DE2154024B2 - - Google Patents
Info
- Publication number
- DE2154024B2 DE2154024B2 DE2154024A DE2154024A DE2154024B2 DE 2154024 B2 DE2154024 B2 DE 2154024B2 DE 2154024 A DE2154024 A DE 2154024A DE 2154024 A DE2154024 A DE 2154024A DE 2154024 B2 DE2154024 B2 DE 2154024B2
- Authority
- DE
- Germany
- Prior art keywords
- voltage
- field effect
- flip
- flop
- effect transistors
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 230000005669 field effect Effects 0.000 claims description 32
- 239000003990 capacitor Substances 0.000 claims description 11
- 238000001514 detection method Methods 0.000 claims description 5
- 230000003111 delayed effect Effects 0.000 claims description 2
- 230000001419 dependent effect Effects 0.000 claims description 2
- 239000011159 matrix material Substances 0.000 claims 1
- 239000010410 layer Substances 0.000 description 25
- 229910052710 silicon Inorganic materials 0.000 description 13
- 239000010703 silicon Substances 0.000 description 13
- 229910052814 silicon oxide Inorganic materials 0.000 description 12
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 11
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 10
- 239000000758 substrate Substances 0.000 description 9
- 229910052581 Si3N4 Inorganic materials 0.000 description 8
- 238000009413 insulation Methods 0.000 description 7
- HQVNEWCFYHHQES-UHFFFAOYSA-N silicon nitride Chemical compound N12[Si]34N5[Si]62N3[Si]51N64 HQVNEWCFYHHQES-UHFFFAOYSA-N 0.000 description 6
- 239000011229 interlayer Substances 0.000 description 5
- 241001191009 Gymnomyza Species 0.000 description 3
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 3
- 239000004065 semiconductor Substances 0.000 description 3
- HLXGRHNZZSMNRX-UHFFFAOYSA-M sodium;3-(n-ethyl-3,5-dimethylanilino)-2-hydroxypropane-1-sulfonate Chemical compound [Na+].[O-]S(=O)(=O)CC(O)CN(CC)C1=CC(C)=CC(C)=C1 HLXGRHNZZSMNRX-UHFFFAOYSA-M 0.000 description 3
- FRIKWZARTBPWBN-UHFFFAOYSA-N [Si].O=[Si]=O Chemical compound [Si].O=[Si]=O FRIKWZARTBPWBN-UHFFFAOYSA-N 0.000 description 2
- 238000010586 diagram Methods 0.000 description 2
- 238000000034 method Methods 0.000 description 2
- 235000012239 silicon dioxide Nutrition 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 238000007599 discharging Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000012774 insulation material Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 229910044991 metal oxide Inorganic materials 0.000 description 1
- 150000004706 metal oxides Chemical class 0.000 description 1
Classifications
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C11/00—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor
- G11C11/21—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements
- G11C11/34—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices
- G11C11/40—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices using transistors
- G11C11/401—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices using transistors forming cells needing refreshing or charge regeneration, i.e. dynamic cells
- G11C11/402—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices using transistors forming cells needing refreshing or charge regeneration, i.e. dynamic cells with charge regeneration individual to each memory cell, i.e. internal refresh
- G11C11/4023—Digital stores characterised by the use of particular electric or magnetic storage elements; Storage elements therefor using electric elements using semiconductor devices using transistors forming cells needing refreshing or charge regeneration, i.e. dynamic cells with charge regeneration individual to each memory cell, i.e. internal refresh using field effect transistors
-
- G—PHYSICS
- G11—INFORMATION STORAGE
- G11C—STATIC STORES
- G11C14/00—Digital stores characterised by arrangements of cells having volatile and non-volatile storage properties for back-up when the power is down
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K3/00—Circuits for generating electric pulses; Monostable, bistable or multistable circuits
