOYSA-N 2-(n-methyl-4-nitroanilino)acetonitrile Chemical compound N#CCN(C)C1=CC=C([N+]([O-])=O)C=C1 DJOYTAUERRJRAT-UHFFFAOYSA-N 0.000 description 1
- 229910015801 BaSrTiO Inorganic materials 0.000 description 1
- 239000004859 Copal Substances 0.000 description 1
- 241000689227 Cora <basidiomycete fungus> Species 0.000 description 1
- 241000907514 Entebbe bat virus Species 0.000 description 1
- 241000782205 Guibourtia conjugata Species 0.000 description 1
- CERQOIWHTDAKMF-UHFFFAOYSA-N Methacrylic acid Chemical compound CC(=C)C(O)=O CERQOIWHTDAKMF-UHFFFAOYSA-N 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 238000003723 Smelting Methods 0.000 description 1
- 229910004116 SrO 2 Inorganic materials 0.000 description 1
- MCMNRKCIXSYSNV-UHFFFAOYSA-N ZrO2 Inorganic materials O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 1
- OIDVIOGBCSGMLA-UHFFFAOYSA-N [O-2].[O-2].[Ti+4].[Sn+2]=O Chemical compound [O-2].[O-2].[Ti+4].[Sn+2]=O OIDVIOGBCSGMLA-UHFFFAOYSA-N 0.000 description 1
- 239000010426 asphalt Substances 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- WEUCVIBPSSMHJG-UHFFFAOYSA-N calcium titanate Chemical compound [O-2].[O-2].[O-2].[Ca+2].[Ti+4] WEUCVIBPSSMHJG-UHFFFAOYSA-N 0.000 description 1
- JXDXDSKXFRTAPA-UHFFFAOYSA-N calcium;barium(2+);oxygen(2-);titanium(4+) Chemical compound [O-2].[Ca+2].[Ti+4].[Ba+2] JXDXDSKXFRTAPA-UHFFFAOYSA-N 0.000 description 1
- HNQGTZYKXIXXST-UHFFFAOYSA-N calcium;dioxido(oxo)tin Chemical compound [Ca+2].[O-][Sn]([O-])=O HNQGTZYKXIXXST-UHFFFAOYSA-N 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000010411 cooking Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000006092 crystalline glass-ceramic Substances 0.000 description 1
- 239000002178 crystalline material Substances 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 230000004907 flux Effects 0.000 description 1
- WSFSSNUMVMOOMR-UHFFFAOYSA-N formaldehyde Substances O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 1
- YBMRDBCBODYGJE-UHFFFAOYSA-N germanium oxide Inorganic materials O=[Ge]=O YBMRDBCBODYGJE-UHFFFAOYSA-N 0.000 description 1
- 230000005484 gravity Effects 0.000 description 1
- 229910021480 group 4 element Inorganic materials 0.000 description 1
- 229910000449 hafnium oxide Inorganic materials 0.000 description 1
- WIHZLLGSGQNAGK-UHFFFAOYSA-N hafnium(4+);oxygen(2-) Chemical compound [O-2].[O-2].[Hf+4] WIHZLLGSGQNAGK-UHFFFAOYSA-N 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910000464 lead oxide Inorganic materials 0.000 description 1
- MLOKPANHZRKTMG-UHFFFAOYSA-N lead(2+);oxygen(2-);tin(4+) Chemical compound [O-2].[O-2].[O-2].[Sn+4].[Pb+2] MLOKPANHZRKTMG-UHFFFAOYSA-N 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 238000010309 melting process Methods 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 239000003607 modifier Substances 0.000 description 1
- PVADDRMAFCOOPC-UHFFFAOYSA-N oxogermanium Chemical compound [Ge]=O PVADDRMAFCOOPC-UHFFFAOYSA-N 0.000 description 1
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 229920006122 polyamide resin Polymers 0.000 description 1
- 229920013716 polyethylene resin Polymers 0.000 description 1
- -1 polypropylene Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920005990 polystyrene resin Polymers 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 238000006748 scratching Methods 0.000 description 1
- 230000002393 scratching effect Effects 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 239000000243 solution Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 229940071182 stannate Drugs 0.000 description 1
- 125000005402 stannate group Chemical group 0.000 description 1
- 238000007669 thermal treatment Methods 0.000 description 1
- 230000007306 turnover Effects 0.000 description 1
- 230000000007 visual effect Effects 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G9/00—Developers
- G03G9/08—Developers with toner particles
- G03G9/10—Developers with toner particles characterised by carrier particles
- G03G9/103—Glass particles
Landscapes
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Developing Agents For Electrophotography (AREA)
- Glass Compositions (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US10449771A | 1971-01-06 | 1971-01-06 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2200249A1 true DE2200249A1 (de) | 1972-07-27 |
Family
ID=22300809
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19722200249 Pending DE2200249A1 (de) | 1971-01-06 | 1972-01-04 | Elektrostatographischer Entwickler,sowie dessen Verwendung |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US3725283A (cg-RX-API-DMAC10.html) |
| BE (1) | BE777720A (cg-RX-API-DMAC10.html) |
| CA (1) | CA973745A (cg-RX-API-DMAC10.html) |
| DE (1) | DE2200249A1 (cg-RX-API-DMAC10.html) |
| FR (1) | FR2121329A5 (cg-RX-API-DMAC10.html) |
