DE2159432A1 - - Google Patents
Info
- Publication number
- DE2159432A1 DE2159432A1 DE19712159432 DE2159432A DE2159432A1 DE 2159432 A1 DE2159432 A1 DE 2159432A1 DE 19712159432 DE19712159432 DE 19712159432 DE 2159432 A DE2159432 A DE 2159432A DE 2159432 A1 DE2159432 A1 DE 2159432A1
- Authority
- DE
- Germany
- Prior art keywords
- group
- tetracycline
- solution
- methyl
- added
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004098 Tetracycline Substances 0.000 claims description 49
- 229960002180 tetracycline Drugs 0.000 claims description 47
- 235000019364 tetracycline Nutrition 0.000 claims description 43
- 229930101283 tetracycline Natural products 0.000 claims description 41
- 150000003522 tetracyclines Chemical class 0.000 claims description 36
- -1 1-methyl-2-p-tolyl-1-pentenyl Chemical group 0.000 claims description 31
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000002947 alkylene group Chemical group 0.000 claims description 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000005842 heteroatom Chemical group 0.000 claims description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 3
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 3
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003545 alkoxy group Chemical group 0.000 claims description 2
- 125000004414 alkyl thio group Chemical group 0.000 claims description 2
- 125000003435 aroyl group Chemical group 0.000 claims description 2
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 2
- 125000005116 aryl carbamoyl group Chemical group 0.000 claims description 2
- 125000005161 aryl oxy carbonyl group Chemical group 0.000 claims description 2
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims description 2
- 125000005110 aryl thio group Chemical group 0.000 claims description 2
- 125000004104 aryloxy group Chemical group 0.000 claims description 2
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 claims description 2
- 230000003115 biocidal effect Effects 0.000 claims 2
- 239000003814 drug Substances 0.000 claims 2
- 241001465754 Metazoa Species 0.000 claims 1
- 239000004480 active ingredient Substances 0.000 claims 1
- 125000002252 acyl group Chemical group 0.000 claims 1
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims 1
- 230000000295 complement effect Effects 0.000 claims 1
- 229940079593 drug Drugs 0.000 claims 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 132
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 130
- 239000000243 solution Substances 0.000 description 118
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 108
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 66
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 59
- 239000000203 mixture Substances 0.000 description 52
- 239000002244 precipitate Substances 0.000 description 52
- 238000000921 elemental analysis Methods 0.000 description 50
- 238000001914 filtration Methods 0.000 description 37
- 239000002904 solvent Substances 0.000 description 37
- 238000006243 chemical reaction Methods 0.000 description 36
- 239000000047 product Substances 0.000 description 35
- XMEVHPAGJVLHIG-FMZCEJRJSA-N chembl454950 Chemical compound [Cl-].C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H]([NH+](C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O XMEVHPAGJVLHIG-FMZCEJRJSA-N 0.000 description 30
- 229960004989 tetracycline hydrochloride Drugs 0.000 description 30
- 239000007795 chemical reaction product Substances 0.000 description 27
- 239000003208 petroleum Substances 0.000 description 26
- 150000001875 compounds Chemical class 0.000 description 17
- 239000000284 extract Substances 0.000 description 17
- 238000001035 drying Methods 0.000 description 15
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 14
