DE2161879B2 - Verfahren zur Herstellung von 2,6-Dinitroanilin-Derivaten - Google Patents
Verfahren zur Herstellung von 2,6-Dinitroanilin-DerivatenInfo
- Publication number
- DE2161879B2 DE2161879B2 DE19712161879 DE2161879A DE2161879B2 DE 2161879 B2 DE2161879 B2 DE 2161879B2 DE 19712161879 DE19712161879 DE 19712161879 DE 2161879 A DE2161879 A DE 2161879A DE 2161879 B2 DE2161879 B2 DE 2161879B2
- Authority
- DE
- Germany
- Prior art keywords
- parts
- chjch
- dinitro
- water
- preparation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 9
- 238000002360 preparation method Methods 0.000 title claims description 5
- QFUSCYRJMXLNRB-UHFFFAOYSA-N 2,6-dinitroaniline Chemical class NC1=C([N+]([O-])=O)C=CC=C1[N+]([O-])=O QFUSCYRJMXLNRB-UHFFFAOYSA-N 0.000 title claims description 3
- 150000001412 amines Chemical class 0.000 claims description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 21
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 14
- 239000000460 chlorine Substances 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 9
- 239000002253 acid Substances 0.000 description 9
- 239000000047 product Substances 0.000 description 7
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 6
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 6
- 150000001875 compounds Chemical class 0.000 description 6
- HFHAVERNVFNSHL-UHFFFAOYSA-N 2-chloro-1,3-dinitro-5-(trifluoromethyl)benzene Chemical compound [O-][N+](=O)C1=CC(C(F)(F)F)=CC([N+]([O-])=O)=C1Cl HFHAVERNVFNSHL-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- 239000003513 alkali Substances 0.000 description 4
- 125000000304 alkynyl group Chemical group 0.000 description 4
- RDOXTESZEPMUJZ-UHFFFAOYSA-N anisole Chemical compound COC1=CC=CC=C1 RDOXTESZEPMUJZ-UHFFFAOYSA-N 0.000 description 4
- 239000007795 chemical reaction product Substances 0.000 description 4
- 125000004186 cyclopropylmethyl group Chemical group [H]C([H])(*)C1([H])C([H])([H])C1([H])[H] 0.000 description 4
- 239000001257 hydrogen Substances 0.000 description 4
- 229910052739 hydrogen Inorganic materials 0.000 description 4
- 150000004679 hydroxides Chemical class 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- -1 methoxyethyl Chemical group 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000008096 xylene Substances 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 3
- 125000001731 2-cyanoethyl group Chemical group [H]C([H])(*)C([H])([H])C#N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 2
- 229910000287 alkaline earth metal oxide Inorganic materials 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 description 2
- QVQLCTNNEUAWMS-UHFFFAOYSA-N barium oxide Chemical compound [Ba]=O QVQLCTNNEUAWMS-UHFFFAOYSA-N 0.000 description 2
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- 125000004965 chloroalkyl group Chemical group 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 125000000623 heterocyclic group Chemical group 0.000 description 2
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 2
- 229910001853 inorganic hydroxide Inorganic materials 0.000 description 2
- 229910052809 inorganic oxide Inorganic materials 0.000 description 2
- UZKWTJUDCOPSNM-UHFFFAOYSA-N methoxybenzene Substances CCCCOC=C UZKWTJUDCOPSNM-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- 239000002351 wastewater Substances 0.000 description 2
- SCYULBFZEHDVBN-UHFFFAOYSA-N 1,1-Dichloroethane Chemical compound CC(Cl)Cl SCYULBFZEHDVBN-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- KYDXWCHDUCDNGR-UHFFFAOYSA-N 1-chloro-2,3-dinitrobenzene Chemical class [O-][N+](=O)C1=CC=CC(Cl)=C1[N+]([O-])=O KYDXWCHDUCDNGR-UHFFFAOYSA-N 0.000 description 1
- YMDZJGQBSPNMEF-UHFFFAOYSA-N 1-phenylazepane Chemical compound C1CCCCCN1C1=CC=CC=C1 YMDZJGQBSPNMEF-UHFFFAOYSA-N 0.000 description 1
- VACNDKUQVLNNLD-UHFFFAOYSA-N 2,6-dinitro-4-(trifluoromethyl)aniline Chemical compound NC1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O VACNDKUQVLNNLD-UHFFFAOYSA-N 0.000 description 1