- H03K3/02—Generators characterised by the type of circuit or by the means used for producing pulses
- H03K3/353—Generators characterised by the type of circuit or by the means used for producing pulses by the use, as active elements, of field-effect transistors with internal or external positive feedback
- H03K3/356—Bistable circuits
- H03K3/356008—Bistable circuits ensuring a predetermined initial state when the supply voltage has been applied; storing the actual state when the supply voltage fails
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K3/00—Circuits for generating electric pulses; Monostable, bistable or multistable circuits
- H03K3/02—Generators characterised by the type of circuit or by the means used for producing pulses
- H03K3/353—Generators characterised by the type of circuit or by the means used for producing pulses by the use, as active elements, of field-effect transistors with internal or external positive feedback
- H03K3/356—Bistable circuits
- H03K3/356017—Bistable circuits using additional transistors in the input circuit
- H03K3/356052—Bistable circuits using additional transistors in the input circuit using pass gates
Landscapes
- Engineering & Computer Science (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Computer Hardware Design (AREA)
- Static Random-Access Memory (AREA)
- Logic Circuits (AREA)
- Non-Volatile Memory (AREA)
- Techniques For Improving Reliability Of Storages (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US8619070A | 1970-11-02 | 1970-11-02 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DE2154024A1 DE2154024A1 (de) | 1972-05-04 |
| DE2154024B2 true DE2154024B2 (enExample) | 1980-03-13 |
| DE2154024C3 DE2154024C3 (enExample) | 1980-11-13 |
Family
ID=22196897
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712154024 Granted DE2154024A1 (de) | 1970-11-02 | 1971-10-29 | Binäres Speicherelement aus einer Flip-Flop Schaltung |
Country Status (15)
| Country | Link |
|---|---|
| US (1) | US3676717A (enExample) |
| JP (1) | JPS5325217B1 (enExample) |
| AU (1) | AU445397B2 (enExample) |
| BE (1) | BE774737A (enExample) |
| BR (1) | BR7107227D0 (enExample) |
| CA (1) | CA946511A (enExample) |
| CH (1) | CH540549A (enExample) |
| DE (1) | DE2154024A1 (enExample) |
| DK (1) | DK132357C (enExample) |
| ES (1) | ES396463A1 (enExample) |
| FR (1) | FR2112392B1 (enExample) |
| GB (1) | GB1313718A (enExample) |
| NL (1) | NL7115023A (enExample) |
| SE (1) | SE364796B (enExample) |
| ZA (1) | ZA716852B (enExample) |
Families Citing this family (48)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA974657A (en) * | 1971-12-28 | 1975-09-16 | Matsushita Electric Industrial Co., Ltd. | Switching device equipped with a semiconductor memory element |
| US3771148A (en) * | 1972-03-31 | 1973-11-06 | Ncr | Nonvolatile capacitive memory cell |
| US3761901A (en) * | 1972-06-28 | 1973-09-25 | Ncr | Nonvolatile memory cell |
| US3845327A (en) * | 1972-08-16 | 1974-10-29 | Westinghouse Electric Corp | Counter with memory utilizing mnos memory elements |
| US4675841A (en) * | 1974-12-23 | 1987-06-23 | Pitney Bowes Inc. | Micro computerized electronic postage meter system |
| GB1516134A (en) * | 1975-05-20 | 1978-06-28 | Plessey Co Ltd | Electrical information store |
| JPS5228824A (en) * | 1975-08-29 | 1977-03-04 | Toshiba Corp | Multiple storage unit |
| GB1537114A (en) * | 1975-08-29 | 1978-12-29 | Tokyo Shibaura Electric Co | Memory apparatus |
| GB1545087A (en) * | 1975-09-05 | 1979-05-02 | Ncr Co | Bistable multivibrator circuit |
| US4095281A (en) * | 1976-03-04 | 1978-06-13 | Rca Corporation | Random access-erasable read only memory cell |
| US4175291A (en) * | 1976-08-16 | 1979-11-20 | Ncr Corporation | Non-volatile random access memory cell |
| US4125877A (en) * | 1976-11-26 | 1978-11-14 | Motorola, Inc. | Dual port random access memory storage cell |
| GB2000407B (en) * | 1977-06-27 | 1982-01-27 | Hughes Aircraft Co | Volatile/non-volatile logic latch circuit |
| JPS5856134B2 (ja) * | 1977-11-24 | 1983-12-13 | ホーチキ株式会社 | 記憶装置 |