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 11
- 239000007788 liquid Substances 0.000 description 11
- 239000000843 powder Substances 0.000 description 11
- 241000894006 Bacteria Species 0.000 description 10
- 238000000034 method Methods 0.000 description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 9
- 238000005481 NMR spectroscopy Methods 0.000 description 9
- 150000001336 alkenes Chemical class 0.000 description 9
- 229910052739 hydrogen Inorganic materials 0.000 description 9
- 239000001257 hydrogen Substances 0.000 description 9
- NQRYJNQNLNOLGT-UHFFFAOYSA-N tetrahydropyridine hydrochloride Natural products C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 8
- 238000005406 washing Methods 0.000 description 8
- 239000002026 chloroform extract Substances 0.000 description 7
- 235000017557 sodium bicarbonate Nutrition 0.000 description 7
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 7
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 230000000844 anti-bacterial effect Effects 0.000 description 6
- 239000012141 concentrate Substances 0.000 description 6
- 239000002253 acid Substances 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 4
- 239000004100 Oxytetracycline Substances 0.000 description 4
- 238000013459 approach Methods 0.000 description 4
- 150000002081 enamines Chemical class 0.000 description 4
- VLKZOEOYAKHREP-UHFFFAOYSA-N hexane Substances CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- 235000010755 mineral Nutrition 0.000 description 4
- 239000011707 mineral Substances 0.000 description 4
- 229960000625 oxytetracycline Drugs 0.000 description 4
- 238000001226 reprecipitation Methods 0.000 description 4
- KPVMGWQGPJULFL-UHFFFAOYSA-N 1-(cyclohexen-1-yl)piperidine Chemical compound C1CCCCN1C1=CCCCC1 KPVMGWQGPJULFL-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 241000191967 Staphylococcus aureus Species 0.000 description 3
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 3
- 239000012265 solid product Substances 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- RMVMLZHPWMTQGK-SOUFLCLCSA-N (4s,4as,5as,6s,12ar)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1([C@H]2O)=CC=CC(O)=C1C(O)=C1[C@@H]2C[C@H]2[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]2(O)C1=O RMVMLZHPWMTQGK-SOUFLCLCSA-N 0.000 description 2
- OAPVUSSHCBRCOL-KBHRXELFSA-N (4s,4as,5as,6s,12ar)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1([C@H]2O)=C(Cl)C=CC(O)=C1C(O)=C1[C@@H]2C[C@H]2[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]2(O)C1=O OAPVUSSHCBRCOL-KBHRXELFSA-N 0.000 description 2
- QYAPHLRPFNSDNH-MRFRVZCGSA-N (4s,4as,5as,6s,12ar)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride Chemical compound Cl.C1=CC(Cl)=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O QYAPHLRPFNSDNH-MRFRVZCGSA-N 0.000 description 2
- ZXICWXHWBPJDOY-UHFFFAOYSA-N 1-[3-methyl-3-(4-methylphenyl)but-1-en-2-yl]piperidine Chemical compound C1=CC(C)=CC=C1C(C)(C)C(=C)N1CCCCC1 ZXICWXHWBPJDOY-UHFFFAOYSA-N 0.000 description 2
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- ROLMZTIHUMKEAI-UHFFFAOYSA-N 4,5-difluoro-2-hydroxybenzonitrile Chemical compound OC1=CC(F)=C(F)C=C1C#N ROLMZTIHUMKEAI-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- 101150065749 Churc1 gene Proteins 0.000 description 2
- QQONPFPTGQHPMA-UHFFFAOYSA-N Propene Chemical compound CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 description 2
- 102100038239 Protein Churchill Human genes 0.000 description 2
- 241000191940 Staphylococcus Species 0.000 description 2
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 238000004458 analytical method Methods 0.000 description 2
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 2
- 125000001309 chloro group Chemical group Cl* 0.000 description 2