- BPPMIQPXQVIZNJ-UHFFFAOYSA-N 2-chloro-1,3-dinitrobenzene Chemical class [O-][N+](=O)C1=CC=CC([N+]([O-])=O)=C1Cl BPPMIQPXQVIZNJ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- MCSXGCZMEPXKIW-UHFFFAOYSA-N 3-hydroxy-4-[(4-methyl-2-nitrophenyl)diazenyl]-N-(3-nitrophenyl)naphthalene-2-carboxamide Chemical compound Cc1ccc(N=Nc2c(O)c(cc3ccccc23)C(=O)Nc2cccc(c2)[N+]([O-])=O)c(c1)[N+]([O-])=O MCSXGCZMEPXKIW-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- JCJJDSPEQWYGDZ-UHFFFAOYSA-N [O-][N+](=O)C1=CC=CC(=C1NCl)[N+]([O-])=O Chemical compound [O-][N+](=O)C1=CC=CC(=C1NCl)[N+]([O-])=O JCJJDSPEQWYGDZ-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 150000001448 anilines Chemical class 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- ZSIQJIWKELUFRJ-UHFFFAOYSA-N azepane Chemical compound C1CCCNCC1 ZSIQJIWKELUFRJ-UHFFFAOYSA-N 0.000 description 1
- 229910052788 barium Inorganic materials 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical compound [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- RQPZNWPYLFFXCP-UHFFFAOYSA-L barium dihydroxide Chemical compound [OH-].[OH-].[Ba+2] RQPZNWPYLFFXCP-UHFFFAOYSA-L 0.000 description 1
- 229910001863 barium hydroxide Inorganic materials 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- AXCZMVOFGPJBDE-UHFFFAOYSA-L calcium dihydroxide Chemical compound [OH-].[OH-].[Ca+2] AXCZMVOFGPJBDE-UHFFFAOYSA-L 0.000 description 1
- 239000000920 calcium hydroxide Substances 0.000 description 1
- 229910001861 calcium hydroxide Inorganic materials 0.000 description 1
- BRPQOXSCLDDYGP-UHFFFAOYSA-N calcium oxide Chemical compound [O-2].[Ca+2] BRPQOXSCLDDYGP-UHFFFAOYSA-N 0.000 description 1
- 239000000292 calcium oxide Substances 0.000 description 1
- ODINCKMPIJJUCX-UHFFFAOYSA-N calcium oxide Inorganic materials [Ca]=O ODINCKMPIJJUCX-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 150000002168 ethanoic acid esters Chemical class 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000012063 pure reaction product Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 150000003254 radicals Chemical group 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000007127 saponification reaction Methods 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 1
- 239000003799 water insoluble solvent Substances 0.000 description 1
Landscapes
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712161879 DE2161879B2 (de) | 1971-12-14 | 1971-12-14 | Verfahren zur Herstellung von 2,6-Dinitroanilin-Derivaten |
| IL40876A IL40876A (en) | 1971-12-14 | 1972-11-20 | Preparation of 2,6-dinitroaniline derivatives |
| CH1790472A CH584183A5 (https=) | 1971-12-14 | 1972-12-08 | |
| JP12351472A JPS4864036A (https=) | 1971-12-14 | 1972-12-11 | |
| IT5459072A IT973979B (it) | 1971-12-14 | 1972-12-11 | Procedimento per la produzione di derivati 2 6 dinitroanilinici |
| SU7201857272A SU577969A3 (ru) | 1971-12-14 | 1972-12-12 | Способ получени производных 2,6-динитроанилина |
| GB5742372A GB1404457A (en) | 1971-12-14 | 1972-12-13 | Preparation of 2,6-dinitoaniline derivatives |
| FR7244605A FR2165551A5 (https=) | 1971-12-14 | 1972-12-14 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19712161879 DE2161879B2 (de) | 1971-12-14 | 1971-12-14 | Verfahren zur Herstellung von 2,6-Dinitroanilin-Derivaten |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE2161879A1 DE2161879A1 (de) | 1973-06-20 |
| DE2161879B2 true DE2161879B2 (de) | 1974-07-04 |
Family
ID=5827868
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712161879 Pending DE2161879B2 (de) | 1971-12-14 | 1971-12-14 | Verfahren zur Herstellung von 2,6-Dinitroanilin-Derivaten |
Country Status (8)
| Country | Link |
|---|---|
| JP (1) | JPS4864036A (https=) |
| CH (1) | CH584183A5 (https=) |
| DE (1) | DE2161879B2 (https=) |
| FR (1) | FR2165551A5 (https=) |
| GB (1) | GB1404457A (https=) |
| IL (1) | IL40876A (https=) |
| IT (1) | IT973979B (https=) |
| SU (1) | SU577969A3 (https=) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1505249A (en) * | 1974-03-23 | 1978-03-30 | Lilly Co Eli | Herbicides |
| US4153730A (en) | 1977-07-20 | 1979-05-08 | Eli Lilly And Company | Fungicidal and herbicidal methods |