| US4193128A (en) * | 1978-05-31 | 1980-03-11 | Westinghouse Electric Corp. | High-density memory with non-volatile storage array |
| US4224686A (en) * | 1978-10-02 | 1980-09-23 | Ncr Corporation | Electrically alterable memory cell |
| WO1980001965A1 (en) * | 1979-03-13 | 1980-09-18 | Ncr Co | Static volatile/non-volatile ram system |
| JPS56500108A (enExample) * | 1979-03-13 | 1981-02-05 | ||
| JPS55138104A (en) * | 1979-04-13 | 1980-10-28 | Hitachi Ltd | Engine controller |
| US4285050A (en) * | 1979-10-30 | 1981-08-18 | Pitney Bowes Inc. | Electronic postage meter operating voltage variation sensing system |
| US4381458B1 (en) | 1980-08-06 | 1995-04-11 | Dallas Semiconductor | Back-up electrical power supplies. |
| US4399522A (en) * | 1980-09-30 | 1983-08-16 | International Business Machines Corporation | Non-volatile static RAM cell with enhanced conduction insulators |
| US4388704A (en) * | 1980-09-30 | 1983-06-14 | International Business Machines Corporation | Non-volatile RAM cell with enhanced conduction insulators |
| US4363110A (en) * | 1980-12-22 | 1982-12-07 | International Business Machines Corp. | Non-volatile dynamic RAM cell |
| US4998888A (en) * | 1984-07-23 | 1991-03-12 | Sgs-Thomson Microelectronics, Inc. | Integrated circuit package with battery housing |
| US5276354A (en) * | 1981-05-27 | 1994-01-04 | Sgs-Thomson Microelectronics, Inc. | Integrated circuit package with battery housing |
| US5055704A (en) * | 1984-07-23 | 1991-10-08 | Sgs-Thomson Microelectronics, Inc. | Integrated circuit package with battery housing |
| FR2517143A1 (fr) * | 1981-11-20 | 1983-05-27 | Efcis | Bascule bistable a stockage non volatil et a repositionnement dynamique |
| US4471471A (en) * | 1981-12-31 | 1984-09-11 | International Business Machines Corporation | Non-volatile RAM device |
| US4432072A (en) * | 1981-12-31 | 1984-02-14 | International Business Machines Corporation | Non-volatile dynamic RAM cell |
| US4446535A (en) * | 1981-12-31 | 1984-05-01 | International Business Machines Corporation | Non-inverting non-volatile dynamic RAM cell |
| US4420821A (en) * | 1982-02-19 | 1983-12-13 | International Business Machines Corporation | Static RAM with non-volatile back-up storage and method of operation thereof |
| US4716312A (en) * | 1985-05-07 | 1987-12-29 | California Institute Of Technology | CMOS logic circuit |
| US4685085A (en) * | 1985-06-17 | 1987-08-04 | Rockwell International Corporation | Non-volatile ram cell with charge pumps |
| DE69634294D1 (de) * | 1996-04-05 | 2005-03-10 | St Microelectronics Srl | Automatische Speichersicherungsschaltung zur Programmierung der Konfigurationszellen einer nichtflüchtigen Halbleiterspeicheranordnung |
| US6122191A (en) * | 1996-05-01 | 2000-09-19 | Cypress Semiconductor Corporation | Semiconductor non-volatile device including embedded non-volatile elements |
| US5892712A (en) * | 1996-05-01 | 1999-04-06 | Nvx Corporation | Semiconductor non-volatile latch device including embedded non-volatile elements |
| US6107865A (en) * | 1997-10-31 | 2000-08-22 | Stmicroelectronics, Inc. | VSS switching scheme for battery backed-up semiconductor devices |
| US6362675B1 (en) * | 1999-07-12 | 2002-03-26 | Ramtron International Corporation | Nonvolatile octal latch and D-type register |
| US8072834B2 (en) * | 2005-08-25 | 2011-12-06 | Cypress Semiconductor Corporation | Line driver circuit and method with standby mode of operation |
| US7859925B1 (en) | 2006-03-31 | 2010-12-28 | Cypress Semiconductor Corporation | Anti-fuse latch self-test circuit and method |
| US7821859B1 (en) | 2006-10-24 | 2010-10-26 | Cypress Semiconductor Corporation | Adaptive current sense amplifier with direct array access capability |
| US20080151654A1 (en) | 2006-12-22 | 2008-06-26 | Allan James D | Method and apparatus to implement a reset function in a non-volatile static random access memory |
| US7859906B1 (en) | 2007-03-30 | 2010-12-28 | Cypress Semiconductor Corporation | Circuit and method to increase read margin in non-volatile memories using a differential sensing circuit |