- QSKWJTXWJJOJFP-UHFFFAOYSA-N chloroform;ethoxyethane Chemical compound ClC(Cl)Cl.CCOCC QSKWJTXWJJOJFP-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- JCSGAUKCDAVARS-UHFFFAOYSA-N demethyltetracycline Natural products CN(C1C(=C(C(C2(C(=C3C(C4=C(C=CC=C4C(C3CC12)O)O)=O)O)O)=O)C(=O)N)O)C JCSGAUKCDAVARS-UHFFFAOYSA-N 0.000 description 2
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000001963 growth medium Substances 0.000 description 2
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 2
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 2
- 238000011835 investigation Methods 0.000 description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 description 2
- 210000000056 organ Anatomy 0.000 description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 2
- 125000006678 phenoxycarbonyl group Chemical group 0.000 description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 description 2
- 150000003053 piperidines Chemical class 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 150000003839 salts Chemical class 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000011877 solvent mixture Substances 0.000 description 2
- 238000001228 spectrum Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 238000012360 testing method Methods 0.000 description 2
- 229940040944 tetracyclines Drugs 0.000 description 2
- XIYOPDCBBDCGOE-IWVLMIASSA-N (4s,4ar,5s,5ar,12ar)-4-(dimethylamino)-1,5,10,11,12a-pentahydroxy-6-methylidene-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide Chemical compound C=C1C2=CC=CC(O)=C2C(O)=C2[C@@H]1[C@H](O)[C@H]1[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]1(O)C2=O XIYOPDCBBDCGOE-IWVLMIASSA-N 0.000 description 1
- NWXMGUDVXFXRIG-WESIUVDSSA-N (4s,4as,5as,6s,12ar)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide Chemical compound C1=CC=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C3=C(O)C2=C1O NWXMGUDVXFXRIG-WESIUVDSSA-N 0.000 description 1
- GUXHBMASAHGULD-SEYHBJAFSA-N (4s,4as,5as,6s,12ar)-7-chloro-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4h-tetracene-2-carboxamide Chemical compound C1([C@H]2O)=C(Cl)C=CC(O)=C1C(O)=C1[C@@H]2C[C@H]2[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]2(O)C1=O GUXHBMASAHGULD-SEYHBJAFSA-N 0.000 description 1
- 125000006034 1,2-dimethyl-1-propenyl group Chemical group 0.000 description 1
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 1
- DVMNNHTYWIYWHM-UHFFFAOYSA-N 1-(1-methyl-1h-inden-2-yl)piperidine Chemical compound C=1C2=CC=CC=C2C(C)C=1N1CCCCC1 DVMNNHTYWIYWHM-UHFFFAOYSA-N 0.000 description 1
- DALVWVIDKYPQGM-UHFFFAOYSA-N 1-(1-piperidin-1-ylprop-1-en-2-yl)piperidine Chemical compound C1CCCCN1C(C)=CN1CCCCC1 DALVWVIDKYPQGM-UHFFFAOYSA-N 0.000 description 1
- VIZQUAMFAFOSLS-UHFFFAOYSA-N 1-(1h-inden-2-yl)piperidine Chemical compound C=1C2=CC=CC=C2CC=1N1CCCCC1 VIZQUAMFAFOSLS-UHFFFAOYSA-N 0.000 description 1
- GYIKNVXMGUQQQN-UHFFFAOYSA-N 1-(2-phenylcyclohexen-1-yl)piperidine Chemical compound C1CCCCN1C1=C(C=2C=CC=CC=2)CCCC1 GYIKNVXMGUQQQN-UHFFFAOYSA-N 0.000 description 1
- DPWSJDWANCYKJF-UHFFFAOYSA-N 1-(3,4-dihydronaphthalen-2-yl)piperidine Chemical compound C1CCCCN1C1=CC2=CC=CC=C2CC1 DPWSJDWANCYKJF-UHFFFAOYSA-N 0.000 description 1
- GTPHAOXGAVFRKK-UHFFFAOYSA-N 1-(3-methyl-1h-inden-2-yl)piperidine Chemical compound C1C2=CC=CC=C2C(C)=C1N1CCCCC1 GTPHAOXGAVFRKK-UHFFFAOYSA-N 0.000 description 1
- ANXNESIMKINOCT-UHFFFAOYSA-N 1-(3-methylbut-1-en-2-yl)piperidine Chemical compound CC(C)C(=C)N1CCCCC1 ANXNESIMKINOCT-UHFFFAOYSA-N 0.000 description 1
- FKKKMIFHZJQRKL-UHFFFAOYSA-N 1-(3-methylbut-2-en-2-yl)piperidine Chemical compound CC(C)=C(C)N1CCCCC1 FKKKMIFHZJQRKL-UHFFFAOYSA-N 0.000 description 1
- IWCYRLNIYAWTBJ-UHFFFAOYSA-N 1-(6-ethyl-3,4-dihydronaphthalen-2-yl)piperidine Chemical compound C1CC2=CC(CC)=CC=C2C=C1N1CCCCC1 IWCYRLNIYAWTBJ-UHFFFAOYSA-N 0.000 description 1