| DE2814860A1 (de) * | 1978-04-06 | 1979-10-11 | Bayer Ag | Verfahren zur herstellung von aromatischen aminen |
| US4301158A (en) | 1980-04-11 | 1981-11-17 | Sandoz, Inc. | N-(2-Propynyl)-2,6-dinitro-benzenamine derivatives |
| IT1131182B (it) * | 1980-05-15 | 1986-06-18 | Montedison Spa | Processo di preparazione di n-di-n-propil-2,6-dinitro-4-trifluorometilanilina a basso contenuto di nitrosammine |
| US4328369A (en) * | 1981-01-14 | 1982-05-04 | Rumianca S.P.A. | Process for the production of 2,6-dinitro-N-alkyl-anilines |
| DE3104310A1 (de) * | 1981-02-07 | 1982-08-19 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung von 5-chlor-2-nitroanilin |
| CN117902988A (zh) * | 2024-01-03 | 2024-04-19 | 福建康峰新材料有限公司 | 一种2,6-二硝基-n,n-二乙醇基-4-三氟甲苯胺的制备方法 |
-
1971
- 1971-12-14 DE DE19712161879 patent/DE2161879B2/de active Pending
-
1972
- 1972-11-20 IL IL40876A patent/IL40876A/xx unknown
- 1972-12-08 CH CH1790472A patent/CH584183A5/xx not_active IP Right Cessation
- 1972-12-11 JP JP12351472A patent/JPS4864036A/ja active Pending
- 1972-12-11 IT IT5459072A patent/IT973979B/it active
- 1972-12-12 SU SU7201857272A patent/SU577969A3/ru active
- 1972-12-13 GB GB5742372A patent/GB1404457A/en not_active Expired
- 1972-12-14 FR FR7244605A patent/FR2165551A5/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS4864036A (https=) | 1973-09-05 |
| IL40876A0 (en) | 1973-01-30 |
| FR2165551A5 (https=) | 1973-08-03 |
| IT973979B (it) | 1974-06-10 |
| IL40876A (en) | 1975-06-25 |
| SU577969A3 (ru) | 1977-10-25 |
| GB1404457A (en) | 1975-08-28 |
| DE2161879A1 (de) | 1973-06-20 |
| CH584183A5 (https=) | 1977-01-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2161879B2 (de) | Verfahren zur Herstellung von 2,6-Dinitroanilin-Derivaten | |
| DE2129200A1 (de) | Verfahren zur Herstellung von N-Arylharnstoffen | |
| DE69508959T2 (de) | Verfahren zur herstellung von 5-amino-2,4,6-triiodoisophthalsäuredichlorid durch chlorierung der entsprechenden säure in gegenwart eines tertiären aminsalzes oder eines quaternären ammoniumsalzes | |
| EP0551632B1 (de) | Verfahren zur Herstellung von Halogenanthranilsäuren | |
| DE1244154B (de) | Verfahren zur Herstellung von Sulfonsaeuregruppen enthaltenden Dithiocarbaminsaeureesterderivaten | |
| DE2153356C2 (de) | Verfahren zur Herstellung von α-Anilinopropionsäuren und/oder deren Derivaten | |
| DE1233405B (de) | Verfahren zur Herstellung von 7-(Oxoalkyl)-1, 3-dimethylxanthinen | |
| DE1568646C3 (de) | Verfahren zur Herstellung von N-Hydroxyimidothiocarbonsäureestern | |
| EP0066246A2 (de) | Verfahren zur Herstellung basisch substituierter Phenylacetonitrile | |
| EP0041923B1 (de) | Verfahren zur Herstellung von N-(1'-Alkoxycarbonyläthyl)-2,6-dialkylanilinen | |
| EP0082398B1 (de) | Verfahren zur Herstellung von 1,2-Benzisothiazolin-3-onen | |
| DE2416260A1 (de) | Verfahren zur herstellung von phenolderivaten | |
| DE1643762C3 (de) | Verfahren zur Herstellung von N-Carboxy-alkoxy-Harnstoffen | |
| DE1543885C3 (de) | Verfahren zur Herstellung von 2-Methoxy^-amino-S-chlorbenzoesäuremethylester | |
| EP0150411A1 (de) | Verfahren zur Herstellung substituierter Chinazolin-2.4(1H.3H)-dione | |
| DE4421884A1 (de) | Verfahren zur Herstellung von Hydroxycarbonsäureaniliden | |
| DE3519864A1 (de) | Verfahren zur herstellung von o- und p-nitrobenzaldehyd | |
| DE2104682C3 (de) | Verfahren zur Herstellung von o-Sulfamidobenzoesäuren | |
| AT352092B (de) | Verfahren zur herstellung von acetoacetamid-n- sulfofluorid | |
| DE2331969C3 (de) | beta-(3,4,5-Trimethoxyphenyl)-propionltril und Verfahren zu seiner Herstellung | |
| DE3227931A1 (de) | Verfahren zur herstellung von brenzcatechinmethylcarbamat | |
| DE929192C (de) | Verfahren zur Herstellung von am Stickstoffatom acylierten oder sulfonylierten aliphatischen Aminocarbonsaeureamiden | |
| CH663957A5 (de) | Verfahren zur herstellung von 3,5-dichlor-2-pyridon. | |
| DE1770772A1 (de) | Verfahren zur Herstellung von Pyridazoniminen | |
| DE1643762A1 (de) | Verfahren zur Herstellung von N-Carboxyalkoxy-Harnstoffen |