| US7881118B2 (en) * | 2007-05-25 | 2011-02-01 | Cypress Semiconductor Corporation | Sense transistor protection for memory programming |
| US8036032B2 (en) * | 2007-12-31 | 2011-10-11 | Cypress Semiconductor Corporation | 5T high density NVDRAM cell |
| US8059458B2 (en) * | 2007-12-31 | 2011-11-15 | Cypress Semiconductor Corporation | 3T high density nvDRAM cell |
| US8064255B2 (en) * | 2007-12-31 | 2011-11-22 | Cypress Semiconductor Corporation | Architecture of a nvDRAM array and its sense regime |
-
1970
- 1970-11-02 US US86190A patent/US3676717A/en not_active Expired - Lifetime
-
1971
- 1971-09-14 CA CA122,839A patent/CA946511A/en not_active Expired
- 1971-10-11 GB GB4717871A patent/GB1313718A/en not_active Expired
- 1971-10-13 ZA ZA716852A patent/ZA716852B/xx unknown
- 1971-10-14 AU AU34579/71A patent/AU445397B2/en not_active Expired
- 1971-10-22 SE SE13458/71A patent/SE364796B/xx unknown
- 1971-10-28 ES ES396463A patent/ES396463A1/es not_active Expired
- 1971-10-29 BR BR7227/71A patent/BR7107227D0/pt unknown
- 1971-10-29 DE DE19712154024 patent/DE2154024A1/de active Granted
- 1971-10-29 BE BE774737A patent/BE774737A/xx unknown
- 1971-11-01 DK DK532971A patent/DK132357C/da not_active IP Right Cessation
- 1971-11-01 NL NL7115023A patent/NL7115023A/xx not_active Application Discontinuation
- 1971-11-02 JP JP8754771A patent/JPS5325217B1/ja active Pending
- 1971-11-02 FR FR7139155A patent/FR2112392B1/fr not_active Expired
- 1971-11-02 CH CH1593071A patent/CH540549A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK132357B (da) | 1975-11-24 |
| CH540549A (de) | 1973-08-15 |
| DE2154024C3 (enExample) | 1980-11-13 |
| GB1313718A (en) | 1973-04-18 |
| SE364796B (enExample) | 1974-03-04 |
| AU445397B2 (en) | 1974-02-21 |
| CA946511A (en) | 1974-04-30 |
| JPS5325217B1 (enExample) | 1978-07-25 |
| US3676717A (en) | 1972-07-11 |
| FR2112392A1 (enExample) | 1972-06-16 |
| DK132357C (da) | 1976-05-03 |
| AU3457971A (en) | 1973-04-19 |
| ZA716852B (en) | 1972-06-28 |
| ES396463A1 (es) | 1975-03-01 |
| FR2112392B1 (enExample) | 1976-09-03 |
| DE2154024A1 (de) | 1972-05-04 |
| NL7115023A (enExample) | 1972-05-04 |
| BE774737A (fr) | 1972-02-14 |
| BR7107227D0 (pt) | 1973-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2154024C3 (enExample) | ||
| DE1817510C3 (de) | Monolithischer Halbleiterspeicher mit Speicherzellen aus Transistoren | |
| DE2235801C3 (de) | Monolithischer Festwertspeicher und Verfahren zur Herstellung | |
| DE2544974A1 (de) | Anordnung zum darstellen logischer funktionen | |
| DE1537992B2 (de) | Bistabile Kippschaltung | |
| DE3206507C2 (enExample) | ||
| DE1803035B2 (de) | Permanentspeicherzelle | |
| DE1961125C3 (de) | Speicherschaltung | |
| DE2332643C2 (de) | Datenspeichervorrichtung | |
| DE2363089C3 (de) | Speicherzelle mit Feldeffekttransistoren | |
| DE2154025C3 (de) | Speicherschaltung aus Feldeffekttransistoren | |
| DE2754987C2 (de) | Halbleiter-Speichervorrichtung | |
| DE3107902C2 (de) | Integrierte MOS-Schaltung | |
| DE2152109C3 (de) | Speichermatrix mit einem Feldeffekt-Halbleiterbauelement je Speicherplatz | |
| DE2351554C2 (de) | Speicher für direkten Zugriff mit dynamischen Speicherzellen | |
| DE68918894T2 (de) | Statische MESFET-Speicherzelle mit wahlfreiem Zugriff. | |
| DE2800336A1 (de) | Integrierte logische schaltung | |
| DE2721039A1 (de) | Digitale ladungsverschiebeanordnung | |
| DE2029566B2 (de) | Schieberegisterstufenschaltung | |
| DE2348984A1 (de) | Anordnung mit feldeffekttransistoren | |
| DE2459023C3 (de) | Integrierbare, aus Isolierschicht-Feldeffekttransistoren gleicher Leitungsund Steuerungsart aufgebaute statische Schreib/Lesespeicherzelle | |
| DE2039606B2 (enExample) | ||
| DE2430947C2 (de) | Halbleiterspeichereinheit | |
| DE1938468C3 (de) | Dynamische Schaltungsanordnung | |
| DE2105479A1 (de) | Schaltung und Aufbau eines Halbleiterspeicherelementes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| C3 | Grant after two publication steps (3rd publication) | ||
| 8339 | Ceased/non-payment of the annual fee |