- RTZMJBBZZPKMFO-UHFFFAOYSA-N 1-(cyclohepten-1-yl)piperidine Chemical compound C1CCCCN1C1=CCCCCC1 RTZMJBBZZPKMFO-UHFFFAOYSA-N 0.000 description 1
- SWSBEBHRHKHUHH-UHFFFAOYSA-N 1-(cyclopenten-1-yl)piperidine Chemical compound C1CCC=C1N1CCCCC1 SWSBEBHRHKHUHH-UHFFFAOYSA-N 0.000 description 1
- CGFVAIHRGVVSOS-XCVCLJGOSA-N 1-[(e)-pent-2-en-3-yl]piperidine Chemical compound CC\C(=C/C)N1CCCCC1 CGFVAIHRGVVSOS-XCVCLJGOSA-N 0.000 description 1
- PUOTYUNWOIIVPA-UHFFFAOYSA-N 1-[3-(4-methylphenyl)but-1-en-2-yl]piperidine Chemical compound C=1C=C(C)C=CC=1C(C)C(=C)N1CCCCC1 PUOTYUNWOIIVPA-UHFFFAOYSA-N 0.000 description 1
- BBZYVBQFBREVLQ-UHFFFAOYSA-N 1-[3-(4-methylphenyl)but-2-en-2-yl]piperidine Chemical compound C=1C=C(C)C=CC=1C(C)=C(C)N1CCCCC1 BBZYVBQFBREVLQ-UHFFFAOYSA-N 0.000 description 1
- WXQFMEVXRXUWQG-UHFFFAOYSA-N 1-[3-methyl-3-(3-methylphenyl)but-1-en-2-yl]piperidine Chemical compound CC1=CC=CC(C(C)(C)C(=C)N2CCCCC2)=C1 WXQFMEVXRXUWQG-UHFFFAOYSA-N 0.000 description 1
- 125000006036 1-ethyl-1-propenyl group Chemical group 0.000 description 1
- URKONRMYEDZNOU-UHFFFAOYSA-N 1-hept-3-en-4-ylpiperidine Chemical compound CCCC(=CCC)N1CCCCC1 URKONRMYEDZNOU-UHFFFAOYSA-N 0.000 description 1
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- FKCAQQMMBYGTIL-UHFFFAOYSA-N 4-(1-cyclohexylprop-1-en-2-yl)morpholine Chemical compound C1COCCN1C(C)=CC1CCCCC1 FKCAQQMMBYGTIL-UHFFFAOYSA-N 0.000 description 1
- JQASZBBPONYDBT-UHFFFAOYSA-N 4-(3-methyl-3-thiophen-2-ylbut-1-en-2-yl)morpholine Chemical compound C=1C=CSC=1C(C)(C)C(=C)N1CCOCC1 JQASZBBPONYDBT-UHFFFAOYSA-N 0.000 description 1
- WLCJLVINAKDLEX-UHFFFAOYSA-N 4-(3-thiophen-2-ylpent-2-en-2-yl)morpholine Chemical compound C=1C=CSC=1C(CC)=C(C)N1CCOCC1 WLCJLVINAKDLEX-UHFFFAOYSA-N 0.000 description 1
- IIQFBBQJYPGOHJ-UHFFFAOYSA-N 4-(cyclohexen-1-yl)morpholine Chemical compound C1CCCC(N2CCOCC2)=C1 IIQFBBQJYPGOHJ-UHFFFAOYSA-N 0.000 description 1
- KEAADBSEIQEOCD-UHFFFAOYSA-N 4-[1-(furan-2-yl)prop-1-en-2-yl]morpholine Chemical compound C1COCCN1C(C)=CC1=CC=CO1 KEAADBSEIQEOCD-UHFFFAOYSA-N 0.000 description 1
- JYVULWOCPJRJHC-UHFFFAOYSA-N 4-undec-2-en-2-ylmorpholine Chemical compound CCCCCCCCC=C(C)N1CCOCC1 JYVULWOCPJRJHC-UHFFFAOYSA-N 0.000 description 1
- 241000212376 Ammi Species 0.000 description 1
- 235000007034 Carum copticum Nutrition 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- FMTDIUIBLCQGJB-UHFFFAOYSA-N Demethylchlortetracyclin Natural products C1C2C(O)C3=C(Cl)C=CC(O)=C3C(=O)C2=C(O)C2(O)C1C(N(C)C)C(O)=C(C(N)=O)C2=O FMTDIUIBLCQGJB-UHFFFAOYSA-N 0.000 description 1
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical group C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- DFPAKSUCGFBDDF-UHFFFAOYSA-N Nicotinamide Chemical group NC(=O)C1=CC=CN=C1 DFPAKSUCGFBDDF-UHFFFAOYSA-N 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- 241000588767 Proteus vulgaris Species 0.000 description 1
- 241000589516 Pseudomonas Species 0.000 description 1
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 1
- 241000293871 Salmonella enterica subsp. enterica serovar Typhi Species 0.000 description 1
- 241000607760 Shigella sonnei Species 0.000 description 1
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical group O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 238000002814 agar dilution Methods 0.000 description 1
- 125000005115 alkyl carbamoyl group Chemical group 0.000 description 1
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 241000933941 bacterium 24 Species 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000005569 butenylene group Chemical group 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 1
- CYDMQBQPVICBEU-UHFFFAOYSA-N chlorotetracycline Natural products C1=CC(Cl)=C2C(O)(C)C3CC4C(N(C)C)C(O)=C(C(N)=O)C(=O)C4(O)C(O)=C3C(=O)C2=C1O CYDMQBQPVICBEU-UHFFFAOYSA-N 0.000 description 1