| GB (1) | GB1376457A (cg-RX-API-DMAC10.html) |
| IT (1) | IT946358B (cg-RX-API-DMAC10.html) |
| NL (1) | NL7200169A (cg-RX-API-DMAC10.html) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4252881A (en) * | 1978-12-11 | 1981-02-24 | Xerox Corporation | Developer mixture |
| US5061586A (en) * | 1990-04-05 | 1991-10-29 | Eastman Kodak Company | Glass composite magnetic carrier particles |
| US5190842A (en) * | 1991-12-19 | 1993-03-02 | Eastman Kodak Company | Two phase ferroelectric-ferromagnetic composite carrier |
| US5190841A (en) * | 1991-12-19 | 1993-03-02 | Eastman Kodak Company | Two-phase ferroelectric-ferromagnetic composite and carrier therefrom |
| US5306592A (en) * | 1992-10-29 | 1994-04-26 | Eastman Kodak Company | Method of preparing electrographic magnetic carrier particles |
| US5268249A (en) * | 1992-10-29 | 1993-12-07 | Eastman Kodak Company | Magnetic carrier particles |
| US8161862B1 (en) * | 2007-01-08 | 2012-04-24 | Corning Incorporated | Hybrid laminated transparent armor |
| JP6938345B2 (ja) * | 2017-11-17 | 2021-09-22 | キヤノン株式会社 | トナー |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA557577A (en) * | 1958-05-20 | The Battelle Development Corporation | Xerographic developer | |
| US2618551A (en) * | 1948-10-20 | 1952-11-18 | Haloid Co | Developer for electrostatic images |
| BE576841A (cg-RX-API-DMAC10.html) * | 1958-03-20 | |||
| US3239465A (en) * | 1958-05-12 | 1966-03-08 | Xerox Corp | Xerographic developer |
| BE592339A (cg-RX-API-DMAC10.html) * | 1959-06-27 | |||
| BE594137A (cg-RX-API-DMAC10.html) * | 1959-08-17 | |||
| US3195030A (en) * | 1964-06-26 | 1965-07-13 | Corning Glass Works | Glass and methods of devitrifying same and making a capacitor therefrom |
| BE756942A (fr) * | 1969-10-01 | 1971-03-16 | Eastman Kodak Co | Revelateur pour l'electrophotographie |
-
1971
- 1971-01-06 US US00104497A patent/US3725283A/en not_active Expired - Lifetime
- 1971-10-26 CA CA126,065A patent/CA973745A/en not_active Expired
-
1972
- 1972-01-03 GB GB12872A patent/GB1376457A/en not_active Expired
- 1972-01-04 DE DE19722200249 patent/DE2200249A1/de active Pending
- 1972-01-05 BE BE777720A patent/BE777720A/xx unknown
- 1972-01-05 FR FR7201006A patent/FR2121329A5/fr not_active Expired
- 1972-01-05 IT IT19108/72A patent/IT946358B/it active
- 1972-01-06 NL NL7200169A patent/NL7200169A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US3725283A (en) | 1973-04-03 |
| GB1376457A (en) | 1974-12-04 |
| FR2121329A5 (cg-RX-API-DMAC10.html) | 1972-08-18 |
| IT946358B (it) | 1973-05-21 |
| CA973745A (en) | 1975-09-02 |
| NL7200169A (cg-RX-API-DMAC10.html) | 1972-07-10 |
| BE777720A (fr) | 1972-07-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1597887A1 (de) | Traegerkoerner fuer elektrostatographischer Entwickler sowie mit solchen Entwicklern arbeitende Abbildungsverfahren | |
| DE68924884T2 (de) | Tonerzusammensetzungen. | |
| US3658500A (en) | Method for producing glass beads for electrostatographic developers | |
| DE2853021A1 (de) | Traegerteilchen fuer elektrostatographische entwicklergemische | |
| DE2200249A1 (de) | Elektrostatographischer Entwickler,sowie dessen Verwendung | |
| DE2104554A1 (de) | Elektrostatographisches Entwicklungs Pulver sowie dessen Verwendung | |
| DE2520214A1 (de) | Elektrostatisches abbildungsverfahren und klassifizierte carriermaterialien dafuer | |
| DE2603005C3 (de) | Druckfixierbarer Toner für elektrostatographische Entwickler | |
| DE2326273A1 (de) | Abbildungsmaterial und verfahren unter dessen verwendung | |
| DE1772220A1 (de) | Elektrostatografischer Entwicklerstoff | |
| DE1797232C3 (de) | Bildempfangsmaterial für elektrophotographische Verfahren | |
| DE2247821A1 (de) | Aufschmelzwalze und verfahren zu ihrer herstellung | |
| DE60118054T2 (de) | Magnetische Trägerteilchen | |
| DE2217933A1 (de) | Elektrostatographisches entwicklergemisch | |
| DE2166512A1 (de) | Elektrophotographische platte und ihre verwendung in elektrophotographischen abbildungsverfahren | |
| DE2517407A1 (de) | Elektrostatographische entwicklerzusammensetzung | |
| DE2409003A1 (de) | Entwicklergemische | |
| DE1522713C3 (de) | Elektrophotographisches Aufzeichnungsmaterial | |
| DE2226292C3 (de) | Verfahren zur Herstellung von Kopien | |
| DE69026842T2 (de) | Entwickler für elektrostatische latente Bilder | |
| DE1772219A1 (de) | Elektrostatografischer Entwicklerstoff | |
| EP0011688B1 (de) | Elektrophotographisches Entwicklermaterial und seine Verwendung | |
| DE1522708A1 (de) | Verfahren zur Herstellung eines Entwicklerstoffes zur Entwicklung latenter elektrostatischer Bilder | |
| DE2400362A1 (de) | Entfernbare ueberzuege fuer verbesserte xerographische platten | |
| DE2200493A1 (de) | Elektrostatographischer Entwickler sowie dessen Verwendung |