- CYDMQBQPVICBEU-XRNKAMNCSA-N chlortetracycline Chemical compound C1=CC(Cl)=C2[C@](O)(C)[C@H]3C[C@H]4[C@H](N(C)C)C(O)=C(C(N)=O)C(=O)[C@@]4(O)C(O)=C3C(=O)C2=C1O CYDMQBQPVICBEU-XRNKAMNCSA-N 0.000 description 1
- 125000003016 chromanyl group Chemical group O1C(CCC2=CC=CC=C12)* 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 description 1
- ZKQFHRVKCYFVCN-UHFFFAOYSA-N ethoxyethane;hexane Chemical compound CCOCC.CCCCCC ZKQFHRVKCYFVCN-UHFFFAOYSA-N 0.000 description 1
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 1
- 125000004705 ethylthio group Chemical group C(C)S* 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical compound C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- 125000002541 furyl group Chemical group 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 125000001841 imino group Chemical group [H]N=* 0.000 description 1
- 125000003454 indenyl group Chemical group C1(C=CC2=CC=CC=C12)* 0.000 description 1
- 238000001802 infusion Methods 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- YCGMWCZZFOIFMR-UHFFFAOYSA-L magnesium;chloroform;sulfate Chemical compound [Mg+2].ClC(Cl)Cl.[O-]S([O-])(=O)=O YCGMWCZZFOIFMR-UHFFFAOYSA-L 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- 125000002816 methylsulfanyl group Chemical group [H]C([H])([H])S[*] 0.000 description 1
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 description 1
- WWECJGLXBSQKRF-UHFFFAOYSA-N n,n-dimethylformamide;methanol Chemical compound OC.CN(C)C=O WWECJGLXBSQKRF-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 229940007042 proteus vulgaris Drugs 0.000 description 1
- 125000004309 pyranyl group Chemical group O1C(C=CC=C1)* 0.000 description 1
- 125000003226 pyrazolyl group Chemical group 0.000 description 1
- 125000004076 pyridyl group Chemical group 0.000 description 1
- 125000000714 pyrimidinyl group Chemical group 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229940115939 shigella sonnei Drugs 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 238000004781 supercooling Methods 0.000 description 1
- LMBFAGIMSUYTBN-MPZNNTNKSA-N teixobactin Chemical compound C([C@H](C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H](CCC(N)=O)C(=O)N[C@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CO)C(=O)N[C@H]1C(N[C@@H](C)C(=O)N[C@@H](C[C@@H]2NC(=N)NC2)C(=O)N[C@H](C(=O)O[C@H]1C)[C@@H](C)CC)=O)NC)C1=CC=CC=C1 LMBFAGIMSUYTBN-MPZNNTNKSA-N 0.000 description 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 description 1
- 125000000335 thiazolyl group Chemical group 0.000 description 1
- 125000001544 thienyl group Chemical group 0.000 description 1
- 125000003258 trimethylene group Chemical group [H]C([H])([*:2])C([H])([H])C([H])([H])[*:1] 0.000 description 1
- 125000004417 unsaturated alkyl group Chemical group 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C233/00—Carboxylic acid amides
- C07C233/01—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C233/12—Carboxylic acid amides having carbon atoms of carboxamide groups bound to hydrogen atoms or to acyclic carbon atoms having the nitrogen atom of at least one of the carboxamide groups bound to a carbon atom of a hydrocarbon radical substituted by halogen atoms or by nitro or nitroso groups
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10916070 | 1970-12-09 | ||
| JP12834770 | 1970-12-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2159432A1 true DE2159432A1 (enExample) | 1972-06-22 |
Family
ID=26448946
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712159432 Pending DE2159432A1 (enExample) | 1970-12-09 | 1971-12-01 |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US3808274A (enExample) |
| AT (1) | AT309686B (enExample) |
| AU (1) | AU467958B2 (enExample) |
| BE (1) | BE776430A (enExample) |
| CA (1) | CA954125A (enExample) |
| DE (1) | DE2159432A1 (enExample) |
| ES (1) | ES397770A1 (enExample) |
| FR (1) | FR2117984B1 (enExample) |
| GB (1) | GB1378893A (enExample) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3951962A (en) * | 1973-11-14 | 1976-04-20 | Yamanouchi Pharmaceutical Co., Ltd. | Novel N-alkenyltetracycline derivatives |
-
1971
- 1971-11-23 CA CA128,318A patent/CA954125A/en not_active Expired
- 1971-12-01 DE DE19712159432 patent/DE2159432A1/de active Pending
- 1971-12-06 US US00205414A patent/US3808274A/en not_active Expired - Lifetime
- 1971-12-06 AT AT1048771A patent/AT309686B/de not_active IP Right Cessation
- 1971-12-07 GB GB5684271A patent/GB1378893A/en not_active Expired
- 1971-12-07 ES ES397770A patent/ES397770A1/es not_active Expired
- 1971-12-08 AU AU36589/71A patent/AU467958B2/en not_active Expired
- 1971-12-09 FR FR7144236A patent/FR2117984B1/fr not_active Expired
- 1971-12-09 BE BE776430A patent/BE776430A/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| AT309686B (de) | 1973-08-27 |
| US3808274A (en) | 1974-04-30 |
| BE776430A (fr) | 1972-04-04 |
| AU467958B2 (en) | 1975-12-18 |
| ES397770A1 (es) | 1975-05-16 |
| GB1378893A (en) | 1974-12-27 |
| FR2117984A1 (enExample) | 1972-07-28 |
| FR2117984B1 (enExample) | 1975-12-26 |
| CA954125A (en) | 1974-09-03 |
| AU3658971A (en) | 1973-06-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0153277B1 (de) | Neue Pleuromutilinderivate, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2159432A1 (enExample) | ||
| DE2847534A1 (de) | 7-eckige klammer auf (sulfomethyl) phenyl eckige klammer zu acetamido- cephalosporinderivate | |
| DE1813918C3 (de) | 2-Hydroxymethyl-3-carbonsäureamido--chinoxalin-M-di-N-oxide, ein Verfahren zu ihrer Herstellung und diese Verbindungen enthaltende antibakterielle Mittel | |
| DE2336655A1 (de) | Neue antibakterielle cyanomethylthioacetylcephalosporine | |
| DE1951012A1 (de) | Ester der 7-(alpha-Amino-alpha-phenylacctamido)-3-methyl-delta?-cephem-4-carbonsaeure | |
| DD210054A5 (de) | Verfahren zur herstellung neuer derivate des cephalosporin | |
| DE1620747C3 (de) | Carbothiamin sowie dessen nichttoxische organische oder anorganische Säureadditionssalze sowie Verfahren zur Herstellung dieser Verbindungen | |
| DE2025414C3 (de) | Cyclische Acylureidophenylacetamidopenicillansäuren | |
| CH516593A (de) | Verfahren zur Herstellung von neuen Estern von a-Aminobenzyl-penicillin | |
| DE2520647A1 (de) | Verfahren zur herstellung von penicillinverbindungen | |
| DE2046349A1 (de) | Neue Cephalosporansaurederivate | |
| DE2537294A1 (de) | S-inosylcystein und verfahren zu seiner herstellung | |
| AT286495B (de) | Verfahren zur Herstellung von neuen Estern des α-Amino-benzylpenicillins | |
| DE1668616B2 (de) | Bisdithiocarbamte, verfahren zu deren herstellung und diese enthaltendes fungizides mittel | |
| DE2147852A1 (de) | Neue Penicilline und Verfahren zu deren Herstellung | |
| DE2037964C3 (de) | 5-NHrofuranderlvate | |
| DE1670936C3 (de) | 3-Carbonsäureamido-chinoxalin-di-Nojdde-0,4), ein Verfahren zu ihrer Herstellung und diese enthaltende antibakterielle Mittel | |
| DE4142128C2 (de) | Verfahren zur Herstellung von Verbindungen mit einer oder mehreren Thiocyanatomethylthio-Gruppierungen | |
| DE2019739A1 (de) | Indolderivate und Verfahren zur Herstellung derselben | |
| DE2012022A1 (de) | Penicillinester und Verfahren zu ihrer Herstellung | |
| AT330745B (de) | Verfahren zur herstellung von neuen 4- aminophenoxy- oder 4- aminophenylthio- 3-amino-5-sulfamoyl-benzoesauren sowie deren niederalkylestern und salzen | |
| DE2039662A1 (de) | Neue 2-(5-Nitro-2-furyl)-vinyl-thieno-[3,2-d]pyrimide | |
| AT268269B (de) | Verfahren zum Herstellen von Nitroimidazolderivaten | |
| DE2408905A1 (de) | Aminoacylthiocephalosporine |